cesium-examples/map/libs/ol/4.6.5/ol-ext-2.0.6/ol-ext.js

15475 lines
530 KiB
JavaScript

/**
* ol-ext - A set of cool extensions for OpenLayers (ol) in node modules structure
* @description ol3,openlayers,popup,menu,symbol,renderer,filter,canvas,interaction,split,statistic,charts,pie,LayerSwitcher,toolbar,animation
* @version v2.0.6
* @author Jean-Marc Viglino
* @see https://github.com/Viglino/ol-ext#,
* @license BSD-3-Clause
*/
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search Control.
* This is the base class for search controls. You can use it for simple custom search or as base to new class.
* @see ol.control.SearchFeature
* @see ol.control.SearchPhoton
*
* @constructor
* @extends {ol.control.Control}
* @fires select
* @fires change:input
* @param {Object=} options
* @param {string} options.className control class name
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {string | undefined} options.inputLabel label for the input, default none
* @param {string | undefined} options.noCollapse prevent collapsing on input blur, default false
* @param {number | undefined} options.typing a delay on each typing to start searching (ms) use -1 to prevent autocompletion, default 300.
* @param {integer | undefined} options.minLength minimum length to start searching, default 1
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
* @param {integer | undefined} options.maxHistory maximum number of items to display in history. Set -1 if you don't want history, default maxItems
* @param {function} options.getTitle a function that takes a feature and return the name to display in the index.
* @param {function} options.autocomplete a function that take a search string and callback function to send an array
*/
ol.control.Search = function(options) {
var self = this;
if (!options) options = {};
if (options.typing == undefined) options.typing = 300;
// Class name for history
this._classname = options.className || 'search';
var element = document.createElement("DIV");
var classNames = (options.className||"")+ " ol-search";
if (!options.target) {
classNames += " ol-unselectable ol-control ol-collapsed";
this.button = document.createElement("BUTTON");
this.button.setAttribute("type", "button");
this.button.setAttribute("title", options.label||"search");
this.button.addEventListener("click", function() {
element.classList.toggle("ol-collapsed");
if (!element.classList.contains("ol-collapsed")) {
element.querySelector("input.search").focus();
var listElements = element.querySelectorAll("li");
for (var i = 0; i < listElements.length; i++) {
listElements[i].classList.remove("select");
}
// Display history
if (!input.value) {
self.drawList_();
}
}
});
element.appendChild(this.button);
}
element.setAttribute('class', classNames);
// Input label
if (options.inputLabel) {
var label = document.createElement("LABEL");
label.innerText = options.inputLabel;
element.appendChild(label);
}
// Search input
var tout, cur="";
var input = this._input = document.createElement("INPUT");
input.setAttribute("type", "search");
input.setAttribute("class", "search");
input.setAttribute("placeholder", options.placeholder||"Search...");
input.addEventListener("change", function(e) {
self.dispatchEvent({ type:"change:input", input:e, value:input.value });
});
var doSearch = function(e) {
// console.log(e.type+" "+e.key)'
var li = element.querySelector("ul.autocomplete li.select");
var val = input.value;
// move up/down
if (e.key=='ArrowDown' || e.key=='ArrowUp' || e.key=='Down' || e.key=='Up') {
if (li) {
li.classList.remove("select");
li = (/Down/.test(e.key)) ? li.nextElementSibling : li.previousElementSibling;
if (li) li.classList.add("select");
}
else element.querySelector("ul.autocomplete li").classList.add("select");
}
// Clear input
else if (e.type=='input' && !val) {
self.drawList_();
}
// Select in the list
else if (li && (e.type=="search" || e.key =="Enter")) {
if (element.classList.contains("ol-control")) input.blur();
li.classList.remove("select");
cur = val;
self._handleSelect(self._list[li.getAttribute("data-search")]);
}
// Search / autocomplete
else if ( (e.type=="search" || e.key =='Enter')
|| (cur!=val && options.typing>=0)) {
// current search
cur = val;
if (cur) {
// prevent searching on each typing
if (tout) clearTimeout(tout);
tout = setTimeout(function() {
if (cur.length >= self.get("minLength")) {
var s = self.autocomplete (cur, function(auto) { self.drawList_(auto); });
if (s) self.drawList_(s);
}
else self.drawList_();
}, options.typing);
}
else self.drawList_();
}
// Clear list selection
else {
var li = element.querySelector("ul.autocomplete li");
if (li) li.classList.remove('select');
}
};
input.addEventListener("keyup", doSearch);
input.addEventListener("search", doSearch);
input.addEventListener("cut", doSearch);
input.addEventListener("paste", doSearch);
input.addEventListener("input", doSearch);
if (!options.noCollapse) {
input.addEventListener('blur', function() {
setTimeout(function(){ element.classList.add('ol-collapsed') }, 200);
});
input.addEventListener('focus', function() {
element.classList.remove('ol-collapsed');
});
}
element.appendChild(input);
// Autocomplete list
var ul = document.createElement('UL');
ul.classList.add('autocomplete');
element.appendChild(ul);
ol.control.Control.call(this, {
element: element,
target: options.target
});
if (typeof (options.getTitle)=='function') this.getTitle = options.getTitle;
if (typeof (options.autocomplete)=='function') this.autocomplete = options.autocomplete;
// Options
this.set('minLength', options.minLength || 1);
this.set('maxItems', options.maxItems || 10);
this.set('maxHistory', options.maxHistory || options.maxItems || 10);
// History
this.restoreHistory();
this.drawList_();
};
ol.inherits(ol.control.Search, ol.control.Control);
/** Returns the text to be displayed in the menu
* @param {any} f feature to be displayed
* @return {string} the text to be displayed in the index, default f.name
* @api
*/
ol.control.Search.prototype.getTitle = function (f) {
return f.name || "No title";
};
/** Force search to refresh
*/
ol.control.Search.prototype.search = function () {
var search = this.element.querySelector("input.search");
this._triggerCustomEvent('search', search);
};
/** Trigger custom event on elemebt
* @param {*} eventName
* @param {*} element
* @private
*/
ol.control.Search.prototype._triggerCustomEvent = function (eventName, element) {
var event;
if (window.CustomEvent) {
event = new CustomEvent(eventName);
} else {
event = document.createEvent("CustomEvent");
event.initCustomEvent(eventName, true, true, {});
}
element.dispatchEvent(event);
};
/** Set the input value in the form (for initialisation purpose)
* @param {string} value
* @param {boolean} search to start a search
* @api
*/
ol.control.Search.prototype.setInput = function (value, search) {
var input = this.element.querySelector("input.search");
input.value = value;
if (search) this._triggerCustomEvent("keyup", input);
};
/** A ligne has been clicked in the menu > dispatch event
* @param {any} f the feature, as passed in the autocomplete
* @api
*/
ol.control.Search.prototype.select = function (f) {
this.dispatchEvent({ type:"select", search:f });
};
/**
* Save history and select
* @param {*} f
* @private
*/
ol.control.Search.prototype._handleSelect = function (f) {
if (!f) return;
// Save input in history
var hist = this.get('history');
// Prevent error on stringify
try {
var fstr = JSON.stringify(f);
for (var i=hist.length-1; i>=0; i--) {
if (!hist[i] || JSON.stringify(hist[i]) === fstr) {
hist.splice(i,1);
}
}
} catch (e) {
for (var i=hist.length-1; i>=0; i--) {
if (hist[i] === f) {
hist.splice(i,1);
}
}
};
hist.unshift(f);
while (hist.length > (this.get('maxHistory')||10)) {
hist.pop();
}
this.saveHistory();
// Select feature
this.select(f);
//this.drawList_();
};
/** Save history (in the localstorage)
*/
ol.control.Search.prototype.saveHistory = function () {
if (this.get('maxHistory')>=0) {
try {
localStorage["ol@search-"+this._classname] = JSON.stringify(this.get('history'));
} catch (e) {};
} else {
localStorage.removeItem("ol@search-"+this._classname);
}
};
/** Restore history (from the localstorage)
*/
ol.control.Search.prototype.restoreHistory = function () {
try {
this.set('history', JSON.parse(localStorage["ol@search-"+this._classname]) );
} catch(e) {
this.set('history', []);
}
};
/**
* Remove previous history
*/
ol.control.Search.prototype.clearHistory = function () {
this.set('history', []);
this.saveHistory();
this.drawList_();
};
/**
* Get history table
*/
ol.control.Search.prototype.getHistory = function () {
return this.get('history');
};
/** Autocomplete function
* @param {string} s search string
* @param {function} cback a callback function that takes an array to display in the autocomplete field (for asynchronous search)
* @return {Array|false} an array of search solutions or false if the array is send with the cback argument (asnchronous)
* @api
*/
ol.control.Search.prototype.autocomplete = function (s, cback) {
cback ([]);
return false;
// or just return [];
};
/** Draw the list
* @param {Array} auto an array of search result
* @private
*/
ol.control.Search.prototype.drawList_ = function (auto) {
var self = this;
var ul = this.element.querySelector("ul.autocomplete");
ul.innerHTML = '';
this._list = [];
if (!auto) {
var input = this.element.querySelector("input.search");
var value = input.value;
if (!value) {
auto = this.get('history');
} else {
return;
}
ul.setAttribute('class', 'autocomplete history');
} else {
ul.setAttribute('class', 'autocomplete');
}
var max = Math.min (self.get("maxItems"),auto.length);
for (var i=0; i<max; i++) {
if (auto[i]) {
if (!i || !self.equalFeatures(auto[i], auto[i-1])) {
var li = document.createElement("LI");
li.setAttribute("data-search", i);
this._list.push(auto[i]);
li.addEventListener("click", function(e) {
self._handleSelect(self._list[e.currentTarget.getAttribute("data-search")]);
});
li.innerHTML = self.getTitle(auto[i]);
ul.appendChild(li);
}
}
}
if (max && this.get("copy")) {
var li = document.createElement("LI");
li.classList.add("copy");
li.innerHTML = this.get("copy");
ul.appendChild(li);
}
};
/** Test if 2 features are equal
* @param {any} f1
* @param {any} f2
* @return {boolean}
*/
ol.control.Search.prototype.equalFeatures = function (f1, f2) {
return false;
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* This is the base class for search controls that use a json service to search features.
* You can use it for simple custom search or as base to new class.
*
* @constructor
* @extends {ol.control.Search}
* @fires select
* @param {any} options extend ol.control.Search options
* @param {string} options.className control class name
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 1000.
* @param {integer | undefined} options.minLength minimum length to start searching, default 3
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
* @param {function | undefined} options.handleResponse Handle server response to pass the features array to the list
*
* @param {string|undefined} options.url Url of the search api
* @param {string | undefined} options.authentication: basic authentication for the search API as btoa("login:pwd")
*/
ol.control.SearchJSON = function(options)
{ options = options || {};
options.className = options.className || 'JSON';
delete options.autocomplete;
options.minLength = options.minLength || 3;
options.typing = options.typing || 800;
ol.control.Search.call(this, options);
// Handle Mix Content Warning
// If the current connection is an https connection all other connections must be https either
var url = options.url || "";
if (window.location.protocol === "https:") {
var parser = document.createElement('a');
parser.href = url;
parser.protocol = window.location.protocol;
url = parser.href;
}
this.set('url', url);
this._auth = options.authentication;
// Overwrite handleResponse
if (typeof(options.handleResponse)==='function') this.handleResponse = options.handleResponse;
};
ol.inherits(ol.control.SearchJSON, ol.control.Search);
/** Autocomplete function (ajax request to the server)
* @param {string} s search string
* @param {function} cback a callback function that takes an array of {name, feature} to display in the autocomplete field
*/
ol.control.SearchJSON.prototype.autocomplete = function (s, cback)
{ var data = this.requestData(s);
var url = encodeURI(this.get('url'));
var parameters = '';
for (var index in data) {
parameters += (parameters) ? '&' : '?';
if (data.hasOwnProperty(index)) parameters += index + '=' + data[index];
}
this.ajax(url + parameters,
function (resp) {
if (resp.status >= 200 && resp.status < 400) {
var data = JSON.parse(resp.response);
cback(this.handleResponse(data));
} else {
console.log(url + parameters, arguments);
}
}, function(){
console.log(url + parameters, arguments);
});
};
/** Send an ajax request (GET)
* @param {string} url
* @param {function} onsuccess callback
* @param {function} onerror callback
*/
ol.control.SearchJSON.prototype.ajax = function (url, onsuccess, onerror){
var self = this;
// Abort previous request
if (this._request) {
this._request.abort();
}
// New request
var ajax = this._request = new XMLHttpRequest();
ajax.open('GET', url, true);
if (this._auth) {
ajax.setRequestHeader("Authorization", "Basic " + this._auth);
}
this.element.classList.add('searching');
// Load complete
ajax.onload = function() {
self._request = null;
self.element.classList.remove('searching');
onsuccess.call(self, this);
};
// Oops, TODO do something ?
ajax.onerror = function() {
self._request = null;
self.element.classList.remove('searching');
if (onerror) onerror.call(self);
};
// GO!
ajax.send();
};
/**
* @param {string} s the search string
* @return {Object} request data (as key:value)
* @api
*/
ol.control.SearchJSON.prototype.requestData = function (s){
return { q: s };
};
/**
* Handle server response to pass the features array to the display list
* @param {any} response server response
* @return {Array<any>} an array of feature
* @api
*/
ol.control.SearchJSON.prototype.handleResponse = function (response) {
return response;
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search places using the photon API.
*
* @constructor
* @extends {ol.control.SearchJSON}
* @fires select
* @param {Object=} Control options.
* @param {string} options.className control class name
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 1000.
* @param {integer | undefined} options.minLength minimum length to start searching, default 3
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
* @param {function | undefined} options.handleResponse Handle server response to pass the features array to the list
*
* @param {string|undefined} options.url Url to photon api, default "http://photon.komoot.de/api/"
* @param {string|undefined} options.lang Force preferred language, default none
* @param {boolean} options.position Search, with priority to geo position, default false
* @param {function} options.getTitle a function that takes a feature and return the name to display in the index, default return street + name + contry
*/
ol.control.SearchPhoton = function(options)
{ options = options || {};
options.className = options.className || 'photon';
options.url = options.url || "http://photon.komoot.de/api/";
ol.control.SearchJSON.call(this, options);
this.set('lang', options.lang);
this.set('position', options.position);
this.set("copy","<a href='http://www.openstreetmap.org/copyright' target='new'>&copy; OpenStreetMap contributors</a>");
};
ol.inherits(ol.control.SearchPhoton, ol.control.SearchJSON);
/** Returns the text to be displayed in the menu
* @param {ol.Feature} f the feature
* @return {string} the text to be displayed in the index
* @api
*/
ol.control.SearchPhoton.prototype.getTitle = function (f)
{ var p = f.properties;
return (p.housenumber||"")
+ " "+(p.street || p.name || "")
+ "<i>"
+ " "+(p.postcode||"")
+ " "+(p.city||"")
+ " ("+p.country
+ ")</i>";
};
/**
* @param {string} s the search string
* @return {Object} request data (as key:value)
* @api
*/
ol.control.SearchPhoton.prototype.requestData = function (s)
{ var data =
{ q: s,
lang: this.get('lang'),
limit: this.get('maxItems')
}
// Handle position proirity
if (this.get('position'))
{ var view = this.getMap().getView();
var pt = new ol.geom.Point(view.getCenter());
pt = (pt.transform (view.getProjection(), "EPSG:4326")).getCoordinates();
data.lon = pt[0];
data.lat = pt[1];
}
return data;
};
/**
* Handle server response to pass the features array to the list
* @param {any} response server response
* @return {Array<any>} an array of feature
*/
ol.control.SearchPhoton.prototype.handleResponse = function (response, cback) {
return response.features;
};
/** Prevent same feature to be drawn twice: test equality
* @param {} f1 First feature to compare
* @param {} f2 Second feature to compare
* @return {boolean}
* @api
*/
ol.control.SearchPhoton.prototype.equalFeatures = function (f1, f2) {
return (this.getTitle(f1) === this.getTitle(f2)
&& f1.geometry.coordinates[0] === f2.geometry.coordinates[0]
&& f1.geometry.coordinates[1] === f2.geometry.coordinates[1]);
};
/** A ligne has been clicked in the menu > dispatch event
* @param {any} f the feature, as passed in the autocomplete
* @api
*/
ol.control.SearchPhoton.prototype.select = function (f)
{ var c = f.geometry.coordinates;
// Add coordinate to the event
try {
c = ol.proj.transform (f.geometry.coordinates, 'EPSG:4326', this.getMap().getView().getProjection());
} catch(e) {};
this.dispatchEvent({ type:"select", search:f, coordinate: c });
};
/** */
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search places using the French National Base Address (BAN) API.
*
* @constructor
* @extends {ol.control.SearchJSON}
* @fires select
* @param {any} options extend ol.control.SearchJSON options
* @param {string} options.className control class name
* @param {boolean | undefined} options.apiKey the service api key.
* @param {string | undefined} options.authentication: basic authentication for the service API as btoa("login:pwd")
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 500.
* @param {integer | undefined} options.minLength minimum length to start searching, default 3
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
*
* @param {StreetAddress|PositionOfInterest|CadastralParcel|Commune} options.type type of search. Using Commune will return the INSEE code, default StreetAddress,PositionOfInterest
* @see {@link https://geoservices.ign.fr/documentation/geoservices/geocodage.html}
*/
ol.control.SearchGeoportail = function(options) {
options = options || {};
options.className = options.className || 'IGNF';
options.typing = options.typing || 500;
options.url = "http://wxs.ign.fr/"+options.apiKey+"/ols/apis/completion";
ol.control.SearchJSON.call(this, options);
this.set("copy","<a href='https://www.geoportail.gouv.fr/' target='new'>&copy; IGN-Géoportail</a>");
this.set('type', options.type || 'StreetAddress,PositionOfInterest');
};
ol.inherits(ol.control.SearchGeoportail, ol.control.SearchJSON);
/** Returns the text to be displayed in the menu
* @param {ol.Feature} f the feature
* @return {string} the text to be displayed in the index
* @api
*/
ol.control.SearchGeoportail.prototype.getTitle = function (f) {
var title = f.fulltext;
return (title);
};
/**
* @param {string} s the search string
* @return {Object} request data (as key:value)
* @api
*/
ol.control.SearchGeoportail.prototype.requestData = function (s) {
return {
text: s,
type: this.get('type')==='Commune' ? 'PositionOfInterest' : this.get('type') || 'StreetAddress,PositionOfInterest',
maximumResponses: this.get('maxItems')
};
};
/**
* Handle server response to pass the features array to the display list
* @param {any} response server response
* @return {Array<any>} an array of feature
* @api
*/
ol.control.SearchGeoportail.prototype.handleResponse = function (response) {
var response = response.results;
if (this.get('type') === 'Commune') {
for (var i=response.length-1; i>=0; i--) {
if ( response[i].kind
&& (response[i].classification>5 || response[i].kind=="Département") ) {
response.splice(i,1);
}
}
}
return response;
};
/** A ligne has been clicked in the menu > dispatch event
* @param {any} f the feature, as passed in the autocomplete
* @api
*/
ol.control.SearchGeoportail.prototype.select = function (f){
if (f.x || f.y) {
var c = [Number(f.x), Number(f.y)];
// Add coordinate to the event
try {
c = ol.proj.transform (c, 'EPSG:4326', this.getMap().getView().getProjection());
} catch(e) {};
// Get insee commune ?
if (this.get('type')==='Commune') {
this.searchCommune(f, function () {
this.dispatchEvent({ type:"select", search:f, coordinate: c });
});
} else {
this.dispatchEvent({ type:"select", search:f, coordinate: c });
}
} else {
this.searchCommune(f);
}
};
/** Search if no position and get the INSEE code
* @param {string} s le nom de la commune
*/
ol.control.SearchGeoportail.prototype.searchCommune = function (f, cback) {
var request = '<?xml version="1.0" encoding="UTF-8"?>'
+'<XLS xmlns:xls="http://www.opengis.net/xls" xmlns:gml="http://www.opengis.net/gml" xmlns="http://www.opengis.net/xls" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" version="1.2" xsi:schemaLocation="http://www.opengis.net/xls http://schemas.opengis.net/ols/1.2/olsAll.xsd">'
+'<RequestHeader/>'
+'<Request requestID="1" version="1.2" methodName="LocationUtilityService">'
+'<GeocodeRequest returnFreeForm="false">'
+'<Address countryCode="PositionOfInterest">'
+'<freeFormAddress>'+f.fulltext+'+</freeFormAddress>'
+'</Address>'
+'</GeocodeRequest>'
+'</Request>'
+'</XLS>'
var url = this.get('url').replace('ols/apis/completion','geoportail/ols')+"?xls="+encodeURIComponent(request);
this.ajax (url, function(resp) {
var xml = resp.response;
if (xml) {
xml = xml.replace(/\n|\r/g,'');
var p = (xml.replace(/.*<gml:pos\>(.*)<\/gml:pos>.*/, "$1")).split(' ');
f.x = Number(p[1]);
f.y = Number(p[0]);
f.kind = (xml.replace(/.*<Place type="Nature">([^<]*)<\/Place>.*/, "$1"));
f.insee = (xml.replace(/.*<Place type="INSEE">([^<]*)<\/Place>.*/, "$1"));
if (f.x || f.y) {
if (cback) cback.call(this, [f]);
else this._handleSelect(f);
}
}
});
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc OpenLayers 3 Layer Switcher Control.
* @require jQuery
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options
* @param {function} displayInLayerSwitcher function that takes a layer and return a boolean if the layer is displayed in the switcher, default test the displayInLayerSwitcher layer attribute
* @param {boolean} options.show_progress show a progress bar on tile layers, default false
* @param {boolean} mouseover show the panel on mouseover, default false
* @param {boolean} reordering allow layer reordering, default true
* @param {boolean} trash add a trash button to delete the layer, default false
* @param {function} oninfo callback on click on info button, if none no info button is shown
* @param {boolean} extent add an extent button to zoom to the extent of the layer
* @param {function} onextent callback when click on extent, default fits view to extent
*
* Layers attributes that control the switcher
* - allwaysOnTop {boolean} true to force layer stay on top of the others while reordering, default false
* - displayInLayerSwitcher {boolean} display in switcher, default true
* - noSwitcherDelete {boolean} to prevent layer deletion (w. trash option = true), default false
*/
ol.control.LayerSwitcher = function(options)
{ options = options || {};
var self = this;
this.dcount = 0;
this.show_progress = options.show_progress;
this.oninfo = (typeof (options.oninfo) == "function" ? options.oninfo: null);
this.onextent = (typeof (options.onextent) == "function" ? options.onextent: null);
this.hasextent = options.extent || options.onextent;
this.hastrash = options.trash;
this.reordering = (options.reordering!==false);
// displayInLayerSwitcher
if (typeof(options.displayInLayerSwitcher) === 'function') {
this.displayInLayerSwitcher = options.displayInLayerSwitcher;
}
var element;
if (options.target)
{ element = $("<div>").addClass(options.switcherClass || "ol-layerswitcher");
}
else
{ element = $("<div>").addClass((options.switcherClass || 'ol-layerswitcher') +' ol-unselectable ol-control ol-collapsed');
this.button = $("<button>")
.attr('type','button')
.on("touchstart", function(e)
{ element.toggleClass("ol-collapsed");
e.preventDefault();
self.overflow();
})
.click (function()
{ element.toggleClass("ol-forceopen").addClass("ol-collapsed");
self.overflow();
})
.appendTo(element);
if (options.mouseover)
{ $(element).mouseleave (function(){ element.addClass("ol-collapsed"); })
.mouseover(function(){ element.removeClass("ol-collapsed"); });
}
this.topv = $("<div>").addClass("ol-switchertopdiv")
.click(function(){ self.overflow("+50%"); })
.appendTo(element);
this.botv = $("<div>").addClass("ol-switcherbottomdiv")
.click(function(){ self.overflow("-50%"); })
.appendTo(element);
}
this.panel_ = $("<ul>").addClass("panel")
.appendTo(element);
this.panel_.on ('mousewheel DOMMouseScroll onmousewheel', function(e)
{ if (self.overflow(Math.max(-1, Math.min(1, (e.originalEvent.wheelDelta || -e.originalEvent.detail)))))
{ e.stopPropagation();
e.preventDefault();
}
});
this.header_ = $("<li>").addClass("ol-header").appendTo(this.panel_);
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
// Enable jQuery dataTransfert
// $.event.props.push('dataTransfer');
this.target = options.target;
};
ol.inherits(ol.control.LayerSwitcher, ol.control.Control);
/** List of tips for internationalization purposes
*/
ol.control.LayerSwitcher.prototype.tip =
{ up: "up/down",
down: "down",
info: "informations...",
extent: "zoom to extent",
trash: "remove layer",
plus: "expand/shrink"
};
/** Test if a layer should be displayed in the switcher
* @param {ol.layer} layer
* @return {boolean} true if the layer is displayed
*/
ol.control.LayerSwitcher.prototype.displayInLayerSwitcher = function(layer) {
return (layer.get("displayInLayerSwitcher")!==false);
};
/**
* Set the map instance the control is associated with.
* @param {_ol_Map_} map The map instance.
*/
ol.control.LayerSwitcher.prototype.setMap = function(map)
{ ol.control.Control.prototype.setMap.call(this, map);
this.drawPanel();
if (this._listener) {
if (this._listener) ol.Observable.unByKey(this._listener.change);
if (this._listener) ol.Observable.unByKey(this._listener.moveend);
if (this._listener) ol.Observable.unByKey(this._listener.size);
}
this._listener = null;
this.map_ = map;
// Get change (new layer added or removed)
if (map)
{ this._listener = {
change: map.getLayerGroup().on('change', this.drawPanel.bind(this)),
moveend: map.on('moveend', this.viewChange.bind(this)),
size: map.on('change:size', this.overflow.bind(this))
}
}
};
/** Add a custom header
*/
ol.control.LayerSwitcher.prototype.setHeader = function(html)
{ this.header_.html(html);
};
/** Calculate overflow and add scrolls
* @param {Number} dir scroll direction -1|0|1|'+50%'|'-50%'
*/
ol.control.LayerSwitcher.prototype.overflow = function(dir)
{
if (this.button)
{ // Nothing to show
if (this.panel_.css('display')=='none')
{ $(this.element).css("height", "auto");
return;
}
// Calculate offset
var h = $(this.element).outerHeight();
var hp = this.panel_.outerHeight();
var dh = this.button.position().top + this.button.outerHeight(true);
var top = this.panel_.position().top-dh;
if (hp > h-dh)
{ // Bug IE: need to have an height defined
$(this.element).css("height", "100%");
switch (dir)
{ case 1: top += 2*$("li.visible .li-content",this.panel_).height(); break;
case -1: top -= 2*$("li.visible .li-content",this.panel_).height(); break;
case "+50%": top += Math.round(h/2); break;
case "-50%": top -= Math.round(h/2); break;
default: break;
}
// Scroll div
if (top+hp <= h-3*dh/2)
{ top = h-3*dh/2-hp;
this.botv.hide();
}
else
{ this.botv.css("display","");//show();
}
if (top >= 0)
{ top = 0;
this.topv.hide();
}
else
{ this.topv.css("display","");
}
// Scroll ?
this.panel_.css('top', top+"px");
return true;
}
else
{ $(this.element).css("height", "auto");
this.panel_.css('top', "0px");
this.botv.hide();
this.topv.hide();
return false;
}
}
else return false;
};
/**
* On view change hide layer depending on resolution / extent
* @param {ol.event} map The map instance.
* @private
*/
ol.control.LayerSwitcher.prototype.viewChange = function(e)
{
var map = this.map_;
var res = this.map_.getView().getResolution();
$("li", this.panel_).each(function()
{ var l = $(this).data('layer');
if (l)
{ if (l.getMaxResolution()<=res || l.getMinResolution()>=res) $(this).addClass("ol-layer-hidden");
else
{ var ex0 = l.getExtent();
if (ex0)
{ var ex = map.getView().calculateExtent(map.getSize());
if (!ol.extent.intersects(ex, ex0))
{ $(this).addClass("ol-layer-hidden");
}
else $(this).removeClass("ol-layer-hidden");
}
else $(this).removeClass("ol-layer-hidden");
}
}
});
};
/**
* Draw the panel control (prevent multiple draw due to layers manipulation on the map with a delay function)
*/
ol.control.LayerSwitcher.prototype.drawPanel = function(e)
{
if (!this.getMap()) return;
var self = this;
// Multiple event simultaneously / draw once => put drawing in the event queue
this.dcount++;
setTimeout (function(){ self.drawPanel_(); }, 0);
};
/** Delayed draw panel control
* @private
*/
ol.control.LayerSwitcher.prototype.drawPanel_ = function(e)
{ if (--this.dcount || this.dragging_) return;
$("li", this.panel_).not(".ol-header").remove();
this.drawList (this.panel_, this.getMap().getLayers());
};
/** Change layer visibility according to the baselayer option
* @param {ol.layer}
* @param {Array<ol.layer>} related layers
*/
ol.control.LayerSwitcher.prototype.switchLayerVisibility = function(l, layers)
{
if (!l.get('baseLayer')) l.setVisible(!l.getVisible());
else
{ if (!l.getVisible()) l.setVisible(true);
layers.forEach(function(li)
{ if (l!==li && li.get('baseLayer') && li.getVisible()) li.setVisible(false);
});
}
};
/** Check if layer is on the map (depending on zoom and extent)
* @param {ol.layer}
* @return {boolean}
*/
ol.control.LayerSwitcher.prototype.testLayerVisibility = function(layer)
{
if (this.map_)
{ var res = this.map_.getView().getResolution();
if (layer.getMaxResolution()<=res || layer.getMinResolution()>=res) return false;
else
{ var ex0 = layer.getExtent();
if (ex0)
{ var ex = this.map_.getView().calculateExtent(this.map_.getSize());
return ol.extent.intersects(ex, ex0);
}
return true;
}
}
return true;
};
/** Start ordering the list
* @param {event} e drag event
* @private
*/
ol.control.LayerSwitcher.prototype.dragOrdering_ = function(e)
{ var drag = e.data;
switch (e.type)
{ // Start ordering
case 'mousedown':
case 'touchstart':
{ e.stopPropagation();
e.preventDefault();
var pageY = e.pageY
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageY)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageY);
drag =
{ self: drag.self,
elt: $(e.currentTarget).closest("li"),
start: true,
element: drag.self.element,
panel: drag.self.panel_,
pageY: pageY
};
drag.elt.parent().addClass('drag');
$(document).on("mouseup mousemove touchend touchcancel touchmove", drag, drag.self.dragOrdering_);
break;
}
// Stop ordering
case 'touchcancel':
case 'touchend':
case 'mouseup':
{ if (drag.target)
{ // Get drag on parent
var drop = drag.layer;
var target = drag.target;
if (drop && target)
{ var collection ;
if (drag.group) collection = drag.group.getLayers();
else collection = drag.self.getMap().getLayers();
var layers = collection.getArray();
// Switch layers
for (var i=0; i<layers.length; i++)
{ if (layers[i]==drop)
{ collection.removeAt (i);
break;
}
}
for (var j=0; j<layers.length; j++)
{ if (layers[j]==target)
{ if (i>j) collection.insertAt (j,drop);
else collection.insertAt (j+1,drop);
break;
}
}
}
}
$("li",drag.elt.parent()).removeClass("dropover dropover-after dropover-before");
drag.elt.removeClass("drag");
drag.elt.parent().removeClass("drag");
$(drag.element).removeClass('drag');
if (drag.div) drag.div.remove();
$(document).off("mouseup mousemove touchend touchcancel touchmove", drag.self.dragOrdering_);
break;
}
// Ordering
case 'mousemove':
case 'touchmove':
{ // First drag (more than 2 px) => show drag element (ghost)
var pageY = e.pageY
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageY)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageY);
if (drag.start && Math.abs(drag.pageY - pageY) > 2)
{ drag.start = false;
drag.elt.addClass("drag");
drag.layer = drag.elt.data('layer');
drag.target = false;
drag.group = drag.elt.parent().parent().data('layer');
// Ghost div
drag.div = $("<li>").appendTo(drag.panel);
drag.div.css ({ position: "absolute", "z-index":10000, left:drag.elt.position().left, opacity:0.5 })
.html($(drag.elt).html())
.addClass("ol-dragover")
.width(drag.elt.outerWidth())
.height(drag.elt.height());
$(drag.element).addClass('drag');
}
if (!drag.start)
{ e.preventDefault();
e.stopPropagation();
// Ghost div
drag.div.css ({ top:pageY - drag.panel.offset().top + drag.panel.scrollTop() +5 });
var li;
if (!e.originalEvent.touches) li = $(e.target);
else li = $(document.elementFromPoint(e.originalEvent.touches[0].clientX, e.originalEvent.touches[0].clientY));
if (li.hasClass("ol-switcherbottomdiv"))
{ drag.self.overflow(-1);
console.log('bottom')
}
else if (li.hasClass("ol-switchertopdiv"))
{ drag.self.overflow(1);
}
if (!li.is("li")) li = li.closest("li");
if (!li.hasClass('dropover')) $("li", drag.elt.parent()).removeClass("dropover dropover-after dropover-before");
if (li.parent().hasClass('drag') && li.get(0) !== drag.elt.get(0))
{ var target = li.data("layer");
// Don't mix layer level
if (target && !target.get("allwaysOnTop") == !drag.layer.get("allwaysOnTop"))
{ li.addClass("dropover");
li.addClass((drag.elt.position().top < li.position().top)?"dropover-after":"dropover-before");
drag.target = target;
}
else
{ drag.target = false;
}
drag.div.show();
}
else
{ drag.target = false;
if (li.get(0) === drag.elt.get(0)) drag.div.hide();
else drag.div.show();
}
if (!drag.target) drag.div.addClass("forbidden");
else drag.div.removeClass("forbidden");
}
break;
}
default: break;
}
};
/** Change opacity on drag
* @param {event} e drag event
* @private
*/
ol.control.LayerSwitcher.prototype.dragOpacity_ = function(e)
{ var drag = e.data;
switch (e.type)
{ // Start opacity
case 'mousedown':
case 'touchstart':
{ e.stopPropagation();
e.preventDefault();
drag.start = e.pageX
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageX)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageX);
drag.elt = $(e.target);
drag.layer = drag.elt.closest("li").data('layer')
drag.self.dragging_ = true;
$(document).on("mouseup touchend mousemove touchmove touchcancel", drag, drag.self.dragOpacity_);
break;
}
// Stop opacity
case 'touchcancel':
case 'touchend':
case 'mouseup':
{ $(document).off("mouseup touchend mousemove touchmove touchcancel", drag.self.dragOpacity_);
drag.layer.setOpacity(drag.opacity);
drag.elt.parent().next().text(Math.round(drag.opacity*100));
drag.self.dragging_ = false;
drag = false;
break;
}
// Move opcaity
default:
{ var x = e.pageX
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageX)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageX);
var dx = Math.max ( 0, Math.min( 1, (x - drag.elt.parent().offset().left) / drag.elt.parent().width() ));
drag.elt.css("left", (dx*100)+"%");
drag.elt.parent().next().text(Math.round(drag.opacity*100));
drag.opacity = dx;
drag.layer.setOpacity(dx);
break;
}
}
}
/** Render a list of layer
* @param {elt} element to render
* @layers {Array{ol.layer}} list of layer to show
* @api stable
*/
ol.control.LayerSwitcher.prototype.drawList = function(ul, collection)
{ var self = this;
var layers = collection.getArray();
var setVisibility = function(e)
{ e.stopPropagation();
e.preventDefault();
var l = $(this).parent().parent().data("layer");
self.switchLayerVisibility(l,collection);
};
function moveLayer (l, layers, inc)
{
for (var i=0; i<layers.getLength(); i++)
{ if (layers.item(i) === l)
{ layers.remove(l);
layers.insertAt(i+inc, l);
return true;
}
if (layers.item(i).getLayers && moveLayer (l, layers.item(i).getLayers(), inc)) return true;
}
return false;
};
function moveLayerUp(e)
{ e.stopPropagation();
e.preventDefault();
moveLayer($(this).closest('li').data("layer"), self.map_.getLayers(), +1);
};
function moveLayerDown(e)
{ e.stopPropagation();
e.preventDefault();
moveLayer($(this).closest('li').data("layer"), self.map_.getLayers(), -1);
};
function onInfo(e)
{ e.stopPropagation();
e.preventDefault();
self.oninfo($(this).closest('li').data("layer"));
};
function zoomExtent(e)
{ e.stopPropagation();
e.preventDefault();
if (self.onextent) self.onextent($(this).closest('li').data("layer"));
else self.map_.getView().fit ($(this).closest('li').data("layer").getExtent(), self.map_.getSize());
};
function removeLayer(e)
{ e.stopPropagation();
e.preventDefault();
var li = $(this).closest("ul").parent();
if (li.data("layer"))
{ li.data("layer").getLayers().remove($(this).closest('li').data("layer"));
if (li.data("layer").getLayers().getLength()==0 && !li.data("layer").get('noSwitcherDelete'))
{ removeLayer.call($(".layerTrash", li), e);
}
}
else self.map_.removeLayer($(this).closest('li').data("layer"));
};
// Add the layer list
for (var i=layers.length-1; i>=0; i--)
{ var layer = layers[i];
if (!self.displayInLayerSwitcher(layer)) continue;
var li = $("<li>").addClass((layer.getVisible()?"visible ":" ")+(layer.get('baseLayer')?"baselayer":""))
.data("layer",layer).appendTo(ul);
var layer_buttons = $("<div>").addClass("ol-layerswitcher-buttons").appendTo(li);
var d = $("<div>").addClass('li-content').appendTo(li);
if (!this.testLayerVisibility(layer)) d.addClass("ol-layer-hidden");
// Visibility
$("<input>")
.attr('type', layer.get('baseLayer') ? 'radio' : 'checkbox')
.attr("checked",layer.getVisible())
.on ('click', setVisibility)
.appendTo(d);
// Label
$("<label>").text(layer.get("title") || layer.get("name"))
.attr('title', layer.get("title") || layer.get("name"))
.on ('click', setVisibility)
.attr('unselectable', 'on')
.css('user-select', 'none')
.on('selectstart', false)
.appendTo(d);
// up/down
if (this.reordering)
{ if ( (i<layers.length-1 && (layer.get("allwaysOnTop") || !layers[i+1].get("allwaysOnTop")) )
|| (i>0 && (!layer.get("allwaysOnTop") || layers[i-1].get("allwaysOnTop")) ) )
{ $("<div>").addClass("layerup")
.on ("mousedown touchstart", {self:this}, this.dragOrdering_ )
.attr("title", this.tip.up)
.appendTo(layer_buttons);
}
}
// Show/hide sub layers
if (layer.getLayers)
{ var nb = 0;
layer.getLayers().forEach(function(l)
{ if (self.displayInLayerSwitcher(l)) nb++;
});
if (nb)
{ $("<div>").addClass(layer.get("openInLayerSwitcher") ? "collapse-layers" : "expend-layers" )
.click(function()
{ var l = $(this).closest('li').data("layer");
l.set("openInLayerSwitcher", !l.get("openInLayerSwitcher") )
})
.attr("title", this.tip.plus)
.appendTo(layer_buttons);
}
}
// $("<div>").addClass("ol-separator").appendTo(layer_buttons);
// Info button
if (this.oninfo)
{ $("<div>").addClass("layerInfo")
.on ('click', onInfo)
.attr("title", this.tip.info)
.appendTo(layer_buttons);
}
// Layer remove
if (this.hastrash && !layer.get("noSwitcherDelete"))
{ $("<div>").addClass("layerTrash")
.on ('click', removeLayer)
.attr("title", this.tip.trash)
.appendTo(layer_buttons);
}
// Layer extent
if (this.hasextent && layers[i].getExtent())
{ var ex = layers[i].getExtent();
if (ex.length==4 && ex[0]<ex[2] && ex[1]<ex[3])
{ $("<div>").addClass("layerExtent")
.on ('click', zoomExtent)
.attr("title", this.tip.extent)
.appendTo(layer_buttons);
}
}
// Progress
if (this.show_progress && layer instanceof ol.layer.Tile)
{ var p = $("<div>")
.addClass("layerswitcher-progress")
.appendTo(d);
this.setprogress_(layer);
layer.layerswitcher_progress = $("<div>").appendTo(p);
}
// Opacity
var opacity = $("<div>").addClass("layerswitcher-opacity")
.on("click", function(e)
{ e.stopPropagation();
e.preventDefault();
var x = e.pageX
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageX)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageX);
var dx = Math.max ( 0, Math.min( 1, (x - $(this).offset().left) / $(this).width() ));
$(this).closest("li").data('layer').setOpacity(dx);
})
.appendTo(d);
$("<div>").addClass("layerswitcher-opacity-cursor")
.on("mousedown touchstart", { self: this }, self.dragOpacity_ )
.css ('left', (layer.getOpacity()*100)+"%")
.appendTo(opacity);
// Percent
$("<div>").addClass("layerswitcher-opacity-label")
.text(Math.round(layer.getOpacity()*100))
.appendTo(d);
// Layer group
if (layer.getLayers)
{ li.addClass('ol-layer-group');
if (layer.get("openInLayerSwitcher")===true)
{ this.drawList ($("<ul>").appendTo(li), layer.getLayers());
}
}
else if (layer instanceof ol.layer.Vector) li.addClass('ol-layer-vector');
else if (layer instanceof ol.layer.VectorTile) li.addClass('ol-layer-vector');
else if (layer instanceof ol.layer.Tile) li.addClass('ol-layer-tile');
else if (layer instanceof ol.layer.Image) li.addClass('ol-layer-image');
else if (layer instanceof ol.layer.Heatmap) li.addClass('ol-layer-heatmap');
}
if (ul==this.panel_) this.overflow();
};
/** Handle progress bar for a layer
* @private
*/
ol.control.LayerSwitcher.prototype.setprogress_ = function(layer)
{
if (!layer.layerswitcher_progress)
{ var loaded = 0;
var loading = 0;
function draw()
{ if (loading === loaded)
{ loading = loaded = 0;
layer.layerswitcher_progress.width(0);
}
else
{ layer.layerswitcher_progress.css('width', (loaded / loading * 100).toFixed(1) + '%');
}
}
layer.getSource().on('tileloadstart', function()
{ loading++;
draw();
});
layer.getSource().on('tileloadend', function()
{ loaded++;
draw();
});
layer.getSource().on('tileloaderror', function()
{ loaded++;
draw();
});
}
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Control bar for OL3
* The control bar is a container for other controls. It can be used to create toolbars.
* Control bars can be nested and combined with ol.control.Toggle to handle activate/deactivate.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {String} options.className class of the control
* @param {bool} options.group is a group, default false
* @param {bool} options.toggleOne only one toggle control is active at a time, default false
* @param {bool} options.autoDeactivate used with subbar to deactivate all control when top level control deactivate, default false
* @param {Array<_ol_control_>} options.controls a list of control to add to the bar
*/
ol.control.Bar = function(options)
{ if (!options) options={};
var element = $("<div>").addClass('ol-unselectable ol-control ol-bar');
if (options.className) element.addClass(options.className);
if (options.group) element.addClass('ol-group');
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
this.set('toggleOne', options.toggleOne);
this.set('autoDeactivate', options.autoDeactivate);
this.controls_ = [];
if (options.controls instanceof Array)
{ for (var i=0; i<options.controls.length; i++)
{ this.addControl(options.controls[i]);
}
}
};
ol.inherits(ol.control.Bar, ol.control.Control);
/** Set the control visibility
* @param {boolean} b
*/
ol.control.Bar.prototype.setVisible = function (val) {
if (val) $(this.element).show();
else $(this.element).hide();
}
/** Get the control visibility
* @return {boolean} b
*/
ol.control.Bar.prototype.getVisible = function ()
{ return ($(this.element).css('display') != 'none');
}
/**
* Set the map instance the control is associated with
* and add its controls associated to this map.
* @param {_ol_Map_} map The map instance.
*/
ol.control.Bar.prototype.setMap = function (map)
{ ol.control.Control.prototype.setMap.call(this, map);
for (var i=0; i<this.controls_.length; i++)
{ var c = this.controls_[i];
// map.addControl(c);
c.setMap(map);
}
};
/** Get controls in the panel
* @param {Array<_ol_control_>}
*/
ol.control.Bar.prototype.getControls = function ()
{ return this.controls_;
};
/** Set tool bar position
* @param {top|left|bottom|right} pos
*/
ol.control.Bar.prototype.setPosition = function (pos)
{ $(this.element).removeClass('ol-left ol-top ol-bottom ol-right');
pos=pos.split ('-');
for (var i=0; i<pos.length; i++)
{ switch (pos[i])
{ case 'top':
case 'left':
case 'bottom':
case 'right':
$(this.element).addClass ("ol-"+pos[i]);
break;
default: break;
}
}
};
/** Add a control to the bar
* @param {_ol_control_} c control to add
*/
ol.control.Bar.prototype.addControl = function (c)
{ this.controls_.push(c);
c.setTarget(this.element);
if (this.getMap())
{ this.getMap().addControl(c);
}
// Activate and toogleOne
c.on ('change:active', this.onActivateControl_.bind(this));
if (c.getActive && c.getActive())
{ c.dispatchEvent({ type:'change:active', key:'active', oldValue:false, active:true });
}
};
/** Deativate all controls in a bar
* @param {_ol_control_} except a control
*/
ol.control.Bar.prototype.deactivateControls = function (except)
{ for (var i=0; i<this.controls_.length; i++)
{ if (this.controls_[i] !== except && this.controls_[i].setActive)
{ this.controls_[i].setActive(false);
}
}
};
ol.control.Bar.prototype.getActiveControls = function ()
{ var active = [];
for (var i=0, c; c=this.controls_[i]; i++)
{ if (c.getActive && c.getActive()) active.push(c);
}
return active;
}
/** Auto activate/deactivate controls in the bar
* @param {boolean} b activate/deactivate
*/
ol.control.Bar.prototype.setActive = function (b)
{ if (!b && this.get("autoDeactivate"))
{ this.deactivateControls();
}
if (b)
{ var ctrls = this.getControls();
for (var i=0, sb; (sb = ctrls[i]); i++)
{ if (sb.get("autoActivate")) sb.setActive(true);
}
}
}
/** Post-process an activated/deactivated control
* @param {ol.event} e :an object with a target {_ol_control_} and active flag {bool}
*/
ol.control.Bar.prototype.onActivateControl_ = function (e) {
if (this.get('toggleOne'))
{ if (e.active)
{ var n;
var ctrl = e.target;
for (n=0; n<this.controls_.length; n++)
{ if (this.controls_[n]===ctrl) break;
}
// Not here!
if (n==this.controls_.length) return;
this.deactivateControls (this.controls_[n]);
}
else
{ // No one active > test auto activate
if (!this.getActiveControls().length)
{ for (var i=0, c; c=this.controls_[i]; i++)
{ if (c.get("autoActivate"))
{ c.setActive();
break;
}
}
}
}
}
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** A simple push button control
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {String} options.className class of the control
* @param {String} options.title title of the control
* @param {String} options.html html to insert in the control
* @param {function} options.handleClick callback when control is clicked (or use change:active event)
*/
ol.control.Button = function(options)
{ options = options || {};
var element = $("<div>").addClass((options.className||"") + ' ol-button ol-unselectable ol-control');
var self = this;
var bt = $("<button>").html(options.html || "")
.attr('type','button')
.attr('title', options.title)
.on("touchstart click", function(e)
{ if (e && e.preventDefault)
{ e.preventDefault();
e.stopPropagation();
}
if (options.handleClick) options.handleClick.call(self, e);
})
.appendTo(element);
// Try to get a title in the button content
if (!options.title) bt.attr("title", bt.children().first().attr('title'));
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
if (options.title) this.set("title", options.title);
};
ol.inherits(ol.control.Button, ol.control.Control);
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc
* OpenLayers 3 Attribution Control integrated in the canvas (for jpeg/png
* @see http://www.kreidefossilien.de/webgis/dokumentation/beispiele/export-map-to-png-with-scale
*
* @constructor
* @extends {ol.control.Attribution}
* @param {Object=} options extend the ol.control.Attribution options.
* @param {ol.style.Style} options.style option is usesd to draw the text.
*/
ol.control.CanvasAttribution = function(options)
{ if (!options) options = {};
ol.control.Attribution.call(this, options);
// Draw in canvas
this.isCanvas_ = !!options.canvas;
// Get style options
if (!options) options={};
if (!options.style) options.style = new ol.style.Style();
this.setStyle (options.style);
}
ol.inherits(ol.control.CanvasAttribution, ol.control.Attribution);
/**
* Draw attribution on canvas
* @param {boolean} b draw the attribution on canvas.
*/
ol.control.CanvasAttribution.prototype.setCanvas = function (b)
{ this.isCanvas_ = b;
$(this.element).css("visibility", b ? "hidden":"visible");
if (this.map_) this.map_.renderSync();
};
/**
* Change the control style
* @param {ol.style.Style} style
*/
ol.control.CanvasAttribution.prototype.setStyle = function (style)
{ var text = style.getText();
this.font_ = text ? text.getFont() : "10px Arial";
var stroke = text ? text.getStroke() : null;
var fill = text ? text.getFill() : null;
this.fontStrokeStyle_ = stroke ? ol.color.asString(stroke.getColor()) : "#fff";
this.fontFillStyle_ = fill ? ol.color.asString(fill.getColor()) : "#000";
this.fontStrokeWidth_ = stroke ? stroke.getWidth() : 3;
if (this.getMap()) this.getMap().render();
};
/**
* Remove the control from its current map and attach it to the new map.
* Subclasses may set up event handlers to get notified about changes to
* the map here.
* @param {ol.Map} map Map.
* @api stable
*/
ol.control.CanvasAttribution.prototype.setMap = function (map)
{ var oldmap = this.getMap();
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.ScaleLine.prototype.setMap.call(this, map);
if (oldmap) oldmap.renderSync();
// Get change (new layer added or removed)
if (map) {
this._listener = map.on('postcompose', this.drawAttribution_.bind(this));
}
this.map_ = map;
this.setCanvas (this.isCanvas_);
}
/**
* Draw attribution in the final canvas
* @private
*/
ol.control.CanvasAttribution.prototype.drawAttribution_ = function(e)
{ var ctx = e.context;
if (!this.isCanvas_) return;
var text = "";
$("li", this.element).each (function()
{ if ($(this).css("display")!="none") text += (text ? " - ":"") + $(this).text();
});
// Get size of the scale div
var position = $(this.element).position();
// Retina device
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.scale(ratio,ratio);
// Position if transform:scale()
var container = $(this.getMap().getViewport()).parent();
var scx = container.outerWidth() / container.get(0).getBoundingClientRect().width;
var scy = container.outerHeight() / container.get(0).getBoundingClientRect().height;
position.left *= scx;
position.top *= scy;
position.right = position.left + $(this.element).outerWidth();
position.bottom = position.top + $(this.element).outerHeight();
// Draw scale text
ctx.beginPath();
ctx.strokeStyle = this.fontStrokeStyle_;
ctx.fillStyle = this.fontFillStyle_;
ctx.lineWidth = this.fontStrokeWidth_;
ctx.textAlign = "right";
ctx.textBaseline ="bottom";
ctx.font = this.font_;
ctx.strokeText(text, position.right, position.bottom);
ctx.fillText(text, position.right, position.bottom);
ctx.closePath();
ctx.restore();
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc
* OpenLayers 3 Scale Line Control integrated in the canvas (for jpeg/png
* @see http://www.kreidefossilien.de/webgis/dokumentation/beispiele/export-map-to-png-with-scale
*
* @constructor
* @extends {ol.control.ScaleLine}
* @param {Object=} options extend the ol.control.ScaleLine options.
* @param {ol.style.Style} options.style used to draw the scale line (default is black/white, 10px Arial).
*/
ol.control.CanvasScaleLine = function(options)
{ ol.control.ScaleLine.call(this, options);
this.scaleHeight_ = 6;
// Get style options
if (!options) options={};
if (!options.style) options.style = new ol.style.Style();
this.setStyle(options.style);
}
ol.inherits(ol.control.CanvasScaleLine, ol.control.ScaleLine);
/**
* Remove the control from its current map and attach it to the new map.
* Subclasses may set up event handlers to get notified about changes to
* the map here.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.control.CanvasScaleLine.prototype.setMap = function (map)
{ var oldmap = this.getMap();
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.ScaleLine.prototype.setMap.call(this, map);
if (oldmap) oldmap.renderSync();
// Add postcompose on the map
if (map) {
this._listener = map.on('postcompose', this.drawScale_.bind(this));
}
// Hide the default DOM element
this.$element = $(this.element).css("visibility","hidden");
this.olscale = $(".ol-scale-line-inner", this.element);
}
/**
* Change the control style
* @param {_ol_style_Style_} style
*/
ol.control.CanvasScaleLine.prototype.setStyle = function (style)
{ var stroke = style.getStroke();
this.strokeStyle_ = stroke ? ol.color.asString(stroke.getColor()) : "#000";
this.strokeWidth_ = stroke ? stroke.getWidth() : 2;
var fill = style.getFill();
this.fillStyle_ = fill ? ol.color.asString(fill.getColor()) : "#fff";
var text = style.getText();
this.font_ = text ? text.getFont() : "10px Arial";
stroke = text ? text.getStroke() : null;
fill = text ? text.getFill() : null;
this.fontStrokeStyle_ = stroke ? ol.color.asString(stroke.getColor()) : this.fillStyle_;
this.fontStrokeWidth_ = stroke ? stroke.getWidth() : 3;
this.fontFillStyle_ = fill ? ol.color.asString(fill.getColor()) : this.strokeStyle_;
// refresh
if (this.getMap()) this.getMap().render();
}
/**
* Draw attribution in the final canvas
* @private
*/
ol.control.CanvasScaleLine.prototype.drawScale_ = function(e)
{ if ( this.$element.css("display")==="none" ) return;
var ctx = e.context;
// Get size of the scale div
var scalewidth = this.olscale.width();
if (!scalewidth) return;
var text = this.olscale.text();
var position = this.$element.position();
// Retina device
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.scale(ratio,ratio);
// Position if transform:scale()
var container = $(this.getMap().getViewport()).parent();
var scx = container.outerWidth() / container.get(0).getBoundingClientRect().width;
var scy = container.outerHeight() / container.get(0).getBoundingClientRect().height;
position.left *= scx;
position.top *= scy;
// On top
position.top += this.$element.height() - this.scaleHeight_;
// Draw scale text
ctx.beginPath();
ctx.strokeStyle = this.fontStrokeStyle_;
ctx.fillStyle = this.fontFillStyle_;
ctx.lineWidth = this.fontStrokeWidth_;
ctx.textAlign = "center";
ctx.textBaseline ="bottom";
ctx.font = this.font_;
ctx.strokeText(text, position.left+scalewidth/2, position.top);
ctx.fillText(text, position.left+scalewidth/2, position.top);
ctx.closePath();
// Draw scale bar
position.top += 2;
ctx.lineWidth = this.strokeWidth_;
ctx.strokeStyle = this.strokeStyle_;
var max = 4;
var n = parseInt(text);
while (n%10 === 0) n/=10;
if (n%5 === 0) max = 5;
for (var i=0; i<max; i++)
{ ctx.beginPath();
ctx.fillStyle = i%2 ? this.fillStyle_ : this.strokeStyle_;
ctx.rect(position.left+i*scalewidth/max, position.top, scalewidth/max, this.scaleHeight_);
ctx.stroke();
ctx.fill();
ctx.closePath();
}
ctx.restore();
}
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* OpenLayers 3 Title Control integrated in the canvas (for jpeg/png
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options extend the ol.control options.
* @param {ol.style.Style} options.style style usesd to draw the title.
*/
ol.control.CanvasTitle = function(options)
{ if (!options) options={};
// Get style options
if (!options.style) options.style = new ol.style.Style();
this.setStyle(options.style);
// Initialize parent
var elt = $("<div>").text(this.text_)
.addClass("ol-title ol-unselectable")
.css(
{ font: this.font_,
position: 'absolute',
top:0, left:0, right:0,
display: 'block',
visibility: 'hidden'
});
ol.control.Control.call(this,
{ element: elt.get(0),
target: options.target
});
}
ol.inherits(ol.control.CanvasTitle, ol.control.Control);
/**
* Remove the control from its current map and attach it to the new map.
* Subclasses may set up event handlers to get notified about changes to
* the map here.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.control.CanvasTitle.prototype.setMap = function (map)
{ var oldmap = this.getMap();
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (oldmap) oldmap.renderSync();
// Get change (new layer added or removed)
if (map) {
this._listener = map.on('postcompose', this.drawTitle_.bind(this));
}
}
/**
* Change the control style
* @param {ol.style.Style} style
*/
ol.control.CanvasTitle.prototype.setStyle = function (style)
{ var text = style.getText();
this.font_ = text ? text.getFont() || "20px Arial" : "20px Arial";
this.text_ = text ? text.getText() : "";
var stroke = text ? text.getStroke() : null;
var fill = text ? text.getFill() : null;
this.strokeStyle_ = stroke ? ol.color.asString(stroke.getColor()) : "#fff";
this.fillStyle_ = fill ? ol.color.asString(fill.getColor()) : "#000";
if (this.element)
{ $(this.element).text(this.text_).css ({font: this.font_});
}
// refresh
if (this.getMap()) this.getMap().render();
}
/**
* Set the map title
* @param {string} map title.
* @api stable
*/
ol.control.CanvasTitle.prototype.setTitle = function (title)
{ this.text_ = title;
$(this.element).text(title);
if (this.getMap()) this.getMap().renderSync();
}
/**
* Get the map title
* @param {string} map title.
* @api stable
*/
ol.control.CanvasTitle.prototype.getTitle = function (title)
{ return this.text_;
}
/**
* Set control visibility
* @param {bool} b
* @api stable
*/
ol.control.CanvasTitle.prototype.setVisible = function (b)
{ if (b) $(this.element).show();
else $(this.element).hide();
if (this.getMap()) this.getMap().renderSync();
}
/**
* Get control visibility
* @return {bool}
* @api stable
*/
ol.control.CanvasTitle.prototype.getVisible = function (b)
{ return ($(this.element).css('display') !== 'none');
}
/** Draw scale line in the final canvas
*/
ol.control.CanvasTitle.prototype.drawTitle_ = function(e)
{ if (!this.getVisible()) return;
var ctx = e.context;
// Retina device
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.scale(ratio,ratio);
var w = ctx.canvas.width/ratio;
var h = $(this.element).height();
var position = { top:0, left:w/2 };
ctx.beginPath();
ctx.fillStyle = this.strokeStyle_;
ctx.rect(0,0, w, h);
ctx.fill();
ctx.closePath();
ctx.beginPath();
ctx.fillStyle = this.fillStyle_;
ctx.textAlign = "center";
ctx.textBaseline = "middle";
ctx.font = this.font_;
ctx.fillText(this.text_, position.left, position.top +h/2);
ctx.closePath();
ctx.restore();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** ol.control.Cloud adds an old map effect on a canvas renderer.
* It colors the map, adds a parchment texture and compass onto the map.
* @constructor
* @param {Object} options
* @param {_ol_color_} options.hue color to set hue of the map, default #963
* @param {Number} options.saturation saturation of the hue color, default 0.6
* @param {Number} options.opacity opacity of the overimpose image, default 0.7
* @todo add effects on pan / zoom change
*/
ol.control.Cloud = function(options)
{ options = options || {};
var div = document.createElement('div');
div.className = "ol-cloud ol-unselectable ol-control";
ol.control.Control.call(this,
{ element: div
});
// Defaut cloud image
this.cloud = options.img;
if (!this.cloud)
{ this.cloud = new Image();
this.cloud.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAQAAAAEACAMAAABrrFhUAAAACXBIWXMAAAsTAAALEwEAmpwYAAAAB3RJTUUH4AYRBhgFS4lkHAAAAB1pVFh0Q29tbWVudAAAAAAAQ3JlYXRlZCB3aXRoIEdJTVBkLmUHAAAA6lBMVEUAAAD///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////+Le70HAAAATnRSTlMAAwkMDxUXGiAiJSowMzU3Ojw/QkRGSUtOT1JUV1lbXmBiZGZoam1ucXN0d3l6fX6AgoSGh4qLjY6QkpSVl5mbnJ6foaKkpaeoqqutrrA/NNYeAAAAAWJLR0QB/wIt3gAALhJJREFUeNrtfel6azeuLAryd9//fbuFuj+IkYtLkr2902dyEseDLIkkiKFQAET+h3/gH/iL//v4Xy0w//Ul53/xJcAHq3q1WHD+/9feEbH+u3zw7+4H//Jpg++2Ctc3cvwT/gPSwX9U3PHhfvct5H8RDXE8r+/dirZ8+Mrg14AQggL252R8TfAf3oAfv+DdH2K+yvv9Zt+H3xWEv64Drq+HswDcvih36fft4N9Y+usN+HPZw+nu490rtC1Al4A/vQy3f47fXvd19Ygrn7bijfYbB94lgL+wAfsK8X1b9tHqh/Dv/7vRpGy/2y+E68XfFwP8vnJBlwB8bgSPBnCqAP6+cfxdJejiPZZ/kALmZ97dgnH4/Yvf3gJ8V/u9/D32he/2b78FtxIAXkWAf8E0+tvkDxd8v/yuBHDZiRQBvvSBt8Vf9uFv+QGvD/nenuCk/ptLEN/z+DRTBXQJIPjnUnBePX9LB1xkPxZ82JOXB44bK5Ar50E3/qetgLTj3RaNzS/wt4DL0nGjDgn25XKeP//o/DcvnT97Ipci7NYfcl3+JRwmuG1G+1VX+9Ma4BfVIf5s//KcQfRzxnQBLzEBL89bC+ZZD447QPCzHXh7rvuZfNsNRPvX/0+kdpn3/wYI4ulbXveAu2P8G4ESfkP3+S6eRf9kC187g7xoA25bcNyQ/8AGoEtAN3Qp+oRsNuH7e9AVAS9q4M0WfHgFfmZIEGeLoyEsNwvnV8IN9uWaH+4oUU5bcNWNP9Nk+JPjx77u7gPy3v7DVQHugmBej3/swCFG+KlTgD9eP2S7ATjY2NOG487tPQEiww3Yv/4TTYA/uf3t6ImuCgjh4eyH5wnB1fzxhUrgi/9+HijjJ84Tc/G7GsQ9Ajos4/pCxdRURGwsBwfP6PbQe6zAH+gB/Fj81ycKDlYAvF776w3Q+sZ2L+d4Pe5Fnz8OEvFtzVmaf9cBuwo4vET/tVaqzLcgfJsXwBBvrsCPtwAfq8ymNUsCLn4AXjz3epyaqNXqkXbdrnpgftmN/3EHtg389VigbjHm/S9P+LT+TfHrBhao1QGb78bJFG4mgHfKkX/VCnRtt/uAtzhY+0bLC/DVNx0otGkKpyHctcDZDJDf0OjfBkSwiz+OHlH7H+elbw/S/sRhBqwFh7w6CF0L4OoX/cQg4puPxTj+viNyFwutU5YRIOvlyc1Pz9T2SOiAiF1Env17yucXGz8+/yYFPeRvMZCeZO1y+G0Lhgq0HRo/40K8LP97qhBDx71+qLt7S9UhIBC0gLjQEDVdpgMDAuiHX0c9fAGCZXNMXkYBmyR8LANtqR+jwtjV/6YP60sXeVzyJSUVmwvUv7zgpHbYgT0C6Iv/pjHA99X/UQ2WMOgFAmvnPdaPWq+1z8MKLmVobXHXLBG7WWRYAv7xBlxjf5x2oPmG6O7di9uu9ZhYkm3SsJlBEwrByR9IuIgnLfAqyfvmCoR+5CXrARnrH6in+3kd+9Hz6neAiLEDdoMRsaKlg3vEtglTD/LXrgDaIa+lX9Jg8OimvGE9rr1FBGEfjZsIaHyl8Ws7+LpxStyX/60dwGcKsMt/vwilIFL80deq7W7rVCd5WyhipCFvr5qKxH8itvyDGwXPofs2Vcj3Ch4f6r+pAUfck9+E+Ovu+vGQRFuWAn6CT77Q3CZkMwZX0IQXA8B2K17bQ9wriWKV7KePif8h7DuG/6OWGnGQEsMXQPwBSeN6vxCK6XEHxHT5SjzklEPrcSrFe5eoLe4TEcAu/RgpULhmn+sfT09cLENoDZLyDEewHVpzlCxWYud1cVt2bMcnMvA+YrpKwCUK0nGzu6Ef8h/BAWRKgAlJsbEBOh2EsQOn5Nmm/yhdOf6RFYh1X86/7n77oq0+cXFu8XDlkFwJkmsHSnNr6cd+8PlVBDK8wiFs8sD3cQHeQaCXm182sDl+mKu/wOBsYcAEUvLdkib0ZLEKEAFvyUDbgXPylBcF8F4Gvjajeu8IYMd20E5fp4sH8ZVgcwDZZWf32tXKuWwP8d/536aPQH+VIBesCKqhjOD65wdXoCWL8/SRi3YB6JZfC+Vs0R/jHtB1f3iNGHBoOvCpBrBe0WSIQI9+rDvLF4CAuwDwpzpgu/fTDUZfv+4p0BXFFLscTfmhpQXhFyBd3rUD2gAC63hBrcZELfmTIzfA8c+Gkh1Yje9coFKBaFEB+u3X9Ah0IhkzMHLktECI/GSId2qirkuaUrSePNiCSMqASSm1n3yvCN9uwLYJzSdWgQjU+vpVBB3ZCzuIipIB1AWoVHcthuVBr7zZ3IK5C3bNmxBj7XwNEb2yApf1dwsA0dR+mqKAfk1baZBahsBAWEHCRCgIGLCUm7Q9kXkRuoCNjePGJPDV87VH+LpoyhfddUCqaG3XH37G6KbZDjFwdyhEBgLaw+EUEJuwoB1zabajZnnz8/xf6EF8SwOiyX+Ygbb+rtrBFtwOFg2UIijQD3WhfUMgh028bOwAUW3qe7b1v1YD+HT9KQBwJe1qUFE3PLyXOhwV08Wa6k/akFgxZYBgtjk3GdzoOPNtB/aLkPkRDkXAW0//vQtc1z89AF23IGMgnQDBcHHC9nsiWcNFHuAOMuTdT3yHT/vjrE58vwi+A6ECbkUA79bfRADhwELT/EU0hJkYnJyNIFE0f7jOfdNpWR5Bgan7/e307GoWNg1B7jvwSgvg8/U3k6DuqqQAzNRgx6p35vAeJ8OO+V8hCzDy2rp4ZmPLqDfZXyiSdN3Xd+DbG5AW4MX6h/5HMiPqAu8gkElHDsNR3thAHc4DhQRIQOiPt3DubHOGEBnm2IGuBM478PVCA/YvwslHrLcZN91Z0sQh++qaDJAtlVKxmFwLg3JHlUJ4aKGGARxYulsQqjl8vooxEZmmm7gI70zA0IPuAqM5AO4Q5TmrFQeaDQbT5uWslWoJefrwWjrOPB0XSmGDyZdB0O4h5gUKgK2fPm8y5/hg/Zse0LSAaycaPNhimHasEr8RS9QQBammdC5ryQn8YQTMiX/a9AQrqeTbk9HA3IsPr0BP9UzmDwb4h5EKuENYM3YTanAjEWxKFYMz5VAsE04nHRn/O9Aw/i58bUtmqq47sV6rdvB4Bb5eUQGwITgYYKavH5gs4QIznUJGzyUz31/Ax/RAGhk7Q8iVdh46lE5EdEswyovVDmmYoNnmw9ESa283AOPEJzMCBfpjPEKtgrhWm++xQ7vDlk70MvaeHYCIedpdBCTit25LSzocaU9lF8+79AHapqQIBPn4WxJwiQFaKKwjxlk/6Xn/YpSpw/zETI3qhXJE0RXLpuJfr8pO6vW7wUPpjVY0SVGjXwIpdO64BXrvHEBmQrBUvha84c+t23P6wauKKJrHB9b6NWxCBEoQQKHuVq6wmRFAo0OxAMY1POv1JoCYUvhSAnAgRJQBiE3T3QHYuACFks9dR6oOiVvj5tAEMFBEDSH9hau7GSa6NdsOdFBORrU0KHcigBd5oMCAUB7AsIDa9mdlerXwu3zP+Y4LC1AClUOmwwj+sGWxCcZ94GRTEBbG3WQgiT0essIDN4/4Mx0wZWGjBlbwh3mXVJA6mYM5ysUoL2WGdX1XTLRuNVxVgQ4e03e/7CDErZ91uJX5onZmObSzf58dxoDCKwhcJx7Xd3lAjR2a16LC9QiUV/zmUbCujVCIZBZUG6iFBDG4XP8WUrr/T1jHj2yXASalZAYCPIoAzlFQk/4GgoQVbOtvGXEtz9USI4bQwFB3LvoAEFdTe/zIugMjvJVqvkELSCAhIu7Qef46n2nsxWuCxOX2o7nAkQLw3WiZ8cH8qTAFWAFqpbsgXKIEESEBJ9x5fNMd19oWoiUblniYRPWgxZn3JGJGxUMLHPDRr3s/UHoisAygykaQaM4ukC69mIMk1HR91CBCqEsVAxkMGVqhW3TXudbXsNqwuFMc+j02yzFFXnkOd7m/r1snUDDqwrSFgE3+Ly6FiznXHyxRN4ABGoFaWaGAx5vFWzsAoTYe2EAaBIUfwZYKBNMIYsOPI4nI+ucTV7gyool5uRcMLOdmowOp7I0DsoBomX0VFVvr18ErZYVSK2AAhupzLhocJPLo3g9VF2ZqLmmhBEMS0NzA19nhqxvYHSJos/+BAzU+hGlvlAYBQ1wBQoVUTXEFREylKivXQ5UioJJbvU1kfZmoh2SkN3AxyzvQ5aF5TUdQ5Ot09kUIdjuo0jBwbRwZjThkT2yzvEiuHaQu+QY048I8/YwHBOuBtpNrHA4qnWEjBOCVe5xxcITgx046Xy+coCbnQE8BAIP1nM5/B8DoADg8tOvO+FpevitMeMTlAXl5BSbBvA7dSFGDzRTz7g9jZqhjx/lWCS5orZEjlvArPJbBDKNU/GzX5VWKQOXpIYyAK49Mq+xpYuQuK8x/47wnv2g5jEs9MjTlSJIN8usiG8owAfgoLwDP3dYnWSEaIqzT+IUGWUPT6Wf6uar6pIjKA4uspSLC5wI11BWYjruuvf4pQ3jptnxlUpejszhFlkmAhhBbJU8CQSt4+IIPfx28QNltXKd/TTKc9rRHevAKeQoEqqpitsQA5gpTDCsEgruOy+5l8A8mAMEsMhbz66DLGDgHxhxW6cWGSyuENswkfShA8KUSDMWzNUTSjgfOPYhdW/4Oirsj+pUwAADq8nxBi/C+LdXfmAawLdVtIb4hNtO+VRf3eCisIkZE6Xs1bMHXDRpUdIa0/xXPNk5Id2HcXidb4LFeys3n02MIo3oM7GBYODrhBokoG8l2YYHsEWPAXhRkjsT3b4EMtifcIvK42sGvCw52YYNoRsDqZr5yAuxlsiqUh7t6D/PACK4EDVR1G6+ZJWrKI/lVWjBmRFdbDxJrfuGGjtgWJA9Y8OQMf530YSMyhg+gkQNHX/8oElN3mLigS8AgX/JcCtTUFi+AucmmAfuFYyAP1n0ABGINFg1SXMDHK5jqF2BjGasNC8COEPBGCYbgaGM0tF64uLpMRDgrEACPhW4aKKaAUKjLw1MB3GJ3ZwmV9mlp4EtubaHEy3awu7lsWIGaXv2g9pS8LP/oCWLEROEEllpUv8wZKDnUQRUAut6mCB8al7GIRISpLWBgetsEQ6rY3y4k8wTSTCQKGKZ7SrZcEtvhIA6+7ntPcNRBJC8yaR7O7XkM9HXtPEQB/TILAX0s8GRFAR5A8PHvFUl5/ibeH2RofFeoDo5ZhEQWlDOb+syOlQBX6BxXY/h1Xvt6G02gZiMUDbvFZSSqFpxP/fr3ugR4qkC1AAQRCEwFcCEJT1dczYOiZKstdv9fI08OApYM2YWuJCktPOSwhvR9iktyTg9/XSCHec91EqA7DO92mysUchqsiqgaIAqCAL6IQn4BW/QqwwAQKhVSyR8HBrC8OYiApJWzTy/kJOCsg+12r/yInHpxnv2AUQYhk/0sED5S3RXHgw9b6D4d6HvqgryEIlT10Hc1DBBg5XfBpffZafMVClM7NWCJgV+HiqhGkO9ZsQsl1qaR7PnSePDXNR+CTdFrlbo1qMTfvSlV5evZ7iMVFK4IAmLTutJRs0SalvCv1C5AbaBPOYm2frmcxPUDXUxMpTqanCxTG0EhhwrYWExvkqMj3+3+UKRFk5tuqiKWDROXLQapDpvp0/WAqAeGg+wQd84JIPWiSZYHherukBJcxKm2oUGBe0WNn227G56yKUF0p4st91GyqpEWDqTCKFDn8CwhMV1BpSfAHnH8y8OlrpC5x66sWuzRgnj3CQhd3rwRKlweP4JqFUB7segOXbrv/QD0OohidfNxVoH5nABpEFFYS6GpiS1R0S23hIj609ZJGXY0u+VqX1rbqQrWVuhFDZRIRWwFUZ1hDBb5brLtjmawwKcO9ZjeIglrHZaVjgp3XIAIXHoat4DqTPr7HphHmuxoMQtCJhp+ZitCUpguX9ixD7WVmG+YEDe5fwmKMtD65v364hWR5dZO40R5MQHLFcXBgZ/oNqRN9grTXS8GD4BjV5cOXUBYB4yTbmSw8iyWQ23OjWGXfn2OreCrvACu7T8hG7NhoEeP4nZH+dPj62vlQEhkriwANhWI+eVHZkSjHaVGCNL6VFXOEOkDZ/akPEKWIUTPjgjFjh2ZpiLYrUBHHdLY2SPUkWlGZelf529X1RcgBjM8YI9lO8AHWmvdUaIQDlJb6CKKgI0YAsL6z1Y8JYQ+x9JbVAxudLVuEihvABFecj5aSOjC9AlYI4CJCOSpCOh45b8U5QUzdoDd1qBBX0uLFggtFIhle7bkDKl1+WdkZuq81dTkTJYoT0gujhBq9Ri1gO1NWe2ATYFZ4bsGfORcikgMrMQHpoptrXaoKzxwvFhG3pnlyHtVrBekRRJpfVJyxkZqm+TPkHC90BYMVTBADIQhIgVvfKR05m7mbVXLbSOS7wdRKrdIHw3ty+QXyE6tb52EkANJXArWjnnS1RmDcf0/7R2ymUEc5L8HgyW3NnoCZC4IoEGFMIW5ylb2NBJ45SAiopqgxZabL1wehDUOOsiEGCgUfaaa4t6rt7VfORdEcWeJFecLhz/DqzS64Ov/Pej1jnQoUJEEsHG1W91J/RRIWobTRxiOZNVqNrpycTiaq3rJWI/ewzetDnWTClwl4qRIzRrnnSLC55OAqgihD+gS1qgQY71zlUa9Lsyl5WP2KhX0khNpmPSiy3mQ0lOVJUdbDcdBEnRj4GzJEJyuTT3iERyi57+eoQLUQgYaxBUaS1r5FLzoIHag2VbMEjtsuZsqX1iEwdhn7Q0Kmtu+l7LgsAHcz553reB3zfBQKp+2yt9pTKJSZKIGNQwbCVFRqRbdu/EFTYQywZoswPNdVXQmd18H9xkf2KVbBxNOZhmPJs+9Cjvc6C4vzQyPx0P5pH499EF7Cs0pnhzmp3FfixwLzas6qq6LmhYKgx1SKCLqgiGHC4vPSqIKSZ6CQZGbgQArxyid/hR5ETWu9CO9RFpFCHNE08muwdpulL/lwxCarm1cHSfKZs0Qk0HQ7Acgoou50WUHuIdKD/13vw6FLoPlonK9S4pEqPlv+RJR+Zc8SDxE24HQSU8ruOlBU5UXVkU9u35oI8j84ltz4Rn5IlbFxQJaZ7mqdU7IDgQws2l7NJQ/0KlFW3+LUE8QCP/1b+pDFSuH7bos3FZbNU+7MdlebWVLRluilHzMfp0MkGjntUB4JX/jYrH3N6BTxc1sFzc/gc0BGk0F//3veOASWMAZc7KNUkFeIzbYc4kwPXwWDi3WHJN2LXClp6MTOvSq+896Qe+3qFiwaNyJqadKVhI0sFgKVCGuHbZt7l0yWgXGsFGuSrP+scOk2IPbRJhcPW9M51ZkhtGVdSjBuUMDB0C1vdpcx3VNvr5UHg+BUMyMHLob6AxdJPvfVTzzhKsyNy0p/S61guQpoVtBuo6l6LGdy1Tvekea3+v9xvAAVFNpIJKcCpqIGE2K77/Uf4trYm96hzh2t4f+MSdWIHkyHLJq1XUjKX2J5MthogXu3JrLCE7q5lTxICeW3Y8gT7rS8xRRrxq8NhwGFmoYAlEXHNNa9frnKgALgCx6V0Q+PaksEiWteO0P6PAL9rdJqSfa0SWG9AJiJlEEsfJCQHQ19OMnefVSjKnw1TcYpDOiubWVTs7z8EhMOld9rAmhEfCKHqayq/nRAM1F3165VVCYPHqM1hI1VgkQKaJ0gLBoyjZayysiGRg1j434HluzdVPwCLHKj7oCwEtAQG9jnb4Vm6r01lfxa8+MWG+8Ll5foQNhxSJ7SbdwGI3ZmPrflYN5Ms1rBQIr4NZWNaPCFzMcjluhJyO4RctoHMJRxJAqXRewuaoDWsuvPe3fiMCUVVQmQR1QSmPENF6pzeswyA4qI2yccR72gs/TFugIlqd5uQsMrRIYzBMr8ve6AsYLnlJoBtKDJdHKOLSbjkVEKSMa5RMkSNJMZhIbuikBhdxE8zjoAI6AACcwfd+B1uGDxifNHVpgWYPYoARmAA+ZvFYUHNXC/SL4ZVCEiz2zRrtOVh3oU29vcHK+WbGnjl+zgfUjoOLcsFGP4BrBOaihvBq7S8Kqe4o/Qoai7wBVQYlLNhetQ1ijBHh5lmoL1j/oD5inz/0KTC9ghgI4tPIRmmvo55O09b0X8kHkXKjHlvu7uGVs/WsDU5idnkhyzFc4Ni8ePZfe7IuerolnfJrM1y+qlovZIYE0s+eKcq3PQVi/m+0EwjVgq8cqfd6BMxvEJD2FMaGZ0x/rDS1ThQ+dts2303uwZKnl6mDottia7NMLOP3Wrg8LpQbpxtu/JXtVGvYRBCu7zp4jQOk01vUnnBbU7BI2EOTQrLzA1asjdHGTx3UgT6Nfe5GgxQPdSxB2hkJFhWzC0U8DGv2pfJUa6X1s+tysgYSsrstsiXhtGMYrjFtPdsLr3tyTs+Dguzk2k+rjImZCMQJs3hp6ABqanYkWV7BFCSoTMOc1QlUDPXAPw5HDVhuF3kKpa6gdGj2D/6crwAw/BrRMs/Yrq0NY1LVVM1wePKU3UeHop3KNut2dUj9ot6XLLW7906s2QfMlOK3RaF92owG35hAnHdAAyyi8wAr8eJoAseQDaAY/uCYc83DYRYNsFPxCgVFZEhWot+x6BDWcETPaZr6rXLRYkxdg9OQYnboPMEa+ZJ8W5/8GPiPWsuzLv2+xARwUkBKDdLOWZURvpISpxswICPQRjRRctTsnsnlFJjfO8raqWWeBOzN4N/cySnEoZpYnWT28PN/VwPw4SkLZS58rnZexxWTcmNGPWF29wWtPAzNgVKczjiU9q1OkcIL8uHVv0g0v52ZFOG0JszNPxIGNizWB3iqRdT3RKHepUONzN5JeZA6KZiHpAloAXgAr6bqn96PWnsDuAAd32GwPWLgNvpDe2rp61Vp0BIXvQLnwSSm57Gm+gcIFl8owVt6XoK6q8tC60FWz55rfTpNZSROxU/xyqJvd86mlLjkMfyvOW+rfGzhFClC6hyRR3BcahOVBrwueuBeltUBm0uKjOH0RxFRhdHvY0swpKrN3NkdrvcLv9brmm+xwa8qbQIeVnUXrbD36GFXur26yCcy8pxcHXZvsBQweJZmUe+y19kvVBt84jwSkraLBaLfhvcMoT9n9AJUD5TTtELsO2Owke0fArioocuJeZS9vLpDULZL1RmaSlZy9+euK9oEONgWy8lw0i9ZgtKuf6sXXmhM31CArshQXkPMa3vZ5DOxd2i38nvL8AurI+zgHZBuNNEeLWZ5TOWU98gwDhpZ9dbJTIGEUCp9Pm5g/yegnEZ3Zj+n/Xps2MyK8C4YwDKfNIfAcXSnmgBd/7BqIwdL06e2G89ObPiTw6UbWyFVeFhHAeoqHKi16r5LZaIWkRLhpdvbxe2yKi8V/NIY8WpCGYmN4wYLhYk73afOt5qpiXTSaQdUbRDrTAjT3JgII35jBDbHWfJ37oJ2sBEZjP3IMLyXOk3CvmOApLOIIieQ6zssicYcoad44N8j65/Zme120zUhRu+WAiNHM8plHNxQzM1riDQcc/NxGE/KaKSo37FnzRicipA7/TliVz43cnZ3wWqVvdj+Rdkg1lYDRVm6BiqKLii+wagnJU4A3zLITp92LpbyC/nXflG3W85iAZBvotI7JTm6GLVc9QZNWyS6zDUq7EwtPWWdO4GmuJO1J2lK/RkOlFI00l0EdQdExNU5eFtiuAK7j+vpts+YcO4F1Ovq9QaitJAloLYyWggu8E5jLcigaPsmnkfY0kiAeYtFqx0RMnmsGAy/YH3lI8lxb7x9l4CGdrdgbSPWfrrNsPGJWGXl0t5Pst1pMP68QpVzm0u4oLCjyNPotQG+iJDQRWzyksSpXQW59GxfDPxmr4ewFmL2Ew9zUxjbvNDf5CCN479/0mVdazApI6+LFw3RQmsA8gfpQRwJCbMznjdk2YYK1/svZN/T8SpQ8B0PcdOSY9Rp2foy5YHEarfM4XDNYS4tw4X/Fk8kPEXuupXBR/lQ9CLI1eEaell6HNSgpumpYK9ijjGuJoQ62EXucV2D6Aa2LZvb5aV9HJDcnjhBo04WixgdBpGiPzy6ijfhFERXVJT4U4/PpQSchlOcKGNJJtVYD4/xSaxnk6c82dZuOXGxM34ArYVd6HxzWTzSbrbSpM9Eepjke+b0bQGA0EnYH1Rjk8OgPAnsaF4PCWzS7rK/ap/REI/Nic9ZcTCik3PTRbJ7RcQN2EYheiGzDpWJaXOfCowVT3kLHoVXWM7IzmyKqE8s2LEaBPK3QANPlFBBb3NPkXMpjrBTzKLuvEHyGBF9Xh+fgBxGm2CYGEo1g5OTH1TCB2qdhRZKQICxKPNzRc1eYFK7GyFZkpAUTUAgjzLoZzX6BDbOyFnhtPo2MlvWbFnx0LLgdO8ZMZb/3bNO2GMyW9ACCu8x23VGdbZPNyGyRwyvLN7TtahjBpu+qNnQZuLhKS84sVmeFjvCQBhBse/CQ6x3o0zRa3+x2OzTbq5Q3HBTRUcJQdaKjZlD6yJCl/1Ujlo6ooXjnsg3dZN8oL7DhjF4zBs/MGyZ2cYwFsvYkGnT0GrrIxBafRbP4PzANmGKBue3Uo9bIW2UVSYYol2DBPg76LOtd/y42hEXv2UNnNJteRaBYdSM4f3+8AncTZSQbFaTmZyQzMIhwUQ05/MlsCdFqPhDzDyrIY+EsthoL0zztZ37BE2uMXnP5ow1pQ/N6wIH4XBynx1aM0aB7bLOlEUuPDvuQy+TJSNz4HjCLBQtXhIx0c3pGqRbi6tvCBS1dJiQRY/YBYUuAY9aJswPacrUBezjMMR6QO40+aonDNeJWsBlcuAV04GGr00EoidUFZ7VEKaXsobVDgzbzD0v9geRqpU6WTVndsgKs6HtS+dNYP3vOk/KylVbR34Ds/XGTROsJZ6LU9FKIFnrf7ym8ISYbJrwuP709lPq7M+mTogqh5/24nKEY1C56YXTkPgMiHOcdtYrY/YOgURlOspMdX3ufH0YbFXoDOCYIumyEyzeyV3YW3XAMHU2g1hPu1U4oWwadG4zveRmedECzgNxHrLVOi56mS1s46fWQrd9hEqcxBkwVraWSj1LFICkAzfV13uSlHrYczzqKkHgrTcMzLrRvwDZctbWZXi3q3RrsflIv3GgjCSv9y1nS5MAuTFpg6KGmgZZ9EBkLMQbmmNAyqscYJ7KQzRXHLAqeppBeN2DrLt5+1lrcT9xko6ChmCCtygXzolSgPBjAPoW5wE9Wpr5hwulyJrksPT7r0G2BqXcfDzndAdmjYu9ygGB0EFKNA2XnsQ4fPNjw1evaq8BWZVnaqewC/3TyaBGl6wrM7nFsABC6v1+Y86Xr3o4UXzbgtAvtiyQ/ow2ZwLwFbK1JZbajK+x4rL3cftCYoVKk4jhQqYa2Dw6tVAsVBJzfcwnVTfROBxyHLF+67WfZh3LUtbZ+sCoVPEtoRUHPWjDP1SUD6eg3tKj116+2qtzJXhhob5BHeOyx9voK9AFLHLsQNzqLlttVuJSCNK8yZaF5F5Fih+Oszcz3hYphpQM6opx5VIwSvB3vAx0fYgdXW+Lz/QbIac4ussWZ9Ir3PP9o6ZINU4HZh67NPbQcBGXz2AMHDrZhQdzgNf+5iEUouLBiI3Zei9xlR3ZXmK1hEWs6kr9p3R6MYid2uubqfUBYFIa1hskTJM7kzfCpOaZOzvmNBA/qTK21EOmuwo3KvJOAZsW3qeM13SY7okUP3bTz3i0TwRsanfMRlUAoldcmKVgWyNFD45GxL8J5F/Mxwjzni+YNsJaavARB9xswQcGRJFncJYhUN4AAubfa8O6gZZ8FsBqcbqVgT7YZiXvWhDGEaoI8G5/LZ2k5YkxpeMoWFLzagKkAdoQciXGVi6SHDcTO4woQLJac/A4HftjKQULhtUprMcTMlck26yA/M1VUEDmHCuSpicQhGgynrf8vlUBTED5bV3mZNepNf1rPTP/DnAIMNAeA3LsNOFf9VO19yXTHFLVOYbWeLu7MEL7TAdt09T1RCDJt3wBRB802i0Xa3Oo++ZQF4y3IhyzUOijVMXcbBiN4X/OQuVMmNm6ybytvp5A/jjmDPQTcxrBn1QMm6wCtM1DqzkarbOUeAmsrb3njrJNOeOFSzdL6SSBue+YNPZDaqnruq0Yex6zJzbC5FhQVSNzzJ62uIZ3BUJ0sC9crKbLyxrIIh31nTWTMcyRa4909fbm0rDmztG/oqbP+zQZcJ02jdXfbAmG0FtNab5Qxm7n48s16rZ7oKm2gkhNAeryLaJ0hAoN3cWvhaG5K0bVoGTtwp/BBzqOHjxuwjRoFZpO9lhgK5gCH/WMmFEdjfCR2tvI9qyF0FJ0w0wTddfTkKfXSRr3E20LrJxBWloV9DvNnV+Dq/6KVYIK1A2SU/FBnynHUcTa2Q1x0DLpd5z/VjR/4QbP7W7JCBoOLLXDggU/EDyWgi8A2cRJZ8V1DUCNAzkJI4gISzXYkRKJ/nUPQG3m0CVsOiIc+GKMXWBx+iRou2qyzvPGC7zagNUfYunhJabZgA0T1Q0WGUIxWF6g8Ra92QGUHAx8JDA9nXrfYAlgh1cGn8VlX2aL1V6kkA89Dh282YNMCrcdS0+01bhLlJDZPgBk1+3HCw6bl9yNnvwUUHEnPvbFzlHCxD+MWLk4lwwUgq7yjDWcbs+f5oRKU69DB2TQGJPpA0mzj0rmkOUYxrzAyG1D3gEGs97oKtDRtx34SI+bWfqcpAFsx8VMGOYly01jz7QZUFevIFXfWTF4Tji5d6i2jRuFn4aGsfgqDR18tU3rX+AuBkdLmU5mk0BuDpJwVKI3HftdM7mYDrqPnmwJoPLkJmUTjBEZv3D7/pPiyef5lAXqeYFJ7T+5brG4lD4Oo70BKzp+fseUtLHxHlWUpu9bPOfzzmHnF1u45G7dZTVRvlFAkob16xzbafzpAK01WczV6jblJa2rT6poSPI9oGKPBxAsNcC8BV2RsTGIbqeOjn4DsEZLQyKWjwiR4e9e02d2zlAcPxQDGUp9sUeBOTL2bvH4fYg0EeMp5+gkxa8QJ8Yoi33MS87MJb7ZErT4z61yzPDfsS1OvM/3ZiZoWizMvmUqEsYMtG8zymQRccgTAVoCW498GAl5z8rLIm5BOZ+0wNoHObQv+Hgv+Sbgpx24F+IiiidJ6/QY3aiovFWafbcAlGJQ+WaY7RajxglszIueOVWmL5FgwNJJcH7NWIQ5nf8PL/J0MpRdpMgWg84DYbcD3N+DKl5nOSQW82fakWuNjw+Hg0o5WRCujqi60J6S50qlwR6en4ecYY/pssUVL7F86AS83oJO+x/ChLg4UGY5iJkZguQV1nL0h1KTn01tV+6QF8FDmy4pDu5tnSZx2OJSTCPBaAF5twFT/XRX2OCdAj9mKMBjLJg3eSfokUdMJYD3E5XTDspKkmQYO9rOBZIcBOZnp79b/yQb0/3HTA+LDdAqh7ESFSoh0yY0cX+c8YWRwsEPsGRH25zN4cZp5rZp1l69lQik/0gE3HsFhB4rygk61KVoHZuK6M2gjttnaWFew0apM40nJVVtA5h0w9wLZq34pry3g+w2AnNOEkxuHNpILRRtvkY8nfwmreL+ognKqhMJG6t62aGMBW6OSNlbwGwv4gQS0VXdvb9uAav9erCA2jJbBZmKrLMuCruZoZ8PzGrWJwQRq2GgmgdlzoZQxWfSDVvOQtzvQT3ZqwuhvnG3j2oNmndl2xzMYRCvAHk1wYjZV9eCfqzFthVwBJbTGe5UpfLMNEPlMBi6MiQoLNDzjrb1r8nVQBWVSPcSqTTOTW2xZyWO922ec+pXxYIGLDhicPRHCbxAkbtTA7g11CzWVYTddZZF3HhExmn5EFz7WPW8dSbYcwYyFEggit/SAvL39n0nAOVc23YGYRt0FALI1OAPl7jj0QGIQ2Xsb9H4WOUdGqlKNMwNG+UwN4BM1sVvBMY9K0LqXamesbSPkCXJlRM4Jvkt9T+/kZpsQtLYRHEnwbQ/ebsDjsw3oTIk5khNt6uZokrdh+DkaZYd974+jHmeth2ov7Gb4ECOm6GdP+XMJkGnkhzqoYjBtiXucAKx2gGtE4YHsfLgeJfhreA5nYxMp/3rzfT46/882YJOBBprP7IeOKQXHVzHtpu7mvE8fRZNity+c5JcxYvxX/IB7f3iPDKOdMS6tu1rTd6thwBlEffJhbSq7Dc9xNjsZd/+j9X+4AZM9KQ3268mbtgXcGlhtWObeq+2T5Rf/DRvWTxluYKcg/9oGTO78NAqTXhZ7sI9WujjyHLOsTK+3IO8LmxnoMMpM//RuNvKZApCtfv1DlxBycYoHYqbHdOtOJGq99e2gEmJyaJbDsTCDGRZ1Rt24ASK/KAGH298GJjavMJ5Ubeh6bLw3zy31m6EntZdU0WPVWyskHHrg8/V/4gdcItRWHHKZyFIkker6uolaxwR6BDT8A8tZqh7tplCPSerc/CD50Pr/RALkmiaZ8Ih0Ng+4dejGhY0XknL1/axjynX6vEEDOh3iVRrwUwnAW49o24GtT9lhqFdvnMg+cHxvB4OgC2FiG7x27tqSn5NQ/PmpfuMKXG7BlRyLw4WvhOrm8RXNodUdGbeOtba5dFdhn207v3P/f7YBfWbDVQKun6XPF8RR0q5dLhrtlXuKfH6a1aP82Pz9RAdsiXOZo3aioIiHPcCp7pJFoahv+vrT6aHM5Y6vZqOM760f/P4G7CSyURtzuP/5SYe9b3OyIYe4yHZ39+L7Tp+IP1n/jyRAbiVAdnfg9JOTxR9TXvfVz6XPagvh9df8wXL4ExmY1LFZQHowCXOI0uh9KrIBKHZV5zyIweEifHv5k+jN270Ab7zCGRSOFd/4weB9X8/m/+0tzPuSb1Tht8z/1Qrg7ZW4aO0ODYEYNF7sqoBt6egokZfJWHcBeHV3eHWBsF+O7y//JzpgC32woWKXbLGIHKed3rwLymmt1wO/UYbvpfdTPwDf3YFm7g9b0AxODZqB8HoleOlEzF0n8M4c/uDj8SdCs/sBu96/tvJ9l4iajmwSq+acGdlCgRfOH368AXjtCl3WD7n6Ajh2M8bm+7eycvKKm5z62/H7x3+r4h4/1w2buO/+8DYwgd/TNpSD93dj/X8i/fjWFcDLLdiWS4jc2cZvLX+38fvJU36+/j/SAZsAjEwpcfH/ICLvZt41/HTcdnB3AqfK558uH3+wAWUNWtc08LzgPhbtIOmvf8D7G/Dn7/7xC89xHmyOXU90f3lWsezDX3rjvCb7uEbMf74Hj+/rvVtluOu9oy88in4J3krAkToz1T7/4PK+1AH4eEf2JW7Ntne0dPRilpk6ifvfmwO9NQLymxLwx/egJodRdmgER/jh9vyJPRy4Nkf8Q28fH+sAfP4yzegRR2Gas9OiV9WGFx/9vpNz8EtH96tPhZP8H8Z/orUWl9aC5eQK4HQBfvYe+TeuwL3+n/rhEA4Hi5o3XuCeDvrVw//JBuDtby6uX8uRgoP+u6361spRplv0q9L++N7f4iMhO2nAmShg8/yws0OmBJS2+JXTx9+xAm/1QcnD7R4SN3L/V2Q/3sYD8je34JQ2awgkZjOoo5O3WcTf/nh8viD8VA6IqwU4CcBoESQ3pvA/tgE/tDqX1b/bRt74A39LTh8/0nTf3oaTwfTae4K4m/JC8C/cyu9LAH7hIfjkkeeigL/68ZB/8ANz0DDv3DP+9ffxSxuAH/0eN03/r1HBX1z3f0YC9rdD/HOi/mNT9hejKMh/hw/8j3uhX3mj+O/55g/v8/8Dqd6Iqc0B7UUAAAAASUVORK5CYII=";
}
this.bird = options.bird;
if (!this.bird)
{ this.bird = new Image();
this.bird.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAIAAAABDCAQAAAD+S8VaAAAAAnNCSVQICFXsRgQAAAAJcEhZcwAAAvMAAALzAdLpCioAAAAZdEVYdFNvZnR3YXJlAHd3dy5pbmtzY2FwZS5vcmeb7jwaAAAG90lEQVR42uWaaVRTRxTHJ4AUUIoIiqISOArIDiIhBBfccCMoR0vVUpXjTqun4Fr1tO5i3YuodaFqRMECKm4VUHEhUvWgBYuilgpiRVZpCARI3r8fWA4hYY9AXu77+ObNzO/O8u787xDSyeYSTzSICpu+DjV0ogrze84PBneByuJv3JpbBlx6MEBbJfG/8S2RAACFXXtU0gERN1BjCc9UEN/e7I2w1gFPinv3UDkHbFiGOqOwJVjlHMALRT3LLJ7trGIOuHwFUsY7q2IOuJ0u7YB//pswWFn6/vnUcbOCAn7ctfnUrsijl85dv5pw786fd9OTsvg5/JykN3fTb6ZcTDgVvefIkqXmVvKr0NN/IUQDO7C1qwJrOwyftIZ7cmIiN21eZlB+SOUtFKNl9kF0hb9ujmyVM73FMmWv3m+2J4zxw74NDN5/5vT1qzeT7j3n5/Bz7mcmPk24cy32Ai8i9Pj2nwIX+jo4kc8UMMqeXr5bfC6N/2tUHrdsCQ4gAR/QNhNRJ8+6GklXH7xStlxW+ViLxrpjqBswJ/z4rYyCFrQnwJPCxGe/x53i+fO+XOth2xpsvQm+PkfGP3YuYIo1oInTyIJiLDFtoZfUP+AXeaW2rZHXKZ8xJ35NeU+1odVSbIIBbEQeb70Tffd6ckmj0QbDy9/zOufdILE6SN0TBkVafnn0ka/NatrrditDXpmYKw36pREwPyr+Y0V72n0CsxoedTDFrMJJyRMDZJYIx8+yYICQKbDJtcjtL9IGAcEMKN7efIy+snnTYv/tR8Ry3+eWRUYFzavRB9SWL7icXKWAVrPRr96wEqjBTjg5bop03GGi77XF85FdqVZNIQ1konOsEvx35yOCN1xMFimszjNSDqh+ektGfVG3xjyTzaqkX3uDTiaCdh0ZA/qSgWXWWfb7CYMQQsiUUANK1j8hoJf1lSFUg0u+z1xCiFuMUYWsAy7QCj9ZzhIgIDCkpi4nhBCGsafNGx2peXCQRvhlcGrEAQSOhYQQQtyTG74YCglN8CswrVF8goEVhBBCrMzdozi33OOHJmvUvQqghQtKMEUu+GDB0Cj2Q/vsUdJn0JH8+oXG4rWS46djSD0ePcr2lUuafbZlIbN0UAnngpyA0I3FumeZxxQYVlZ/ooWleKm0+FHQbTDuWnAp5F6cbNfskcDtcg9J9aMGNUxDIiglgy+CPxhypj4Ddu/cfFpxOrIqrv7QAsH4V2nwYxoEvwQEOpRlAeeG07hWnopH7FMHgTr6VmhAA1xEQNjF4bMxQwpcj2I9duVZLiVtTb7YT7T2I30JccyqrrA7ZuESRF0SvhQ/QKfByDu/VZAs5O6rXS9U6onZ+A2CLgQvwWn0l5n4TAFnjOKksR5En6i73q6/q3IRhvwugB8LBylwi6IhixxX9Wd/CoWQwTrJTuaEOSwzENcKDR7Yj4xOg4+Hq3SEXzX8fIfcObAZPizV+bGxqLZhMyxBWgdP+xi4ScGbCNnhhrodqxnrso65pLidNxMQENihqoPgS3AY5rU7krh35eCPbon2c4hap2nnxob2GQQE+zpAM4qFb53EoUWxE3t93jXyBwyXcG1KD+8/IXwBAmFYg26Vx37oHjnIlnQlGzbJvMCX+lQrPgT6dat9yAcT/S6aSOIs2rjjxLaQ9SsX83gv8uShiNuAn4mR9fZ5dizpphRpREvj1YvOhiU84OdmoghFyKH47y/GHohtLf45ITvVuLyfyKLI5RlntyJSXx2+P+gaejt5O7FNCSEkcFHTuAmPom6/qqxJqFRee33wHGc6rVLjXtym8C8nTTcnDNMh/n5BfnN8mFY18jWdbPlceeBViEsPi16xxFSL7ncjukVelTvxUzsxjOlAUzsULv8/GfdEJa7G7D7YWLCcUzbNkfb42zaXNaG2h4XTHH/n9x+bjIHKqeAdNMZf55fbrKBYLNq+lqb433lkFrUk5hNKdu6mIf5XA1KetzibR+09TLcfonrMtVYlNKk9h2gV//FCW3tCFmMXT0nOe83bxpklbdDJqrD+BC1mwUzTtOw2Sl/UFjpsh8ci2pHirFgxV8nxV/oJxO2RwR6+HNFbmfkZ15PaqwQe/VmJ+R18Aql37XTAsQ9EefUBW6NeEk34IaWN8HkIQk+Jva0SzwGXP6p1XDeEoqB1qx/L0B3dKY+VSr0JDurDFNaK2ZoYg5142sx1m3LEYxUsq+Vv8ejVSv8bdJ/UXySds9eDB4JwEnFIRS6KUIi/8RJxCEEARte74GBR6DycFpGgtZNFPkHrHgOx61miSaPDEOtEn8qWwvepZMc5Mel3ItZmHbbM12wSXV/snMHZQ6eRlzEzI9d9rnftskwERhXVNxF7ik1Krd87pbLCbWYR9Y7v0f/htaJHbsoDhwAAAABJRU5ErkJggg==";
}
// Parameters
this.set('opacity', options.opacity||0.3);
this.set('density', options.density||0.5);
this.setWind(options);
};
ol.inherits(ol.control.Cloud, ol.control.Control);
/**
* Remove the control from its current map and attach it to the new map.
* Subclasses may set up event handlers to get notified about changes to
* the map here.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.control.Cloud.prototype.setMap = function (map) {
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (map)
{ this._listener = map.on('postcompose', this.drawCloud_.bind(this));
}
};
/** Set wind direction / force
*/
ol.control.Cloud.prototype.setWind= function (options)
{ options = options || {};
var rnd = Math.random;
var a = options.windAngle || rnd()*Math.PI;
var speed = options.windSpeed || rnd();
this.wind = { angle: a, cos: Math.cos(a), sin: Math.sin(a), speed: speed };
}
/**
* @private
*/
ol.control.Cloud.prototype.drawCloud_ = function (event)
{ if (!this.getMap()) return;
var ctx = event.context;
var canvas = ctx.canvas;
var ratio = event.frameState.pixelRatio;
// var m = Math.max(canvas.width, canvas.height);
// var res = view.getResolution()/ratio;
// var rot = view.getRotation();
// Not ready !
if (!this.cloud.width) return;
// Go!
var p = this.particules;
var rnd = Math.random;
var w = this.cloud.width;
var h = this.cloud.height;
var w2 = this.cloud.width/2;
var h2 = this.cloud.height/2;
var d = (this.get('density')*10*canvas.width*canvas.height/w/h) << 0;
function addClouds (nb, reset)
{ for (var i=0; i<nb; i++)
{ p.push({ x: rnd()*canvas.width-w2, y: rnd()*canvas.height-h2 });
}
}
// First time: init clouds
if (!p)
{ p = this.particules = [];
addClouds(d);
// Wind
var a = rnd()*Math.PI;
this.width = canvas.width;
this.height = canvas.height;
// Birds
this.birds = [];
for (var i=0; i<5; i++)
{ var b = { angle: rnd()*2*Math.PI, x: rnd()*canvas.width, y: rnd()*canvas.height, rot:0, fly:0 };
b.cos = Math.cos(b.angle);
b.sin = Math.cos(b.angle);
this.birds.push (b);
}
}
// Parameters changed
else if (d != p.length)
{ if (this.width !== canvas.width || this.height !== canvas.height)
{ p = this.particules = [];
addClouds(d);
this.width = canvas.width;
this.height = canvas.height;
}
else if (d > p.length)
{ addClouds(1);
}
else if (d < p.length)
{ p.splice ( (p.length*rnd()) << 0, 1);
}
}
// Draw clouds
var dx = this.wind.cos * this.wind.speed;
var dy = this.wind.sin * this.wind.speed;
for (var i=0; i<p.length; i++)
{ p[i].x += dx + rnd()*2-1;
p[i].y += dy + rnd()*2-1;
// out!
if (p[i].x < -w)
{ p[i].x = canvas.width;
p[i].y = rnd()*canvas.height-h2;
}
else if (p[i].x > canvas.width)
{ p[i].x = -w;
p[i].y = rnd()*canvas.height-h2;
}
if (p[i].y < -h)
{ p[i].y = canvas.height;
p[i].x = rnd()*canvas.width-w2;
}
else if (p[i].y > canvas.height)
{ p[i].y = -h;
p[i].x = rnd()*canvas.width-w2;
}
}
// Draw clouds
ctx.globalAlpha = this.get('opacity');
for (var i=0; i<p.length; i++)
{ ctx.drawImage(this.cloud, p[i].x,p[i].y);
}
ctx.globalAlpha = 1;
// Draw birds
var w = this.bird.width/2;
var h = this.bird.height/2;
var sc = 0.5;
var dw = canvas.width+w;
var dh = canvas.height+h;
for (var i=0; i<this.birds.length; i++)
{ var bi = this.birds[i];
// Animate birds
var sx = 0;
if (bi.fly)
{ bi.fly = (++bi.fly%5)
sx = -0.1
}
else if (rnd()<0.01) bi.fly=1;
// Rotate birds
if (bi.rot)
{ bi.angle += bi.rot;
bi.cos = Math.cos(bi.angle);
bi.sin = Math.sin(bi.angle);
}
if (rnd()<0.01)
{ bi.rot = bi.rot ? 0 : rnd()*Math.PI/200-Math.PI/400;
bi.cos = Math.cos(bi.angle);
bi.sin = Math.sin(bi.angle);
}
// Move birds
bi.x += bi.sin;
if (bi.x>dw) bi.x = -w;
if (bi.x<-w) bi.x = dw;
bi.y -= bi.cos;
if (bi.y>dh) bi.y = -h;
if (bi.y<-h) bi.y = dh;
// Draw birds
ctx.save();
ctx.translate (bi.x, bi.y);
ctx.rotate(bi.angle)
ctx.scale(sc+sx,sc);
ctx.drawImage( this.bird, -w,-h );
ctx.restore();
}
// Continue animation
this.getMap().render();
}
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Draw a compass on the map. The position/size of the control is defined in the css.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options. The style {_ol_style_Stroke_} option is usesd to draw the text.
* @param {string} options.className class name for the control
* @param {Image} options.image an image, default use the src option or a default image
* @param {string} options.src image src, default use the image option or a default image
* @param {boolean} options.rotateVithView rotate vith view (false to show watermark), default true
* @param {_ol_style_Stroke_} options.style style to draw the lines, default draw no lines
*/
ol.control.Compass = function(options)
{ var self = this;
if (!options) options = {};
// Initialize parent
var elt = document.createElement("div");
elt.className = "ol-compassctrl ol-unselectable ol-hidden" + (options.className ? " "+options.className : "");
elt.style.position = "absolute";
elt.style.visibility = "hidden";
ol.control.Control.call(this, { element: elt });
this.set('rotateVithView', options.rotateWithView!==false);
// Style to draw the lines
this.style = options.style;
// The image
if (options.image)
{ this.img_ = options.image;
}
else if (options.src)
{ this.img_ = new Image();
this.img_.onload = function(){ if (self.getMap()) self.getMap().renderSync(); }
this.img_.src = options.src;
}
else this.img_ = this.defaultCompass_($(this.element).width(), this.style ? this.style.getColor():"");
// 8 angles
this.da_ = [];
for (var i=0; i<8; i++) this.da_[i] = [ Math.cos(Math.PI*i/8), Math.sin(Math.PI*i/8) ];
};
ol.inherits(ol.control.Compass, ol.control.Control);
/**
* Remove the control from its current map and attach it to the new map.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.control.Compass.prototype.setMap = function (map)
{ var oldmap = this.getMap();
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (oldmap) oldmap.renderSync();
// Get change (new layer added or removed)
if (map) this._listener = map.on('postcompose', this.drawCompass_.bind(this));
};
/**
* Create a default image.
* @param {number} s the size of the compass
* @private
*/
ol.control.Compass.prototype.defaultCompass_ = function (s, color)
{ var canvas = document.createElement('canvas');
var ctx = canvas.getContext("2d");
var s = canvas.width = canvas.height;
var r = s/2;
var r2 = 0.22*r;
function draw (r, r2)
{ ctx.fillStyle = color ||"#963";
ctx.beginPath();
ctx.moveTo (0,0);
ctx.lineTo (r,0); ctx.lineTo (r2,r2); ctx.moveTo (0,0);
ctx.lineTo (-r,0); ctx.lineTo (-r2,-r2); ctx.moveTo (0,0);
ctx.lineTo (0,r); ctx.lineTo (-r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,-r); ctx.lineTo (r2,-r2); ctx.moveTo (0,0);
ctx.fill();
ctx.stroke();
};
function draw2 (r, r2)
{ ctx.globalCompositeOperation = "destination-out";
ctx.fillStyle = "#fff";
ctx.beginPath();
ctx.moveTo (0,0);
ctx.lineTo (r,0); ctx.lineTo (r2,-r2); ctx.moveTo (0,0);
ctx.lineTo (-r,0); ctx.lineTo (-r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,r); ctx.lineTo (r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,-r); ctx.lineTo (-r2,-r2); ctx.moveTo (0,0);
ctx.fill();
ctx.globalCompositeOperation="source-over";
ctx.beginPath();
ctx.moveTo (0,0);
ctx.lineTo (r,0); ctx.lineTo (r2,-r2); ctx.moveTo (0,0);
ctx.lineTo (-r,0); ctx.lineTo (-r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,r); ctx.lineTo (r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,-r); ctx.lineTo (-r2,-r2); ctx.moveTo (0,0);
ctx.stroke();
};
ctx.translate(r,r);
ctx.strokeStyle = color || "#963";
ctx.lineWidth = 1.5;
ctx.beginPath();
ctx.arc (0,0, s*0.41, 0, 2*Math.PI);
ctx.arc (0,0, s*0.44, 0, 2*Math.PI);
ctx.stroke();
ctx.rotate(Math.PI/4)
draw (r*0.9, r2*0.8);
draw2 (r*0.9, r2*0.8);
ctx.rotate(-Math.PI/4)
draw (r, r2);
draw2 (r, r2);
return canvas;
};
/** Draw compass
* @param {ol.event} e postcompose event
* @private
*/
ol.control.Compass.prototype.drawCompass_ = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
// Retina device
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.scale(ratio,ratio);
var w = $(this.element).width();
var h = $(this.element).height();
var pos = $(this.element).position();
var compass = this.img_;
var rot = e.frameState.viewState.rotation;
ctx.beginPath();
ctx.translate(pos.left+w/2, pos.top+h/2);
if (this.get('rotateVithView')) ctx.rotate(rot);
/*
ctx.globalCompositeOperation = "multiply";
ctx.globalAlpha = this.opacity || 1;
*/
if (this.style)
{ ctx.beginPath();
ctx.strokeStyle = this.style.getColor();
ctx.lineWidth = this.style.getWidth();
var m = Math.max(canvas.width, canvas.height);
for (var i=0; i<8; i++)
{ ctx.moveTo (-this.da_[i][0]*m, -this.da_[i][1]*m);
ctx.lineTo (this.da_[i][0]*m, this.da_[i][1]*m);
}
ctx.stroke();
}
if (compass.width)
{ ctx.drawImage (compass, -w/2, -h/2, w, h);
}
ctx.closePath();
ctx.restore();
};
/** A simple control to disable all actions on the map.
* The control will create an invisible div over the map.
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {String} options.class class of the control
* @param {String} options.html html code to insert in the control
* @param {bool} options.on the control is on
* @param {function} options.toggleFn callback when control is clicked
*/
ol.control.Disable = function(options)
{ var options = options||{};
var element = $("<div>").addClass((options.calssName||"")+' ol-disable ol-unselectable ol-control');
element.css({ top:0, left:0, right:0, bottom:0, "z-index":10000, background:"none", display:"none" });
ol.control.Control.call(this,
{ element: element.get(0)
});
}
ol.inherits(ol.control.Disable, ol.control.Control);
/** Test if the control is on
* @return {bool}
* @api stable
*/
ol.control.Disable.prototype.isOn = function()
{ return $(this.element).hasClass("ol-disable");
}
/** Disable all action on the map
* @param {bool} b, default false
* @api stable
*/
ol.control.Disable.prototype.disableMap = function(b)
{ if (b)
{ $(this.element).addClass("ol-enable").show();
}
else
{ $(this.element).removeClass("ol-enable").hide();
}
}
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** A simple gauge control to display level information on the map.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {String} options.className class of the control
* @param {String} options.title title of the control
* @param {number} options.max maximum value, default 100;
* @param {number} options.val the value, default 0
*/
ol.control.Gauge = function(options)
{ options = options || {};
var element = $("<div>").addClass((options.className||"") + ' ol-gauge ol-unselectable ol-control');
this.title_ = $("<span>").appendTo(element);
this.gauge_ = $("<button>").attr('type','button').appendTo($("<div>").appendTo(element)).width(0);
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
this.setTitle(options.title);
this.val(options.val);
this.set("max", options.max||100);
};
ol.inherits(ol.control.Gauge, ol.control.Control);
/** Set the control title
* @param {string} title
*/
ol.control.Gauge.prototype.setTitle = function(title)
{ this.title_.html(title||"");
if (!title) this.title_.hide();
else this.title_.show();
};
/** Set/get the gauge value
* @param {number|undefined} v the value or undefined to get it
* @return {number} the value
*/
ol.control.Gauge.prototype.val = function(v)
{ if (v!==undefined)
{ this.val_ = v;
this.gauge_.css("width", (v/this.get('max')*100)+"%");
}
return this.val_;
};
/** Bookmark positions on ol maps.
*
* @constructor
* @extends {ol.control.Control}
* @fires add
* @fires remove
* @param {} options Geobookmark's options
* @param {string} options.className default ol-bookmark
* @param {string} options.placeholder input placeholder, default Add a new geomark...
* @param {bool} options.editable enable modification, default true
* @param {string} options.namespace a namespace to save the boolmark (if more than one on a page), default ol
* @param {Array<any>} options.marks a list of default bookmarks:
* @see [Geobookmark example](../../examples/map.control.geobookmark.html)
* @example
var bm = new GeoBookmark ({
marks: {
"Paris": {pos:_ol_proj_.transform([2.351828, 48.856578], 'EPSG:4326', 'EPSG:3857'), zoom:11, permanent: true },
"London": {pos:_ol_proj_.transform([-0.1275,51.507222], 'EPSG:4326', 'EPSG:3857'), zoom:12}
}
});
*/
ol.control.GeoBookmark = function(options) {
options = options || {};
var self = this;
var element = document.createElement('div');
if (options.target) {
element.className = options.className || "ol-bookmark";
} else {
element.className = (options.className || "ol-bookmark") +
" ol-unselectable ol-control ol-collapsed";
element.addEventListener("mouseleave", function() {
if (input !== document.activeElement) {
menu.style.display = 'none';
};
});
// Show bookmarks on click
this.button = document.createElement('button');
this.button.setAttribute('type', 'button');
this.button.addEventListener('click', function(e) {
menu.style.display = (menu.style.display === '' || menu.style.display === 'none' ? 'block': 'none');
});
element.appendChild(this.button);
}
// The menu
var menu = document.createElement('div');
element.appendChild(menu);
var ul = document.createElement('ul');
menu.appendChild(ul);
var input = document.createElement('input');
input.setAttribute("placeholder", options.placeholder || "Add a new geomark...")
input.addEventListener("change", function(e) {
var title = this.value;
if (title) {
self.addBookmark(title);
this.value = '';
self.dispatchEvent({
type: "add",
name: title
});
}
menu.style.display = 'none';
});
input.addEventListener("blur", function() {
menu.style.display = 'none';
});
menu.appendChild(input);
// Init
ol.control.Control.call(this, {
element: element,
target: options.target
});
this.on("propertychange", function(e) {
if (e.key==='editable') {
element.className = element.className.replace(" ol-editable","");
if (this.get('editable')) {
element.className += " ol-editable";
}
}
// console.log(e);
}.bind(this));
this.set("namespace", options.namespace || 'ol');
this.set("editable", options.editable !== false);
// Set default bmark
this.setBookmarks(localStorage[this.get('namespace')+"@bookmark"] ? null:options.marks);
};
ol.inherits(ol.control.GeoBookmark, ol.control.Control);
/** Set bookmarks
* @param {} bmark a list of bookmarks, default retreave in the localstorage
* @example
bm.setBookmarks({
"Paris": {pos:_ol_proj_.transform([2.351828, 48.856578], 'EPSG:4326', 'EPSG:3857'), zoom:11, permanent: true },
"London": {pos:_ol_proj_.transform([-0.1275,51.507222], 'EPSG:4326', 'EPSG:3857'), zoom:12}
});
*/
ol.control.GeoBookmark.prototype.setBookmarks = function(bmark) {
if (!bmark) bmark = JSON.parse(localStorage[this.get('namespace')+"@bookmark"] || "{}");
var modify = this.get("editable");
var ul = this.element.querySelector("ul");
var menu = this.element.querySelector("div");
var self = this;
ul.innerHTML = '';
for (var b in bmark) {
var li = document.createElement('li');
li.textContent = b;
li.setAttribute('data-bookmark', JSON.stringify(bmark[b]));
li.addEventListener('click', function() {
var bm = JSON.parse(this.getAttribute("data-bookmark"));
self.getMap().getView().setCenter(bm.pos);
self.getMap().getView().setZoom(bm.zoom);
menu.style.display = 'none';
});
ul.appendChild(li);
if (modify && !bmark[b].permanent) {
var button = document.createElement('button');
button.setAttribute('data-name', b);
button.setAttribute("title", "Suppr.");
button.addEventListener('click', function(e) {
self.removeBookmark(this.getAttribute("data-name"));
self.dispatchEvent({ type: "remove", name: this.getAttribute("data-name") });
e.stopPropagation();
});
li.appendChild(button);
}
}
localStorage[this.get('namespace')+"@bookmark"] = JSON.stringify(bmark);
};
/** Get Geo bookmarks
* @return {any} a list of bookmarks : { BM1:{pos:ol.coordinates, zoom: integer}, BM2:{pos:ol.coordinates, zoom: integer} }
*/
ol.control.GeoBookmark.prototype.getBookmarks = function() {
return JSON.parse(localStorage[this.get('namespace')+"@bookmark"] || "{}");
};
/** Remove a Geo bookmark
* @param {string} name
*/
ol.control.GeoBookmark.prototype.removeBookmark = function(name) {
if (!name) {
return;
};
var bmark = this.getBookmarks();
delete bmark[name];
this.setBookmarks(bmark);
};
/** Add a new Geo bookmark (replace existing one if any)
* @param {string} name name of the bookmark (display in the menu)
* @param {_ol_coordinate_} position default current position
* @param {number} zoom default current map zoom
* @param {bool} permanent prevent from deletion, default false
*/
ol.control.GeoBookmark.prototype.addBookmark = function(name, position, zoom, permanent)
{
if (!name) return;
var bmark = this.getBookmarks();
// Don't override permanent bookmark
if (bmark[name] && bmark[name].permanent) return;
// Create or override
bmark[name] = {
pos: position || this.getMap().getView().getCenter(),
zoom: zoom || this.getMap().getView().getZoom(),
permanent: !!permanent
};
this.setBookmarks(bmark);
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Control bar for OL3
* The control bar is a container for other controls. It can be used to create toolbars.
* Control bars can be nested and combined with ol.control.Toggle to handle activate/deactivate.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {String} options.className class of the control
* @param {String} options.centerLabel label for center button, default center
*/
ol.control.GeolocationBar = function(options) {
if (!options) options = {};
options.className = options.className || 'ol-geobar';
ol.control.Bar.call(this, options);
this.setPosition(options.position || 'bottom-right');
var element = $(this.element);
// Geolocation draw interaction
var interaction = new ol.interaction.GeolocationDraw({
source: options.source,
zoom: options.zoom,
followTrack: true,
minAccuracy: options.minAccuracy || 10000
});
this._geolocBt = new ol.control.Toggle ({
className: 'geolocBt',
interaction: interaction,
onToggle: function(b) {
interaction.pause(true);
interaction.setFollowTrack(true);
element.removeClass('pauseTrack');
}
});
this.addControl(this._geolocBt);
this._geolocBt.setActive(false);
// Buttons
var bar = new ol.control.Bar();
this.addControl(bar);
var centerBt = new ol.control.TextButton ({
className: 'centerBt',
html: options.centerLabel ||'center',
handleClick: function(b) {
interaction.setFollowTrack('auto');
}
});
bar.addControl(centerBt);
var startBt = new ol.control.Button ({
className: 'startBt',
handleClick: function(){
interaction.pause(false);
interaction.setFollowTrack('auto');
element.addClass('pauseTrack');
}
});
bar.addControl(startBt);
var pauseBt = new ol.control.Button ({
className: 'pauseBt',
handleClick: function(){
interaction.pause(true);
interaction.setFollowTrack('auto');
element.removeClass('pauseTrack');
}
});
bar.addControl(pauseBt);
interaction.on('follow', function(e) {
if (e.following) {
element.removeClass('centerTrack');
} else {
element.addClass('centerTrack');
}
});
// Activate
this._geolocBt.on('change:active', function(e) {
if (e.active) {
element.addClass('ol-active');
} else {
element.removeClass('ol-active');
}
});
};
ol.inherits(ol.control.GeolocationBar, ol.control.Bar);
/** Get the ol.interaction.GeolocationDraw associatedwith the bar
*
*/
ol.control.GeolocationBar.prototype.getInteraction = function () {
return this._geolocBt.getInteraction();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* OpenLayers 3 lobe Overview Control.
* The globe can rotate with map (follow.)
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {boolean} follow follow the map when center change, default false
* @param {top|bottom-left|right} align position as top-left, etc.
* @param {Array<ol.layer>} layers list of layers to display on the globe
* @param {ol.style.Style | Array.<ol.style.Style> | undefined} style style to draw the position on the map , default a marker
*/
ol.control.Globe = function(opt_options)
{ var options = opt_options || {};
var self = this;
// API
var element;
if (options.target)
{ element = $("<div>");
this.panel_ = $(options.target);
}
else
{ element = $("<div>").addClass('ol-globe ol-unselectable ol-control');
if (/top/.test(options.align)) element.addClass('ol-control-top');
if (/right/.test(options.align)) element.addClass('ol-control-right');
this.panel_ = $("<div>").addClass("panel")
.appendTo(element);
this.pointer_ = $("<div>").addClass("ol-pointer")
.appendTo(element);
}
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
// http://openlayers.org/en/latest/examples/sphere-mollweide.html ???
// Create a globe map
this.ovmap_ = new ol.Map(
{ controls: new ol.Collection(),
interactions: new ol.Collection(),
target: this.panel_.get(0),
view: new ol.View
({ zoom: 0,
center: [0,0]
}),
layers: options.layers
});
setTimeout (function()
{ self.ovmap_.updateSize();
}, 0);
this.set('follow', options.follow || false);
// Cache extent
this.extentLayer = new ol.layer.Vector(
{ name: 'Cache extent',
source: new ol.source.Vector(),
style: options.style || [new ol.style.Style(
{ image: new ol.style.Circle(
{ fill: new ol.style.Fill({
color: 'rgba(255,0,0, 1)'
}),
stroke: new ol.style.Stroke(
{ width: 7,
color: 'rgba(255,0,0, 0.8)'
}),
radius: 5
})
}
)]
})
this.ovmap_.addLayer(this.extentLayer);
};
ol.inherits(ol.control.Globe, ol.control.Control);
/**
* Set the map instance the control associated with.
* @param {ol.Map} map The map instance.
*/
ol.control.Globe.prototype.setMap = function(map) {
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
// Get change (new layer added or removed)
if (map)
{ this._listener = map.getView().on('propertychange', this.setView.bind(this));
this.setView();
}
};
/** Set the globe center with the map center
*/
ol.control.Globe.prototype.setView = function()
{ if (this.getMap() && this.get('follow'))
{ this.setCenter(this.getMap().getView().getCenter());
}
}
/** Get globe map
* @return {ol.Map}
*/
ol.control.Globe.prototype.getGlobe = function()
{ return this.ovmap_;
}
/** Show/hide the globe
*/
ol.control.Globe.prototype.show = function(b)
{ if (b!==false) $(this.element).removeClass("ol-collapsed");
else $(this.element).addClass("ol-collapsed");
this.ovmap_.updateSize();
}
/** Set position on the map
* @param {top|bottom-left|right} align
*/
ol.control.Globe.prototype.setPosition = function(align)
{ if (/top/.test(align)) $(this.element).addClass("ol-control-top");
else $(this.element).removeClass("ol-control-top");
if (/right/.test(align)) $(this.element).addClass("ol-control-right");
else $(this.element).removeClass("ol-control-right");
}
/** Set the globe center
* @param {_ol_coordinate_} center the point to center to
* @param {boolean} show true to show a pointer
*/
ol.control.Globe.prototype.setCenter = function (center, show)
{ var self = this;
this.pointer_.addClass("hidden");
if (center)
{ var map = this.ovmap_;
var p = map.getPixelFromCoordinate(center);
var h = $(this.element).height();
setTimeout(function() {
self.pointer_.css({ 'top': Math.min(Math.max(p[1],0),h) , 'left': "50%" } )
.removeClass("hidden");
}, 800);
map.getView().animate({ center: [center[0],0] });
}
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Draw a graticule on the map.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} _ol_control_ options.
* - projection {ol.projectionLike} projection to use for the graticule, default EPSG:4326
* - maxResolution {number} max resolution to display the graticule
* - style {ol.style.Style} Style to use for drawing the graticule, default black.
* - step {number} step beetween lines (in proj units), default 1
* - stepCoord {number} show a coord every stepCoord, default 1
* - spacing {number} spacing beetween lines (in px), default 40px
* - borderWidth {number} width of the border (in px), default 5px
* - margin {number} margin of the border (in px), default 0px
*/
ol.control.Graticule = function(options)
{ var self = this;
if (!options) options = {};
// Initialize parent
var elt = document.createElement("div");
elt.className = "ol-graticule ol-unselectable ol-hidden";
ol.control.Control.call(this, { element: elt });
this.set('projection', options.projection || 'EPSG:4326');
// Use to limit calculation
var p = new ol.proj.Projection({code:this.get('projection')});
var m = p.getMetersPerUnit();
this.fac = 1;
while (m/this.fac>10)
{ this.fac *= 10;
}
this.fac = 10000/this.fac;
this.set('maxResolution', options.maxResolution || Infinity);
this.set('step', options.step || 0.1);
this.set('stepCoord', options.stepCoord || 1);
this.set('spacing', options.spacing || 40);
this.set('margin', options.margin || 0);
this.set('borderWidth', options.borderWidth || 5);
this.set('stroke', options.stroke!==false);
this.formatCoord = options.formatCoord || function(c){return c;};
if (options.style instanceof ol.style.Style) this.style = options.style;
else this.style = new ol.style.Style(
{ stroke: new ol.style.Stroke({ color:"#000", width:1 }),
fill: new ol.style.Fill({ color: "#fff" }),
text: new ol.style.Text(
{ stroke: new ol.style.Stroke({ color:"#fff", width:2 }),
fill: new ol.style.Fill({ color:"#000" }),
})
});
};
ol.inherits(ol.control.Graticule, ol.control.Control);
/**
* Remove the control from its current map and attach it to the new map.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.control.Graticule.prototype.setMap = function (map) {
var oldmap = this.getMap();
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (oldmap) oldmap.renderSync();
// Get change (new layer added or removed)
if (map) {
this._listener = map.on('postcompose', this.drawGraticule_.bind(this));
}
};
ol.control.Graticule.prototype.setStyle = function (style)
{ this.style = style;
};
ol.control.Graticule.prototype.getStyle = function (style)
{ return style;
};
ol.control.Graticule.prototype.drawGraticule_ = function (e)
{ if (this.get('maxResolution')<e.frameState.viewState.resolution) return;
var ctx = e.context;
var canvas = ctx.canvas;
var ratio = e.frameState.pixelRatio;
var w = canvas.width/ratio;
var h = canvas.height/ratio;
var proj = this.get('projection');
var map = this.getMap();
var bbox =
[ map.getCoordinateFromPixel([0,0]),
map.getCoordinateFromPixel([w,0]),
map.getCoordinateFromPixel([w,h]),
map.getCoordinateFromPixel([0,h])
];
var xmax = -Infinity;
var xmin = Infinity;
var ymax = -Infinity;
var ymin = Infinity;
for (var i=0, c; c=bbox[i]; i++)
{ bbox[i] = ol.proj.transform (c, map.getView().getProjection(), proj);
xmax = Math.max (xmax, bbox[i][0]);
xmin = Math.min (xmin, bbox[i][0]);
ymax = Math.max (ymax, bbox[i][1]);
ymin = Math.min (ymin, bbox[i][1]);
}
var spacing = this.get('spacing');
var step = this.get('step');
var step2 = this.get('stepCoord');
var borderWidth = this.get('borderWidth');
var margin = this.get('margin');
// Limit max line draw
var ds = (xmax-xmin)/step*spacing;
if (ds>w)
{ var dt = Math.round((xmax-xmin)/w*spacing /step);
step *= dt;
if (step>this.fac) step = Math.round(step/this.fac)*this.fac;
}
xmin = (Math.floor(xmin/step))*step -step;
ymin = (Math.floor(ymin/step))*step -step;
xmax = (Math.floor(xmax/step))*step +2*step;
ymax = (Math.floor(ymax/step))*step +2*step;
var extent = ol.proj.get(proj).getExtent();
if (extent)
{ if (xmin < extent[0]) xmin = extent[0];
if (ymin < extent[1]) ymin = extent[1];
if (xmax > extent[2]) xmax = extent[2]+step;
if (ymax > extent[3]) ymax = extent[3]+step;
}
var hasLines = this.style.getStroke() && this.get("stroke");
var hasText = this.style.getText();
var hasBorder = this.style.getFill();
ctx.save();
ctx.scale(ratio,ratio);
ctx.beginPath();
ctx.rect(margin, margin, w-2*margin, h-2*margin);
ctx.clip();
ctx.beginPath();
var txt = {top:[],left:[],bottom:[], right:[]};
for (var x=xmin; x<xmax; x += step)
{ var p0 = ol.proj.transform ([x, ymin], proj, map.getView().getProjection());
p0 = map.getPixelFromCoordinate(p0);
if (hasLines) ctx.moveTo(p0[0], p0[1]);
var p = p0;
for (var y=ymin+step; y<=ymax; y+=step)
{ var p1 = ol.proj.transform ([x, y], proj, map.getView().getProjection());
p1 = map.getPixelFromCoordinate(p1);
if (hasLines) ctx.lineTo(p1[0], p1[1]);
if (p[1]>0 && p1[1]<0) txt.top.push([x, p]);
if (p[1]>h && p1[1]<h) txt.bottom.push([x,p]);
p = p1;
}
}
for (var y=ymin; y<ymax; y += step)
{ var p0 = ol.proj.transform ([xmin, y], proj, map.getView().getProjection());
p0 = map.getPixelFromCoordinate(p0);
if (hasLines) ctx.moveTo(p0[0], p0[1]);
var p = p0;
for (var x=xmin+step; x<=xmax; x+=step)
{ var p1 = ol.proj.transform ([x, y], proj, map.getView().getProjection());
p1 = map.getPixelFromCoordinate(p1);
if (hasLines) ctx.lineTo(p1[0], p1[1]);
if (p[0]<0 && p1[0]>0) txt.left.push([y,p]);
if (p[0]<w && p1[0]>w) txt.right.push([y,p]);
p = p1;
}
}
if (hasLines)
{ ctx.strokeStyle = this.style.getStroke().getColor();
ctx.lineWidth = this.style.getStroke().getWidth();
ctx.stroke();
}
// Draw text
if (hasText)
{
ctx.fillStyle = this.style.getText().getFill().getColor();
ctx.strokeStyle = this.style.getText().getStroke().getColor();
ctx.lineWidth = this.style.getText().getStroke().getWidth();
ctx.textAlign = 'center';
ctx.textBaseline = 'hanging';
var tf;
var offset = (hasBorder ? borderWidth : 0) + margin + 2;
for (var i=0, t; t = txt.top[i]; i++) if (!(Math.round(t[0]/this.get('step'))%step2))
{ tf = this.formatCoord(t[0]);
ctx.strokeText(tf, t[1][0], offset);
ctx.fillText(tf, t[1][0], offset);
}
ctx.textBaseline = 'alphabetic';
for (var i=0, t; t = txt.bottom[i]; i++) if (!(Math.round(t[0]/this.get('step'))%step2))
{ tf = this.formatCoord(t[0]);
ctx.strokeText(tf, t[1][0], h-offset);
ctx.fillText(tf, t[1][0], h-offset);
}
ctx.textBaseline = 'middle';
ctx.textAlign = 'left';
for (var i=0, t; t = txt.left[i]; i++) if (!(Math.round(t[0]/this.get('step'))%step2))
{ tf = this.formatCoord(t[0]);
ctx.strokeText(tf, offset, t[1][1]);
ctx.fillText(tf, offset, t[1][1]);
}
ctx.textAlign = 'right';
for (var i=0, t; t = txt.right[i]; i++) if (!(Math.round(t[0]/this.get('step'))%step2))
{ tf = this.formatCoord(t[0]);
ctx.strokeText(tf, w-offset, t[1][1]);
ctx.fillText(tf, w-offset, t[1][1]);
}
}
// Draw border
if (hasBorder)
{ var fillColor = this.style.getFill().getColor();
var color, stroke;
if (stroke = this.style.getStroke())
{ color = this.style.getStroke().getColor();
}
else
{ color = fillColor;
fillColor = "#fff";
}
ctx.strokeStyle = color;
ctx.lineWidth = stroke ? stroke.getWidth() : 1;
//
for (var i=1; i<txt.top.length; i++)
{ ctx.beginPath();
ctx.rect(txt.top[i-1][1][0], margin, txt.top[i][1][0]-txt.top[i-1][1][0], borderWidth);
ctx.fillStyle = Math.round(txt.top[i][0]/step)%2 ? color: fillColor;
ctx.fill();
ctx.stroke();
}
for (var i=1; i<txt.bottom.length; i++)
{ ctx.beginPath();
ctx.rect(txt.bottom[i-1][1][0], h-borderWidth-margin, txt.bottom[i][1][0]-txt.bottom[i-1][1][0], borderWidth);
ctx.fillStyle = Math.round(txt.bottom[i][0]/step)%2 ? color: fillColor;
ctx.fill();
ctx.stroke();
}
for (var i=1; i<txt.left.length; i++)
{ ctx.beginPath();
ctx.rect(margin, txt.left[i-1][1][1], borderWidth, txt.left[i][1][1]-txt.left[i-1][1][1]);
ctx.fillStyle = Math.round(txt.left[i][0]/step)%2 ? color: fillColor;
ctx.fill();
ctx.stroke();
}
for (var i=1; i<txt.right.length; i++)
{ ctx.beginPath();
ctx.rect(w-borderWidth-margin, txt.right[i-1][1][1], borderWidth, txt.right[i][1][1]-txt.right[i-1][1][1]);
ctx.fillStyle = Math.round(txt.right[i][0]/step)%2 ? color: fillColor;
ctx.fill();
ctx.stroke();
}
ctx.beginPath();
ctx.fillStyle = color;
ctx.rect(margin,margin, borderWidth, borderWidth);
ctx.rect(margin,h-borderWidth-margin, borderWidth,borderWidth);
ctx.rect(w-borderWidth-margin,margin, borderWidth, borderWidth);
ctx.rect(w-borderWidth-margin,h-borderWidth-margin, borderWidth,borderWidth);
ctx.fill();
}
ctx.restore();
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Draw a grid reference on the map and add an index.
*
* @constructor
* @extends {ol.control.Control}
* @fires select
* @param {Object=} Control options.
* - style {ol.style.Style} Style to use for drawing the grid (stroke and text), default black.
* - maxResolution {number} max resolution to display the graticule
* - extent {ol.extent} extent of the grid, required
* - size {ol.size} number of lines and cols, required
* - margin {number} margin to display text (in px), default 0px
* - source {ol.source.Vector} source to use for the index, default none (use setIndex to reset the index)
* - property {string | function} a property to display in the index or a function that takes a feature and return the name to display in the index, default 'name'.
* - sortFeatures {function|undefined} sort function to sort 2 features in the index, default sort on property option
* - indexTitle {function|undefined} a function that takes a feature and return the title to display in the index, default the first letter of property option
* - filterLabel {string} label to display in the search bar, default 'filter'
*/
ol.control.GridReference = function(options)
{ var self = this;
if (!options) options = {};
// Initialize parent
var elt = document.createElement("div");
elt.className = (!options.target ? "ol-control ":"") +"ol-gridreference ol-unselectable "+(options.className||"");
ol.control.Control.call(this,
{ element: elt,
target: options.target
});
if (typeof (options.property)=='function') this.getFeatureName = options.property;
if (typeof (options.sortFeatures)=='function') this.sortFeatures = options.sortFeatures;
if (typeof (options.indexTitle)=='function') this.indexTitle = options.indexTitle;
// Set index using the source
this.source_ = options.source;
if (options.source)
{ this.setIndex(options.source.getFeatures(), options);
// reload on ready
options.source.once('change',function(e)
{ if (options.source.getState() === 'ready')
{ this.setIndex(options.source.getFeatures(), options);
}
}.bind(this));
};
// Options
this.set('maxResolution', options.maxResolution || Infinity);
this.set('extent', options.extent);
this.set('size', options.size);
this.set('margin', options.margin || 0);
this.set('property', options.property || 'name');
this.set('filterLabel', options.filterLabel || 'filter');
if (options.style instanceof ol.style.Style) this.style = options.style;
else this.style = new ol.style.Style(
{ stroke: new ol.style.Stroke({ color:"#000", width:1 }),
text: new ol.style.Text(
{ font: "bold 14px Arial",
stroke: new ol.style.Stroke({ color:"#fff", width:2 }),
fill: new ol.style.Fill({ color:"#000" }),
})
});
};
ol.inherits(ol.control.GridReference, ol.control.Control);
/** Returns the text to be displayed in the index
* @param {ol.Feature} f the feature
* @return {string} the text to be displayed in the index
* @api
*/
ol.control.GridReference.prototype.getFeatureName = function (f)
{ return f.get(this.get('property')||'name');
};
/** Sort function
* @param {ol.Feature} a first feature
* @param {ol.Feature} b second feature
* @return {Number} 0 if a==b, -1 if a<b, 1 if a>b
* @api
*/
ol.control.GridReference.prototype.sortFeatures = function (a,b)
{ return (this.getFeatureName(a) == this.getFeatureName(b)) ? 0 : (this.getFeatureName(a) < this.getFeatureName(b)) ? -1 : 1;
};
/** Get the feature title
* @param {ol.Feature} f
* @return the first letter of the eature name (getFeatureName)
* @api
*/
ol.control.GridReference.prototype.indexTitle = function (f)
{ return this.getFeatureName(f).charAt(0);
};
/** Display features in the index
* @param { Array<ol.Feature> | ol.Collection<ol.Feature> } features
*/
ol.control.GridReference.prototype.setIndex = function (features)
{ if (!this.getMap()) return;
var self = this;
if (features.getArray) features = features.getArray();
features.sort ( function(a,b) { return self.sortFeatures(a,b); } );
var elt = $(this.element).html("");
var search = $("<input>").attr('type', 'search')
.attr('placeholder', this.get('filterLabel') || 'filter')
.on('search keyup', function()
{ var v = $(this).val().replace(/^\*/,'');
// console.log(v)
var r = new RegExp (v, 'i');
$('li',ul).each(function()
{ var self = $(this);
if (self.hasClass('ol-title')) self.show();
else
{ if (r.test($('.ol-name',self).text())) self.show();
else self.hide();
}
});
$("li.ol-title", ul).each(function()
{ var nextVisible = $(this).nextAll("li:visible").first()
if (nextVisible.length && !nextVisible.hasClass('ol-title')) $(this).show();
else $(this).hide();
});
})
.appendTo(elt);
var ul = $("<ul>").appendTo(elt);
var r, title;
for (var i=0, f; f=features[i]; i++)
{ r = this.getReference(f.getGeometry().getFirstCoordinate());
if (r)
{ var name = this.getFeatureName(f);
var c = this.indexTitle(f);
if (c != title)
{ $("<li>").addClass('ol-title').text(c).appendTo(ul);
}
title = c;
$("<li>").append($("<span>").addClass("ol-name").text(name))
.append($("<span>").addClass("ol-ref").text(r))
.data ('feature', f)
.click(function()
{ self.dispatchEvent({ type:"select", feature:$(this).data('feature') });
})
.appendTo(ul);
}
}
};
/** Get reference for a coord
* @param {ol.coordinate} coords
* @return {string} the reference
*/
ol.control.GridReference.prototype.getReference = function (coords)
{ if (!this.getMap()) return;
var extent = this.get('extent');
var size = this.get('size');
var dx = Math.floor ( (coords[0] - extent[0]) / (extent[2]- extent[0]) * size[0] );
if (dx<0 || dx>=size[0]) return "";
var dy = Math.floor ( (extent[3] - coords[1]) / (extent[3]- extent[1]) * size[1] );
if (dy<0 || dy>=size[1]) return "";
return String.fromCharCode(65+dx)+dy;
};
/**
* Remove the control from its current map and attach it to the new map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.control.GridReference.prototype.setMap = function (map)
{ var oldmap = this.getMap();
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (oldmap) oldmap.renderSync();
// Get change (new layer added or removed)
if (map)
{ this._listener = map.on('postcompose', this.drawGrid_.bind(this));
if (this.source_) this.setIndex(this.source_.getFeatures());
}
};
/** Set style
* @param {ol.style.Style} style
*/
ol.control.GridReference.prototype.setStyle = function (style)
{ this.style = style;
};
/** Get style
* @return {ol.style.Style} style
*/
ol.control.GridReference.prototype.getStyle = function ()
{ return style;
};
/** Draw the grid
* @param {ol.event} e postcompose event
* @private
*/
ol.control.GridReference.prototype.drawGrid_ = function (e)
{ if (this.get('maxResolution')<e.frameState.viewState.resolution) return;
var ctx = e.context;
var canvas = ctx.canvas;
var ratio = e.frameState.pixelRatio;
var w = canvas.width/ratio;
var h = canvas.height/ratio;
var extent = this.get('extent');
var size = this.get('size');
var map = this.getMap();
var ex = ol.extent.boundingExtent([map.getPixelFromCoordinate([extent[0],extent[1]]), map.getPixelFromCoordinate([extent[2],extent[3]])]);
var p0 = [ex[0],ex[1]];
var p1 = [ex[2],ex[3]];
var dx = (p1[0]-p0[0])/size[0];
var dy = (p1[1]-p0[1])/size[1];
ctx.save();
var margin = this.get('margin');
ctx.scale(ratio,ratio);
ctx.strokeStyle = this.style.getStroke().getColor();
ctx.lineWidth = this.style.getStroke().getWidth();
// Draw grid
ctx.beginPath();
for (var i=0; i<=size[0]; i++)
{ ctx.moveTo(p0[0]+i*dx, p0[1]);
ctx.lineTo(p0[0]+i*dx, p1[1]);
}
for (var i=0; i<=size[1]; i++)
{ ctx.moveTo(p0[0], p0[1]+i*dy);
ctx.lineTo(p1[0], p0[1]+i*dy);
}
ctx.stroke();
// Draw text
ctx.font = this.style.getText().getFont();
ctx.fillStyle = this.style.getText().getFill().getColor();
ctx.strokeStyle = this.style.getText().getStroke().getColor();
var lw = ctx.lineWidth = this.style.getText().getStroke().getWidth();
var spacing = margin +lw;
ctx.textAlign = 'center';
var letter, x, y;
for (var i=0; i<size[0]; i++)
{ letter = String.fromCharCode(65+i);
x = p0[0]+i*dx+dx/2;
y = p0[1]-spacing;
if (y<0)
{ y = spacing;
ctx.textBaseline = 'hanging';
}
else ctx.textBaseline = 'alphabetic';
ctx.strokeText(letter, x, y);
ctx.fillText(letter, x, y);
y = p1[1]+spacing;
if (y>h)
{ y = h-spacing;
ctx.textBaseline = 'alphabetic';
}
else ctx.textBaseline = 'hanging';
ctx.strokeText(letter, x, y);
ctx.fillText(letter, x, y);
}
ctx.textBaseline = 'middle';
for (var i=0; i<size[0]; i++)
{ y = p0[1]+i*dy+dy/2;
ctx.textAlign = 'right';
x = p0[0] - spacing;
if (x<0)
{ x = spacing;
ctx.textAlign = 'left';
}
else ctx.textAlign = 'right';
ctx.strokeText(i, x, y);
ctx.fillText(i, x, y);
x = p1[0] + spacing;
if (x>w)
{ x = w-spacing;
ctx.textAlign = 'right';
}
else ctx.textAlign = 'left';
ctx.strokeText(i, x, y);
ctx.fillText(i, x, y);
}
ctx.restore();
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* OpenLayers 3 Layer Switcher Control.
* @require jQuery
*
* @constructor
* @extends {ol.control.LayerSwitcher}
* @param {Object=} options Control options.
*/
ol.control.LayerPopup = function(options)
{ options = options || {};
options.switcherClass="ol-layerswitcher-popup";
if (options.mouseover!==false) options.mouseover=true;
ol.control.LayerSwitcher.call(this, options);
};
ol.inherits(ol.control.LayerPopup, ol.control.LayerSwitcher);
/** Disable overflow
*/
ol.control.LayerPopup.prototype.overflow = function(){};
/** Render a list of layer
* @param {elt} element to render
* @layers {Array{ol.layer}} list of layer to show
* @api stable
*/
ol.control.LayerPopup.prototype.drawList = function(ul, layers)
{ var self=this;
var setVisibility = function(e)
{ e.preventDefault();
var l = $(this).data("layer");
self.switchLayerVisibility(l,layers);
};
layers.forEach(function(layer)
{ if (self.displayInLayerSwitcher(layer))
{ var d = $("<li>").text(layer.get("title") || layer.get("name"))
.data ('layer', layer)
.click (setVisibility)
.on ("touchstart", setVisibility)
.appendTo(ul);
if (self.testLayerVisibility(layer)) d.addClass("ol-layer-hidden");
if (layer.getVisible()) d.addClass("select");
}
});
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc OpenLayers 3 Layer Switcher Control.
* @require layer.getPreview
* @require jQuery
*
* @constructor
* @extends {ol.control.LayerSwitcher}
* @param {Object=} options Control options.
*/
ol.control.LayerSwitcherImage = function(options)
{ options = options || {};
options.switcherClass="ol-layerswitcher-image";
if (options.mouseover!==false) options.mouseover=true;
ol.control.LayerSwitcher.call(this, options);
};
ol.inherits(ol.control.LayerSwitcherImage, ol.control.LayerSwitcher);
/** Render a list of layer
* @param {elt} element to render
* @layers {Array{ol.layer}} list of layer to show
* @api stable
*/
ol.control.LayerSwitcherImage.prototype.drawList = function(ul, layers)
{ var self = this;
var setVisibility = function(e)
{ e.preventDefault();
var l = $(this).data("layer");
self.switchLayerVisibility(l,layers);
if (e.type=="touchstart") $(self.element).addClass("ol-collapsed");
};
ul.css("height","auto");
layers.forEach(function(layer)
{ if (self.displayInLayerSwitcher(layer))
{ var prev = layer.getPreview ? layer.getPreview() : ["none"];
var d = $("<li>").addClass("ol-imgcontainer")
.data ('layer', layer)
.click (setVisibility)
.on ("touchstart", setVisibility);
if (layer.getVisible()) d.addClass("select");
for (var k=0; k<prev.length; k++)
{ $("<img>").attr('src', prev[k])
.appendTo(d);
}
$("<p>").text(layer.get("title") || layer.get("name")).appendTo(d);
if (self.testLayerVisibility(layer)) d.addClass("ol-layer-hidden");
d.appendTo(ul);
}
});
};
/** Disable overflow
*/
ol.control.LayerSwitcherImage.prototype.overflow = function(){};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Control overlay for OL3
* The overlay control is a control that display an overlay over the map
*
* @constructor
* @extends {ol.control.Control}
* @fire change:visible
* @param {Object=} options Control options.
* - className {String} class of the control
* - hideOnClick {bool} hide the control on click, default false
* - closeBox {bool} add a closeBox to the control, default false
*/
ol.control.Overlay = function(options)
{ if (!options) options={};
var element = $("<div>").addClass('ol-unselectable ol-overlay');
if (options.className) element.addClass(options.className);
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
var self = this;
if (options.hideOnClick) element.click(function(){self.hide();});
this.set("closeBox", options.closeBox);
this._timeout = false;
this.setContent (options.content);
};
ol.inherits(ol.control.Overlay, ol.control.Control);
/** Set the content of the overlay
* @param {string} html the html to display in the control (or a jQuery object)
*/
ol.control.Overlay.prototype.setContent = function (html)
{ var self = this;
if (html)
{ var elt = $(this.element);
elt.html(html);
if (this.get("closeBox"))
{ var cb = $("<div>").addClass("ol-closebox")
.click(function(){self.hide();});
elt.prepend(cb);
}
};
};
/** Set the control visibility
* @param {string} html the html to display in the control (or a jQuery object)
* @param {ol.coordinate} coord coordinate of the top left corner of the control to start from
*/
ol.control.Overlay.prototype.show = function (html, coord)
{ var self = this;
var elt = $(this.element).show();
if (coord)
{ this.center_ = this.getMap().getPixelFromCoordinate(coord);
elt.css({"top":this.center_[1], "left":this.center_[0] });
}
else
{
//TODO: Do fix from hkollmann pull request
this.center_ = false;
elt.css({"top":"", "left":"" });
}
this.setContent(html);
if (this._timeout) clearTimeout(this._timeout);
this._timeout = setTimeout(function()
{ elt.addClass("ol-visible")
.css({ "top":"", "left":"" });
self.dispatchEvent({ type:'change:visible', visible:true, element: self.element });
}, 10);
self.dispatchEvent({ type:'change:visible', visible:false, element: self.element });
};
/** Set the control visibility hidden
*/
ol.control.Overlay.prototype.hide = function ()
{ var elt = $(this.element).removeClass("ol-visible");
if (this.center_)
{ elt.css({"top":this.center_[1], "left":this.center_[0] })
this.center_ = false;
}
if (this._timeout) clearTimeout(this._timeout);
this._timeout = setTimeout(function(){ elt.hide(); }, 500);
this.dispatchEvent({ type:'change:visible', visible:false, element: this.element });
};
/** Toggle control visibility
*/
ol.control.Overlay.prototype.toggle = function ()
{ if (this.getVisible()) this.hide();
else this.show();
}
/** Get the control visibility
* @return {boolean} b
*/
ol.control.Overlay.prototype.getVisible = function ()
{ return ($(this.element).css('display') != 'none');
};
/** Change class name
* @param {String} className
*/
ol.control.Overlay.prototype.setClass = function (className)
{ var vis = $(this.element).hasClass("ol-visible");
$(this.element).removeClass().addClass('ol-unselectable ol-overlay'+(vis?" ol-visible ":" ")+className);
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* OpenLayers 3 Layer Overview Control.
* The overview can rotate with map.
* Zoom levels are configurable.
* Click on the overview will center the map.
* Change width/height of the overview trough css.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options Control options.
* @param {ol.ProjectionLike} options.projection The projection. Default is EPSG:3857 (Spherical Mercator).
* @param {Number} options.minZoom default 0
* @param {Number} options.maxZoom default 18
* @param {boolean} options.rotation enable rotation, default false
* @param {top|bottom-left|right} options.align position
* @param {Array<ol.layer>} options.layers list of layers
* @param {ol.style.Style | Array.<ol.style.Style> | undefined} options.style style to draw the map extent on the overveiw
* @param {bool|elastic} options.panAnimation use animation to center map on click, default true
*/
ol.control.Overview = function(options)
{ options = options || {};
var self = this;
// API
this.minZoom = options.minZoom || 0;
this.maxZoom = options.maxZoom || 18;
this.rotation = options.rotation;
var element;
if (options.target)
{ element = $("<div>");
this.panel_ = $(options.target);
}
else
{ element = $("<div>").addClass('ol-overview ol-unselectable ol-control ol-collapsed');
if (/top/.test(options.align)) element.addClass('ol-control-top');
if (/right/.test(options.align)) element.addClass('ol-control-right');
$("<button>").on("touchstart", function(e){ self.toggleMap(); e.preventDefault(); })
.attr('type','button')
.click (function(){self.toggleMap()})
.appendTo(element);
this.panel_ = $("<div>").addClass("panel")
.appendTo(element);
}
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
// Create a overview map
this.ovmap_ = new ol.Map(
{ controls: new ol.Collection(),
interactions: new ol.Collection(),
target: this.panel_.get(0),
view: new ol.View
({ zoom: 14,
center: [270148, 6247782],
projection: options.projection
}),
layers: options.layers
});
this.oview_ = this.ovmap_.getView();
// Cache extent
this.extentLayer = new ol.layer.Vector(
{ name: 'Cache extent',
source: new ol.source.Vector(),
style: options.style || [new ol.style.Style(
{ image: new ol.style.Circle(
{ fill: new ol.style.Fill({
color: 'rgba(255,0,0, 1)'
}),
stroke: new ol.style.Stroke(
{ width: 7,
color: 'rgba(255,0,0, 0.8)'
}),
radius: 5
}),
stroke: new ol.style.Stroke(
{ width: 5,
color: "rgba(255,0,0,0.8)"
})
}
)]
})
this.ovmap_.addLayer(this.extentLayer);
/** Elastic bounce
* @param {Int} bounce number of bounce
* @param {Number} amplitude amplitude of the bounce [0,1]
* @return {Number}
*/
ol.easing.bounceFn = function (bounce, amplitude)
{ var a = (2*bounce+1) * Math.PI/2;
var b = amplitude>0 ? -1/amplitude : -100;
var c = - Math.cos(a) * Math.pow(2, b);
return function(t)
{ t = 1-Math.cos(t*Math.PI/2);
return 1 + Math.abs( Math.cos(a*t) ) * Math.pow(2, b*t) + c*t;
}
}
/** Elastic bounce
* @param {Int} bounce number of bounce
* @param {Number} amplitude amplitude of the bounce [0,1]
* @return {Number}
*/
ol.easing.elasticFn = function (bounce, amplitude)
{ var a = 3*bounce * Math.PI/2;
var b = amplitude>0 ? -1/amplitude : -100;
var c = Math.cos(a) * Math.pow(2, b);
return function(t)
{ t = 1-Math.cos(t*Math.PI/2);
return 1 - Math.cos(a*t) * Math.pow(2, b*t) + c*t;
}
}
// Click on the preview center the map
this.ovmap_.addInteraction (new ol.interaction.Pointer({
handleDownEvent: function(evt) {
if (options.panAnimation !==false) {
if (options.panAnimation=="elastic" || options.elasticPan) {
self.getMap().getView().animate({
center: evt.coordinate,
easing: ol.easing.elasticFn(2,0.3),
duration: 1000
});
} else {
self.getMap().getView().animate({
center: evt.coordinate,
duration: 300
});
}
}
else self.getMap().getView().setCenter(evt.coordinate);
return false;
}
}));
};
ol.inherits(ol.control.Overview, ol.control.Control);
/** Get overview map
* @return {ol.Map}
*/
ol.control.Overview.prototype.getOverviewMap = function()
{ return this.ovmap_;
};
/** Toggle overview map
*/
ol.control.Overview.prototype.toggleMap = function()
{ $(this.element).toggleClass("ol-collapsed");
this.ovmap_.updateSize();
};
/** Set overview map position
* @param {top|bottom-left|right}
*/
ol.control.Overview.prototype.setPosition = function(align)
{ if (/top/.test(align)) $(this.element).addClass("ol-control-top");
else $(this.element).removeClass("ol-control-top");
if (/right/.test(align)) $(this.element).addClass("ol-control-right");
else $(this.element).removeClass("ol-control-right");
};
/**
* Set the map instance the control associated with.
* @param {ol.Map} map The map instance.
*/
ol.control.Overview.prototype.setMap = function(map) {
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (map)
{ this._listener = map.getView().on('propertychange', this.setView.bind(this));
this.setView();
}
};
/** Calculate the extent of the map and draw it on the overview
*/
ol.control.Overview.prototype.calcExtent_ = function(extent)
{ var map = this.getMap();
if (!map) return;
var source = this.extentLayer.getSource();
source.clear();
var f = new ol.Feature();
var size = map.getSize();
var resolution = map.getView().getResolution();
var rotation = map.getView().getRotation();
var center = map.getView().getCenter();
if (!resolution) return;
var dx = resolution * size[0] / 2;
var dy = resolution * size[1] / 2;
var res2 = this.oview_.getResolution();
if (dx/res2>5 || dy/res2>5)
{ var cos = Math.cos(rotation);
var sin = Math.sin(rotation);
var i, x, y;
extent=[[-dx,-dy],[-dx,dy],[dx,dy],[dx,-dy]];
for (i = 0; i < 4; ++i)
{ x = extent[i][0];
y = extent[i][1];
extent[i][0] = center[0] + x * cos - y * sin;
extent[i][1] = center[1] + x * sin + y * cos;
}
f.setGeometry (new ol.geom.Polygon( [ extent ]));
}
else
{ f.setGeometry (new ol.geom.Point( center ));
}
source.addFeature(f);
};
/**
* @private
*/
ol.control.Overview.prototype.setView = function(e)
{ if (!e)
{ // refresh all
this.setView({key:'rotation'});
this.setView({key:'resolution'});
this.setView({key:'center'});
return;
}
// Set the view params
switch (e.key)
{ case 'rotation':
if (this.rotation) this.oview_.setRotation(this.getMap().getView().getRotation());
else if (this.oview_.getRotation()) this.oview_.setRotation(0);
break;
case 'center':
{ var mapExtent = this.getMap().getView().calculateExtent(this.getMap().getSize());
var extent = this.oview_.calculateExtent(this.ovmap_.getSize());
if (mapExtent[0]<extent[0] || mapExtent[1]<extent[1]
|| mapExtent[2]>extent[2] || mapExtent[3]>extent[3])
{ this.oview_.setCenter(this.getMap().getView().getCenter());
}
break;
}
case 'resolution':
{ var z = Math.round(this.getMap().getView().getZoom()/2)*2-4;
z = Math.min ( this.maxZoom, Math.max(this.minZoom, z) );
this.oview_.setZoom(z);
break;
}
default: break;
}
this.calcExtent_();
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Permalink Control.
*
* Add a `permalink`property to layers to be handled by the control (and added in the url).
* The layer's permalink property is used to name the layer in the url.
* The control must be added after all layer are inserted in the map to take them into acount.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} options
* @param {bool} options.urlReplace replace url or not, default true
* @param {integer} options.fixed number of digit in coords, default 6
* @param {bool} options.anchor use "#" instead of "?" in href
* @param {function} options.onclick a function called when control is clicked
*/
ol.control.Permalink = function(opt_options)
{ var options = opt_options || {};
var self = this;
var button = document.createElement('button');
this.replaceState_ = (options.urlReplace!==false);
this.fixed_ = options.fixed || 6;
this.hash_ = options.anchor ? "#" : "?";
function linkto()
{ if (typeof(options.onclick) == 'function') options.onclick(self.getLink());
else self.setUrlReplace(!self.replaceState_);
}
button.addEventListener('click', linkto, false);
button.addEventListener('touchstart', linkto, false);
var element = document.createElement('div');
element.className = (options.className || "ol-permalink") + " ol-unselectable ol-control";
element.appendChild(button);
ol.control.Control.call(this,
{ element: element,
target: options.target
});
this.on ('change', this.viewChange_.bind(this));
// Save search params
this.search_ = {};
var hash = document.location.hash || document.location.search;
if (hash)
{ hash = hash.replace(/(^#|^\?)/,"").split("&");
for (var i=0; i<hash.length; i++)
{ var t = hash[i].split("=");
switch(t[0])
{ case 'lon':
case 'lat':
case 'z':
case 'r':
case 'l': break;
default: this.search_[t[0]] = t[1];
}
}
}
// Decode permalink
this.setPosition();
};
ol.inherits(ol.control.Permalink, ol.control.Control);
/**
* Set the map instance the control associated with.
* @param {ol.Map} map The map instance.
*/
ol.control.Permalink.prototype.setMap = function(map) {
if (this._listener) {
ol.Observable.unByKey(this._listener.change);
ol.Observable.unByKey(this._listener.moveend);
}
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
// Get change
if (map)
{ this._listener = {
change: map.getLayerGroup().on('change', this.layerChange_.bind(this)),
moveend: map.on('moveend', this.viewChange_.bind(this))
};
this.setPosition();
}
};
/** Get layer given a permalink name (permalink propertie in the layer)
* @param {string} the permalink to search for
* @param {Array<ol.layer>|undefined} an array of layer to search in
* @return {ol.layer|false}
*/
ol.control.Permalink.prototype.getLayerByLink = function (id, layers)
{ if (!layers && this.getMap()) layers = this.getMap().getLayers().getArray();
for (var i=0; i<layers.length; i++)
{ if (layers[i].get('permalink') == id) return layers[i];
// Layer Group
if (layers[i].getLayers)
{ var li = this.getLayerByLink ( id, layers[i].getLayers().getArray() );
if (li) return li;
}
}
return false;
}
/** Set map position according to the current link
*/
ol.control.Permalink.prototype.setPosition = function()
{ var map = this.getMap();
if (!map) return;
var hash = document.location.hash || document.location.search;
if (!hash) return;
var param = {};
hash = hash.replace(/(^#|^\?)/,"").split("&");
for (var i=0; i<hash.length; i++)
{ var t = hash[i].split("=");
param[t[0]] = t[1];
}
var c = ol.proj.transform([Number(param.lon),Number(param.lat)], 'EPSG:4326', map.getView().getProjection());
if (c[0] && c[1]) map.getView().setCenter(c);
if (param.z) map.getView().setZoom(Number(param.z));
if (param.r) map.getView().setRotation(Number(param.r));
if (param.l)
{ var l = param.l.split("|");
// Reset layers
function resetLayers(layers)
{ if (!layers) layers = map.getLayers().getArray();
for (var i=0; i<layers.length; i++)
{ if (layers[i].get('permalink'))
{ layers[i].setVisible(false);
// console.log("hide "+layers[i].get('permalink'));
}
if (layers[i].getLayers)
{ resetLayers (layers[i].getLayers().getArray());
}
}
}
resetLayers();
for (var i=0; i<l.length; i++)
{ var t = l[i].split(":");
var li = this.getLayerByLink(t[0]);
var op = Number(t[1]);
if (li)
{ li.setOpacity(op);
li.setVisible(true);
}
}
}
}
/**
* Get the parameters added to the url. The object can be changed to add new values.
* @return {Object} a key value object added to the url as &key=value
* @api stable
*/
ol.control.Permalink.prototype.getUrlParams = function()
{ return this.search_;
}
/**
* Get the permalink
* @return {permalink}
*/
ol.control.Permalink.prototype.getLink = function()
{ var map = this.getMap();
var c = ol.proj.transform(map.getView().getCenter(), map.getView().getProjection(), 'EPSG:4326');
var z = map.getView().getZoom();
var r = map.getView().getRotation();
var l = this.layerStr_;
// Change anchor
var anchor = "lon="+c[0].toFixed(this.fixed_)+"&lat="+c[1].toFixed(this.fixed_)+"&z="+z+(r?"&r="+(Math.round(r*10000)/10000):"")+(l?"&l="+l:"");
for (var i in this.search_) anchor += "&"+i+"="+this.search_[i];
//return document.location.origin+document.location.pathname+this.hash_+anchor;
return document.location.protocol+"//"+document.location.host+document.location.pathname+this.hash_+anchor;
}
/**
* Enable / disable url replacement (replaceSate)
* @param {bool}
*/
ol.control.Permalink.prototype.setUrlReplace = function(replace)
{ try{
this.replaceState_ = replace;
if (!replace)
{ var s = "";
for (var i in this.search_)
{ s += (s==""?"?":"&") + i+"="+this.search_[i];
}
window.history.replaceState (null,null, document.location.origin+document.location.pathname+s);
}
else window.history.replaceState (null,null, this.getLink());
}catch(e){}
}
/**
* On view change refresh link
* @param {ol.event} The map instance.
* @private
*/
ol.control.Permalink.prototype.viewChange_ = function()
{ try{
if (this.replaceState_) window.history.replaceState (null,null, this.getLink());
}catch(e){}
}
/**
* Layer change refresh link
* @param {ol.event} The map instance.
* @private
*/
ol.control.Permalink.prototype.layerChange_ = function(e)
{ // Get layers
var l = "";
function getLayers(layers)
{ for (var i=0; i<layers.length; i++)
{ if (layers[i].getVisible() && layers[i].get("permalink"))
{ if (l) l += "|";
l += layers[i].get("permalink")+":"+layers[i].get("opacity");
}
// Layer Group
if (layers[i].getLayers) getLayers(layers[i].getLayers().getArray());
}
}
getLayers(this.getMap().getLayers().getArray());
this.layerStr_ = l;
this.viewChange_();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc OpenLayers 3 Profil Control.
* Draw a profil of a feature (with a 3D geometry)
*
* @constructor
* @extends {ol.control.Control}
* @fires over, out, show
* @param {Object=} _ol_control_ opt_options.
*
*/
ol.control.Profil = function(opt_options)
{ var options = opt_options || {};
this.info = options.info || ol.control.Profil.prototype.info;
var self = this;
var element;
if (options.target)
{ element = $("<div>").addClass(options.className || "ol-profil");
}
else
{ element = $("<div>").addClass((options.className || 'ol-profil') +' ol-unselectable ol-control ol-collapsed');
this.button = $("<button>")
.attr('type','button')
.on("click touchstart", function(e)
{ self.toggle();
e.preventDefault();
})
.appendTo(element);
}
var div = $("<div>").addClass("ol-inner").appendTo(element);
div = $("<div>").css("position","relative").appendTo(div);
var ratio = this.ratio = 2;
this.canvas_ = document.createElement('canvas');
this.canvas_.width = (options.width || 300)*ratio;
this.canvas_.height = (options.height || 150)*ratio;
$(this.canvas_).css({
"transform":"scale(0.5,0.5)", "transform-origin":"0 0",
"-ms-transform":"scale(0.5,0.5)", "-ms-transform-origin":"0 0",
"-webkit-transform":"scale(0.5,0.5)", "-webkit-transform-origin":"0 0",
"transform":"scale(0.5,0.5)", "transform-origin":"0 0"
});
$("<div>").appendTo(div)
.width (this.canvas_.width/ratio)
.height (this.canvas_.height/ratio)
.append(this.canvas_)
.on("click mousemove", function(e){ self.onMove(e); });
ol.control.Control.call(this,
{ element: element.get(0),
target: options.target
});
// Offset in px
this.margin_ = { top:10*ratio, left:40*ratio, bottom:30*ratio, right:10*ratio };
if (!this.info.ytitle) this.margin_.left -= 20*ratio;
if (!this.info.xtitle) this.margin_.bottom -= 20*ratio;
// Cursor
this.bar_ = $("<div>").addClass("ol-profilbar")
.css({top:(this.margin_.top/ratio)+"px", height:(this.canvas_.height-this.margin_.top-this.margin_.bottom)/ratio+"px" })
.appendTo(div);
this.cursor_ = $("<div>").addClass("ol-profilcursor")
.appendTo(div);
this.popup_ = $("<div>").addClass("ol-profilpopup")
.appendTo(this.cursor_);
// Track information
var t = $("<table cellpadding='0' cellspacing='0'>").appendTo(div).width(this.canvas_.width/ratio);
var tr = $("<tr>").addClass("track-info").appendTo(t);
$("<td>").html((this.info.zmin||"Zmin")+': <span class="zmin">').appendTo(tr);
$("<td>").html((this.info.zmax||"Zmax")+': <span class="zmax">').appendTo(tr);
$("<td>").html((this.info.distance||"Distance")+': <span class="dist">').appendTo(tr);
$("<td>").html((this.info.time||"Time")+': <span class="time">').appendTo(tr);
tr = $("<tr>").addClass("point-info").appendTo(t);
$("<td>").html((this.info.altitude||"Altitude")+': <span class="z">').appendTo(tr);
$("<td>").html((this.info.distance||"Distance")+': <span class="dist">').appendTo(tr);
$("<td>").html((this.info.time||"Time")+': <span class="time">').appendTo(tr);
// Array of data
this.tab_ = [];
// Show feature
if (options.feature)
{ this.setGeometry (options.feature);
}
};
ol.inherits(ol.control.Profil, ol.control.Control);
/** Custom infos list
* @api stable
*/
ol.control.Profil.prototype.info =
{ "zmin": "Zmin",
"zmax": "Zmax",
"ytitle": "Altitude (m)",
"xtitle": "Distance (km)",
"time": "Time",
"altitude": "Altitude",
"distance": "Distance"
};
/** Show popup info
* @param {string} info to display as a popup
* @api stable
*/
ol.control.Profil.prototype.popup = function(info)
{ this.popup_.html(info);
}
/** Mouse move over canvas
*/
ol.control.Profil.prototype.onMove = function(e)
{ if (!this.tab_.length) return;
var pos = $(this.canvas_).offset();
var dx = e.pageX -pos.left;
var dy = e.pageY -pos.top;
var ratio = this.ratio;
if (dx>this.margin_.left/ratio && dx<(this.canvas_.width-this.margin_.right)/ratio
&& dy>this.margin_.top/ratio && dy<(this.canvas_.height-this.margin_.bottom)/ratio)
{ this.bar_.css("left", dx+"px").show();
var d = (dx*ratio-this.margin_.left)/this.scale_[0];
var p0 = this.tab_[0];
for (var i=1, p; p=this.tab_[i]; i++)
{ if (p[0]>=d)
{ if (d < (p[0]+p0[0])/2) p = p0;
break;
}
}
if (p) this.cursor_.css({
left:dx+"px",
top:(this.canvas_.height-this.margin_.bottom+p[1]*this.scale_[1]+this.dy_)/ratio+"px"
}).show();
else this.cursor_.hide();
this.bar_.parent().addClass("over");
$(".point-info .z", this.element).text(p[1]+"m");
$(".point-info .dist", this.element).text((p[0]/1000).toFixed(1)+"km");
$(".point-info .time", this.element).text(p[2]);
if (dx>this.canvas_.width/ratio/2) this.popup_.addClass('ol-left');
else this.popup_.removeClass('ol-left');
this.dispatchEvent({ type:'over', click:e.type=="click", coord: p[3], time: p[2], distance: p[0] });
}
else
{ if (this.bar_.parent().hasClass("over"))
{ this.bar_.hide();
this.cursor_.hide();
this.bar_.parent().removeClass("over");
this.dispatchEvent({ type:'out' });
}
}
}
/** Show panel
* @api stable
*/
ol.control.Profil.prototype.show = function()
{ $(this.element).removeClass("ol-collapsed");
this.dispatchEvent({ type:'show', show: true });
}
/** Hide panel
* @api stable
*/
ol.control.Profil.prototype.hide = function()
{ $(this.element).addClass("ol-collapsed");
this.dispatchEvent({ type:'show', show: false });
}
/** Toggle panel
* @api stable
*/
ol.control.Profil.prototype.toggle = function()
{ var b = $(this.element).toggleClass("ol-collapsed").hasClass("ol-collapsed");
this.dispatchEvent({ type:'show', show: !b });
}
/** Is panel visible
*/
ol.control.Profil.prototype.isShown = function()
{ return (!$(this.element).hasClass("ol-collapsed"));
}
/**
* Set the geometry to draw the profil.
* @param {ol.Feature|ol.geom} f the feature.
* @param {Object=} options
* - projection {ol.ProjectionLike} feature projection, default projection of the map
* - zunit {m|km} default m
* - unit {m|km} default km
* - zmin {Number|undefined} default 0
* - zmax {Number|undefined} default max Z of the feature
* - graduation {Number|undefined} z graduation default 100
* - amplitude {integer|undefined} amplitude of the altitude, default zmax-zmin
* @api stable
*/
ol.control.Profil.prototype.setGeometry = function(g, options)
{ if (!options) options = {};
if (g instanceof ol.Feature) g = g.getGeometry();
var canvas = this.canvas_;
var ctx = canvas.getContext('2d');
var w = canvas.width;
var h = canvas.height;
ctx.setTransform(1, 0, 0, 1, 0, 0);
ctx.clearRect(0,0, w, h);
// No Z
if (!/Z/.test(g.getLayout())) return;
// No time
if(/M/.test(g.getLayout())) $(".time", this.element).parent().show();
else $(".time", this.element).parent().hide();
// Coords
var c = g.getCoordinates();
switch (g.getType())
{ case "LineString": break;
case "MultiLineString": c = c[0]; break;
default: return;
}
// Distance beetween 2 coords
var wgs84Sphere = new ol.Sphere(6378137);
var proj = options.projection || this.getMap().getView().getProjection();
function dist2d(p1,p2)
{ return wgs84Sphere.haversineDistance(
ol.proj.transform(p1, proj, 'EPSG:4326'),
ol.proj.transform(p2, proj, 'EPSG:4326'));
}
function getTime(t0, t1)
{ if (!t0 || !t1) return "-"
var dt = (t1-t0) / 60; // mn
var ti = Math.trunc(dt/60);
var mn = Math.trunc(dt-ti*60);
return ti+"h"+(mn<10?"0":"")+mn+"mn";
}
// Margin
ctx.setTransform(1, 0, 0, 1, this.margin_.left, h-this.margin_.bottom);
var ratio = this.ratio;
w -= this.margin_.right + this.margin_.left;
h -= this.margin_.top + this.margin_.bottom;
// Draw axes
ctx.strokeStyle = "#000";
ctx.lineWidth = 0.5*ratio;
ctx.beginPath();
ctx.moveTo(0,0); ctx.lineTo(0,-h);
ctx.moveTo(0,0); ctx.lineTo(w, 0);
ctx.stroke();
//
var zmin=Infinity, zmax=-Infinity;
var d, z, ti, t = this.tab_ = [];
for (var i=0, p; p=c[i]; i++)
{ z = p[2];
if (z<zmin) zmin=z;
if (z>zmax) zmax=z;
if (i==0) d = 0;
else d += dist2d(c[i-1], p);
ti = getTime(c[0][3],p[3]);
t.push ([d, z, ti, p]);
}
// Info
$(".track-info .zmin", this.element).text(zmin.toFixed(2)+"m");
$(".track-info .zmax", this.element).text(zmax.toFixed(2)+"m");
if (d>1000)
{ $(".track-info .dist", this.element).text((d/1000).toFixed(1)+"km");
}
else
{ $(".track-info .dist", this.element).text((d).toFixed(1)+"m");
}
$(".track-info .time", this.element).text(ti);
// Set graduation
var grad = options.graduation || 100;
while (true)
{ zmax = Math.ceil(zmax/grad)*grad;
zmin = Math.floor(zmin/grad)*grad;
var nbgrad = (zmax-zmin)/grad;
if (h/nbgrad < 15*ratio)
{ grad *= 2;
}
else break;
}
// Set amplitude
if (typeof(options.zmin)=='number' && zmin > options.zmin) zmin = options.zmin;
if (typeof(options.zmax)=='number' && zmax < options.zmax) zmax = options.zmax;
var amplitude = options.amplitude;
if (amplitude)
{ zmax = Math.max (zmin + amplitude, zmax);
}
// Scales lines
var scx = w/d;
var scy = -h/(zmax-zmin);
var dy = this.dy_ = -zmin*scy;
this.scale_ = [scx,scy];
// Draw
ctx.font = (10*ratio)+"px arial";
ctx.textAlign = "right";
ctx.textBaseline = "middle";
ctx.fillStyle="#000";
// Scale Z
ctx.beginPath();
for (var i=zmin; i<=zmax; i+=grad)
{ if (options.zunit!="km") ctx.fillText(i, -4*ratio, i*scy+dy);
else ctx.fillText((i/1000).toFixed(1), -4*ratio, i*scy+dy);
ctx.moveTo (-2*ratio, i*scy+dy);
if (i!=0) ctx.lineTo (d*scx, i*scy+dy);
else ctx.lineTo (0, i*scy+dy);
}
// Scale X
ctx.textAlign = "center";
ctx.textBaseline = "top";
ctx.setLineDash([ratio,3*ratio]);
var unit = options.unit ||"km";
var step;
if (d>1000)
{ step = Math.round(d/1000)*100;
if (step > 1000) step = Math.ceil(step/1000)*1000;
}
else
{ unit = "m";
if (d>100) step = Math.round(d/100)*10;
else if (d>10) step = Math.round(d/10);
else if (d>1) step = Math.round(d)/10;
else step = d;
}
for (var i=0; i<=d; i+=step)
{ var txt = (unit=="m") ? i : (i/1000);
//if (i+step>d) txt += " "+ (options.zunits || "km");
ctx.fillText(Math.round(txt*10)/10, i*scx, 4*ratio);
ctx.moveTo (i*scx, 2*ratio); ctx.lineTo (i*scx, 0);
}
ctx.font = (12*ratio)+"px arial";
ctx.fillText(this.info.xtitle.replace("(km)","("+unit+")"), w/2, 18*ratio);
ctx.save();
ctx.rotate(-Math.PI/2);
ctx.fillText(this.info.ytitle, h/2, -this.margin_.left);
ctx.restore();
ctx.stroke();
//
ctx.strokeStyle = "#369";
ctx.lineWidth = 1;
ctx.setLineDash([]);
ctx.beginPath();
for (var i=0, p; p=t[i]; i++)
{ if (i==0) ctx.moveTo(p[0]*scx,p[1]*scy+dy);
else ctx.lineTo(p[0]*scx,p[1]*scy+dy);
}
ctx.stroke();
};
/** Get profil image
* @param {string|undefined} type image format or 'canvas' to get the canvas image, default image/png.
* @param {Number|undefined} encoderOptions between 0 and 1 indicating image quality image/jpeg or image/webp, default 0.92.
* @return {string} requested data uri
* @api stable
*/
ol.control.Profil.prototype.getImage = function(type, encoderOptions)
{ if (type==="canvas") return this.canvas_;
return this.canvas_.toDataURL(type, encoderOptions);
}
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search places using the French National Base Address (BAN) API.
*
* @constructor
* @extends {ol.control.Search}
* @fires select
* @param {Object=} Control options.
* @param {string} options.className control class name
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 500.
* @param {integer | undefined} options.minLength minimum length to start searching, default 3
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
*
* @param {string|undefined} options.url Url to BAN api, default "https://api-adresse.data.gouv.fr/search/"
* @param {boolean} options.position Search, with priority to geo position, default false
* @param {function} options.getTitle a function that takes a feature and return the text to display in the menu, default return label attribute
* @see {@link https://adresse.data.gouv.fr/api/}
*/
ol.control.SearchBAN = function(options)
{ options = options || {};
options.typing = options.typing || 500;
options.url = options.url || "https://api-adresse.data.gouv.fr/search/";
options.className = options.className || 'BAN';
ol.control.SearchPhoton.call(this, options);
this.set("copy","<a href='https://adresse.data.gouv.fr/' target='new'>&copy; BAN-data.gouv.fr</a>");
};
ol.inherits(ol.control.SearchBAN, ol.control.SearchPhoton);
/** Returns the text to be displayed in the menu
* @param {ol.Feature} f the feature
* @return {string} the text to be displayed in the index
* @api
*/
ol.control.SearchBAN.prototype.getTitle = function (f) {
var p = f.properties;
return (p.label);
};
/** A ligne has been clicked in the menu > dispatch event
* @param {any} f the feature, as passed in the autocomplete
* @api
*/
ol.control.SearchBAN.prototype.select = function (f){
var c = f.geometry.coordinates;
// Add coordinate to the event
try {
c = ol.proj.transform (f.geometry.coordinates, 'EPSG:4326', this.getMap().getView().getProjection());
} catch(e) {};
this.dispatchEvent({ type:"select", search:f, coordinate: c });
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search features.
*
* @constructor
* @extends {ol.control.Search}
* @fires select
* @param {Object=} Control options.
* @param {string} options.className control class name
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 300.
* @param {integer | undefined} options.minLength minimum length to start searching, default 1
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
*
* @param {string | undefined} options.property a property to display in the index, default 'name'.
* @param {function} options.getTitle a function that takes a feature and return the name to display in the index, default return the property
* @param {function | undefined} options.getSearchString a function that take a feature and return a text to be used as search string, default geTitle() is used as search string
*/
ol.control.SearchFeature = function(options) {
if (!options) options = {};
options.className = options.className || 'feature';
ol.control.Search.call(this, options);
if (typeof(options.getSearchString)=="function") this.getSearchString = options.getSearchString;
this.set('property', options.property || 'name');
this.source_ = options.source;
};
ol.inherits(ol.control.SearchFeature, ol.control.Search);
/** Returns the text to be displayed in the menu
* @param {ol.Feature} f the feature
* @return {string} the text to be displayed in the index
* @api
*/
ol.control.SearchFeature.prototype.getTitle = function (f) {
return f.get(this.get('property')||'name');
};
/** Return the string to search in
* @param {ol.Feature} f the feature
* @return {string} the text to be used as search string
* @api
*/
ol.control.SearchFeature.prototype.getSearchString = function (f) {
return this.getTitle(f);
};
/** Get the source
* @return {ol.source.Vector}
* @api
*/
ol.control.SearchFeature.prototype.getSource = function () {
return this.source_;
}
/** Get the source
* @param {ol.source.Vector} source
* @api
*/
ol.control.SearchFeature.prototype.setSource = function (source) {
this.source_ = source;
};
/** Autocomplete function
* @param {string} s search string
* @param {int} max max
* @param {function} cback a callback function that takes an array to display in the autocomplete field (for asynchronous search)
* @return {Array<any>|false} an array of search solutions or false if the array is send with the cback argument (asnchronous)
* @api
*/
ol.control.SearchFeature.prototype.autocomplete = function (s) {
var result = [];
if (this.source_) {
// regexp
s = s.replace(/^\*/,'');
var rex = new RegExp(s, 'i');
// The source
var features = this.source_.getFeatures();
var max = this.get('maxItems')
for (var i=0, f; f=features[i]; i++) {
var att = this.getSearchString(f);
if (att !== undefined && rex.test(att)) {
result.push(f);
if ((--max)<=0) break;
}
}
}
return result;
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search places using the French National Base Address (BAN) API.
*
* @constructor
* @extends {ol.control.SearchJSON}
* @fires select
* @param {any} options extend ol.control.SearchJSON options
* @param {string} options.className control class name
* @param {boolean | undefined} options.apiKey the service api key.
* @param {string | undefined} options.authentication: basic authentication for the service API as btoa("login:pwd")
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 500.
* @param {integer | undefined} options.minLength minimum length to start searching, default 3
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
*
* @param {Number} options.pageSize item per page for parcelle list paging, use -1 for no paging, default 5
* @see {@link https://geoservices.ign.fr/documentation/geoservices/geocodage.html}
*/
ol.control.SearchGeoportailParcelle = function(options) {
var self = this;
options.type = "Commune";
options.className = options.className ? options.className+" IGNF-parcelle" : "IGNF-parcelle";
options.inputLabel = "Commune";
options.noCollapse = true;
options.placeholder = options.placeholder || "Choisissez une commune...";
ol.control.SearchGeoportail.call(this, options);
this.set('copy', null);
var element = this.element;
// Add parcel form
var div = document.createElement("DIV");
element.appendChild(div);
var label = document.createElement("LABEL");
label.innerText = 'Préfixe'
div.appendChild(label);
var label = document.createElement("LABEL");
label.innerText = 'Section'
div.appendChild(label);
var label = document.createElement("LABEL");
label.innerText = 'Numéro'
div.appendChild(label);
div.appendChild(document.createElement("BR"));
// Input
this._inputParcelle = {
prefix: document.createElement("INPUT"),
section: document.createElement("INPUT"),
numero: document.createElement("INPUT")
};
this._inputParcelle.prefix.setAttribute('maxlength',3);
this._inputParcelle.section.setAttribute('maxlength',2);
this._inputParcelle.numero.setAttribute('maxlength',4);
// Delay search
var tout;
var doSearch = function(e) {
if (tout) clearTimeout(tout);
tout = setTimeout(function() {
self.autocompleteParcelle();
}, options.typing || 0);
}
// Add inputs
for (var i in this._inputParcelle) {
div.appendChild(this._inputParcelle[i]);
this._inputParcelle[i].addEventListener("keyup", doSearch);
}
this.activateParcelle(false);
// Autocomplete list
var ul = document.createElement('UL');
ul.classList.add('autocomplete-parcelle');
element.appendChild(ul);
ul = document.createElement('UL');
ul.classList.add('autocomplete-page');
element.appendChild(ul);
// Show/hide list on fcus/blur
this._input.addEventListener('blur', function() {
setTimeout(function(){ element.classList.add('ol-collapsed-list') }, 200);
});
this._input.addEventListener('focus', function() {
element.classList.remove('ol-collapsed-list');
self._listParcelle([]);
if (self._commune) {
self._commune = null;
self._input.value = '';
self.drawList_();
}
self.activateParcelle(false);
});
this.on('select', this.selectCommune.bind(this));
this.set('pageSize', options.pageSize || 5);
};
ol.inherits(ol.control.SearchGeoportailParcelle, ol.control.SearchGeoportail);
/** Select a commune => start searching parcelle
* @param {any} e
* @private
*/
ol.control.SearchGeoportailParcelle.prototype.selectCommune = function(e) {
this._commune = e.search.insee;
this._input.value = e.search.insee + ' - ' + e.search.fulltext;
this.activateParcelle(true);
this._inputParcelle.numero.focus();
this.autocompleteParcelle();
};
/** Activate parcelle inputs
* @param {bolean} b
*/
ol.control.SearchGeoportailParcelle.prototype.activateParcelle = function(b) {
for (var i in this._inputParcelle) {
this._inputParcelle[i].readOnly = !b;
}
if (b) {
this._inputParcelle.section.parentElement.classList.add('ol-active');
} else {
this._inputParcelle.section.parentElement.classList.remove('ol-active');
}
};
/** Send search request for the parcelle
* @param {any} e
* @private
*/
ol.control.SearchGeoportailParcelle.prototype.autocompleteParcelle = function(e) {
var self = this;
// Add 0 to fit the format
function complete (s, n, c)
{ if (!s) return s;
c = c || "0";
while (s.length < n) s = c+s;
return s.replace(/\*/g,'_');
}
// The selected commune
var commune = this._commune;
var prefix = complete (this._inputParcelle.prefix.value, 3);
if (prefix === '000') {
prefix = '___';
}
// Get parcelle number
var section = complete (this._inputParcelle.section.value, 2);
var numero = complete (this._inputParcelle.numero.value, 4, "0");
var search = commune + (prefix||'___') + (section||"__") + (numero ? numero : section ? "____":"0001");
// Request
var request = '<?xml version="1.0" encoding="UTF-8"?>'
+'<XLS xmlns:xls="http://www.opengis.net/xls" xmlns:gml="http://www.opengis.net/gml" xmlns="http://www.opengis.net/xls" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" version="1.2" xsi:schemaLocation="http://www.opengis.net/xls http://schemas.opengis.net/ols/1.2/olsAll.xsd">'
+'<RequestHeader/>'
+'<Request requestID="1" version="1.2" methodName="LocationUtilityService">'
+'<GeocodeRequest returnFreeForm="false">'
+'<Address countryCode="CadastralParcel">'
+'<freeFormAddress>'+search+'+</freeFormAddress>'
+'</Address>'
+'</GeocodeRequest>'
+'</Request>'
+'</XLS>'
var url = this.get('url').replace('ols/apis/completion','geoportail/ols?xls=')+encodeURIComponent(request);
// Geocode
this.ajax(url, function(resp) {
// XML to JSON
var parser = new DOMParser();
var xmlDoc = parser.parseFromString(resp.response,"text/xml");
var parcelles = xmlDoc.getElementsByTagName('GeocodedAddress');
var jsonResp = []
for (var i=0, parc; parc= parcelles[i]; i++) {
var node = parc.getElementsByTagName('gml:pos')[0] || parc.getElementsByTagName('pos')[0];
var p = node.childNodes[0].nodeValue.split(' ');
var att = parc.getElementsByTagName('Place');
var json = {
lon: Number(p[1]),
lat: Number(p[0])
};
for (var k=0, a; a=att[k]; k++) {
json[a.attributes.type.value] = a.childNodes[0].nodeValue;
}
jsonResp.push(json);
}
self._listParcelle(jsonResp);
}, function() {
console.log('oops')
});
};
/**
* Draw the autocomplete list
* @param {*} resp
* @private
*/
ol.control.SearchGeoportailParcelle.prototype._listParcelle = function(resp) {
var self = this;
var ul = this.element.querySelector("ul.autocomplete-parcelle");
ul.innerHTML='';
var page = this.element.querySelector("ul.autocomplete-page");
page.innerHTML='';
this._listParc = [];
// Show page i
function showPage(i) {
var l = ul.children;
var visible = "ol-list-"+i;
for (k=0; k<l.length; k++) {
l[k].style.display = (l[k].className===visible) ? '' : 'none';
}
l = page.children;
for (k=0; k<l.length; k++) {
l[k].className = (l[k].innerText==i) ? 'selected' : '';
}
page.style.display = l.length>1 ? '' : 'none';
}
// Sort table
resp.sort(function(a,b) {
var na = a.INSEE+a.CommuneAbsorbee+a.Section+a.Numero;
var nb = b.INSEE+b.CommuneAbsorbee+b.Section+b.Numero;
return na===nb ? 0 : na<nb ? -1 : 1;
});
// Show list
var n = this.get('pageSize');
for (var i=0, r; r = resp[i]; i++) {
var li = document.createElement("LI");
li.setAttribute("data-search", i);
if (n>0) li.classList.add("ol-list-"+Math.floor(i/n));
this._listParc.push(r);
li.addEventListener("click", function(e) {
self._handleParcelle(self._listParc[e.currentTarget.getAttribute("data-search")]);
});
li.innerHTML = r.INSEE+r.CommuneAbsorbee+r.Section+r.Numero;
ul.appendChild(li);
//
if (n>0 && !(i%n)) {
li = document.createElement("LI");
li.innerText = Math.floor(i/n);
li.addEventListener("click", function(e) {
showPage(e.currentTarget.innerText);
});
page.appendChild(li);
}
}
if (n>0) showPage(0);
};
/**
* Handle parcelle section
* @param {*} parc
* @private
*/
ol.control.SearchGeoportailParcelle.prototype._handleParcelle = function(parc) {
this.dispatchEvent({
type:"parcelle",
search: parc,
coordinate: ol.proj.fromLonLat([parc.lon, parc.lat], this.getMap().getView().getProjection())
});
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Search places using the French National Base Address (BAN) API.
*
* @constructor
* @extends {ol.control.Search}
* @fires select
* @param {Object=} Control options.
* @param {string} options.className control class name
* @param {boolean | undefined} options.polygon To get output geometry of results (in geojson format), default false.
* @param {Element | string | undefined} options.target Specify a target if you want the control to be rendered outside of the map's viewport.
* @param {string | undefined} options.label Text label to use for the search button, default "search"
* @param {string | undefined} options.placeholder placeholder, default "Search..."
* @param {number | undefined} options.typing a delay on each typing to start searching (ms), default 500.
* @param {integer | undefined} options.minLength minimum length to start searching, default 3
* @param {integer | undefined} options.maxItems maximum number of items to display in the autocomplete list, default 10
*
* @param {string|undefined} options.url Url to BAN api, default "https://api-adresse.data.gouv.fr/search/"
* @see {@link https://wiki.openstreetmap.org/wiki/Nominatim}
*/
ol.control.SearchNominatim = function(options)
{ options = options || {};
options.className = options.className || 'nominatim';
options.typing = options.typing || 500;
options.url = options.url || "https://nominatim.openstreetmap.org/search";
ol.control.SearchJSON.call(this, options);
this.set("copy","<a href='http://www.openstreetmap.org/copyright' target='new'>&copy; OpenStreetMap contributors</a>");
this.set("polygon", options.polygon);
};
ol.inherits(ol.control.SearchNominatim, ol.control.SearchJSON);
/** Returns the text to be displayed in the menu
* @param {ol.Feature} f the feature
* @return {string} the text to be displayed in the index
* @api
*/
ol.control.SearchNominatim.prototype.getTitle = function (f) {
var title = f.display_name+"<i>"+f.class+" - "+f.type+"</i>";
if (f.icon) title = "<img src='"+f.icon+"' />" + title;
return (title);
};
/**
* @param {string} s the search string
* @return {Object} request data (as key:value)
* @api
*/
ol.control.SearchNominatim.prototype.requestData = function (s) {
return {
format: "json",
addressdetails: 1,
q: s,
polygon_geojson: this.get('polygon') ? 1:0,
limit: this.get('maxItems')
};
};
/** A ligne has been clicked in the menu > dispatch event
* @param {any} f the feature, as passed in the autocomplete
* @api
*/
ol.control.SearchNominatim.prototype.select = function (f){
var c = [Number(f.lon), Number(f.lat)];
// Add coordinate to the event
try {
c = ol.proj.transform (c, 'EPSG:4326', this.getMap().getView().getProjection());
} catch(e) {};
this.dispatchEvent({ type:"select", search:f, coordinate: c });
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc OpenLayers 3 swipe Control.
*
* @constructor
* @extends {ol.control.Control}
* @param {Object=} Control opt_options.
* - layers {ol.layer} layer to swipe
* - rightLayer {ol.layer} layer to swipe on right side
* - className {string} control class name
* - position {number} position propertie of the swipe [0,1], default 0.5
* - orientation {vertical|horizontal} orientation propertie, default vertical
*/
ol.control.Swipe = function(opt_options)
{ var options = opt_options || {};
var self = this;
var button = document.createElement('button');
var element = document.createElement('div');
element.className = (options.className || "ol-swipe") + " ol-unselectable ol-control";
element.appendChild(button);
$(element).on ("mousedown touchstart", this, this.move );
ol.control.Control.call(this,
{ element: element
});
// An array of listener on layer postcompose
this._listener = [];
this.layers = [];
if (options.layers) this.addLayer(options.layers, false);
if (options.rightLayers) this.addLayer(options.rightLayers, true);
this.on('propertychange', function()
{ if (this.getMap()) this.getMap().renderSync();
if (this.get('orientation') === "horizontal")
{ $(this.element).css("top", this.get('position')*100+"%");
$(this.element).css("left", "");
}
else
{ if (this.get('orientation') !== "vertical") this.set('orientation', "vertical");
$(this.element).css("left", this.get('position')*100+"%");
$(this.element).css("top", "");
}
$(this.element).removeClass("horizontal vertical");
$(this.element).addClass(this.get('orientation'));
}.bind(this));
this.set('position', options.position || 0.5);
this.set('orientation', options.orientation || 'vertical');
};
ol.inherits(ol.control.Swipe, ol.control.Control);
/**
* Set the map instance the control associated with.
* @param {_ol_Map_} map The map instance.
*/
ol.control.Swipe.prototype.setMap = function(map)
{
for (var i=0; i<this._listener.length; i++) {
ol.Observable.unByKey(this._listener[i]);
}
this._listener = [];
if (this.getMap()) {
this.getMap().renderSync();
}
ol.control.Control.prototype.setMap.call(this, map);
if (map)
{ this._listener = [];
for (var i=0; i<this.layers.length; i++)
{ var l = this.layers[i];
if (l.right) this._listener.push (l.layer.on('precompose', this.precomposeRight.bind(this)));
else this._listener.push (l.layer.on('precompose', this.precomposeLeft.bind(this)));
this._listener.push(l.layer.on('postcompose', this.postcompose.bind(this)));
}
map.renderSync();
}
};
/** @private
*/
ol.control.Swipe.prototype.isLayer_ = function(layer)
{ for (var k=0; k<this.layers.length; k++)
{ if (this.layers[k].layer === layer) return k;
}
return -1;
};
/** Add a layer to clip
* @param {ol.layer|Array<ol.layer>} layer to clip
* @param {bool} add layer in the right part of the map, default left.
*/
ol.control.Swipe.prototype.addLayer = function(layers, right)
{ if (!(layers instanceof Array)) layers = [layers];
for (var i=0; i<layers.length; i++) {
var l = layers[i];
if (this.isLayer_(l)<0)
{ this.layers.push({ layer:l, right:right });
if (this.getMap())
{ if (right) this._listener.push (l.on('precompose', this.precomposeRight.bind(this)));
else this._listener.push (l.on('precompose', this.precomposeLeft.bind(this)));
this._listener.push(l.on('postcompose', this.postcompose.bind(this)));
this.getMap().renderSync();
}
}
}
};
/** Remove a layer to clip
* @param {ol.layer|Array<ol.layer>} layer to clip
*/
ol.control.Swipe.prototype.removeLayer = function(layers)
{ if (!(layers instanceof Array)) layers = [layers];
for (var i=0; i<layers.length; i++)
{ var k = this.isLayer_(layers[i]);
if (k >=0 && this.getMap())
{ if (this.layers[k].right) layers[i].un('precompose', this.precomposeRight, this);
else layers[i].un('precompose', this.precomposeLeft, this);
layers[i].un('postcompose', this.postcompose, this);
this.layers.splice(k,1);
this.getMap().renderSync();
}
}
};
/** @private
*/
ol.control.Swipe.prototype.move = function(e)
{ var self = e.data;
switch (e.type)
{ case 'touchcancel':
case 'touchend':
case 'mouseup':
{ self.isMoving = false;
$(document).off ("mouseup mousemove touchend touchcancel touchmove", self.move );
break;
}
case 'mousedown':
case 'touchstart':
{ self.isMoving = true;
$(document).on ("mouseup mousemove touchend touchcancel touchmove", self, self.move );
}
case 'mousemove':
case 'touchmove':
{ if (self.isMoving)
{ if (self.get('orientation') === "vertical")
{ var pageX = e.pageX
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageX)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageX);
if (!pageX) break;
pageX -= $(self.getMap().getTargetElement()).offset().left;
var l = self.getMap().getSize()[0];
l = Math.min(Math.max(0, 1-(l-pageX)/l), 1);
self.set('position', l);
}
else
{ var pageY = e.pageY
|| (e.originalEvent.touches && e.originalEvent.touches.length && e.originalEvent.touches[0].pageY)
|| (e.originalEvent.changedTouches && e.originalEvent.changedTouches.length && e.originalEvent.changedTouches[0].pageY);
if (!pageY) break;
pageY -= $(self.getMap().getTargetElement()).offset().top;
var l = self.getMap().getSize()[1];
l = Math.min(Math.max(0, 1-(l-pageY)/l), 1);
self.set('position', l);
}
}
break;
}
default: break;
}
};
/** @private
*/
ol.control.Swipe.prototype.precomposeLeft = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
ctx.save();
ctx.beginPath();
if (this.get('orientation') === "vertical") ctx.rect (0,0, canvas.width*this.get('position'), canvas.height);
else ctx.rect (0,0, canvas.width, canvas.height*this.get('position'));
ctx.clip();
};
/** @private
*/
ol.control.Swipe.prototype.precomposeRight = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
ctx.save();
ctx.beginPath();
if (this.get('orientation') === "vertical") ctx.rect (canvas.width*this.get('position'), 0, canvas.width, canvas.height);
else ctx.rect (0,canvas.height*this.get('position'), canvas.width, canvas.height);
ctx.clip();
};
/** @private
*/
ol.control.Swipe.prototype.postcompose = function(e)
{ e.context.restore();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** ol.control.Target draw a target at the center of the map.
* @constructor
* @param {Object} options
* - style {ol.style.Style|Array<ol.style.Style>} ol.style.Stroke: draw a cross on the map, ol.style.Image: draw the image on the map
* - composite {string} composite operation : difference|multiply|xor|screen|overlay|darken|lighter|lighten|...
*/
ol.control.Target = function(options)
{ options = options || {};
this.style = options.style ||
[ new ol.style.Style({ image: new ol.style.RegularShape ({ points: 4, radius: 11, radius1: 0, radius2: 0, snapToPixel:true, stroke: new ol.style.Stroke({ color: "#fff", width:3 }) }) }),
new ol.style.Style({ image: new ol.style.RegularShape ({ points: 4, radius: 11, radius1: 0, radius2: 0, snapToPixel:true, stroke: new ol.style.Stroke({ color: "#000", width:1 }) }) })
];
if (!(this.style instanceof Array)) this.style = [this.style];
this.composite = options.composite || '';
var div = document.createElement('div');
div.className = "ol-target ol-unselectable ol-control";
ol.control.Control.call(this,
{ element: div,
target: options.target
});
this.setVisible(options.visible!==false);
};
ol.inherits(ol.control.Target, ol.control.Control);
/**
* Remove the control from its current map and attach it to the new map.
* Subclasses may set up event handlers to get notified about changes to
* the map here.
* @param {ol.Map} map Map.
* @api stable
*/
ol.control.Target.prototype.setMap = function (map)
{ if (this.getMap())
{ if (this.getVisible()) this.getMap().renderSync();
}
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.control.Control.prototype.setMap.call(this, map);
if (map)
{ this._listener = map.on('postcompose', this.drawTarget_.bind(this));
}
};
/** Set the control visibility
* @paraam {boolean} b
*/
ol.control.Target.prototype.setVisible = function (b)
{ this.set("visible",b);
if (this.getMap()) this.getMap().renderSync();
};
/** Get the control visibility
* @return {boolean} b
*/
ol.control.Target.prototype.getVisible = function ()
{ return this.get("visible");
};
/** Draw the target
* @private
*/
ol.control.Target.prototype.drawTarget_ = function (e)
{ if (!this.getMap() || !this.getVisible()) return;
var ctx = e.context;
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.scale(ratio,ratio);
var cx = ctx.canvas.width/(2*ratio);
var cy = ctx.canvas.height/(2*ratio);
var geom = new ol.geom.Point (this.getMap().getCoordinateFromPixel([cx,cy]));
if (this.composite) ctx.globalCompositeOperation = this.composite;
for (var i=0; i<this.style.length; i++)
{ var style = this.style[i];
if (style instanceof ol.style.Style)
{ var sc=0;
// OL < v4.3 : setImageStyle don't check retina
var imgs = ol.Map.prototype.getFeaturesAtPixel ? false : style.getImage();
if (imgs)
{ sc = imgs.getScale();
imgs.setScale(ratio*sc);
}
e.vectorContext.setStyle(style);
e.vectorContext.drawGeometry(geom);
if (imgs) imgs.setScale(sc);
}
}
/*
for (var i=0; i<this.style.length; i++)
{ var style = this.style[i];
if (style.stroke instanceof ol.style.Stroke)
{ ctx.lineWidth = style.stroke.getWidth();
ctx.strokeStyle = ol.color.asString(style.stroke.getColor());
var m = style.radius || 10;
var dx = cx + ctx.lineWidth/2;
var dy = cy + ctx.lineWidth/2;
ctx.beginPath();
ctx.moveTo (dx-m, dy);
ctx.lineTo (dx+m, dy);
ctx.moveTo (dx, dy-m);
ctx.lineTo( dx, dy+m);
ctx.stroke();
}
else if (style instanceof ol.style.Image)
{ var img = style.getImage();
ctx.drawImage(img, cx-img.width/2, cy-img.height/2);
}
else if (style instanceof ol.style.Text)
{ ctx.font = style.getFont();
ctx.textBaseline = "middle";
ctx.textAlign = "center";
var fill = style.getFill();
if (fill)
{ ctx.fillStyle = ol.color.asString(fill.getColor());
ctx.fillText(style.getText(), cx, cy);
}
var stroke = style.getStroke();
if (stroke)
{ ctx.lineWidth = stroke.getWidth();
ctx.strokeStyle = ol.color.asString(stroke.getColor());
ctx.strokeText(style.getText(), cx, cy);
}
}
}
*/
ctx.restore();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** A simple push button control drawn as text
* @constructor
* @extends {ol.control.Button}
* @param {Object=} options Control options.
* @param {String} options.className class of the control
* @param {String} options.title title of the control
* @param {String} options.html html to insert in the control
* @param {function} options.handleClick callback when control is clicked (or use change:active event)
*/
ol.control.TextButton = function(options)
{ options = options || {};
options.className = (options.className||"") + " ol-text-button";
ol.control.Button.call(this, options);
};
ol.inherits(ol.control.TextButton, ol.control.Button);
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** A simple toggle control
* The control can be created with an interaction to control its activation.
*
* @constructor
* @extends {ol.control.Control}
* @fires change:active, change:disable
* @param {Object=} options Control options.
* @param {String} options.className class of the control
* @param {String} options.title title of the control
* @param {String} options.html html to insert in the control
* @param {ol.interaction} options.interaction interaction associated with the control
* @param {bool} options.active the control is created active, default false
* @param {bool} options.disable the control is created disabled, default false
* @param {ol.control.Bar} options.bar a subbar associated with the control (drawn when active if control is nested in a ol.control.Bar)
* @param {bool} options.autoActive the control will activate when shown in an ol.control.Bar, default false
* @param {function} options.onToggle callback when control is clicked (or use change:active event)
*/
ol.control.Toggle = function(options)
{ options = options || {};
var self = this;
this.interaction_ = options.interaction;
if (this.interaction_)
{ this.interaction_.on("change:active", function(e)
{ self.setActive(!e.oldValue);
});
}
if (options.toggleFn) options.onToggle = options.toggleFn; // compat old version
options.handleClick = function()
{ self.toggle();
if (options.onToggle) options.onToggle.call(self, self.getActive());
};
options.className = (options.className||"") + " ol-toggle";
ol.control.Button.call(this, options);
this.set("title", options.title);
this.set ("autoActivate", options.autoActivate);
if (options.bar)
{ this.subbar_ = options.bar;
this.subbar_.setTarget(this.element);
$(this.subbar_.element).addClass("ol-option-bar");
}
this.setActive (options.active);
this.setDisable (options.disable);
};
ol.inherits(ol.control.Toggle, ol.control.Button);
/**
* Set the map instance the control is associated with
* and add interaction attached to it to this map.
* @param {_ol_Map_} map The map instance.
*/
ol.control.Toggle.prototype.setMap = function(map)
{ if (!map && this.getMap())
{ if (this.interaction_)
{ this.getMap().removeInteraction (this.interaction_);
}
if (this.subbar_) this.getMap().removeControl (this.subbar_);
}
ol.control.Control.prototype.setMap.call(this, map);
if (map)
{ if (this.interaction_) map.addInteraction (this.interaction_);
if (this.subbar_) map.addControl (this.subbar_);
}
};
/** Get the subbar associated with a control
* @return {ol.control.Bar}
*/
ol.control.Toggle.prototype.getSubBar = function ()
{ return this.subbar_;
};
/**
* Test if the control is disabled.
* @return {bool}.
* @api stable
*/
ol.control.Toggle.prototype.getDisable = function()
{ return $("button", this.element).prop("disabled");
};
/** Disable the control. If disable, the control will be deactivated too.
* @param {bool} b disable (or enable) the control, default false (enable)
*/
ol.control.Toggle.prototype.setDisable = function(b)
{ if (this.getDisable()==b) return;
$("button", this.element).prop("disabled", b);
if (b && this.getActive()) this.setActive(false);
this.dispatchEvent({ type:'change:disable', key:'disable', oldValue:!b, disable:b });
};
/**
* Test if the control is active.
* @return {bool}.
* @api stable
*/
ol.control.Toggle.prototype.getActive = function()
{ return $(this.element).hasClass("ol-active");
};
/** Toggle control state active/deactive
*/
ol.control.Toggle.prototype.toggle = function()
{ if (this.getActive()) this.setActive(false);
else this.setActive(true);
};
/** Change control state
* @param {bool} b activate or deactivate the control, default false
*/
ol.control.Toggle.prototype.setActive = function(b)
{ if (this.getActive()==b) return;
if (b) $(this.element).addClass("ol-active");
else $(this.element).removeClass("ol-active");
if (this.interaction_) this.interaction_.setActive (b);
if (this.subbar_) this.subbar_.setActive(b);
this.dispatchEvent({ type:'change:active', key:'active', oldValue:!b, active:b });
};
/** Set the control interaction
* @param {_ol_interaction_} i interaction to associate with the control
*/
ol.control.Toggle.prototype.setInteraction = function(i)
{ this.interaction_ = i;
};
/** Get the control interaction
* @return {_ol_interaction_} interaction associated with the control
*/
ol.control.Toggle.prototype.getInteraction = function()
{ return this.interaction_;
};
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Feature animation base class
* Use the {@link _ol_Map_#animateFeature} or {@link _ol_layer_Vector_#animateFeature} to animate a feature
* on postcompose in a map or a layer
* @constructor
* @fires animationstart|animationend
* @param {ol.featureAnimationOptions} options
* @param {Number} options.duration duration of the animation in ms, default 1000
* @param {bool} options.revers revers the animation direction
* @param {Number} options.repeat number of time to repeat the animation, default 0
* @param {oo.style.Style} options.hiddenStyle a style to display the feature when playing the animation
* to be used to make the feature selectable when playing animation
* (@see {@link ../examples/map.featureanimation.select.html}), default the feature
* will be hidden when playing (and niot selectable)
* @param {ol.easing.Function} options.fade an easing function used to fade in the feature, default none
* @param {ol.easing.Function} options.easing an easing function for the animation, default ol.easing.linear
*/
ol.featureAnimation = function(options)
{ options = options || {};
this.duration_ = typeof (options.duration)=='number' ? (options.duration>=0 ? options.duration : 0) : 1000;
this.fade_ = typeof(options.fade) == 'function' ? options.fade : null;
this.repeat_ = Number(options.repeat);
var easing = typeof(options.easing) =='function' ? options.easing : ol.easing.linear;
if (options.revers) this.easing_ = function(t) { return (1 - easing(t)); };
else this.easing_ = easing;
this.hiddenStyle = options.hiddenStyle;
ol.Object.call(this);
};
ol.inherits(ol.featureAnimation, ol.Object);
/** Draw a geometry
* @param {olx.animateFeatureEvent} e
* @param {ol.geom} geom geometry for shadow
* @param {ol.geom} shadow geometry for shadow (ie. style with zIndex = -1)
* @private
*/
ol.featureAnimation.prototype.drawGeom_ = function (e, geom, shadow)
{ if (this.fade_)
{ e.context.globalAlpha = this.fade_(1-e.elapsed);
}
var style = e.style;
for (var i=0; i<style.length; i++)
{ var sc=0;
// OL < v4.3 : setImageStyle doesn't check retina
var imgs = ol.Map.prototype.getFeaturesAtPixel ? false : style[i].getImage();
if (imgs)
{ sc = imgs.getScale();
imgs.setScale(e.frameState.pixelRatio*sc);
}
// Prevent crach if the style is not ready (image not loaded)
try{
e.vectorContext.setStyle(style[i]);
if (style[i].getZIndex()<0) e.vectorContext.drawGeometry(shadow||geom);
else e.vectorContext.drawGeometry(geom);
} catch(e) {};
if (imgs) imgs.setScale(sc);
}
};
/** Function to perform manipulations onpostcompose.
* This function is called with an ol.featureAnimationEvent argument.
* The function will be overridden by the child implementation.
* Return true to keep this function for the next frame, false to remove it.
* @param {ol.featureAnimationEvent} e
* @return {bool} true to continue animation.
* @api
*/
ol.featureAnimation.prototype.animate = function (e)
{ return false;
};
/** An animation controler object an object to control animation with start, stop and isPlaying function.
* To be used with {@link olx.Map#animateFeature} or {@link ol.layer.Vector#animateFeature}
* @typedef {Object} ol.animationControler
* @property {function} start - start animation.
* @property {function} stop - stop animation option arguments can be passed in animationend event.
* @property {function} isPlaying - return true if animation is playing.
*/
/** Animate feature on a map
* @function
* @fires animationstart, animationend
* @param {ol.Feature} feature Feature to animate
* @param {ol.featureAnimation|Array<ol.featureAnimation>} fanim the animation to play
* @return {olx.animationControler} an object to control animation with start, stop and isPlaying function
*/
ol.Map.prototype.animateFeature =
/** Animate feature on a vector layer
* @fires animationstart, animationend
* @param {ol.Feature} feature Feature to animate
* @param {ol.featureAnimation|Array<ol.featureAnimation>} fanim the animation to play
* @return {olx.animationControler} an object to control animation with start, stop and isPlaying function
*/
ol.layer.Vector.prototype.animateFeature = function(feature, fanim)
{ var self = this;
var listenerKey;
// Save style
var style = feature.getStyle();
var flashStyle = style || (this.getStyleFunction ? this.getStyleFunction()(feature) : null);
if (!flashStyle) flashStyle=[];
if (!(flashStyle instanceof Array)) flashStyle = [flashStyle];
// Hide feature while animating
feature.setStyle(fanim.hiddenStyle || []);
// Structure pass for animating
var event =
{ // Frame context
vectorContext: null,
frameState: null,
start: 0,
time: 0,
elapsed: 0,
extent: false,
// Feature information
feature: feature,
geom: feature.getGeometry(),
typeGeom: feature.getGeometry().getType(),
bbox: feature.getGeometry().getExtent(),
coord: ol.extent.getCenter(feature.getGeometry().getExtent()),
style: flashStyle
};
if (!(fanim instanceof Array)) fanim = [fanim];
// Remove null animations
for (var i=fanim.length-1; i>=0; i--)
{ if (fanim[i].duration_===0) fanim.splice(i,1);
}
var nb=0, step = 0;
function animate(e)
{ event.vectorContext = e.vectorContext;
event.frameState = e.frameState;
if (!event.extent)
{ event.extent = e.frameState.extent;
event.start = e.frameState.time;
event.context = e.context;
}
event.time = e.frameState.time - event.start;
event.elapsed = event.time / fanim[step].duration_;
if (event.elapsed > 1) event.elapsed = 1;
// Stop animation?
if (!fanim[step].animate(event))
{ nb++;
// Repeat animation
if (nb < fanim[step].repeat_)
{ event.extent = false;
}
// newt step
else if (step < fanim.length-1)
{ fanim[step].dispatchEvent({ type:'animationend', feature: feature });
step++;
nb=0;
event.extent = false;
}
// the end
else
{ stop();
}
}
// tell OL3 to continue postcompose animation
e.frameState.animate = true;
}
// Stop animation
function stop(options)
{ ol.Observable.unByKey(listenerKey);
listenerKey = null;
feature.setStyle(style);
// Send event
var event = { type:'animationend', feature: feature };
if (options)
{ for (var i in options) if (options.hasOwnProperty(i))
{ event[i] = options[i];
}
}
fanim[step].dispatchEvent(event);
self.dispatchEvent(event);
}
// Launch animation
function start(options)
{ if (fanim.length && !listenerKey)
{ listenerKey = self.on('postcompose', animate.bind(self));
// map or layer?
if (self.renderSync) self.renderSync();
else self.changed();
// Send event
var event = { type:'animationstart', feature: feature };
if (options)
{ for (var i in options) if (options.hasOwnProperty(i))
{ event[i] = options[i];
}
}
fanim[step].dispatchEvent(event);
self.dispatchEvent(event);
}
}
start();
// Return animation controler
return {
start: start,
stop: stop,
isPlaying: function() { return (!!listenerKey); }
};
};
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Bounce animation:
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationBounceOptions} options
* @param {Integer} options.bounce number of bounce, default 3
* @param {Integer} options.amplitude bounce amplitude,default 40
* @param {ol.easing} options.easing easing used for decaying amplitude, use function(){return 0} for no decay, default ol.easing.linear
* @param {Integer} options.duration duration in ms, default 1000
*/
ol.featureAnimation.Bounce = function(options)
{ options = options || {};
ol.featureAnimation.call(this, options);
this.amplitude_ = options.amplitude || 40;
this.bounce_ = -Math.PI*(options.bounce || 3);
}
ol.inherits(ol.featureAnimation.Bounce, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Bounce.prototype.animate = function (e)
{ // Animate
var flashGeom = e.geom.clone();
/*
var t = this.easing_(e.elapsed)
t = Math.abs(Math.sin(this.bounce_*t)) * this.amplitude_ * (1-t) * e.frameState.viewState.resolution;
*/
var t = Math.abs(Math.sin(this.bounce_*e.elapsed)) * this.amplitude_ * (1-this.easing_(e.elapsed)) * e.frameState.viewState.resolution;
flashGeom.translate(0, t);
this.drawGeom_(e, flashGeom, e.geom);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Drop animation: drop a feature on the map
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationDropOptions} options
* @param {Number} options.speed speed of the feature if 0 the duration parameter will be used instead, default 0
* @param {Number} options.side top or bottom, default top
*/
ol.featureAnimation.Drop = function(options)
{ options = options || {};
this.speed_ = options.speed || 0;
ol.featureAnimation.call(this, options);
this.side_ = options.side || 'top';
}
ol.inherits(ol.featureAnimation.Drop, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Drop.prototype.animate = function (e)
{ // First time > calculate duration / speed
if (!e.time)
{ var angle = e.frameState.viewState.rotation;
var s = e.frameState.size[1] * e.frameState.viewState.resolution;
if (this.side_!='top') s *= -1;
this.dx = -Math.sin(angle)*s;
this.dy = Math.cos(angle)*s;
if (this.speed_)
{ this.duration_ = s/this.speed_/e.frameState.viewState.resolution;
}
}
// Animate
var flashGeom = e.geom.clone();
flashGeom.translate(
this.dx*(1-this.easing_(e.elapsed)),
this.dy*(1-this.easing_(e.elapsed))
);
this.drawGeom_(e, flashGeom, e.geom);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Fade animation: feature fade in
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationOptions} options
*/
ol.featureAnimation.Fade = function(options)
{ options = options || {};
this.speed_ = options.speed || 0;
ol.featureAnimation.call(this, options);
}
ol.inherits(ol.featureAnimation.Fade, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Fade.prototype.animate = function (e)
{ e.context.globalAlpha = this.easing_(e.elapsed);
this.drawGeom_(e, e.geom);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Do nothing for a given duration
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationShowOptions} options
*
*/
ol.featureAnimation.None = function(options)
{ ol.featureAnimation.call(this, options);
};
ol.inherits(ol.featureAnimation.None, ol.featureAnimation);
/** Animate: do nothing during the laps time
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.None.prototype.animate = function (e)
{
return (e.time <= this.duration_);
};
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Do nothing
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationShowOptions} options
*/
ol.featureAnimation.Null = function(options)
{ ol.featureAnimation.call(this, { duration:0 });
};
ol.inherits(ol.featureAnimation.Null, ol.featureAnimation);
/*
Copyright (c) 2016-2018 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Path animation: feature follow a path
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationPathOptions} options extend ol.featureAnimation options
* @param {Number} options.speed speed of the feature, if 0 the duration parameter will be used instead, default 0
* @param {Number|boolean} options.rotate rotate the symbol when following the path, true or the initial rotation, default false
* @param {ol.geom.LineString|ol.Feature} options.path the path to follow
*/
ol.featureAnimation.Path = function(options)
{ options = options || {};
ol.featureAnimation.call(this, options);
this.speed_ = options.speed || 0;
this.path_ = options.path;
switch (options.rotate) {
case true:
case 0:
this.rotate_ = 0;
break;
default:
this.rotate_ = options.rotate || false;
break;
}
if (this.path_ && this.path_.getGeometry) this.path_ = this.path_.getGeometry();
if (this.path_ && this.path_.getLineString) this.path_ = this.path_.getLineString();
if (this.path_.getLength)
{ this.dist_ = this.path_.getLength()
if (this.path_ && this.path_.getCoordinates) this.path_ = this.path_.getCoordinates();
}
else this.dist_ = 0;
if (this.speed_>0) this.duration_ = this.dist_/this.speed_;
}
ol.inherits(ol.featureAnimation.Path, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Path.prototype.animate = function (e)
{ // First time
if (!e.time)
{ if (!this.dist_) return false;
}
var dmax = this.dist_*this.easing_(e.elapsed);
var p0, p, dx,dy, dl, d = 0;
p = this.path_[0];
// Linear interpol
for (var i = 1; i<this.path_.length; i++)
{ p0 = p;
p = this.path_[i];
dx = p[0]-p0[0];
dy = p[1]-p0[1];
dl = Math.sqrt(dx*dx+dy*dy);
if (dl && d+dl>=dmax)
{ var s = (dmax-d)/dl;
p = [ p0[0] + (p[0]-p0[0])*s, p0[1] + (p[1]-p0[1])*s];
break;
}
d += dl;
}
// Rotate symbols
if (this.rotate_!==false) {
var angle = this.rotate_ - Math.atan2(p0[1] - p[1], p0[0] - p[0]);
for (var k=0, s; s=e.style[k]; k++) {
if (s.getImage()) {
s.getImage().setRotation(angle)
}
}
}
e.geom.setCoordinates(p);
// Animate
this.drawGeom_(e, e.geom);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Shakee animation:
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationShakeOptions} options
* @param {Integer} options.bounce number o bounds, default 6
* @param {Integer} options.amplitude amplitude of the animation, default 40
* @param {bool} options.horizontal shake horizontally default false (vertical)
*/
ol.featureAnimation.Shake = function(options)
{ options = options || {};
ol.featureAnimation.call(this, options);
// this.easing_ = options.easing_ || function(t){return (0.5+t)*t -0.5*t ;};
this.amplitude_ = options.amplitude || 40;
this.bounce_ = -Math.PI*(options.bounce || 6);
this.horizontal_ = options.horizontal;
}
ol.inherits(ol.featureAnimation.Shake, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Shake.prototype.animate = function (e)
{ // Animate
var flashGeom = e.geom.clone();
var shadow = e.geom.clone();
var t = this.easing_(e.elapsed)
t = Math.sin(this.bounce_*t) * this.amplitude_ * (1-t) * e.frameState.viewState.resolution;
if (this.horizontal_)
{ flashGeom.translate(t, 0);
shadow.translate(t, 0);
}
else flashGeom.translate(0, t);
this.drawGeom_(e, flashGeom, shadow);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Show an object for a given duration
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationOptions} options
*/
ol.featureAnimation.Show = function(options)
{ ol.featureAnimation.call(this, options);
}
ol.inherits(ol.featureAnimation.Show, ol.featureAnimation);
/** Animate: just show the object during the laps time
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Show.prototype.animate = function (e)
{
this.drawGeom_(e, e.geom);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Slice animation: feature enter from left
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationSlideOptions} options
* @param {Number} options.speed speed of the animation, if 0 the duration parameter will be used instead, default 0
*/
ol.featureAnimation.Slide = function(options)
{ options = options || {};
this.speed_ = options.speed || 0;
ol.featureAnimation.call(this, options);
this.side_ = options.side || 'left';
}
ol.inherits(ol.featureAnimation.Slide, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Slide.prototype.animate = function (e)
{ // First time > calculate duration / speed
if (!e.time)
{ if (this.side_=='left') this.dx = (e.extent[0]-e.bbox[2])
else this.dx = (e.extent[2]-e.bbox[0])
if (this.speed_) this.duration_ = Math.abs(this.dx)/this.speed_/e.frameState.viewState.resolution;
}
// Animate
var flashGeom = e.geom.clone();
flashGeom.translate(this.dx*(1-this.easing_(e.elapsed)), 0);
this.drawGeom_(e, flashGeom);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Teleport a feature at a given place
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationOptions} options
*/
ol.featureAnimation.Teleport = function(options)
{ ol.featureAnimation.call(this, options);
}
ol.inherits(ol.featureAnimation.Teleport, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Teleport.prototype.animate = function (e)
{ var sc = this.easing_(e.elapsed);
if (sc)
{ e.context.save()
var ratio = e.frameState.pixelRatio;
e.context.globalAlpha = sc;
e.context.scale(sc,1/sc);
var m = e.frameState.coordinateToPixelTransform;
var dx = (1/sc-1) * ratio * (m[0]*e.coord[0] + m[1]*e.coord[1] +m[4]);
var dy = (sc-1) * ratio * (m[2]*e.coord[0] + m[3]*e.coord[1] +m[5]);
e.context.translate(dx,dy);
this.drawGeom_(e, e.geom);
e.context.restore()
}
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Slice animation: feature enter from left
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationThrowOptions} options
* @param {left|right} options.side side of the animation, default left
*/
ol.featureAnimation.Throw = function(options)
{ options = options || {};
ol.featureAnimation.call(this, options);
this.speed_ = options.speed || 0;
this.side_ = options.side || 'left';
}
ol.inherits(ol.featureAnimation.Throw, ol.featureAnimation);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Throw.prototype.animate = function (e)
{ // First time > calculate duration / speed
if (!e.time && this.speed_)
{ var dx, dy;
if (this.side_=='left')
{ dx = this.dx = e.extent[0]-e.bbox[2];
dy = this.dy = e.extent[3]-e.bbox[1];
}
else
{ dx = this.dx = e.extent[2]-e.bbox[0];
dy = this.dy = e.extent[3]-e.bbox[1];
}
this.duration_ = Math.sqrt(dx*dx+dy*dy)/this.speed_/e.frameState.viewState.resolution;
}
// Animate
var flashGeom = e.geom.clone();
var shadow = e.geom.clone();
flashGeom.translate(this.dx*(1-this.easing_(e.elapsed)),
this.dy*Math.cos(Math.PI/2*this.easing_(e.elapsed)));
shadow.translate(this.dx*(1-this.easing_(e.elapsed)), 0);
this.drawGeom_(e, flashGeom, shadow);
return (e.time <= this.duration_);
}
/*
Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL license (http://www.cecill.info/).
*/
/** Zoom animation: feature zoom in (for points)
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationZoomOptions} options
* @param {bool} options.zoomOut to zoom out
*/
ol.featureAnimation.Zoom = function(options)
{ options = options || {};
ol.featureAnimation.call(this, options);
this.set('zoomout', options.zoomOut);
}
ol.inherits(ol.featureAnimation.Zoom, ol.featureAnimation);
/** Zoom animation: feature zoom out (for points)
* @constructor
* @extends {ol.featureAnimation}
* @param {ol.featureAnimationZoomOptions} options
*/
ol.featureAnimation.ZoomOut = function(options)
{ options = options || {};
options.zoomOut = true;
ol.featureAnimation.Zoom.call(this, options);
}
ol.inherits(ol.featureAnimation.ZoomOut, ol.featureAnimation.Zoom);
/** Animate
* @param {ol.featureAnimationEvent} e
*/
ol.featureAnimation.Zoom.prototype.animate = function (e)
{ var fac = this.easing_(e.elapsed);
if (fac)
{ if (this.get('zoomout')) fac = 1/fac;
var style = e.style;
var imgs, sc=[]
for (var i=0; i<style.length; i++)
{ imgs = style[i].getImage();
if (imgs)
{ sc[i] = imgs.getScale();
imgs.setScale(sc[i]*fac);
}
}
e.context.save()
var ratio = e.frameState.pixelRatio;
var m = e.frameState.coordinateToPixelTransform;
var dx = (1/fac-1)* ratio * (m[0]*e.coord[0] + m[1]*e.coord[1] +m[4]);
var dy = (1/fac-1)* ratio * (m[2]*e.coord[0] + m[3]*e.coord[1] +m[5]);
e.context.scale(fac,fac);
e.context.translate(dx,dy);
this.drawGeom_(e, e.geom);
e.context.restore()
for (var i=0; i<style.length; i++)
{ imgs = style[i].getImage();
if (imgs) imgs.setScale(sc[i]);
}
}
/*
var sc = this.easing_(e.elapsed);
if (sc)
{ e.context.save()
console.log(e)
var ratio = e.frameState.pixelRatio;
var m = e.frameState.coordinateToPixelTransform;
var dx = (1/(sc)-1)* ratio * (m[0]*e.coord[0] + m[1]*e.coord[1] +m[4]);
var dy = (1/(sc)-1)*ratio * (m[2]*e.coord[0] + m[3]*e.coord[1] +m[5]);
e.context.scale(sc,sc);
e.context.translate(dx,dy);
this.drawGeom_(e, e.geom);
e.context.restore()
}
*/
return (e.time <= this.duration_);
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
ol.filter = {};
/**
* @classdesc
* Abstract base class; normally only used for creating subclasses and not instantiated in apps.
* Used to create filters
* Use {@link _ol_Map_#addFilter}, {@link _ol_Map_#removeFilter} or {@link _ol_Map_#getFilters} to handle filters on a map.
* Use {@link ol.layer.Base#addFilter}, {@link ol.layer.Base#removeFilter} or {@link ol.layer.Base#getFilters}
* to handle filters on layers.
*
* @constructor
* @extends {ol.Object}
* @param {} options Extend {@link _ol_control_Control_} options.
* @param {bool} options.active
*/
ol.filter.Base = function(options) {
ol.Object.call(this);
// Array of postcompose listener
this._listener = [];
if (options && options.active===false) this.set('active', false);
else this.set('active', true);
};
ol.inherits(ol.filter.Base, ol.Object);
/** Activate / deactivate filter
* @param {bool} b
*/
ol.filter.Base.prototype.setActive = function (b) {
this.set('active', b===true);
};
/** Get filter active
* @return {bool}
*/
ol.filter.Base.prototype.getActive = function (b) {
return this.get('active');
};
(function(){
/** Internal function
* @scoop {ol.filter} this the filter
* @private
*/
function precompose_(e)
{ if (this.get('active')) this.precompose(e);
}
/** Internal function
* @scoop {ol.filter} this the filter
* @private
*/
function postcompose_(e) {
if (this.get('active')) this.postcompose(e);
}
/** Force filter redraw / Internal function
* @scoop {ol.map||ol.layer} this: the map or layer the filter is added to
* @private
*/
function filterRedraw_(e) {
if (this.renderSync) this.renderSync();
else this.changed();
}
/** Add a filter to an ol object
* @scoop {ol.map||ol.layer} this: the map or layer the filter is added to
* @private
*/
function addFilter_(filter) {
if (!this.filters_) this.filters_ = [];
this.filters_.push(filter);
if (filter.precompose) filter._listener.push ( { listener: this.on('precompose', precompose_.bind(filter)), target: this });
if (filter.postcompose) filter._listener.push ( { listener: this.on('postcompose', postcompose_.bind(filter)), target: this });
filter._listener.push ( { listener: filter.on('propertychange', filterRedraw_.bind(this)), target: this });
filterRedraw_.call (this);
};
/** Remove a filter to an ol object
* @scoop {ol.map||ol.layer} this: the map or layer the filter is added to
* @private
*/
function removeFilter_(filter) {
if (!this.filters_) this.filters_ = [];
for (var i=this.filters_.length-1; i>=0; i--) {
if (this.filters_[i]===filter) this.filters_.splice(i,1);
}
for (var i=filter._listener.length-1; i>=0; i--) {
// Remove listener on this object
if (filter._listener[i].target === this) {
ol.Observable.unByKey(filter._listener[i].listener);
filter._listener.splice(i,1);
}
}
filterRedraw_.call (this);
};
/** Add a filter to an ol.Map
* @param {ol.filter}
*/
ol.Map.prototype.addFilter = function (filter) {
addFilter_.call (this, filter);
};
/** Remove a filter to an ol.Map
* @param {ol.filter}
*/
ol.Map.prototype.removeFilter = function (filter)
{ removeFilter_.call (this, filter);
};
/** Get filters associated with an ol.Map
* @return {Array<ol.filter>}
*/
ol.Map.prototype.getFilters = function ()
{ return this.filters_;
};
/** Add a filter to an ol.Layer
* @param {ol.filter}
*/
ol.layer.Base.prototype.addFilter = function (filter)
{ addFilter_.call (this, filter);
};
/** Remove a filter to an ol.Layer
* @param {ol.filter}
*/
ol.layer.Base.prototype.removeFilter = function (filter)
{ removeFilter_.call (this, filter);
};
/** Get filters associated with an ol.Map
* @return {Array<ol.filter>}
*/
ol.layer.Base.prototype.getFilters = function ()
{ return this.filters_;
};
})();
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Mask drawing using an ol.Feature
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @param {ol.filter.CropOptions} options
* - feature {ol.Feature} feature to mask with
* - fill {ol.style.Fill} style to fill with
* - inner {bool} mask inner, default false
*/
ol.filter.Mask = function(options)
{ options = options || {};
ol.filter.Base.call(this, options);
if (options.feature)
{ switch (options.feature.getGeometry().getType())
{ case "Polygon":
case "MultiPolygon":
this.feature_ = options.feature;
break;
default: break;
}
}
this.set("inner", options.inner);
this.fillColor_ = options.fill ? ol.color.asString(options.fill.getColor()) || "rgba(0,0,0,0.2)" : "rgba(0,0,0,0.2)";
}
ol.inherits(ol.filter.Mask, ol.filter.Base);
/** Draw the feature into canvas
*/
ol.filter.Mask.prototype.drawFeaturePath_ = function(e, out)
{ var ctx = e.context;
var canvas = ctx.canvas;
var ratio = e.frameState.pixelRatio;
// Transform
var m = e.frameState.coordinateToPixelTransform;
function tr(pt)
{ return [
(pt[0]*m[0]+pt[1]*m[1]+m[4])*ratio,
(pt[0]*m[2]+pt[1]*m[3]+m[5])*ratio
];
}
// Old version
if (!m)
{ m = e.frameState.coordinateToPixelMatrix;
tr = function(pt)
{ return [
(pt[0]*m[0]+pt[1]*m[1]+m[12])*ratio,
(pt[0]*m[4]+pt[1]*m[5]+m[13])*ratio
];
}
}
// Geometry
var ll = this.feature_.getGeometry().getCoordinates();
if (this.feature_.getGeometry().getType()=="Polygon") ll = [ll];
ctx.beginPath();
if (out)
{ ctx.moveTo (0,0);
ctx.lineTo (canvas.width, 0);
ctx.lineTo (canvas.width, canvas.height);
ctx.lineTo (0, canvas.height);
ctx.lineTo (0, 0);
}
for (var l=0; l<ll.length; l++)
{ var c = ll[l];
for (var i=0; i<c.length; i++)
{ var pt = tr(c[i][0]);
ctx.moveTo (pt[0], pt[1]);
for (var j=1; j<c[i].length; j++)
{ pt = tr(c[i][j]);
ctx.lineTo (pt[0], pt[1]);
}
}
}
}
ol.filter.Mask.prototype.postcompose = function(e)
{ if (!this.feature_) return;
var ctx = e.context;
ctx.save();
this.drawFeaturePath_(e, !this.get("inner"));
ctx.fillStyle = this.fillColor_;
ctx.fill("evenodd");
ctx.restore();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Clip layer or map
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @param {ol.filter.ClipOptions} options
* - coords {Array<ol.Coordinate>}
* - extent {ol.Extent}
* - units {%|px} coords units percent or pixel
* - keepAspectRatio {boolean} keep aspect ratio
* - color {string} backgroundcolor
*/
ol.filter.Clip = function(options)
{ options = options || {};
ol.filter.Base.call(this, options);
this.set("coords", options.coords);
this.set("units", options.units);
this.set("keepAspectRatio", options.keepAspectRatio);
this.set("extent", options.extent || [0,0,1,1]);
this.set("color", options.color);
if (!options.extent && options.units!="%" && options.coords)
{ var xmin = Infinity;
var ymin = Infinity;
var xmax = -Infinity;
var ymax = -Infinity;
for (var i=0, p; p=options.coords[i]; i++)
{ if (xmin > p[0]) xmin = p[0];
if (xmax < p[0]) xmax = p[0];
if (ymin > p[1]) ymin = p[1];
if (ymax < p[1]) ymax = p[1];
}
options.extent = [xmin,ymin,xmax,ymax];
}
}
ol.inherits(ol.filter.Clip, ol.filter.Base);
ol.filter.Clip.prototype.clipPath_ = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
var coords = this.get("coords");
if (!coords) return;
var ex = this.get('extent');
var scx = 1, scy = 1;
if (this.get("units")=="%")
{ scx = canvas.width/(ex[2]-ex[0]);
scy = canvas.height/(ex[3]-ex[1]);
}
if (this.get("keepAspectRatio"))
{ scx = scy = Math.min (scx, scy);
}
var pos = this.get('position');
var dx=0, dy=0;
if (/left/.test(pos))
{ dx = -ex[0]*scx;
}
else if (/center/.test(pos))
{ dx = canvas.width/2 - (ex[2]-ex[0])*scx/2;
}
else if (/right/.test(pos))
{ dx = canvas.width - (ex[2]-ex[0])*scx;
}
var fx = function(x) { return x*scx + dx };
if (/top/.test(pos))
{ dy = -ex[1]*scy;
}
else if (/middle/.test(pos))
{ dy = canvas.height/2 - (ex[3]-ex[1])*scy/2;
}
else if (/bottom/.test(pos))
{ dy = canvas.height - (ex[3]-ex[1])*scy;
}
var fy = function(y) { return y*scy + dy; };
ctx.moveTo ( fx(coords[0][0]), fy(coords[0][1]) );
for (var i=1; p=coords[i]; i++)
{ ctx.lineTo ( fx(p[0]), fy(p[1]) );
}
ctx.lineTo ( fx(coords[0][0]), fy(coords[0][1]) );
};
ol.filter.Clip.prototype.precompose = function(e)
{ if (!this.get("color"))
{ e.context.save();
e.context.beginPath();
this.clipPath_(e);
e.context.clip();
}
}
ol.filter.Clip.prototype.postcompose = function(e)
{ if (this.get("color"))
{ var ctx = e.context;
var canvas = e.context.canvas;
ctx.save();
ctx.beginPath();
ctx.moveTo(0,0);
ctx.lineTo(0,canvas.height);
ctx.lineTo(canvas.width, canvas.height);
ctx.lineTo(canvas.width, canvas.height);
ctx.lineTo(canvas.width, 0);
ctx.lineTo(0, 0);
this.clipPath_(e);
ctx.fillStyle = this.get("color");
ctx.fill("evenodd");
};
e.context.restore();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Colorize map or layer
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @author Thomas Tilak https://github.com/thhomas
* @author Jean-Marc Viglino https://github.com/viglino
* @param {ol.filter.ColorizeOptions} options
* - feature {ol.Feature} feature to mask with
* - color {Array<integer>} style to fill with
* - inner {bool} mask inner, default false
*/
ol.filter.Colorize = function(options)
{ ol.filter.Base.call(this, options);
this.setFilter(options);
}
ol.inherits(ol.filter.Colorize, ol.filter.Base);
ol.filter.Colorize.prototype.setFilter = function(options)
{ options = options || {};
switch (options)
{ case "grayscale": options = { operation:'hue', red:0, green:0, blue:0, value:1 }; break;
case "invert": options = { operation:'difference', red:255, green:255, blue:255, value:1 }; break;
case "sepia": options = { operation:'color', red:153, green:102, blue:51, value:0.6 }; break;
default: break;
}
var color = options.color ? ol.color.asArray(options.color) : [ options.red, options.green, options.blue, options.value];
this.set('color', ol.color.asString(color))
this.set ('value', color[3]||1);
switch (options.operation)
{ case 'color':
case 'hue':
case 'difference':
case 'color-dodge':
case 'enhance':
this.set ('operation', options.operation);
break;
case 'saturation':
var v = 255*(options.value || 0);
this.set('color', ol.color.asString([0,0,v,v||1]));
this.set ('operation', options.operation);
break;
case 'luminosity':
var v = 255*(options.value || 0);
this.set('color', ol.color.asString([v,v,v,255]));
//this.set ('operation', 'luminosity')
this.set ('operation', 'hard-light');
break;
case 'contrast':
var v = 255*(options.value || 0);
this.set('color', ol.color.asString([v,v,v,255]));
this.set('operation', 'soft-light');
break;
default:
this.set ('operation', 'color');
break;
}
}
ol.filter.Colorize.prototype.setValue = function(v)
{ this.set ('value', v);
var c = ol.color.asArray(this.get("color"));
c[3] = v;
this.set("color", ol.color.asString(c));
}
ol.filter.Colorize.prototype.setColor = function(c)
{ c = ol.color.asArray(c);
if (c)
{ c[3] = this.get("value");
this.set("color", ol.color.asString(c));
}
}
ol.filter.Colorize.prototype.precompose = function(e)
{}
ol.filter.Colorize.prototype.postcompose = function(e)
{ // Set back color hue
var ctx = e.context;
var canvas = ctx.canvas;
ctx.save();
if (this.get('operation')=='enhance')
{ var v = this.get('value');
if (v)
{ var w = canvas.width;
var h = canvas.height;
ctx.globalCompositeOperation = 'color-burn'
ctx.globalAlpha = v;
ctx.drawImage (canvas, 0, 0, w, h);
ctx.drawImage (canvas, 0, 0, w, h);
ctx.drawImage (canvas, 0, 0, w, h);
}
}
else
{ ctx.globalCompositeOperation = this.get('operation');
ctx.fillStyle = this.get('color');
ctx.fillRect(0,0,canvas.width,canvas.height);
}
ctx.restore();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Colorize map or layer
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @param {ol.filter.CompositeOptions} options
* - operation {string} composite operation
*/
ol.filter.Composite = function(options)
{ ol.filter.Base.call(this, options);
this.set("operation", options.operation || "source-over");
}
ol.inherits(ol.filter.Composite, ol.filter.Base);
/** Change the current operation
* @param {string} operation composite function
*/
ol.filter.Composite.prototype.setOperation = function(operation)
{ this.set('operation', operation || "source-over");
}
ol.filter.Composite.prototype.precompose = function(e)
{ var ctx = e.context;
ctx.save();
ctx.globalCompositeOperation = this.get('operation');
}
ol.filter.Composite.prototype.postcompose = function(e)
{ e.context.restore();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Crop drawing using an ol.Feature
* @constructor
* @requires ol.filter
* @requires ol.filter.Mask
* @extends {ol.filter.Mask}
* @param {ol.filter.CropOptions}
* - feature {_ol_Feature_} feature to crop with
* - inner {bool} crop inner, default false
*/
ol.filter.Crop = function(options)
{ options = options || {};
ol.filter.Mask.call(this, options);
}
ol.inherits(ol.filter.Crop, ol.filter.Mask);
ol.filter.Crop.prototype.precompose = function(e)
{ if (!this.feature_) return;
var ctx = e.context;
ctx.save();
this.drawFeaturePath_(e, this.get("inner"));
ctx.clip("evenodd");
}
ol.filter.Crop.prototype.postcompose = function(e)
{ if (this.feature_) e.context.restore();
}
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Fold filer map
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @param {ol.filter.FoldOptions}
* - fold {Array<int>} number of fold (horizontal and vertical)
* - margin {Number} margin in px, default 8
* - padding {Number} padding in px, default 8
* - fsize {integer|Array<integer>} fold size in px, default 8,10
*/
ol.filter.Fold = function(options)
{ options = options || {};
ol.filter.Base.call(this, options);
this.set("fold", options.fold || [8,4]);
this.set("margin", options.margin || 8);
this.set("padding", options.padding || 8);
if (typeof options.fsize == "number") options.fsize = [options.fsize,options.fsize];
this.set("fsize", options.fsize || [8,10]);
}
ol.inherits(ol.filter.Fold, ol.filter.Base);
ol.filter.Fold.prototype.drawLine_ = function(ctx, d, m)
{ var canvas = ctx.canvas;
var fold = this.get("fold");
var w = canvas.width;
var h = canvas.height;
ctx.beginPath();
ctx.moveTo ( m, m );
for (var i=1; i<=fold[0]; i++)
{ x = i*w/fold[0] - (i==fold[0] ? m : 0);
y = d[1]*(i%2) +m;
ctx.lineTo ( x, y );
}
for (var i=1; i<=fold[1]; i++)
{ x = w - d[0]*(i%2) - m;
y = i*h/fold[1] - (i==fold[1] ? d[0]*(fold[0]%2) + m : 0);
ctx.lineTo ( x, y );
}
for (var i=fold[0]; i>0; i--)
{ x = i*w/fold[0] - (i==fold[0] ? d[0]*(fold[1]%2) + m : 0);
y = h - d[1]*(i%2) -m;
ctx.lineTo ( x, y );
}
for (var i=fold[1]; i>0; i--)
{ x = d[0]*(i%2) + m;
y = i*h/fold[1] - (i==fold[1] ? m : 0);
ctx.lineTo ( x, y );
}
ctx.closePath();
}
ol.filter.Fold.prototype.precompose = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
var fold = this.get("fold");
var w = canvas.width;
var h = canvas.height;
ctx.save();
ctx.shadowColor = "rgba(0,0,0,0.3)";
ctx.shadowBlur = 8;
ctx.shadowOffsetX = 2;
ctx.shadowOffsetY = 3;
this.drawLine_(ctx, this.get("fsize"), this.get("margin"));
ctx.fillStyle="#fff";
ctx.fill();
ctx.strokeStyle = "rgba(0,0,0,0.1)";
ctx.stroke();
ctx.restore();
ctx.save();
this.drawLine_(ctx, this.get("fsize"), this.get("margin") + this.get("padding"));
ctx.clip();
}
ol.filter.Fold.prototype.postcompose = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
ctx.restore();
ctx.save();
this.drawLine_(ctx, this.get("fsize"), this.get("margin"));
ctx.clip();
var fold = this.get("fold");
var w = canvas.width/fold[0];
var h = canvas.height/fold[1];
var grd = ctx.createRadialGradient(5*w/8,5*w/8,w/4,w/2,w/2,w);
grd.addColorStop(0,"transparent");
grd.addColorStop(1,"rgba(0,0,0,0.2)");
ctx.fillStyle = grd;
ctx.scale (1,h/w);
for (var i=0; i<fold[0]; i++) for (var j=0; j<fold[1]; j++)
{ ctx.save()
ctx.translate(i*w, j*w);
ctx.fillRect(0,0,w,w);
ctx.restore()
}
ctx.restore();
}
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Make a map or layer look like made of a set of Lego bricks.
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @param {ol.filter.LegoOptions}
* - brickSize {Number} size of te brick, default 30
* - crossOrigin {null | string | undefined} crossOrigin attribute for loaded images.
*/
ol.filter.Lego = function(options)
{ if (!options) options = {};
ol.filter.Base.call(this, options);
var img = new Image();
// Default image
img.src = this.img[options.img] || this.img.ol3;
img.crossOrigin = options.crossOrigin || null;
// and pattern
this.pattern =
{ canvas: document.createElement('canvas')
};
this.setBrick (options.brickSize, img);
this.internal_ = document.createElement('canvas');
}
ol.inherits(ol.filter.Lego, ol.filter.Base);
/** Image definition
*/
ol.filter.Lego.prototype.img =
{ brick: "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAQAAAAAYLlVAAAAAnNCSVQICFXsRgQAAAAJcEhZcwAAD10AAA9dAah0GUAAAAAZdEVYdFNvZnR3YXJlAHd3dy5pbmtzY2FwZS5vcmeb7jwaAAAGAElEQVRo3sWZy4tkVx3HP+fcc29Vd1dP17TdTcbJPDKPMGR0kVEZkuBCF0EE9Z8QXLhxMUsRF4oLwYWQTSCgSxUXroQhoiEuskgEUUQh+BhHOpkZO11dr3vvefxc3FPlNHNvPbrD1Dl016XoqvM539/znFbcZo3VjbFmxcMA3Mg2fSoAiQJDov7/B1o9+aEgkycv4PBSPU9eHeDEixNwOAFXPYvFia0+rcnQEeBr218cfLIwCqW1UWillEYphUKpCmCCIQAiCEhAJIggTiSISBAfggTvJZTifQghWO+89cOQexuOXN8Pwz/9ff9X/xF0uEA7AmTsjLp/2xZQCgXHlj0OEBEAeRwGkep3qN6pfibDB3DBixMnvdCXt8J3FZowNYFSjgv71RtPaehjD0alalVOqCtHU3qlAGrVAGbidCtUYLUAiV6dCUx8XV4BhUKjY0AJgUB4LE8sA7CkCRSalFYnE72WiBrLSCKCp6TALZNRDEDCwgAKQ/vyRidN9c32K1sbqlCP/C+P9kXJI597PA7HkGJRCLNUGCY767udF9e+9dz1S5ueoRzIEZa1OxcK9td+/fAHvYH0LY6MkgHFIuYwS0ifXe1+qXvn1vk99QfzCwokToUylPrre1/de/vMnf9+5MsSg2HMELegAsl86duvnP3e8y/f1r83v8Li1RO7k/9c2t/avHnt27xpyhRDguEIuxDA3OXXX93+8a0rz6ZvcKgadqUEL73wx+9sb5//WWKTGCOHsxEWM0H71e2ffmF3lPyEkZppVyVYefCw/9a5f3epSvsWh7MMsUgeaL20/dpLu4fJXZUvFCgi46/8i5RNFCCc4bA5JuZ7f/Kp7g9fuLSdvLnY8lEHxz8ItOPcaN7gPAB1tvPl7udupT9nvGSmLLlHSosWLdbJTgpgLna+eVv9hiO1ZIpFOGBEFmejBnrO/tc/0znXTf+sHMuPwD0MrSnETID6/SXPrH/junp3Xiw3atCjxJCRktKu10DHzrZ+pOvpc5cP/6T8CWtt4BATZ4tkBoCvTz8tbTb8TnHiYi/0pgCmPufMUkB1ss9vtU7Trgt9EgyGhIS0zgjRB6RukaSdfHpLPly2xTg2chQJmgRN2qiAa3DBtu5kYXgqAIFYEzTJDAVCnQIqaA+O0wyFjj8q1oY6AB/qd5nLw9JvcpqOOcFMT5dqlg/UAoy5exS2TgGg6DxhkHofqHVCGYf3ho/S904DcHZ6jpZ6lWMY1iogCDxsn8oDduP3BEI9QvSBWgU8YRDeGezsyEk1SNlD8HF51wjQoEAgHNkffXBw+XfJiZbXXCTBT2fZaAJfn4iEEt+z73bTk92jZTxPwOFxVCeGRif0tt4HCtxB+f0P7l//rTlBAN6gjcNicThcfU2NCnjf0NU43L59vf2XZf1A8wzX8JRTgLw+Ckx17SahIZGOyMri7dHalXf6DJdYfovPAgVlRLAzAXwI0gCQU5La8m6SXeH9pi+pWf5lUooIUFKSN6V0A1AE39RyeAYYEpvYNjf4OwP8XNuf50UycnKKKURjSTMALkjzzgpyEhI0LW7ygHvYRh00G7zARQL5dBYU9JtLWvQB52e0VX0MOl5anmOP+3yIjZldpteZijZXuIbBxZ1PAEbkc05GVspZtnX04hlHEDKucpUePYbklCgyNjjDLp9AERhjKSNAQc6IwSzPMQClt37OIeOQ7vQWxJPSZSf2OZMyK1h8jHsbNSgY0Z/tNRWA2HmuVXLIZsxnliw2mROAyR2Rjwmn8vyC0XynrUwQ3PzGs6QX06rDRgD9GIDEjF9pUFLSXyRsowLFIp2/44icDpZ02umq6S3ZxDwupp3hYs1cVMAu1noLBZaMNbJoAD3tl6prOodnTF5feBoBRmGweO8fyClISMlIowkkApRYyqbeZ5YJQrHc4UNieeGYArL8NeUkFcvgJKc/AU56ajxejod+/DT/W/IkQC4P3GoBwoGsFKAf9v2qAGIxej9MU8rTGdNjWtVsJv315aL3YwDYqG5MTDxAPMvTNkJS3ReY6AmtlTrhKsf/AHgAA6ezGE+FAAAAAElFTkSuQmCC",
ol3: "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAQAAAAAYLlVAAAAAnNCSVQICFXsRgQAAAAJcEhZcwAAD10AAA9dAah0GUAAAAAZdEVYdFNvZnR3YXJlAHd3dy5pbmtzY2FwZS5vcmeb7jwaAAAHtUlEQVRo3sWZTWxcVxXHf/d9zIztcTz+pE6cOHXiyLJJadKgKE2oCBLlQwIWSCxYI0WiGxZZIYRAArFAYoEEi0hIsGBBURd0g4iK2lJAaWlaojZVKkU0H26cxB8Zz/f7uPeweHdebDLPnqlQ5l2N5/mN7tz/+Z//OffcM4rPUKCPl0eBAqqfAEAt5Ia1LwCuAg93CyCnAzgj7TstEKMluW+/x0AsWmKBmFggTu4lIpYome2Qw0kA8I2xL9T2Bp5COY6ncJRSDkopFEolANowBEAEATGIGBEkFjEiYkQbI0ZrMaFobYwxkY51pOumpSNTiau6bm7oZX1NP4Ai+ylYADkmGqUPxwSUQsG2ZbcDsBAA2QoGkeSvSZ4kr/alDcRGSyyxbJqqvG5+pHAwbRegVMz+leTBY7qcbTee8vsmQycRmnL6CkD1G4DXFl0fGegvANfpnws8+947AwqFg2MDSjAYzJY80QuAHl2gcPDJF3PiDLiimtIQC0ETEhD3klE8AJeuASg8CgeHir7vLBVOjwypQK3plyoromRNtzSamJg6QbcgvJ7C0J0YnCweG/jek/Ozw5q6bEiFiIHz+wNWBv68+rPNmlQjYnKE1Ai6cYfXA/W5Q6Uvl84f3zel3vH+SIDYoVAeofOdqa9PvbHn/PoDHYZ4eDSpE3fJgLs79YXToz858uxJ5+/en4jQ6hHr5OPZlZHhpcM/4BUv9PFw8agQdQVg1+UHnx/75fG5Gf83lFWGVUrQsmmu/HBsbN8f3Mi1MVLeGUJ3Lig8P/a7s5MN97c01I5+VUIk91err0/fLqFwgBHKOzmimzyQPzX2q1OTZfeianUVKCLNr93EZxiFIOyhnB0Tu6vf/XTp54uzY+4r3S1veYj5CEPBjqFsA3cDoEaLXy199rj/Is0eM2XILXzy5MkzSO6TAvAOFF84qf5KRfWYYhE2aJCzI5MDbxf7B58pTpf89x8qX1yWGKXKFaUBZIF1tWo/KzJPiYi3VAgYbrFEnpiYiBzBTgx0ts99YvDcvHr7YSBJka/Q4k1u3jz5eQ/EYebkXvL241NUeZN/31gkDwibhHjk8PGzTh+OrWw7X/6g/+TB8nuJrQCc4Z/KU08rb+1f/1gCSqy9NUNoP72txtXRb40dfJ+nkgMEZTw78riZLhDRndNP3vGG9GBKnRzhrppmilfhmcWoRYkxyuxv86euUaT24h4W2WN53WQmheB1ygc7MaCKuc+N5LeW6wfOXeUorwFQZIV5RlnbNqcGjBMyaAFUcfHwcHHxOznBakA6JQq34B4dkXtt+8QjvnCQa/Z/jxpFCmdbpPSJI7NyhMVzK/j2UQuFi4OLkz57FECcIcGCU8yZeirQvdxjjuvpTKGAem2EcjpjkjnUC5cvfIm/bRG3Y4e7AwOmEwPKOJotfhvlPj61dGaBEChtAdD88Yeq9et1LqWOUTj2lYzOItSmcxi2ZDXUw+k0n0bqDoXDJBsMM8rHKeIKFbxgIV9nL3cSFlPpZQBoa6AjgCYXK2YkndbckkxmWWfu2D00ozzYNinOlagwbRct/k92zNJARxFK01yur/mX2wDWGE0jfuHyNfa+Y6hQYNsmJQ45hqwwFaPpOVo6s2zDsCMDgsBq2sBR9xj8ZvX70+LJc9w+scA1Sjz49rjMy7zMywE5IY64PMcNDlkHKCbt9xhMZwhOooGODGhMzVyqTUxIm4Pll9797ixnWFZ3WORdSqz//hI+Pv7LT5dXOcNZltUa49y3qplC0Hb5uBMAbwcGDKYS/eLu6YMfrSZCUhWY+QCfGZ7iZYRbarSdYMfd0bvXazh8ii/yF2vcAVwitB1hZirWnROREFLYjN4uLQ5QTZ/WmeA2VwDUHbBks351HRxK3OaqtTTHEQwxmpjkxJApQh111kBAvBH+9O7y/KveFsfcYyNj82qywqZdxmWBAjEREbHdkrNEqNE6o6qJiVeiC4UPHuqg20PvExxGE6YAWp2jwEvabmIyqpoGuTB4ozEwd6lKvYflRzgBBIQWQrQjAG2MZABoEeJH4UU3N8f1rC/psPyz+AQWQEhIK6s09wACk+EC0NTwcCM3KrDAf6ihd6ui2ccxcrRoEaQg6lnQPYDYSLZlAS1cXBzyLHGfW0SZPDgMscgBDK10BARUs48mVgNxtl2GKh6ObVpOM8Uy94hsZpe0nakoMMdhPGJreRtAg9YuJ6NIwp18G7OJsilVyHGIQ2yySZ0WIYocQ+xhknEUhiYRoQUQ0KJBbSfleAChjvQuh4wypbQLovEpMWHrnPY2K0RoG/eR5SCgQXVn1SQAJNpNWiFlhm0+i8jZIrMNoN0j0jbhJMoPaOwu2sQFJt69oRKyadNqTGQBOFsAiM34CQchIdVuwtYyEOgu4jumQosiEX5a6aq0S9Z2T2zTThfdkS0MRN21lISAiBwD5KwDnLReStp0MZomrc4bTyaAhql131gztAhw8cnhWxeIBRASEWbVPju5wAS9/VYgdnthGwPSe5uynYqlpun9EuCTzHt0O67r5uP8teRRAC25H/cXgNmQvgKomhXdLwB2M7pu0pTyeK70mJYUm251sLfo/T8AGEoKes8eIGZ43E5wk36BBwhO2mbqgwZa9C0CAP4LFLGzNDDzmrAAAAAASUVORK5CYII=",
lego: "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAD8AAAA/CAQAAAD9VthUAAAAAnNCSVQICFXsRgQAAAAJcEhZcwAADzoAAA86AZc528IAAAAZdEVYdFNvZnR3YXJlAHd3dy5pbmtzY2FwZS5vcmeb7jwaAAAHvElEQVRYw8WZWWxcVxnHf+fec2fGu+M4qbPH2EmTLk4FApqQNrgiVYyKeClIwBsvPCAQkZAQPND2gRekCoGQEItYHhBLurCksoTKA6QNJW0CBZLWCc3qEBvHy3hsz93O+XiYMxM7nhmPGxGf++Dre2fO7/v+5/u+s4zigzSxVq3osaZNAwzkuq1nPeUrAE9p99JTAKWn5WYEwErpv9TdGbECRlKMgBEjRlIgsqlAKBBaSKUokAjgkcFz+Ce6BvM9sVbKU55WKKWUh1IeoJQCFhsgIIIgIohYEWwq1ooVK9ZasdbG1hhrjUmMsYlZsJEJzYIpmLwZs/8xZ9JpaGYHOYfPyvrChrdbpAxbjFRltCqhnQ2yxBTKf0WQUgNrwYqIFStGUkkllqIU5E/2aQBbEV8pz/ZM3Or8/95UmeUB+J63RiHoAWi1ZHTvNl6pNfXe99Taeq/W1HvuYOzvKG5c4q1afIWHj4eHBwgWwWCQ1aWvBvC8VXngE5DbmO3UxrOeqEhmTFEcPiIiadwEfVttWxmd623tyu7Mfnrjru5cM0Th+Nyp2Z/MztvJNDLkSImZJ27MhNWIr8j1tn+g9at7+/ubivaSHYkmjPF1f+sj7Uc3Xc29VPjm1JSJEzJkCZkjaVT8hvzubDvQ8cz9AwPeG/rHFD3BZkoeTqLwCuqzrQf7nw9+UJhOidEEFAhX0sCJr1fyXm/uPLr5849n/u1/j3mMWtqtYEFm5v/2pXUHdhzNjgaxzunQQzNX3wDdWIT0dT3bP3Qo8wIXSVWNDpWQys2xmW/3fbn1WpAWXUrWNaARvN+/7lu7jzysf8q4siuEh5A8fX5/+8XepLyEs8zfCd7raP/K9scf1T9iQjUUzU+JynOR3TQBgpAS1a16dVtusONTH8kc42ZjcFFKEApcJyBHjizt+O8Wr3e2P7Uv+3curyT7InhJ8nFCMmTJkqWlVlnzVsj0psc69vbrV1SyKnjJgCsEZMiQoanWINcfe39v6xfv808Suu6f5EVlQA7QAcC/1DXp42GmuazOiaJbjjDFSTUNCLOEZMiQEJAjrZYB9b0PmoPe7fpNZQAkYFb1A9CphtWwGlbNkmX/R59TpzhPAAwdf37XKWac1JZJAnc1VSfp0ufSqtK3NT/Y3DJVKZ5tYbHiwfvJAjc5dO7Pw4cZOb4vc51ccvZjh7ZfubaTC8y4evgeAjQaTYCpgZfq06TXpD++Rd6hHHTdZ8JKDs8yAsAD92/gjxSfGNvYzp7Wt3nj6sS2D5NxtXAeHNwnIFpOqSe+bg+2d6ejFXzXS8WlJUSyhBiKoAqj1yFuYQLQZCvFOMLDx8evPFuOF7HV0sqzXmsuP1mJ5tbfVirYc++VITnItvyN8rhJjqIrL7qS50KCX1mWeLXFr5Z02nqiJ2+lXOasIQHJkD75C6DjtQ8dH6Eg99FHyD+LBRclaomnqgL3lo++w4utWsBVbNYtr1htYZFBZgm2299Z5rmXl4+ZtwaPjDlt9CJ0gIeqXNXFN7WKDtMLnW1y+9e6Txc5z2le25Te0BTVic89ovf3yIXE1QeP4FbJbmCla21V723evjklncued/0mZA6AcEABfH/6rXzb2IM5fJD1zLvIB02zm3ak+iK0hK8mvmBnzA/Hoy3LJoyW4XIITn5daAbaX0w3XBnIIsCBL7zDpFNvPWoRvBY+larBZ5Gb6eX20xXxf/2QDMkgmc+sl8MyJH2cf/Seka3yGFv+kR7Ok/1riwxhvruJUYffhGCxWKS0IqqReFXFN5g583qaNokC0aSf/JUaVn95ufNrJ9SwGlapMkkUXuPMAy/E24CJbQVeVWeIXDAFbEYwWCymes3XAMZW9d5gC8k3Rn++79hJjErvvcBB0P53/sBBAOa5knmdnWwlywlQZ7mHfQivOsd6yVDEkGIwxDVrfo2yY4nJ5tMTLe9rkYKSkUtcEqXk9/DKok9d5nLlfpzxyn0Tu7Gk7jLVNx8eQFw98oUi6Vz07NiZ3c/4y+bz+i1gHxliEhJnQFKn6MbVu01ISRaSX2b8vk/4q4D77GErCTGxM2EBW1P8pLr4YJkjiKORhZ91hR1qpsG9m89O9pASOXxMXF6wrCb0ACIidBJe8ZNdjHID24DsA/RhCImInAnztQqr897UeI1lDp3ToU8TO2jiat39q0cLD7GJlNBdERFhLd8dPjamtldx98K8dhNGD91cZ6zKPl6hyNJPP5rYIcsGFGprVva+Nl4GF455lVzI0UcvU0ySX7R5aKabHnrwMRSJlhiQr7fT1QCprYPnmKHgzjQtliwZNrIZHyHBkHHLSMG4KI+JK6Lna+9wFuETUzecLAUHN6QkBARofHwCFImr6Mbld+Lw0Upwhy/acKWUMswS07YI77tllHJTqsW4t4lLtcLKBwyl0JN05YQSiqS0knW+a7eGu4W3rrgmJMwRNpCkLvRsaBoqKAkzZGgi66S/HV+Sf4GQxvor4xPbYDkVIuLS2RZ6CV4wRMQkNNpXGb9go1V8BSElJXRrWIXCupM9We2hvMPPG1bbaqxf3sWhamTzhjVpHsCc/a9dQ3xo82uJL9jRNRLfTTnnBO+u/pTkLT5c8fPNd9nt5tLmRbsVynbsXR704Bbeq775v0uht3btfyZT7OA5knjdAAAAAElFTkSuQmCC"
};
/** Overwrite to handle brickSize
* @param {string} key
* @param {} val
*/
ol.filter.Lego.prototype.set = function (key, val)
{ ol.filter.Base.prototype.set.call(this, key, val);
if (key=="brickSize" && this.pattern.canvas.width!=val)
{ this.setBrick(val);
}
}
/** Set the current brick
* @param {Number} width the pattern width, default 30
* @param {brick|ol3|lego|undefined} img the pattern, default ol3
* @param {string} crossOrigin
*/
ol.filter.Lego.prototype.setBrick = function (width, img, crossOrigin)
{ width = Number(width) || 30;
if (typeof(img) === 'string')
{ var i = new Image;
i.src = this.img[img] || this.img.ol3;
i.crossOrigin = crossOrigin || null;
img = i;
}
if (img) this.pattern.img = img;
if (!this.pattern.img.width)
{ var self = this;
this.pattern.img.onload = function()
{ self.setBrick(width,img);
}
return;
}
this.pattern.canvas.width = this.pattern.canvas.height = width;
this.pattern.ctx = this.pattern.canvas.getContext("2d");
this.pattern.ctx.fillStyle = this.pattern.ctx.createPattern (this.pattern.img, 'repeat');
this.set("brickSize", width);
this.set("img", img.src);
};
/** Get translated pattern
* @param {number} offsetX x offset
* @param {number} offsetY y offset
*/
ol.filter.Lego.prototype.getPattern = function (offsetX, offsetY)
{
if (!this.pattern.ctx) return "transparent";
//return this.pattern.ctx.fillStyle
var c = this.pattern.canvas;
var ctx = this.pattern.ctx;
var sc = c.width / this.pattern.img.width;
ctx.save();
ctx.clearRect(0,0,c.width,c.height);
ctx.scale(sc,sc);
offsetX /= sc;
offsetY /= sc;
ctx.translate(offsetX, offsetY);
ctx.beginPath();
ctx.clearRect(-2*c.width, -2*c.height, 4*c.width, 4*c.height);
ctx.rect(-offsetX, -offsetY, 2*c.width/sc, 2*c.height/sc);
ctx.fill();
ctx.restore();
return ctx.createPattern(c, 'repeat');
};
/** Postcompose operation
*/
ol.filter.Lego.prototype.postcompose = function(e)
{ // Set back color hue
var ctx = e.context;
var canvas = ctx.canvas;
var ratio = e.frameState.pixelRatio;
ctx.save();
// resize
var step = this.pattern.canvas.width*ratio, step2 = step/2;
var p = e.frameState.extent;
var res = e.frameState.viewState.resolution/ratio;
var offset = [ -Math.round((p[0]/res)%step), Math.round((p[1]/res)%step) ];
var ctx2 = this.internal_.getContext("2d");
var w = this.internal_.width = canvas.width;
var h = this.internal_.height = canvas.height;
// No smoothing please
ctx2.webkitImageSmoothingEnabled =
ctx2.mozImageSmoothingEnabled =
ctx2.msImageSmoothingEnabled =
ctx2.imageSmoothingEnabled = false;
var w2 = Math.floor((w-offset[0])/step);
var h2 = Math.floor((h-offset[1])/step);
ctx2.drawImage (canvas, offset[0], offset[1], w2*step, h2*step, 0, 0, w2, h2);
//
ctx.webkitImageSmoothingEnabled =
ctx.mozImageSmoothingEnabled =
ctx.msImageSmoothingEnabled =
ctx.imageSmoothingEnabled = false;
ctx.clearRect (0, 0, w,h);
ctx.drawImage (this.internal_, 0,0, w2,h2, offset[0],offset[1], w2*step, h2*step);
/*
for (var x=offset[0]; x<w; x+=step) for (var y=offset[1]; y<h; y+=step)
{ if (x>=0 && y<h) ctx2.drawImage (canvas, x, y, 1, 1, x, y, step, step);
}
ctx.clearRect (0, 0, w,h);
ctx.drawImage (c, 0, 0);
*/
// Draw brick stud
ctx.scale(ratio,ratio);
ctx.fillStyle = this.getPattern (offset[0]/ratio, offset[1]/ratio);
ctx.rect(0,0, w, h);
ctx.fill();
ctx.restore();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Add texture effects on maps or layers
* @constructor
* @requires ol.filter
* @extends {ol.filter.Base}
* @param {ol.filter.TextureOptions} options
* - feature {_ol_Feature_} feature to mask with
* - fill {_ol_style_Fill_} style to fill with
* - inner {bool} mask inner, default false
*/
ol.filter.Texture = function(options)
{ ol.filter.Base.call(this, options);
this.setFilter(options);
}
ol.inherits(ol.filter.Texture, ol.filter.Base);
/** Set texture
* @option {ol.filter.TextureOptions}
* - img {Image | undefined} Image object for the texture
* - src {string} Image source URI
* - scale {number} scale to draw the image. Default 1.
* - rotateWithView {bool} Whether to rotate the texture with the view (may cause animation lags on mobile or slow devices). Default is true.
* - crossOrigin {null | string | undefined} The crossOrigin attribute for loaded images.
*/
ol.filter.Texture.prototype.setFilter = function(options)
{ var img;
options = options || {};
if (options.img) img = option.img;
else
{ img = new Image();
if (options.src) {
// Look for a texture stored in ol.filter.Texture.Image
if (ol.filter.Texture.Image && ol.filter.Texture.Image[options.src]) {
img.src = ol.filter.Texture.Image[options.src];
}
// default source
else {
if (!img.src) img.src = options.src;
}
}
img.crossOrigin = options.crossOrigin || null;
}
this.set('rotateWithView', options.rotateWithView !== false);
this.set('opacity', typeof(options.opacity)=='number' ? options.opacity : 1);
this.set('ready', false);
var self = this;
function setPattern(img)
{ self.pattern = {};
self.pattern.scale = options.scale || 1;
self.pattern.canvas = document.createElement('canvas');
self.pattern.canvas.width = img.width * self.pattern.scale;
self.pattern.canvas.height = img.height * self.pattern.scale;
self.pattern.canvas.width = img.width;// * self.pattern.scale;
self.pattern.canvas.height = img.height;// * self.pattern.scale;
self.pattern.ctx = self.pattern.canvas.getContext("2d");
self.pattern.ctx.fillStyle = self.pattern.ctx.createPattern(img, 'repeat');
// Force refresh
self.set('ready', true);
};
if (img.width)
{ setPattern(img);
}
else
{ img.onload = function()
{ setPattern(img);
}
}
}
/** Get translated pattern
* @param {number} x offset
* @param {number} y offset
*/
ol.filter.Texture.prototype.getPattern = function (offsetX, offsetY)
{ var c = this.pattern.canvas;
var ctx = this.pattern.ctx;
ctx.save();
/*
offsetX /= this.pattern.scale;
offsetY /= this.pattern.scale;
ctx.scale(this.pattern.scale,this.pattern.scale);
*/
ctx.translate(-offsetX, offsetY);
ctx.beginPath();
ctx.rect(offsetX, -offsetY, c.width, c.height);
ctx.fill();
ctx.restore();
return ctx.createPattern(c, 'repeat');
}
/** Draw pattern over the map on postcompose
*/
ol.filter.Texture.prototype.postcompose = function(e)
{ // not ready
if (!this.pattern) return;
// Set back color hue
var ctx = e.context;
var canvas = ctx.canvas;
var m = 1.5 * Math.max(canvas.width, canvas.height);
var mt = e.frameState.pixelToCoordinateTransform;
// Old version (matrix)
if (!mt)
{ mt = e.frameState.pixelToCoordinateMatrix,
mt[2] = mt[4];
mt[3] = mt[5];
mt[4] = mt[12];
mt[5] = mt[13];
}
var ratio = e.frameState.pixelRatio;
var res = e.frameState.viewState.resolution;
var w = canvas.width/2,
h = canvas.height/2;
ctx.save();
ctx.globalCompositeOperation = "multiply";
//ctx.globalCompositeOperation = "overlay";
//ctx.globalCompositeOperation = "color";
ctx.globalAlpha = this.get('opacity');
ctx.scale(ratio*this.pattern.scale,ratio*this.pattern.scale);
if (this.get('rotateWithView'))
{ // Translate pattern
res *= this.pattern.scale
ctx.fillStyle = this.getPattern ((w*mt[0] + h*mt[1] + mt[4])/res, (w*mt[2] + h*mt[3] + mt[5])/res);
// Rotate on canvas center and fill
ctx.translate(w/this.pattern.scale, h/this.pattern.scale);
ctx.rotate(e.frameState.viewState.rotation);
ctx.beginPath();
ctx.rect(-w-m, -h-m, 2*m, 2*m);
ctx.fill();
}
else
{
/**/
var dx = -(w*mt[0] + h*mt[1] + mt[4])/res;
var dy = (w*mt[2] + h*mt[3] + mt[5])/res;
var cos = Math.cos(e.frameState.viewState.rotation);
var sin = Math.sin(e.frameState.viewState.rotation);
var offsetX = (dx*cos - dy*sin) / this.pattern.scale;
var offsetY = (dx*sin + dy*cos) / this.pattern.scale;
ctx.translate(offsetX, offsetY);
ctx.beginPath();
ctx.fillStyle = this.pattern.ctx.fillStyle;
ctx.rect(-offsetX -m , -offsetY -m, 2*m, 2*m);
ctx.fill();
/* //old version without centered rotation
var offsetX = -(e.frameState.extent[0]/res) % this.pattern.canvas.width;
var offsetY = (e.frameState.extent[1]/res) % this.pattern.canvas.height;
ctx.rotate(e.frameState.viewState.rotation);
ctx.translate(offsetX, offsetY);
ctx.beginPath();
ctx.fillStyle = this.pattern.ctx.fillStyle
ctx.rect(-offsetX -m , -offsetY -m, 2*m, 2*m);
ctx.fill();
*/
}
ctx.restore();
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Handles coordinates on the center of the viewport.
* It can be used as abstract base class used for creating subclasses.
* The CenterTouch interaction modifies map browser event coordinate and pixel properties to force pointer on the viewport center to any interaction that them.
* Only pointermove pointerup are concerned with it.
* @constructor
* @extends {ol.interaction.Interaction}
* @param {olx.interaction.InteractionOptions} options Options
* - targetStyle {ol.style.Style|Array<ol.style.Style>} a style to draw the target point, default cross style
* - composite {string} composite operation : difference|multiply|xor|screen|overlay|darken|lighter|lighten|...
*/
ol.interaction.CenterTouch = function(options)
{ options = options || {};
// LIst of listerner on the object
this._listener = {};
// Filter event
var rex = /^pointermove$|^pointerup$/;
// Default style = cross
this.targetStyle = options.targetStyle ||
[ new ol.style.Style({ image: new ol.style.RegularShape ({ points: 4, radius: 11, radius1: 0, radius2: 0, snapToPixel:true, stroke: new ol.style.Stroke({ color: "#fff", width:3 }) }) }),
new ol.style.Style({ image: new ol.style.RegularShape ({ points: 4, radius: 11, radius1: 0, radius2: 0, snapToPixel:true, stroke: new ol.style.Stroke({ color: "#000", width:1 }) }) })
];
if (!(this.targetStyle instanceof Array)) this.targetStyle = [this.targetStyle];
this.composite = options.composite || '';
// Interaction to defer center on top of the interaction
// this is done to enable other coordinates manipulation inserted after the interaction (snapping)
this.ctouch = new ol.interaction.Interaction(
{ handleEvent: function(e)
{ if (rex.test(e.type) && this.getMap())
{ e.coordinate = this.getMap().getView().getCenter();
e.pixel = this.getMap().getSize();
e.pixel = [ e.pixel[0]/2, e.pixel[1]/2 ];
}
return true;
}
});
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ if (rex.test(e.type)) this.pos_ = e.coordinate;
if (options.handleEvent) return options.handleEvent.call (this,e);
return true;
}
});
};
ol.inherits(ol.interaction.CenterTouch, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.interaction.CenterTouch.prototype.setMap = function(map)
{ if (this.getMap())
{ this.getMap().removeInteraction(this.ctouch);
}
if (this._listener.drawtarget) ol.Observable.unByKey(this._listener.drawtarget);
this._listener.drawtarget = null;
ol.interaction.Interaction.prototype.setMap.call (this, map);
if (this.getMap())
{ if (this.getActive()) this.getMap().addInteraction(this.ctouch);
this._listener.drawtarget = this.getMap().on('postcompose', this.drawTarget_.bind(this));
}
};
/**
* Activate or deactivate the interaction.
* @param {boolean} active Active.
* @observable
* @api
*/
ol.interaction.CenterTouch.prototype.setActive = function(b)
{ ol.interaction.Interaction.prototype.setActive.call (this, b);
this.pos_ = null;
if (this.getMap())
{ if (this.getActive())
{ this.getMap().addInteraction(this.ctouch);
}
else this.getMap().removeInteraction(this.ctouch);
}
};
/** Get the position of the target
*/
ol.interaction.CenterTouch.prototype.getPosition = function (e)
{ if (!this.pos_)
{ var px =this.getMap().getSize();
px = [ px[0]/2, px[1]/2 ];
this.pos_ = this.getMap().getCoordinateFromPixel(px);
}
return this.pos_;
};
/** Draw the target
* @private
*/
ol.interaction.CenterTouch.prototype.drawTarget_ = function (e)
{ if (!this.getMap() || !this.getActive()) return;
var ctx = e.context;
var ratio = e.frameState.pixelRatio;
ctx.save();
var cx = ctx.canvas.width/(2*ratio);
var cy = ctx.canvas.height/(2*ratio);
var geom = new ol.geom.Point (this.getMap().getCoordinateFromPixel([cx,cy]));
if (this.composite) ctx.globalCompositeOperation = this.composite;
for (var i=0; i<this.targetStyle.length; i++)
{ var style = this.targetStyle[i];
if (style instanceof ol.style.Style)
{ var sc=0;
// OL < v4.3 : setImageStyle doesn't check retina
var imgs = ol.Map.prototype.getFeaturesAtPixel ? false : style.getImage();
if (imgs)
{ sc = imgs.getScale();
imgs.setScale(ratio*sc);
}
e.vectorContext.setStyle(style);
e.vectorContext.drawGeometry(geom);
if (imgs) imgs.setScale(sc);
}
}
ctx.restore();
};
/** Clip interaction to clip layers in a circle
* @constructor
* @extends {ol.interaction.Pointer}
* @param {ol.interaction.Clip.options} options flashlight param
* - radius {number} radius of the clip, default 100
* - layers {ol.layer|Array<ol.layer>} layers to clip
*/
ol.interaction.Clip = function(options) {
this.layers_ = [];
ol.interaction.Pointer.call(this,
{ handleDownEvent: this.setPosition,
handleMoveEvent: this.setPosition
});
// Default options
options = options || {};
this.pos = false;
this.radius = (options.radius||100);
if (options.layers) this.addLayer(options.layers);
};
ol.inherits(ol.interaction.Clip, ol.interaction.Pointer);
/** Set the map > start postcompose
*/
ol.interaction.Clip.prototype.setMap = function(map) {
if (this.getMap()) {
for (var i=0; i<this.layers_.length; i++) {
if (this.layers_[i].precompose) ol.Observable.unByKey(this.layers_[i].precompose);
if (this.layers_[i].postcompose) ol.Observable.unByKey(this.layers_[i].postcompose);
this.layers_[i].precompose = this.layers_[i].postcompose = null;
}
this.getMap().renderSync();
}
ol.interaction.Pointer.prototype.setMap.call(this, map);
if (map) {
for (var i=0; i<this.layers_.length; i++) {
this.layers_[i].precompose = this.layers_[i].layer.on('precompose', this.precompose_.bind(this));
this.layers_[i].postcompose = this.layers_[i].layer.on('postcompose', this.postcompose_.bind(this));
}
map.renderSync();
}
}
/** Set clip radius
* @param {integer} radius
*/
ol.interaction.Clip.prototype.setRadius = function(radius)
{ this.radius = radius;
if (this.getMap()) this.getMap().renderSync();
}
/** Add a layer to clip
* @param {ol.layer|Array<ol.layer>} layer to clip
*/
ol.interaction.Clip.prototype.addLayer = function(layers)
{ if (!(layers instanceof Array)) layers = [layers];
for (var i=0; i<layers.length; i++) {
var l = { layer: layers[i] }
if (this.getMap()) {
l.precompose = layers[i].on('precompose', this.precompose_.bind(this));
l.postcompose = layers[i].on('postcompose', this.postcompose_.bind(this));
this.getMap().renderSync();
}
this.layers_.push(l);
}
}
/** Remove a layer to clip
* @param {ol.layer|Array<ol.layer>} layer to clip
*/
ol.interaction.Clip.prototype.removeLayer = function(layers)
{ if (!(layers instanceof Array)) layers = [layers];
for (var i=0; i<layers.length; i++)
{ var k;
for (k=0; k<this.layers_.length; k++)
{ if (this.layers_[k].layer===layers[i])
{ break;
}
}
if (k!=this.layers_.length && this.getMap())
{ if (this.layers_[k].precompose) ol.Observable.unByKey(this.layers_[k].precompose);
if (this.layers_[k].postcompose) ol.Observable.unByKey(this.layers_[k].postcompose);
this.layers_.splice(k,1);
this.getMap().renderSync();
}
}
}
/** Set position of the clip
* @param {ol.Pixel|ol.MapBrowserEvent}
*/
ol.interaction.Clip.prototype.setPosition = function(e)
{ if (e.pixel) this.pos = e.pixel;
else
{ if (e && e instanceof Array) this.pos = e;
else e = [-10000000,-10000000];
}
if (this.getMap()) this.getMap().renderSync();
}
/* @private
*/
ol.interaction.Clip.prototype.precompose_ = function(e)
{ var ctx = e.context;
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.beginPath();
ctx.arc (this.pos[0]*ratio, this.pos[1]*ratio, this.radius*ratio, 0, 2*Math.PI);
ctx.clip();
}
/* @private
*/
ol.interaction.Clip.prototype.postcompose_ = function(e)
{ e.context.restore();
};
/**
* Activate or deactivate the interaction.
* @param {boolean} active Active.
* @observable
* @api
*/
ol.interaction.Clip.prototype.setActive = function(b)
{ ol.interaction.Pointer.prototype.setActive.call (this, b);
if(b) {
for(var i=0; i<this.layers_.length; i++) {
this.layers_[i].precompose = this.layers_[i].layer.on('precompose', this.precompose_.bind(this));
this.layers_[i].postcompose = this.layers_[i].layer.on('postcompose', this.postcompose_.bind(this));
}
} else {
for(var i=0; i<this.layers_.length; i++) {
if (this.layers_[i].precompose) ol.Observable.unByKey(this.layers_[i].precompose);
if (this.layers_[i].postcompose) ol.Observable.unByKey(this.layers_[i].postcompose);
this.layers_[i].precompose = this.layers_[i].postcompose = null;
}
}
if (this.getMap()) this.getMap().renderSync();
}
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction draw hole
* @constructor
* @extends {ol.interaction.Interaction}
* @fires drawstart, drawend
* @param {olx.interaction.DrawHoleOptions} options extend olx.interaction.DrawOptions
* @param {Array<ol.layer.Vector> | undefined} options.layers A list of layers from which polygons should be selected. Alternatively, a filter function can be provided. default: all visible layers
*/
ol.interaction.DrawHole = function(options)
{ if (!options) options = {};
var self = this;
// Select interaction for the current feature
this._select = new ol.interaction.Select();
this._select.setActive(false);
// Geometry function that test points inside the current
var geometryFn, geomFn = options.geometryFunction;
if (geomFn)
{ geometryFn = function(c,g)
{ g = self._geometryFn (c, g);
return geomFn (c,g);
}
}
else
{ geometryFn = function(c,g) { return self._geometryFn (c, g); }
}
// Create draw interaction
options.type = "Polygon";
options.geometryFunction = geometryFn;
ol.interaction.Draw.call(this, options);
// Layer filter function
if (options.layers)
{ if (typeof (options.layers) === 'function') this.layers_ = options.layers;
else if (options.layers.indexOf)
{ this.layers_ = function(l)
{ return (options.layers.indexOf(l) >= 0);
};
}
}
// Start drawing if inside a feature
this.on('drawstart', this._startDrawing.bind(this));
// End drawing add the hole to the current Polygon
this.on('drawend', this._finishDrawing.bind(this));
};
ol.inherits(ol.interaction.DrawHole, ol.interaction.Draw);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.DrawHole.prototype.setMap = function(map)
{ if (this.getMap()) this.getMap().removeInteraction(this._select);
if (map) map.addInteraction(this._select);
ol.interaction.Draw.prototype.setMap.call (this, map);
};
/**
* Activate/deactivate the interaction
* @param {boolean}
* @api stable
*/
ol.interaction.DrawHole.prototype.setActive = function(b)
{ this._select.getFeatures().clear();
ol.interaction.Draw.prototype.setActive.call (this, b);
};
/**
* Remove last point of the feature currently being drawn
* (test if points to remove before).
*/
ol.interaction.DrawHole.prototype.removeLastPoint = function()
{ if (this._feature && this._feature.getGeometry().getCoordinates()[0].length>2)
{ ol.interaction.Draw.prototype.removeLastPoint.call(this);
}
};
/**
* Get the current polygon to hole
* @return {ol.Feature}
*/
ol.interaction.DrawHole.prototype.getPolygon = function()
{ return this._polygon;
// return this._select.getFeatures().item(0).getGeometry();
};
/**
* Get current feature to add a hole and start drawing
* @param {ol.interaction.Draw.Event} e
* @private
*/
ol.interaction.DrawHole.prototype._startDrawing = function(e)
{ var map = this.getMap();
var layersFilter = this.layers_;
this._feature = e.feature;
var coord = e.feature.getGeometry().getCoordinates()[0][0];
// Check object under the pointer
var features = map.getFeaturesAtPixel(
map.getPixelFromCoordinate(coord),
{ layerFilter: layersFilter
}
);
var current = null;
if (features)
{ var poly = features[0].getGeometry();
if (poly.getType() === "Polygon"
&& poly.intersectsCoordinate(coord)) {
this._polygonIndex = false;
this._polygon = poly;
current = features[0];
}
else if (poly.getType() === "MultiPolygon"
&& poly.intersectsCoordinate(coord)) {
for (var i=0, p; p=poly.getPolygon(i); i++) {
if (p.intersectsCoordinate(coord)) {
this._polygonIndex = i;
this._polygon = p;
current = features[0];
break;
}
}
}
else current = null;
}
console.log(this._polygonIndex)
this._select.getFeatures().clear();
if (!current)
{ this.setActive(false);
this.setActive(true);
}
else
{ this._select.getFeatures().push(current);
}
};
/**
* Stop drawing and add the sketch feature to the target feature.
* @param {ol.interaction.Draw.Event} e
* @private
*/
ol.interaction.DrawHole.prototype._finishDrawing = function(e)
{ // The feature is the hole
e.hole = e.feature;
// Get the current feature
e.feature = this._select.getFeatures().item(0);
// Create the hole
var c = e.hole.getGeometry().getCoordinates()[0];
if (c.length > 3) {
if (this._polygonIndex!==false) {
var geom = e.feature.getGeometry();
var newGeom = new ol.geom.MultiPolygon();
for (var i=0, pi; pi=geom.getPolygon(i); i++) {
if (i===this._polygonIndex) {
pi.appendLinearRing(new ol.geom.LinearRing(c));
newGeom.appendPolygon(pi);
}
else newGeom.appendPolygon(pi);
}
e.feature.setGeometry(newGeom);
} else {
this.getPolygon().appendLinearRing(new ol.geom.LinearRing(c));
}
}
// reset
this._feature = null;
this._select.getFeatures().clear();
};
/**
* Function that is called when a geometry's coordinates are updated.
* @param {Array<ol.coordinate>} coordinates
* @param {ol.geom.Polygon} geometry
* @return {ol.geom.Polygon}
* @private
*/
ol.interaction.DrawHole.prototype._geometryFn = function(coordinates, geometry)
{ var coord = coordinates[0].pop();
if (!this.getPolygon() || this.getPolygon().intersectsCoordinate(coord))
{ this.lastOKCoord = [coord[0],coord[1]];
}
coordinates[0].push([this.lastOKCoord[0],this.lastOKCoord[1]]);
if (geometry)
{ geometry.setCoordinates([coordinates[0].concat([coordinates[0][0]])]);
}
else
{ geometry = new ol.geom.Polygon(coordinates);
}
return geometry;
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction rotate
* @constructor
* @extends {ol.interaction.Interaction}
* @fires drawstart, drawing, drawend, drawcancel
* @param {olx.interaction.TransformOptions} options
* @param {Array<ol.Layer>} source Destination source for the drawn features
* @param {ol.Collection<ol.Feature>} features Destination collection for the drawn features
* @param {ol.style.Style | Array.<ol.style.Style> | ol.style.StyleFunction | undefined} style style for the sketch
* @param {integer} sides number of sides, default 0 = circle
* @param { ol.events.ConditionType | undefined } squareCondition A function that takes an ol.MapBrowserEvent and returns a boolean to draw square features.
* @param { ol.events.ConditionType | undefined } centerCondition A function that takes an ol.MapBrowserEvent and returns a boolean to draw centered features.
* @param { bool } canRotate Allow rotation when centered + square, default: true
* @param { number } clickTolerance click tolerance on touch devices, default: 6
* @param { number } maxCircleCoordinates Maximum number of point on a circle, default: 100
*/
ol.interaction.DrawRegular = function(options)
{ if (!options) options={};
var self = this;
this.squaredClickTolerance_ = options.clickTolerance ? options.clickTolerance * options.clickTolerance : 36;
this.maxCircleCoordinates_ = options.maxCircleCoordinates || 100;
// Collection of feature to transform
this.features_ = options.features;
// List of layers to transform
this.source_ = options.source;
// Square condition
this.squareFn_ = options.squareCondition;
// Centered condition
this.centeredFn_ = options.centerCondition;
// Allow rotation when centered + square
this.canRotate_ = (options.canRotate !== false);
// Specify custom geometry name
this.geometryName_ = options.geometryName
// Number of sides (default=0: circle)
this.setSides(options.sides);
// Style
var white = [255, 255, 255, 1];
var blue = [0, 153, 255, 1];
var width = 3;
var defaultStyle = [
new ol.style.Style({
stroke: new ol.style.Stroke({ color: white, width: width + 2 })
}),
new ol.style.Style({
image: new ol.style.Circle({
radius: width * 2,
fill: new ol.style.Fill({ color: blue }),
stroke: new ol.style.Stroke({ color: white, width: width / 2 })
}),
stroke: new ol.style.Stroke({ color: blue, width: width }),
fill: new ol.style.Fill({
color: [255, 255, 255, 0.5]
})
})
];
// Create a new overlay layer for the sketch
this.sketch_ = new ol.Collection();
this.overlayLayer_ = new ol.layer.Vector(
{ source: new ol.source.Vector({
features: this.sketch_,
useSpatialIndex: false
}),
name:'DrawRegular overlay',
displayInLayerSwitcher: false,
style: options.style || defaultStyle
});
ol.interaction.Interaction.call(this,
{
/*
handleDownEvent: this.handleDownEvent_,
handleMoveEvent: this.handleMoveEvent_,
handleUpEvent: this.handleUpEvent_,
*/
handleEvent: this.handleEvent_
});
};
ol.inherits(ol.interaction.DrawRegular, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.DrawRegular.prototype.setMap = function(map)
{ if (this.getMap()) this.getMap().removeLayer(this.overlayLayer_);
ol.interaction.Interaction.prototype.setMap.call (this, map);
this.overlayLayer_.setMap(map);
};
/**
* Activate/deactivate the interaction
* @param {boolean}
* @api stable
*/
ol.interaction.DrawRegular.prototype.setActive = function(b)
{ this.reset();
ol.interaction.Interaction.prototype.setActive.call (this, b);
}
/**
* Reset the interaction
* @api stable
*/
ol.interaction.DrawRegular.prototype.reset = function()
{ this.overlayLayer_.getSource().clear();
this.started_ = false;
}
/**
* Set the number of sides.
* @param {int} number of sides.
* @api stable
*/
ol.interaction.DrawRegular.prototype.setSides = function (nb)
{ nb = parseInt(nb);
this.sides_ = nb>2 ? nb : 0;
}
/**
* Allow rotation when centered + square
* @param {bool}
* @api stable
*/
ol.interaction.DrawRegular.prototype.canRotate = function (b)
{ if (b===true || b===false) this.canRotate_ = b;
return this.canRotate_;
}
/**
* Get the number of sides.
* @return {int} number of sides.
* @api stable
*/
ol.interaction.DrawRegular.prototype.getSides = function ()
{ return this.sides_;
}
/** Default start angle array for each sides
*/
ol.interaction.DrawRegular.prototype.startAngle =
{ 'default':Math.PI/2,
3: -Math.PI/2,
4: Math.PI/4
};
/** Get geom of the current drawing
* @return {ol.geom.Polygon | ol.geom.Point}
*/
ol.interaction.DrawRegular.prototype.getGeom_ = function ()
{ this.overlayLayer_.getSource().clear();
if (!this.center_) return false;
var g;
if (this.coord_)
{ var center = this.center_;
var coord = this.coord_;
// Special case: circle
if (!this.sides_ && this.square_ && !this.centered_){
center = [(coord[0] + center[0])/2, (coord[1] + center[1])/2];
var d = [coord[0] - center[0], coord[1] - center[1]];
var r = Math.sqrt(d[0]*d[0]+d[1]*d[1]);
var circle = new ol.geom.Circle(center, r, 'XY');
// Optimize points on the circle
var centerPx = this.getMap().getPixelFromCoordinate(center);
var dmax = Math.max (100, Math.abs(centerPx[0]-this.coordPx_[0]), Math.abs(centerPx[1]-this.coordPx_[1]));
dmax = Math.min ( this.maxCircleCoordinates_, Math.round(dmax / 3 ));
return ol.geom.Polygon.fromCircle (circle, dmax, 0);
}
else {
var hasrotation = this.canRotate_ && this.centered_ && this.square_;
var d = [coord[0] - center[0], coord[1] - center[1]];
if (this.square_ && !hasrotation)
{ //var d = [coord[0] - center[0], coord[1] - center[1]];
var dm = Math.max (Math.abs(d[0]), Math.abs(d[1]));
coord[0] = center[0] + (d[0]>0 ? dm:-dm);
coord[1] = center[1] + (d[1]>0 ? dm:-dm);
}
var r = Math.sqrt(d[0]*d[0]+d[1]*d[1]);
if (r>0)
{ var circle = new ol.geom.Circle(center, r, 'XY');
var a;
if (hasrotation) a = Math.atan2(d[1], d[0]);
else a = this.startAngle[this.sides_] || this.startAngle['default'];
if (this.sides_) g = ol.geom.Polygon.fromCircle (circle, this.sides_, a);
else
{ // Optimize points on the circle
var centerPx = this.getMap().getPixelFromCoordinate(this.center_);
var dmax = Math.max (100, Math.abs(centerPx[0]-this.coordPx_[0]), Math.abs(centerPx[1]-this.coordPx_[1]));
dmax = Math.min ( this.maxCircleCoordinates_, Math.round(dmax / (this.centered_ ? 3:5) ));
g = ol.geom.Polygon.fromCircle (circle, dmax, 0);
}
if (hasrotation) return g;
// Scale polygon to fit extent
var ext = g.getExtent();
if (!this.centered_) center = this.center_;
else center = [ 2*this.center_[0]-this.coord_[0], 2*this.center_[1]-this.coord_[1] ];
var scx = (center[0] - coord[0]) / (ext[0] - ext[2]);
var scy = (center[1] - coord[1]) / (ext[1] - ext[3]);
if (this.square_)
{ var sc = Math.min(Math.abs(scx),Math.abs(scy));
scx = Math.sign(scx)*sc;
scy = Math.sign(scy)*sc;
}
var t = [ center[0] - ext[0]*scx, center[1] - ext[1]*scy ];
g.applyTransform(function(g1, g2, dim)
{ for (var i=0; i<g1.length; i+=dim)
{ g2[i] = g1[i]*scx + t[0];
g2[i+1] = g1[i+1]*scy + t[1];
}
return g2;
});
return g;
}
}
}
// No geom => return a point
return new ol.geom.Point(this.center_);
};
/** Draw sketch
* @return {ol.Feature} The feature being drawn.
*/
ol.interaction.DrawRegular.prototype.drawSketch_ = function(evt)
{ this.overlayLayer_.getSource().clear();
if (evt)
{ this.square_ = this.squareFn_ ? this.squareFn_(evt) : evt.originalEvent.shiftKey;
this.centered_ = this.centeredFn_ ? this.centeredFn_(evt) : evt.originalEvent.metaKey || evt.originalEvent.ctrlKey;
var g = this.getGeom_();
if (g)
{ var f = this.feature_;
if (this.geometryName_) f.setGeometryName(this.geometryName_)
f.setGeometry (g);
this.overlayLayer_.getSource().addFeature(f);
if (this.coord_ && this.square_ && ((this.canRotate_ && this.centered_ && this.coord_) || (!this.sides_ && !this.centered_)))
{ this.overlayLayer_.getSource().addFeature(new ol.Feature(new ol.geom.LineString([this.center_,this.coord_])));
}
return f;
}
}
};
/** Draw sketch (Point)
*/
ol.interaction.DrawRegular.prototype.drawPoint_ = function(pt, noclear)
{ if (!noclear) this.overlayLayer_.getSource().clear();
this.overlayLayer_.getSource().addFeature(new ol.Feature(new ol.geom.Point(pt)));
};
/**
* @param {ol.MapBrowserEvent} evt Map browser event.
*/
ol.interaction.DrawRegular.prototype.handleEvent_ = function(evt)
{ switch (evt.type)
{ case "pointerdown": {
this.downPx_ = evt.pixel;
this.start_(evt);
}
break;
case "pointerup":
// Started and fisrt move
if (this.started_ && this.coord_)
{ var dx = this.downPx_[0] - evt.pixel[0];
var dy = this.downPx_[1] - evt.pixel[1];
if (dx*dx + dy*dy <= this.squaredClickTolerance_)
{ // The pointer has moved
if ( this.lastEvent == "pointermove" )
{ this.end_(evt);
}
// On touch device there is no move event : terminate = click on the same point
else
{ dx = this.upPx_[0] - evt.pixel[0];
dy = this.upPx_[1] - evt.pixel[1];
if ( dx*dx + dy*dy <= this.squaredClickTolerance_)
{ this.end_(evt);
}
else
{ this.handleMoveEvent_(evt);
this.drawPoint_(evt.coordinate,true);
}
}
}
}
this.upPx_ = evt.pixel;
break;
case "pointerdrag":
if (this.started_)
{ var centerPx = this.getMap().getPixelFromCoordinate(this.center_);
var dx = centerPx[0] - evt.pixel[0];
var dy = centerPx[1] - evt.pixel[1];
if (dx*dx + dy*dy <= this.squaredClickTolerance_)
{ this.reset();
}
}
break;
case "pointermove":
if (this.started_)
{ var dx = this.downPx_[0] - evt.pixel[0];
var dy = this.downPx_[1] - evt.pixel[1];
if (dx*dx + dy*dy > this.squaredClickTolerance_)
{ this.handleMoveEvent_(evt);
this.lastEvent = evt.type;
}
}
break;
default:
this.lastEvent = evt.type;
// Prevent zoom in on dblclick
if (this.started_ && evt.type==='dblclick')
{ //evt.stopPropagation();
return false;
}
break;
}
return true;
}
/** Stop drawing.
*/
ol.interaction.DrawRegular.prototype.finishDrawing = function()
{ if (this.started_ && this.coord_)
{ this.end_({ pixel: this.upPx_, coordinate: this.coord_});
}
};
/**
* @param {ol.MapBrowserEvent} evt Event.
*/
ol.interaction.DrawRegular.prototype.handleMoveEvent_ = function(evt)
{ if (this.started_)
{ this.coord_ = evt.coordinate;
this.coordPx_ = evt.pixel;
var f = this.drawSketch_(evt);
this.dispatchEvent({
type:'drawing',
feature: f,
pixel: evt.pixel,
startCoordinate: this.center_,
coordinate: evt.coordinate,
square: this.square_,
centered: this.centered_
});
}
else
{ this.drawPoint_(evt.coordinate);
}
};
/** Start an new draw
* @param {ol.MapBrowserEvent} evt Map browser event.
* @return {boolean} `false` to stop the drag sequence.
*/
ol.interaction.DrawRegular.prototype.start_ = function(evt)
{ if (!this.started_)
{ this.started_ = true;
this.center_ = evt.coordinate;
this.coord_ = null;
var f = this.feature_ = new ol.Feature();
this.drawSketch_(evt);
this.dispatchEvent({ type:'drawstart', feature: f, pixel: evt.pixel, coordinate: evt.coordinate });
}
else
{ this.coord_ = evt.coordinate;
}
};
/** End drawing
* @param {ol.MapBrowserEvent} evt Map browser event.
* @return {boolean} `false` to stop the drag sequence.
*/
ol.interaction.DrawRegular.prototype.end_ = function(evt)
{ this.coord_ = evt.coordinate;
this.started_ = false;
// Add new feature
if (this.coord_ && this.center_[0]!=this.coord_[0] && this.center_[1]!=this.coord_[1])
{ var f = this.feature_;
if (this.geometryName_) f.setGeometryName(this.geometryName_)
f.setGeometry(this.getGeom_());
if (this.source_) this.source_.addFeature(f);
else if (this.features_) this.features_.push(f);
this.dispatchEvent({ type:'drawend', feature: f, pixel: evt.pixel, coordinate: evt.coordinate, square: this.square_, centered: this.centered_ });
}
else
{ this.dispatchEvent({ type:'drawcancel', feature: null, pixel: evt.pixel, coordinate: evt.coordinate, square: this.square_, centered: this.centered_ });
}
this.center_ = this.coord_ = null;
this.drawSketch_();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction DrawTouch :
* @constructor
* @extends {ol.interaction.CenterTouch}
* @param {olx.interaction.DrawOptions} options
* - source {ol.source.Vector | undefined} Destination source for the drawn features.
* - type {ol.geom.GeometryType} Drawing type ('Point', 'LineString', 'Polygon') not ('MultiPoint', 'MultiLineString', 'MultiPolygon' or 'Circle'). Required.
* - tap {boolean} enable on tap, default true
* Inherited params
* - targetStyle {ol.style.Style|Array<ol.style.Style>} a style to draw the target point, default cross style
* - composite {string} composite operation : difference|multiply|xor|screen|overlay|darken|lighter|lighten|...
*/
ol.interaction.DrawTouch = function(options)
{ var options = options||{};
var self = this;
options.handleEvent = function(e)
{ if (this.get("tap"))
{ switch (e.type)
{ case "singleclick":
this.addPoint();
break;
case "dblclick":
this.addPoint();
this.finishDrawing();
return false;
break;
default: break;
}
}
return true;
}
ol.interaction.CenterTouch.call(this, options);
this.typeGeom_ = options.type;
this.source_ = options.source;
this.set("tap", (options.tap!==false));
// Style
var white = [255, 255, 255, 1];
var blue = [0, 153, 255, 1];
var width = 3;
var defaultStyle = [
new ol.style.Style({
stroke: new ol.style.Stroke({ color: white, width: width + 2 })
}),
new ol.style.Style({
image: new ol.style.Circle({
radius: width * 2,
fill: new ol.style.Fill({ color: blue }),
stroke: new ol.style.Stroke({ color: white, width: width / 2 })
}),
stroke: new ol.style.Stroke({ color: blue, width: width }),
fill: new ol.style.Fill({
color: [255, 255, 255, 0.5]
})
})
];
this.overlay_ = new ol.layer.Vector(
{ source: new ol.source.Vector({useSpatialIndex: false }),
style: defaultStyle
});
this.geom_ = [];
};
ol.inherits(ol.interaction.DrawTouch, ol.interaction.CenterTouch);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.DrawTouch.prototype.setMap = function(map) {
if (this._listener.drawSketch) ol.Observable.unByKey(this._listener.drawSketch);
this._listener.drawSketch = null;
ol.interaction.CenterTouch.prototype.setMap.call (this, map);
this.overlay_.setMap(map);
if (this.getMap())
{ this._listener.drawSketch = this.getMap().on("postcompose", this.drawSketchLink_.bind(this));
}
};
/** Start drawing and add the sketch feature to the target layer.
* The ol.interaction.Draw.EventType.DRAWSTART event is dispatched before inserting the feature.
*/
ol.interaction.DrawTouch.prototype.startDrawing = function()
{ this.geom_ = [];
this.addPoint();
};
/** Get geometry type
* @return {ol.geom.GeometryType}
*/
ol.interaction.DrawTouch.prototype.getGeometryType = function()
{ return this.typeGeom_;
};
/** Start drawing and add the sketch feature to the target layer.
* The ol.interaction.Draw.EventType.DRAWEND event is dispatched before inserting the feature.
*/
ol.interaction.DrawTouch.prototype.finishDrawing = function()
{ if (!this.getMap()) return;
var f;
switch (this.typeGeom_)
{ case "LineString":
if (this.geom_.length > 1) f = new ol.Feature(new ol.geom.LineString(this.geom_));
break;
case "Polygon":
// Close polygon
if (this.geom_[this.geom_.length-1] != this.geom_[0])
{ this.geom_.push(this.geom_[0]);
}
// Valid ?
if (this.geom_.length > 3)
{ f = new ol.Feature(new ol.geom.Polygon([ this.geom_ ]));
}
break;
default: break;
}
if (f) this.source_.addFeature (f);
// reset
this.geom_ = [];
this.drawSketch_();
}
/** Add a new Point to the drawing
*/
ol.interaction.DrawTouch.prototype.addPoint = function()
{ if (!this.getMap()) return;
this.geom_.push(this.getPosition());
switch (this.typeGeom_)
{ case "Point":
var f = new ol.Feature( new ol.geom.Point (this.geom_.pop()));
this.source_.addFeature(f);
break;
case "LineString":
case "Polygon":
this.drawSketch_();
break;
default: break;
}
}
/** Remove last point of the feature currently being drawn.
*/
ol.interaction.DrawTouch.prototype.removeLastPoint = function()
{ if (!this.getMap()) return;
this.geom_.pop();
this.drawSketch_();
}
/** Draw sketch
* @private
*/
ol.interaction.DrawTouch.prototype.drawSketch_ = function()
{ if (!this.overlay_) return;
this.overlay_.getSource().clear();
if (this.geom_.length)
{ var f;
if (this.typeGeom_ == "Polygon")
{ f = new ol.Feature(new ol.geom.Polygon([this.geom_]));
this.overlay_.getSource().addFeature(f);
}
var geom = new ol.geom.LineString(this.geom_);
f = new ol.Feature(geom);
this.overlay_.getSource().addFeature(f);
f = new ol.Feature( new ol.geom.Point (this.geom_.slice(-1).pop()) );
this.overlay_.getSource().addFeature(f);
}
}
/** Draw contruction lines on postcompose
* @private
*/
ol.interaction.DrawTouch.prototype.drawSketchLink_ = function(e)
{ if (!this.getActive() || !this.getPosition()) return;
var ctx = e.context;
ctx.save();
var p, pt = this.getMap().getPixelFromCoordinate(this.getPosition());
var ratio = e.frameState.pixelRatio || 1;
ctx.scale(ratio,ratio);
ctx.strokeStyle = "rgba(0, 153, 255, 1)";
ctx.lineWidth = 1;
ctx.beginPath();
ctx.arc (pt[0],pt[1], 5, 0, 2*Math.PI);
ctx.stroke();
if (this.geom_.length)
{ p = this.getMap().getPixelFromCoordinate(this.geom_[this.geom_.length-1]);
ctx.beginPath();
ctx.moveTo(p[0],p[1]);
ctx.lineTo(pt[0],pt[1]);
if (this.typeGeom_ == "Polygon")
{ p = this.getMap().getPixelFromCoordinate(this.geom_[0]);
ctx.lineTo(p[0],p[1]);
}
ctx.stroke();
}
ctx.restore();
}
/**
* Activate or deactivate the interaction.
* @param {boolean} active Active.
* @observable
* @api
*/
ol.interaction.DrawTouch.prototype.setActive = function(b)
{ ol.interaction.CenterTouch.prototype.setActive.call (this, b);
if (!b) this.geom_ = [];
this.drawSketch_();
}
/** Extend DragAndDrop choose drop zone + fires loadstart, loadend
* @require jQuery
*
* @constructor
* @extends {ol.interaction.DragAndDrop}
* @fires loadstart, loadend, addfeatures
* @param {ol.dropfile.options} flashlight options param
* - zone {string} selector for the drop zone, default document
* - projection {ol.projection} default projection of the map
* - formatConstructors {Array<function(new:ol.format.Feature)>|undefined} Format constructors, default [ ol.format.GPX, ol.format.GeoJSON, ol.format.IGC, ol.format.KML, ol.format.TopoJSON ]
* - accept {Array<string>|undefined} list of eccepted format, default ["gpx","json","geojson","igc","kml","topojson"]
*/
ol.interaction.DropFile = function(options)
{ options = options||{};
ol.interaction.DragAndDrop.call(this, {});
var zone = options.zone || document;
$(zone).on('dragenter', this.onstop );
$(zone).on('dragover', this.onstop );
$(zone).on('dragleave', this.onstop );
// Options
this.formatConstructors_ = options.formatConstructors || [ ol.format.GPX, ol.format.GeoJSON, ol.format.IGC, ol.format.KML, ol.format.TopoJSON ];
this.projection_ = options.projection;
this.accept_ = options.accept || ["gpx","json","geojson","igc","kml","topojson"];
var self = this;
$(zone).on('drop', function(e){ return self.ondrop(e.originalEvent); });
};
ol.inherits(ol.interaction.DropFile, ol.interaction.DragAndDrop);
/** Set the map
*/
ol.interaction.DropFile.prototype.setMap = function(map)
{ ol.interaction.Interaction.prototype.setMap.call(this, map);
};
/** Do somthing when over
*/
ol.interaction.DropFile.prototype.onstop = function(e)
{ e.preventDefault();
e.stopPropagation();
return false;
}
/** Do somthing when over
*/
ol.interaction.DropFile.prototype.ondrop = function(e)
{ if (e.dataTransfer && e.dataTransfer.files.length)
{ var self = this;
e.preventDefault();
e.stopPropagation();
// fetch FileList object
var files = e.dataTransfer.files; // e.originalEvent.target.files ?
// process all File objects
var file;
var pat = /\.([0-9a-z]+)(?=[?#])|(\.)(?:[\w]+)$/;
for (var i=0; file=files[i]; i++)
{ var ex = file.name.match(pat)[0];
self.dispatchEvent({ type:'loadstart', file: file, filesize: file.size, filetype: file.type, fileextension: ex, projection: projection, target: self });
// Load file
features = [];
var reader = new FileReader();
var projection = this.projection_ || this.getMap().getView().getProjection();
var formatConstructors = this.formatConstructors_
if (!projection) return;
function tryReadFeatures (format, result, options)
{ try
{ return format.readFeatures(result, options);
} catch (e) {}
}
var theFile = file;
reader.onload = function(e)
{ var result = e.target.result;
var features = [];
var i, ii;
for (i = 0, ii = formatConstructors.length; i < ii; ++i)
{ var formatConstructor = formatConstructors[i];
var format = new formatConstructor();
features = tryReadFeatures(format, result, { featureProjection: projection });
if (features && features.length > 0)
{ self.dispatchEvent({ type:'addfeatures', features: features, file: theFile, projection: projection, target: self });
self.dispatchEvent({ type:'loadend', features: features, file: theFile, projection: projection, target: self });
return;
}
}
self.dispatchEvent({ type:'loadend', file: theFile, target: self });
};
reader.readAsText(file);
};
}
else {}
return false;
};
/**
* @constructor
* @extends {ol.interaction.Pointer}
* @param {ol.flashlight.options} flashlight options param
* - color {ol.Color} light color, default transparent
* - fill {ol.Color} fill color, default rgba(0,0,0,0.8)
* - radius {number} radius of the flash
*/
ol.interaction.Flashlight = function(options) {
ol.interaction.Pointer.call(this,
{ handleDownEvent: this.setPosition,
handleMoveEvent: this.setPosition
});
// Default options
options = options||{};
this.pos = false;
this.radius = (options.radius||100);
this.setColor(options);
};
ol.inherits(ol.interaction.Flashlight, ol.interaction.Pointer);
/** Set the map > start postcompose
*/
ol.interaction.Flashlight.prototype.setMap = function(map) {
if (this.getMap()) {
this.getMap().render();
}
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.interaction.Pointer.prototype.setMap.call(this, map);
if (map) {
this._listener = map.on('postcompose', this.postcompose_.bind(this));
}
}
/** Set flashlight radius
* @param {integer} radius
*/
ol.interaction.Flashlight.prototype.setRadius = function(radius)
{ this.radius = radius
if (this.getMap()) this.getMap().renderSync();
}
/** Set flashlight color
* @param {ol.flashlight.options} flashlight options param
* - color {ol.Color} light color, default transparent
* - fill {ol.Color} fill color, default rgba(0,0,0,0.8)
*/
ol.interaction.Flashlight.prototype.setColor = function(options)
{ // Backcolor
var color = (options.fill ? options.fill : [0,0,0,0.8]);
var c = ol.color.asArray(color);
this.startColor = ol.color.asString(c);
// Halo color
var endColor;
if (options.color)
{ c = this.endColor = ol.color.asString(ol.color.asArray(options.color)||options.color);
}
else
{ c[3] = 0
this.endColor = ol.color.asString(c);
}
c[3] = 0.1;
this.midColor = ol.color.asString(c);
if (this.getMap()) this.getMap().renderSync();
}
/** Set position of the flashlight
* @param {ol.Pixel|ol.MapBrowserEvent}
*/
ol.interaction.Flashlight.prototype.setPosition = function(e)
{ if (e.pixel) this.pos = e.pixel;
else this.pos = e;
if (this.getMap())
{ this.getMap().renderSync();
}
}
/** Postcompose function
*/
ol.interaction.Flashlight.prototype.postcompose_ = function(e)
{ var ctx = e.context;
var ratio = e.frameState.pixelRatio;
var w = ctx.canvas.width;
var h = ctx.canvas.height;
ctx.save();
ctx.scale(ratio,ratio);
if (!this.pos)
{ ctx.fillStyle = this.startColor;
ctx.fillRect( 0,0,w,h );
}
else
{ var d = Math.max(w, h);
// reveal wherever we drag
var radGrd = ctx.createRadialGradient( this.pos[0], this.pos[1], w*this.radius/d, this.pos[0], this.pos[1], h*this.radius/d );
radGrd.addColorStop( 0, this.startColor );
radGrd.addColorStop( 0.8, this.midColor );
radGrd.addColorStop( 1, this.endColor );
ctx.fillStyle = radGrd;
ctx.fillRect( this.pos[0] - d, this.pos[1] - d, 2*d, 2*d );
}
ctx.restore();
};
/** Interaction to draw on the current geolocation
* It combines a draw with a ol.Geolocation
* @constructor
* @extends {ol.interaction.Interaction}
* @fires drawstart, drawend, drawing, tracking, follow
* @param {any} options
* @param { ol.Collection.<ol.Feature> | undefined } option.features Destination collection for the drawn features.
* @param { ol.source.Vector | undefined } options.source Destination source for the drawn features.
* @param {ol.geom.GeometryType} options.type Drawing type ('Point', 'LineString', 'Polygon'), default LineString.
* @param {Number | undefined} options.minAccuracy minimum accuracy underneath a new point will be register (if no condition), default 20
* @param {function | undefined} options.condition a function that take a ol.Geolocation object and return a boolean to indicate whether location should be handled or not, default return true if accuraty < minAccuraty
* @param {Object} options.attributes a list of attributes to register as Point properties: {accuracy:true,accuracyGeometry:true,heading:true,speed:true}, default none.
* @param {Number} options.tolerance tolerance to add a new point (in projection unit), use ol.geom.LineString.simplify() method, default 5
* @param {Number} options.zoom zoom for tracking, default 16
* @param {boolean|auto|position|visible} options.followTrack true if you want the interaction to follow the track on the map, default true
* @param { ol.style.Style | Array.<ol.style.Style> | ol.StyleFunction | undefined } options.style Style for sketch features.
*/
ol.interaction.GeolocationDraw = function(options)
{ if (!options) options={};
var self = this;
// Geolocation
var geoloc = this.geolocation = new ol.Geolocation(
({ projection: "EPSG:4326",
trackingOptions:
{ maximumAge: 10000,
enableHighAccuracy: true,
timeout: 600000
}
}));
this.geolocation.on('change', this.draw_.bind(this));
// Current path
this.path_ = [];
this.lastPosition_ = false;
// Default style
var white = [255, 255, 255, 1];
var blue = [0, 153, 255, 1];
var width = 3;
var circle = new ol.style.Circle(
{ radius: width * 2,
fill: new ol.style.Fill({ color: blue }),
stroke: new ol.style.Stroke({ color: white, width: width / 2 })
});
var style =
[ new ol.style.Style(
{ stroke: new ol.style.Stroke({ color: white, width: width + 2 })
}),
new ol.style.Style(
{ stroke: new ol.style.Stroke({ color: blue, width: width }),
fill: new ol.style.Fill({
color: [255, 255, 255, 0.5]
})
})
];
var triangle = new ol.style.RegularShape(
{ radius: width * 3.5,
points: 3,
rotation: 0,
fill: new ol.style.Fill({ color: blue }),
stroke: new ol.style.Stroke({ color: white, width: width / 2 })
});
// stretch the symbol
var c = triangle.getImage();
var ctx = c.getContext("2d");
var c2 = document.createElement('canvas');
c2.width = c2.height = c.width;
c2.getContext("2d").drawImage(c, 0,0);
ctx.clearRect(0,0,c.width,c.height);
ctx.drawImage(c2, 0,0, c.width, c.height, width, 0, c.width-2*width, c.height);
var defaultStyle = function(f)
{ if (f.get('heading')===undefined)
{ style[1].setImage(circle);
}
else
{ style[1].setImage(triangle);
triangle.setRotation( f.get('heading') || 0);
}
return style;
}
// Style for the accuracy geometry
this.locStyle =
{ error: new ol.style.Style({ fill: new ol.style.Fill({ color: [255, 0, 0, 0.2] }) }),
warn: new ol.style.Style({ fill: new ol.style.Fill({ color: [255, 192, 0, 0.2] }) }),
ok: new ol.style.Style({ fill: new ol.style.Fill({ color: [0, 255, 0, 0.2] }) }),
};
// Create a new overlay layer for the sketch
this.overlayLayer_ = new ol.layer.Vector(
{ source: new ol.source.Vector(),
name:'GeolocationDraw overlay',
style: options.style || defaultStyle
});
this.sketch_ = [new ol.Feature(), new ol.Feature(), new ol.Feature()];
this.overlayLayer_.getSource().addFeatures(this.sketch_);
this.features_ = options.features;
this.source_ = options.source;
this.condition_ = options.condition || function(loc) { return loc.getAccuracy() < this.get("minAccuracy") };
// Prevent interaction when tracking
ol.interaction.Interaction.call(this,
{ handleEvent: function()
{ return (!this.get('followTrack') || this.get('followTrack')=='auto');// || !geoloc.getTracking());
}
});
this.set("type", options.type||"LineString");
this.set("attributes", options.attributes||{});
this.set("minAccuracy", options.minAccuracy||20);
this.set("tolerance", options.tolerance||5);
this.set("zoom", options.zoom);
this.setFollowTrack (options.followTrack===undefined ? true : options.followTrack);
this.setActive(false);
};
ol.inherits(ol.interaction.GeolocationDraw, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.GeolocationDraw.prototype.setMap = function(map)
{ if (this.getMap()) this.getMap().removeLayer(this.overlayLayer_);
ol.interaction.Pointer.prototype.setMap.call (this, map);
this.overlayLayer_.setMap(map);
if (map) this.geolocation.setProjection(map.getView().getProjection());
};
/** Activate or deactivate the interaction.
* @param {boolean} active
*/
ol.interaction.GeolocationDraw.prototype.setActive = function(active)
{ ol.interaction.Interaction.prototype.setActive.call(this, active);
this.overlayLayer_.setVisible(active);
if (this.getMap())
{ this.geolocation.setTracking(active);
this.getMap().renderSync();
}
this.pause(!active);
if (active)
{ // Start drawing
this.reset();
this.dispatchEvent({ type:'drawstart', feature: this.sketch_[1]});
}
else
{ var f = this.sketch_[1].clone();
if (f.getGeometry())
{ if (this.features_) this.features_.push(f);
if (this.source_) this.source_.addFeature(f);
this.dispatchEvent({ type:'drawend', feature: f});
}
}
};
/** Reset drawing
*/
ol.interaction.GeolocationDraw.prototype.reset = function()
{ this.sketch_[1].setGeometry();
this.path_ = [];
this.lastPosition_ = false;
};
/** Start tracking = setActive(true)
*/
ol.interaction.GeolocationDraw.prototype.start = function()
{ this.setActive(true);
};
/** Stop tracking = setActive(false)
*/
ol.interaction.GeolocationDraw.prototype.stop = function()
{ this.setActive(false);
};
/** Pause drawing
* @param {boolean} b
*/
ol.interaction.GeolocationDraw.prototype.pause = function(b)
{ this.pause_ = b!==false;
};
/** Is paused
* @return {boolean} b
*/
ol.interaction.GeolocationDraw.prototype.isPaused = function()
{ return this.pause_;
};
/** Enable following the track on the map
* @param {boolean|auto|position|visible} follow,
* false: don't follow,
* true: follow (position+zoom),
* 'position': follow only position,
* 'auto': start following until user move the map,
* 'visible': center when position gets out of the visible extent
*/
ol.interaction.GeolocationDraw.prototype.setFollowTrack = function(follow)
{ this.set('followTrack', follow);
var map = this.getMap();
// Center if wanted
if (follow !== false && !this.lastPosition_ && map)
{ var pos = this.path_[this.path_.length-1];
if (pos)
{ map.getView().animate({
center: pos,
zoom: (follow!="position" ? this.get("zoom") : undefined)
})
}
}
this.lastPosition_ = false;
this.dispatchEvent({ type:'follow', following: follow!==false });
};
/** Add a new point to the current path
* @private
*/
ol.interaction.GeolocationDraw.prototype.draw_ = function(active)
{ var map = this.getMap();
if (!map) return;
// Current location
var loc = this.geolocation;
var accu = loc.getAccuracy();
var pos = loc.getPosition();
pos.push (Math.round((loc.getAltitude()||0)*100)/100);
pos.push (Math.round((new Date()).getTime()/1000));
var p = loc.getAccuracyGeometry();
// Center on point
// console.log(this.get('followTrack'))
switch (this.get('followTrack'))
{ // Follow center + zoom
case true:
// modify zoom
if (this.get('followTrack') == true)
{ map.getView().setZoom( this.get("zoom") || 16 );
if (!ol.extent.containsExtent(map.getView().calculateExtent(map.getSize()), p.getExtent()))
{ map.getView().fit(p.getExtent());
}
}
// Follow position
case 'position':
// modify center
map.getView().setCenter( pos );
break;
// Keep on following
case 'auto':
if (this.lastPosition_)
{ var center = map.getView().getCenter();
// console.log(center,this.lastPosition_)
if (center[0]!=this.lastPosition_[0] || center[1]!=this.lastPosition_[1])
{ //this.dispatchEvent({ type:'follow', following: false });
this.setFollowTrack (false);
}
else
{ map.getView().setCenter( pos );
this.lastPosition_ = pos;
}
}
else
{ map.getView().setCenter( pos );
if (this.get("zoom")) map.getView().setZoom( this.get("zoom") );
this.lastPosition_ = pos;
}
break;
// Force to stay on the map
case 'visible':
if (!ol.extent.containsCoordinate(map.getView().calculateExtent(map.getSize()), pos))
{ map.getView().setCenter (pos);
}
break;
// Don't follow
default: break;
}
// Draw occuracy
var f = this.sketch_[0];
f.setGeometry(p);
if (accu < this.get("minAccuracy")/2) f.setStyle(this.locStyle.ok);
else if (accu < this.get("minAccuracy")) f.setStyle(this.locStyle.warn);
else f.setStyle(this.locStyle.error);
var geo;
if (!this.pause_ && this.condition_.call(this, loc))
{ f = this.sketch_[1];
this.path_.push(pos);
switch (this.get("type"))
{ case "Point":
this.path_ = [pos];
f.setGeometry(new ol.geom.Point(pos, 'XYZM'));
var attr = this.get('attributes');
if (attr.heading) f.set("heading",loc.getHeading());
if (attr.accuracy) f.set("accuracy",loc.getAccuracy());
if (attr.altitudeAccuracy) f.set("altitudeAccuracy",loc.getAltitudeAccuracy());
if (attr.speed) f.set("speed",loc.getSpeed());
break;
case "LineString":
if (this.path_.length>1)
{ geo = new ol.geom.LineString(this.path_, 'XYZM');
geo.simplify (this.get("tolerance"));
f.setGeometry(geo);
}
else f.setGeometry();
break;
case "Polygon":
if (this.path_.length>2)
{ geo = new ol.geom.Polygon([this.path_], 'XYZM');
geo.simplify (this.get("tolerance"));
f.setGeometry(geo);
}
else f.setGeometry();
break;
}
this.dispatchEvent({ type:'drawing', feature: this.sketch_[1], geolocation: loc });
}
this.sketch_[2].setGeometry(new ol.geom.Point(pos));
this.sketch_[2].set("heading",loc.getHeading());
// Drawing
this.dispatchEvent({ type:'tracking', feature: this.sketch_[1], geolocation: loc });
};
/** Interaction hover do to something when hovering a feature
* @constructor
* @extends {ol.interaction.Interaction}
* @fires hover, enter, leave
* @param {olx.interaction.HoverOptions}
* - cursor { string | undefined } css cursor propertie or a function that gets a feature, default: none
* - featureFilter {function | undefined} filter a function with two arguments, the feature and the layer of the feature. Return true to select the feature
* - layerFilter {function | undefined} filter a function with one argument, the layer to test. Return true to test the layer
* - handleEvent { function | undefined } Method called by the map to notify the interaction that a browser event was dispatched to the map. The function may return false to prevent the propagation of the event to other interactions in the map's interactions chain.
*/
ol.interaction.Hover = function(options)
{ if (!options) options={};
var self = this;
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ if (e.type=="pointermove") { self.handleMove_(e); };
if (options.handleEvent) return options.handleEvent(e);
return true;
}
});
this.setFeatureFilter (options.featureFilter);
this.setLayerFilter (options.layerFilter);
this.setCursor (options.cursor);
};
ol.inherits(ol.interaction.Hover, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.Hover.prototype.setMap = function(map)
{ if (this.previousCursor_!==undefined && this.getMap())
{ this.getMap().getTargetElement().style.cursor = this.previousCursor_;
this.previousCursor_ = undefined;
}
ol.interaction.Interaction.prototype.setMap.call (this, map);
};
/**
* Set cursor on hover
* @param { string } cursor css cursor propertie or a function that gets a feature, default: none
* @api stable
*/
ol.interaction.Hover.prototype.setCursor = function(cursor)
{ if (!cursor && this.previousCursor_!==undefined && this.getMap())
{ this.getMap().getTargetElement().style.cursor = this.previousCursor_;
this.previousCursor_ = undefined;
}
this.cursor_ = cursor;
};
/** Feature filter to get only one feature
* @param {function} filter a function with two arguments, the feature and the layer of the feature. Return true to select the feature
*/
ol.interaction.Hover.prototype.setFeatureFilter = function(filter)
{ if (typeof (filter) == 'function') this.featureFilter_ = filter;
else this.featureFilter_ = function(){ return true; };
};
/** Feature filter to get only one feature
* @param {function} filter a function with one argument, the layer to test. Return true to test the layer
*/
ol.interaction.Hover.prototype.setLayerFilter = function(filter)
{ if (typeof (filter) == 'function') this.layerFilter_ = filter;
else this.layerFilter_ = function(){ return true; };
};
/** Get features whenmove
* @param {ol.event} e "move" event
*/
ol.interaction.Hover.prototype.handleMove_ = function(e)
{ var map = this.getMap();
if (map)
{ //var b = map.hasFeatureAtPixel(e.pixel);
var feature, layer;
var self = this;
var b = map.forEachFeatureAtPixel(e.pixel,
function(f, l)
{ if (self.layerFilter_.call(null, l)
&& self.featureFilter_.call(null,f,l))
{ feature = f;
layer = l;
return true;
}
else
{ feature = layer = null;
return false;
}
});
if (b) this.dispatchEvent({ type:"hover", feature:feature, layer:layer, coordinate:e.coordinate, pixel: e.pixel, map: e.map, dragging:e.dragging });
if (this.feature_===feature && this.layer_===layer)
{
}
else
{ this.feature_ = feature;
this.layer_ = layer;
if (feature) this.dispatchEvent({ type:"enter", feature:feature, layer:layer, coordinate:e.coordinate, pixel: e.pixel, map: e.map, dragging:e.dragging });
else this.dispatchEvent({ type:"leave", coordinate:e.coordinate, pixel: e.pixel, map: e.map, dragging:e.dragging });
}
if (this.cursor_)
{ var style = map.getTargetElement().style;
if (b)
{ if (style.cursor != this.cursor_)
{ this.previousCursor_ = style.cursor;
style.cursor = this.cursor_;
}
}
else if (this.previousCursor_ !== undefined)
{ style.cursor = this.previousCursor_;
this.previousCursor_ = undefined;
}
}
}
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction to handle longtouch events
* @constructor
* @extends {ol.interaction.Interaction}
* @param {olx.interaction.LongTouchOptions}
* @param {function | undefined} options.handleLongTouchEvent Function handling "longtouch" events, it will receive a mapBrowserEvent.
* @param {interger | undefined} options.delay The delay for a long touch in ms, default is 1000
*/
ol.interaction.LongTouch = function(options)
{ if (!options) options = {};
this.delay_ = options.delay || 1000;
var ltouch = options.handleLongTouchEvent || function(){};
var _timeout = null;
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ if (this.getActive())
{ switch (e.type)
{ case 'pointerdown':
if (_timeout) clearTimeout(_timeout);
_timeout = setTimeout (function()
{ e.type = "longtouch";
ltouch(e)
}, this.delay_);
break;
/* case 'pointermove': */
case 'pointerdrag':
case 'pointerup':
if (_timeout)
{ clearTimeout(_timeout);
_timeout = null;
}
break;
default: break;;
}
}
else
{ if (_timeout)
{ clearTimeout(_timeout);
_timeout = null;
}
}
return true;
}
});
};
ol.inherits(ol.interaction.LongTouch, ol.interaction.Interaction);
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Modify interaction with a popup to delet a point on touch device
* @constructor
* @fires showpopup
* @fires hidepopup
* @extends {ol.interaction.Modify}
* @param {olx.interaction.ModifyOptions} options
* @param {String|undefined} options.title title to display, default "remove point"
* @param {Boolean|undefined} options.usePopup use a popup, default true
*/
ol.interaction.ModifyTouch = function(options) {
var self = this;
if (!options) options = {};
this._popup = new ol.Overlay.Popup ({
popupClass: options.calssName || 'modifytouch',
positioning: 'bottom-rigth',
offsetBox: 10
});
this._source = options.source;
this._features = options.features;
// popup content
var a = document.createElement('a');
a.appendChild(document.createTextNode(options.title || "remove point"));
a.onclick = function() {
self.removePoint();
};
this.setPopupContent(a);
var pixelTolerance = options.pixelTolerance || 0;
var searchDist = pixelTolerance +5;
// Check if there is a feature to select
options.condition = function(e) {
var features = this.getMap().getFeaturesAtPixel(e.pixel,{
hitTolerance: searchDist
});
var found = false;
if (features) {
var search = this._features;
if (!search) {
var p0 = [e.pixel[0] - searchDist, e.pixel[1] - searchDist]
var p1 = [e.pixel[0] + searchDist, e.pixel[1] + searchDist]
p0 = this.getMap().getCoordinateFromPixel(p0);
p1 = this.getMap().getCoordinateFromPixel(p1);
var ext = ol.extent.boundingExtent([p0,p1]);
search = this._source.getFeaturesInExtent(ext);
}
if (search.getArray) search = search.getArray();
for (var i=0, f; f=features[i]; i++) {
if (search.indexOf(f) >= 0) break;
}
if (f) {
var p0 = e.pixel;
var p1 = f.getGeometry().getClosestPoint(e.coordinate);
p1 = this.getMap().getPixelFromCoordinate(p1);
var dx = p0[0] - p1[0];
var dy = p0[1] - p1[1];
found = (Math.sqrt(dx*dx+dy*dy) < searchDist);
}
}
// Show popup if any
this.showDeleteBt(found ? { type:'show', feature:f, coordinate: e.coordinate } : { type:'hide' });
// Prevent click on the popup
e.preventDefault();
e.stopPropagation();
return true;
};
// Hide popup on insert
options.insertVertexCondition = function(e) {
this.showDeleteBt({ type:'hide' });
return true;
}
ol.interaction.Modify.call(this, options);
this.on(['modifystart','modifyend'], function(){
this.showDeleteBt({ type:'hide', modifying: true });
});
// Use a popup ?
this.set('usePopup', options.usePopup !== false);
};
ol.inherits(ol.interaction.ModifyTouch, ol.interaction.Modify);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.ModifyTouch.prototype.setMap = function(map) {
if (this.getMap()) {
this.getMap().removeOverlay(this._popup);
}
ol.interaction.Modify.prototype.setMap.call (this, map);
if (this.getMap()) {
this.getMap().addOverlay(this._popup);
}
};
/** Activate the interaction and remove popup
* @param {Boolean} b
*/
ol.interaction.ModifyTouch.prototype.setActive = function(b) {
ol.interaction.Modify.prototype.setActive.call (this, b);
this.showDeleteBt({ type:'hide' });
};
/**
* Remove the current point
*/
ol.interaction.ModifyTouch.prototype.removePoint = function() {
// Prevent touch + click on popup
if (new Date() - this._timeout < 200) return;
// Remove point
ol.interaction.Modify.prototype.removePoint.call (this);
this.showDeleteBt({ type:'hide' });
}
/**
* Show the delete button (menu)
* @param {Event} e
* @api stable
*/
ol.interaction.ModifyTouch.prototype.showDeleteBt = function(e) {
if (this.get('usePopup') && e.type==='show') {
this._popup.show(e.coordinate, this._menu);
} else {
this._popup.hide();
}
e.type += 'popup';
this.dispatchEvent(e);
// Date if popup start a timeout to prevent touch + click on the popup
this._timeout = new Date();
};
/**
* Change the popup content
* @param {DOMElement} html
*/
ol.interaction.ModifyTouch.prototype.setPopupContent = function(html) {
this._menu = html;
}
/**
* Get the popup content
* @return {DOMElement}
*/
ol.interaction.ModifyTouch.prototype.getPopupContent = function() {
return this._menu;
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Offset interaction for offseting feature geometry
* @constructor
* @extends {ol.interaction.Pointer}
* @fires offsetstart
* @fires offsetting
* @fires offsetend
* @param {any} options
* @param {ol.layer.Vector | Array<ol.layer.Vector>} options.layers list of feature to transform
* @param {ol.Collection.<ol.Feature>} options.features collection of feature to transform
* @param {ol.source.Vector | undefined} options.source source to duplicate feature when ctrl key is down
* @param {boolean} options.duplicate force feature to duplicate (source must be set)
*/
ol.interaction.Offset = function(options)
{ if (!options) options = {};
// Extend pointer
ol.interaction.Pointer.call(this, {
handleDownEvent: this.handleDownEvent_,
handleDragEvent: this.handleDragEvent_,
handleMoveEvent: this.handleMoveEvent_,
handleUpEvent: this.handleUpEvent_
});
// Collection of feature to transform
this.features_ = options.features;
// List of layers to transform
this.layers_ = options.layers ? (options.layers instanceof Array) ? options.layers:[options.layers] : null;
// duplicate
this.set('duplicate', options.duplicate);
this.source_ = options.source;
// init
this.previousCursor_ = false;
};
ol.inherits(ol.interaction.Offset, ol.interaction.Pointer);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.Offset.prototype.setMap = function(map) {
ol.interaction.Pointer.prototype.setMap.call (this, map);
};
/** Get Feature at pixel
* @param {ol.MapBrowserEvent} evt Map browser event.
* @return {any} a feature and the hit point
* @private
*/
ol.interaction.Offset.prototype.getFeatureAtPixel_ = function(e) {
var self = this;
return this.getMap().forEachFeatureAtPixel(e.pixel,
function(feature, layer) {
var current;
// feature belong to a layer
if (self.layers_) {
for (var i=0; i<self.layers_.length; i++) {
if (self.layers_[i]===layer) {
current = feature;
break;
}
}
}
// feature in the collection
else if (self.features_) {
self.features_.forEach (function(f) {
if (f===feature) {
current = feature
}
});
}
// Others
else {
current = feature;
}
// Only poygon or linestring
var typeGeom = current.getGeometry().getType();
if (current && /Polygon|LineString/.test(typeGeom)) {
if (typeGeom==='Polygon' && current.getGeometry().getCoordinates().length>1) return false;
// test distance
var p = current.getGeometry().getClosestPoint(e.coordinate);
var dx = p[0]-e.coordinate[0];
var dy = p[1]-e.coordinate[1];
var d = Math.sqrt(dx*dx+dy*dy) / e.frameState.viewState.resolution;
if (d<5) {
return {
feature: current,
hit: p,
coordinates: current.getGeometry().getCoordinates(),
geom: current.getGeometry().clone(),
geomType: typeGeom
}
} else {
return false;
}
} else {
return false;
}
}, { hitTolerance: 5 });
};
/**
* @param {ol.MapBrowserEvent} e Map browser event.
* @return {boolean} `true` to start the drag sequence.
* @private
*/
ol.interaction.Offset.prototype.handleDownEvent_ = function(e) {
this.current_ = this.getFeatureAtPixel_(e);
if (this.source_ && (this.get('duplicate') ||e.originalEvent.ctrlKey)) {
this.current_.feature = this.current_.feature.clone();
this.source_.addFeature(this.current_.feature);
}
if (this.current_) {
this.dispatchEvent({ type:'offsetstart', feature: this.current_.feature, offset: 0 });
return true;
} else {
return false;
}
};
/**
* @param {ol.MapBrowserEvent} e Map browser event.
* @private
*/
ol.interaction.Offset.prototype.handleDragEvent_ = function(e) {
var p = this.current_.geom.getClosestPoint(e.coordinate);
var d = ol.coordinate.dist2d(p, e.coordinate);
switch (this.current_.geomType) {
case 'Polygon': {
var seg = ol.coordinate.findSegment(p, this.current_.coordinates[0]).segment;
if (seg) {
var v1 = [ seg[1][0]-seg[0][0], seg[1][1]-seg[0][1] ];
var v2 = [ e.coordinate[0]-p[0], e.coordinate[1]-p[1] ];
if (v1[0]*v2[1] - v1[1]*v2[0] > 0) {
d = -d;
}
var offset = [];
for (var i=0; i<this.current_.coordinates.length; i++) {
offset.push( ol.coordinate.offsetCoords(this.current_.coordinates[i], i==0 ? d : -d) );
}
this.current_.feature.setGeometry(new ol.geom.Polygon(offset));
}
break;
}
case 'LineString': {
var seg = ol.coordinate.findSegment(p, this.current_.coordinates).segment;
if (seg) {
var v1 = [ seg[1][0]-seg[0][0], seg[1][1]-seg[0][1] ];
var v2 = [ e.coordinate[0]-p[0], e.coordinate[1]-p[1] ];
if (v1[0]*v2[1] - v1[1]*v2[0] > 0) {
d = -d;
}
var offset = ol.coordinate.offsetCoords(this.current_.coordinates, d);
this.current_.feature.setGeometry(new ol.geom.LineString(offset));
}
break;
}
default: {
break;
}
}
this.dispatchEvent({ type:'offsetting', feature: this.current_.feature, offset: d, segment: [p, e.coordinate], coordinate: e.coordinate });
};
/**
* @param {ol.MapBrowserEvent} e Map browser event.
* @private
*/
ol.interaction.Offset.prototype.handleUpEvent_ = function(e) {
this.dispatchEvent({ type:'offsetend', feature: this.current_.feature, coordinate: e.coordinate });
this.current_ = false;
};
/**
* @param {ol.MapBrowserEvent} e Event.
* @private
*/
ol.interaction.Offset.prototype.handleMoveEvent_ = function(e) {
var f = this.getFeatureAtPixel_(e);
if (f) {
if (this.previousCursor_ === false) {
this.previousCursor_ = e.map.getTargetElement().style.cursor;
}
e.map.getTargetElement().style.cursor = 'pointer';
} else {
e.map.getTargetElement().style.cursor = this.previousCursor_;
this.previousCursor_ = false;
}
};
/*
Water ripple effect.
Original code (Java) by Neil Wallis
@link http://www.neilwallis.com/java/water.html
Original code (JS) by Sergey Chikuyonok (serge.che@gmail.com)
@link http://chikuyonok.ru
@link http://media.chikuyonok.ru/ripple/
Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
@link https://github.com/Viglino
*/
/**
* @constructor
* @extends {ol.interaction.Pointer}
* @param {ol.flashlight.options} flashlight options param
* - color {ol.Color} light color, default transparent
* - fill {ol.Color} fill color, default rgba(0,0,0,0.8)
* - radius {number} radius of the flash
*/
ol.interaction.Ripple = function(options)
{
ol.interaction.Pointer.call(this,
{ handleDownEvent: this.rainDrop,
handleMoveEvent: this.rainDrop
});
// Default options
options = options||{};
this.riprad = options.radius || 3;
this.ripplemap = [];
this.last_map = [];
// Generate random ripples
this.interval = options.interval;
this.rains (this.interval);
};
ol.inherits(ol.interaction.Ripple, ol.interaction.Pointer);
/** Set the map > start postcompose
*/
ol.interaction.Ripple.prototype.setMap = function(map)
{ if (this.oncompose)
{ ol.Observable.unByKey(oncompose);
if (this.getMap()) this.getMap().render();
}
ol.interaction.Pointer.prototype.setMap.call(this, map);
if (map)
{ this.oncompose = map.on('postcompose', this.postcompose_.bind(this));
}
}
/** Generate random rain drop
* @param {integer} interval
*/
ol.interaction.Ripple.prototype.rains = function(interval)
{ if (this.onrain) clearTimeout (this.onrain);
var self = this;
vdelay = (typeof(interval)=="number" ? interval : 1000)/2;
delay = 3*vdelay/2;
var rnd = Math.random;
function rain()
{ if (self.width) self.rainDrop([rnd() * self.width, rnd() * self.height]);
self.onrain = setTimeout (rain, rnd()*vdelay + delay);
};
// Start raining
if (delay) rain();
}
/** Disturb water at specified point
* @param {ol.Pixel|ol.MapBrowserEvent}
*/
ol.interaction.Ripple.prototype.rainDrop = function(e)
{ if (!this.width) return;
var dx,dy;
if (e.pixel)
{ dx = e.pixel[0]*this.ratio;
dy = e.pixel[1]*this.ratio;
}
else
{ dx = e[0]*this.ratio;
dy = e[1]*this.ratio;
}
dx <<= 0;
dy <<= 0;
for (var j = dy - this.riprad*this.ratio; j < dy + this.riprad*this.ratio; j++)
{ for (var k = dx - this.riprad*this.ratio; k < dx + this.riprad*this.ratio; k++)
{ this.ripplemap[this.oldind + (j * this.width) + k] += 128;
}
}
}
/** Postcompose function
*/
ol.interaction.Ripple.prototype.postcompose_ = function(e)
{ var ctx = e.context;
var canvas = ctx.canvas;
// Initialize when canvas is ready / modified
if (this.width != canvas.width || this.height != canvas.height)
{ this.width = canvas.width;
this.height = canvas.height;
this.ratio = e.frameState.pixelRatio;
this.half_width = this.width >> 1;
this.half_height = this.height >> 1;
this.size = this.width * (this.height + 2) * 2;
this.oldind = this.width;
this.newind = this.width * (this.height + 3);
for (var i = 0; i < this.size; i++) {
this.last_map[i] = this.ripplemap[i] = 0;
}
}
this.texture = ctx.getImageData(0, 0, this.width, this.height);
this.ripple = ctx.getImageData(0, 0, this.width, this.height);
// Run animation
var a, b, data, cur_pixel, new_pixel;
var t = this.oldind; this.oldind = this.newind; this.newind = t;
var i = 0;
var _rd = this.ripple.data,
_td = this.texture.data;
for (var y = 0; y < this.height; y++) {
for (var x = 0; x < this.width; x++) {
var _newind = this.newind + i,
_mapind = this.oldind + i;
data = (
this.ripplemap[_mapind - this.width] +
this.ripplemap[_mapind + this.width] +
this.ripplemap[_mapind - 1] +
this.ripplemap[_mapind + 1]) >> 1;
data -= this.ripplemap[_newind];
data -= data >> 5;
this.ripplemap[_newind] = data;
//where data=0 then still, where data>0 then wave
data = 1024 - data;
if (this.last_map[i] != data)
{ this.last_map[i] = data;
//offsets
a = (((x - this.half_width) * data / 1024) << 0) + this.half_width;
b = (((y - this.half_height) * data / 1024) << 0) + this.half_height;
//bounds check
if (a >= this.width) a = this.width - 1;
if (a < 0) a = 0;
if (b >= this.height) b = this.height - 1;
if (b < 0) b = 0;
new_pixel = (a + (b * this.width)) * 4;
cur_pixel = i * 4;
/**/
_rd[cur_pixel] = _td[new_pixel];
_rd[cur_pixel + 1] = _td[new_pixel + 1];
_rd[cur_pixel + 2] = _td[new_pixel + 2];
/*/
// only in blue pixels
if (_td[new_pixel + 2]>_td[new_pixel + 1]
&& _td[new_pixel + 2]>_td[new_pixel])
{
_rd[cur_pixel] = _td[new_pixel];
_rd[cur_pixel + 1] = _td[new_pixel + 1];
_rd[cur_pixel + 2] = _td[new_pixel + 2];
}
else this.ripplemap[_newind] = 0;
/**/
}
++i;
}
}
ctx.putImageData(this.ripple, 0, 0);
// tell OL3 to continue postcompose animation
this.getMap().render();
};
/*
Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (http://www.cecill.info/).
ol.interaction.SelectCluster is an interaction for selecting vector features in a cluster.
*/
/**
* @classdesc
* Interaction for selecting vector features in a cluster.
* It can be used as an ol.interaction.Select.
* When clicking on a cluster, it springs apart to reveal the features in the cluster.
* Revealed features are selectable and you can pick the one you meant.
* Revealed features are themselves a cluster with an attribute features that contain the original feature.
*
* @constructor
* @extends {ol.interaction.Select}
* @param {olx.interaction.SelectOptions=} options SelectOptions.
* @param {ol.style} options.featureStyle used to style the revealed features as options.style is used by the Select interaction.
* @param {boolean} options.selectCluster false if you don't want to get cluster selected
* @param {Number} options.PointRadius to calculate distance between the features
* @param {bool} options.spiral means you want the feature to be placed on a spiral (or a circle)
* @param {Number} options.circleMaxObject number of object that can be place on a circle
* @param {Number} options.maxObjects number of object that can be drawn, other are hidden
* @param {bool} options.animation if the cluster will animate when features spread out, default is false
* @param {Number} options.animationDuration animation duration in ms, default is 500ms
* @fires ol.interaction.SelectEvent
* @api stable
*/
ol.interaction.SelectCluster = function(options)
{ options = options || {};
this.pointRadius = options.pointRadius || 12;
this.circleMaxObjects = options.circleMaxObjects || 10;
this.maxObjects = options.maxObjects || 60;
this.spiral = (options.spiral !== false);
this.animate = options.animate;
this.animationDuration = options.animationDuration || 500;
this.selectCluster_ = (options.selectCluster !== false);
// Create a new overlay layer for
var overlay = this.overlayLayer_ = new ol.layer.Vector(
{ source: new ol.source.Vector({
features: new ol.Collection(),
useSpatialIndex: true
}),
name:'Cluster overlay',
updateWhileAnimating: true,
updateWhileInteracting: true,
displayInLayerSwitcher: false,
style: options.featureStyle
});
// Add the overlay to selection
if (options.layers)
{ if (typeof(options.layers) == "function")
{ var fn = options.layers;
options.layers = function(layer)
{ return (layer===overlay || fn(layer));
};
}
else if (options.layers.push)
{ options.layers.push(this.overlayLayer_);
}
}
// Don't select links
if (options.filter)
{ var fn = options.filter;
options.filter = function(f,l)
{ //if (l===overlay && f.get("selectclusterlink")) return false;
if (!l && f.get("selectclusterlink")) return false;
else return fn(f,l);
};
}
else options.filter = function(f,l)
{ //if (l===overlay && f.get("selectclusterlink")) return false;
if (!l && f.get("selectclusterlink")) return false;
else return true;
};
this.filter_ = options.filter;
ol.interaction.Select.call(this, options);
this.on("select", this.selectCluster.bind(this));
};
ol.inherits(ol.interaction.SelectCluster, ol.interaction.Select);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.SelectCluster.prototype.setMap = function(map) {
if (this.getMap()) {
this.getMap().removeLayer(this.overlayLayer_);
}
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.interaction.Select.prototype.setMap.call (this, map);
this.overlayLayer_.setMap(map);
// map.addLayer(this.overlayLayer_);
if (map && map.getView()) {
this._listener = map.getView().on('change:resolution', this.clear.bind(this));
}
};
/**
* Clear the selection, close the cluster and remove revealed features
* @api stable
*/
ol.interaction.SelectCluster.prototype.clear = function()
{ this.getFeatures().clear();
this.overlayLayer_.getSource().clear();
};
/**
* Get the layer for the revealed features
* @api stable
*/
ol.interaction.SelectCluster.prototype.getLayer = function()
{ return this.overlayLayer_;
};
/**
* Select a cluster
* @param {ol.Feature} a cluster feature ie. a feature with a 'features' attribute.
* @api stable
*/
ol.interaction.SelectCluster.prototype.selectCluster = function (e)
{ // Nothing selected
if (!e.selected.length)
{ this.clear();
return;
}
// Get selection
var feature = e.selected[0];
// It's one of ours
if (feature.get('selectclusterfeature')) return;
// Clic out of the cluster => close it
var source = this.overlayLayer_.getSource();
source.clear();
var cluster = feature.get('features');
// Not a cluster (or just one feature)
if (!cluster || cluster.length==1) return;
// Remove cluster from selection
if (!this.selectCluster_) this.getFeatures().clear();
var center = feature.getGeometry().getCoordinates();
// Pixel size in map unit
var pix = this.getMap().getView().getResolution();
var r = pix * this.pointRadius * (0.5 + cluster.length / 4);
// Draw on a circle
if (!this.spiral || cluster.length <= this.circleMaxObjects)
{ var max = Math.min(cluster.length, this.circleMaxObjects);
for (var i=0; i<max; i++)
{ var a = 2*Math.PI*i/max;
if (max==2 || max == 4) a += Math.PI/4;
var p = [ center[0]+r*Math.sin(a), center[1]+r*Math.cos(a) ];
var cf = new ol.Feature({ 'selectclusterfeature':true, 'features':[cluster[i]], geometry: new ol.geom.Point(p) });
cf.setStyle(cluster[i].getStyle());
source.addFeature(cf);
var lk = new ol.Feature({ 'selectclusterlink':true, geometry: new ol.geom.LineString([center,p]) });
source.addFeature(lk);
};
}
// Draw on a spiral
else
{ // Start angle
var a = 0;
var r;
var d = 2*this.pointRadius;
var features = new Array();
var links = new Array();
var max = Math.min (this.maxObjects, cluster.length);
// Feature on a spiral
for (var i=0; i<max; i++)
{ // New radius => increase d in one turn
r = d/2 + d*a/(2*Math.PI);
// Angle
a = a + (d+0.1)/r;
var dx = pix*r*Math.sin(a)
var dy = pix*r*Math.cos(a)
var p = [ center[0]+dx, center[1]+dy ];
var cf = new ol.Feature({ 'selectclusterfeature':true, 'features':[cluster[i]], geometry: new ol.geom.Point(p) });
cf.setStyle(cluster[i].getStyle());
source.addFeature(cf);
var lk = new ol.Feature({ 'selectclusterlink':true, geometry: new ol.geom.LineString([center,p]) });
source.addFeature(lk);
}
}
if (this.animate) this.animateCluster_(center);
};
/**
* Animate the cluster and spread out the features
* @param {ol.Coordinates} the center of the cluster
*/
ol.interaction.SelectCluster.prototype.animateCluster_ = function(center)
{ // Stop animation (if one is running)
if (this.listenerKey_)
{ this.overlayLayer_.setVisible(true);
ol.Observable.unByKey(this.listenerKey_);
}
// Features to animate
var features = this.overlayLayer_.getSource().getFeatures();
if (!features.length) return;
this.overlayLayer_.setVisible(false);
var style = this.overlayLayer_.getStyle();
var stylefn = (typeof(style) == 'function') ? style : style.length ? function(){ return style; } : function(){ return [style]; } ;
var duration = this.animationDuration || 500;
var start = new Date().getTime();
// Animate function
function animate(event)
{ var vectorContext = event.vectorContext;
// Retina device
var ratio = event.frameState.pixelRatio;
var res = event.target.getView().getResolution();
var e = ol.easing.easeOut((event.frameState.time - start) / duration);
for (var i=0, feature; feature = features[i]; i++) if (feature.get('features'))
{ var pt = feature.getGeometry().getCoordinates();
pt[0] = center[0] + e * (pt[0]-center[0]);
pt[1] = center[1] + e * (pt[1]-center[1]);
var geo = new ol.geom.Point(pt);
// Image style
var st = stylefn(feature, res);
for (var s=0; s<st.length; s++)
{ var sc;
// OL < v4.3 : setImageStyle doesn't check retina
var imgs = ol.Map.prototype.getFeaturesAtPixel ? false : st[s].getImage();
if (imgs)
{ sc = imgs.getScale();
imgs.setScale(ratio);
}
// OL3 > v3.14
if (vectorContext.setStyle)
{ vectorContext.setStyle(st[s]);
vectorContext.drawGeometry(geo);
}
// older version
else
{ vectorContext.setImageStyle(imgs);
vectorContext.drawPointGeometry(geo);
}
if (imgs) imgs.setScale(sc);
}
}
// Stop animation and restore cluster visibility
if (e > 1.0)
{ ol.Observable.unByKey(this.listenerKey_);
this.overlayLayer_.setVisible(true);
this.overlayLayer_.changed();
return;
}
// tell OL3 to continue postcompose animation
event.frameState.animate = true;
}
// Start a new postcompose animation
this.listenerKey_ = this.getMap().on('postcompose', animate.bind(this));
//select.getMap().renderSync();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction to snap to guidelines
* @constructor
* @extends {ol.interaction.Interaction}
* @param {olx.interaction.SnapGuidesOptions}
* - pixelTolerance {number | undefined} distance (in px) to snap to a guideline, default 10 px
* - style {ol.style.Style | Array<ol.style.Style> | undefined} Style for the sektch features.
*/
ol.interaction.SnapGuides = function(options)
{ if (!options) options = {};
// Intersect 2 guides
function getIntersectionPoint (d1, d2)
{ var d1x = d1[1][0] - d1[0][0];
var d1y = d1[1][1] - d1[0][1];
var d2x = d2[1][0] - d2[0][0];
var d2y = d2[1][1] - d2[0][1];
var det = d1x * d2y - d1y * d2x;
if (det != 0)
{ var k = (d1x * d1[0][1] - d1x * d2[0][1] - d1y * d1[0][0] + d1y * d2[0][0]) / det;
return [d2[0][0] + k*d2x, d2[0][1] + k*d2y];
}
else return false;
}
function dist2D (p1,p2)
{ var dx = p1[0]-p2[0];
var dy = p1[1]-p2[1];
return Math.sqrt(dx*dx+dy*dy);
}
// Snap distance (in px)
this.snapDistance_ = options.pixelTolerance || 10;
// Default style
var sketchStyle =
[ new ol.style.Style({
stroke: new ol.style.Stroke(
{ color: '#ffcc33',
lineDash: [8,5],
width: 1.25
})
})
];
// Custom style
if (options.style) sketchStyle = options.style instanceof Array ? options.style : [options.style];
// Create a new overlay for the sketch
this.overlaySource_ = new ol.source.Vector(
{ features: new ol.Collection(),
useSpatialIndex: false
});
/* Speed up with a ImageVector layer (deprecated)
this.overlayLayer_ = new ol.layer.Image(
{ source: new ol.source.ImageVector(
{ source: this.overlaySource_,
style: function(f)
{ return sketchStyle;
}
}),
name:'Snap overlay',
displayInLayerSwitcher: false
});
*/
this.overlayLayer_ = new ol.layer.Vector(
{ source: this.overlaySource_,
style: function(f)
{ return sketchStyle;
},
name:'Snap overlay',
displayInLayerSwitcher: false
});
// Use snap interaction
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ if (this.getActive())
{ var features = this.overlaySource_.getFeatures();
var prev = null;
var p = null;
var res = e.frameState.viewState.resolution;
for (var i=0, f; f = features[i]; i++)
{ var c = f.getGeometry().getClosestPoint(e.coordinate);
if ( dist2D(c, e.coordinate) / res < this.snapDistance_)
{ // Intersection on 2 lines
if (prev)
{ var c2 = getIntersectionPoint(prev.getGeometry().getCoordinates(), f.getGeometry().getCoordinates());
if (c2)
{ if (dist2D(c2, e.coordinate) / res < this.snapDistance_)
{ p = c2;
}
}
}
else
{ p = c;
}
prev = f;
}
}
if (p) e.coordinate = p;
}
return true;
}
});
};
ol.inherits(ol.interaction.SnapGuides, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.SnapGuides.prototype.setMap = function(map)
{ if (this.getMap()) this.getMap().removeLayer(this.overlayLayer_);
ol.interaction.Interaction.prototype.setMap.call (this, map);
this.overlayLayer_.setMap(map);
if (map) this.projExtent_ = map.getView().getProjection().getExtent();
};
/** Activate or deactivate the interaction.
* @param {boolean} active
*/
ol.interaction.SnapGuides.prototype.setActive = function(active)
{ this.overlayLayer_.setVisible(active);
ol.interaction.Interaction.prototype.setActive.call (this, active);
}
/** Clear previous added guidelines
* @param {Array<ol.Feature> | undefined} features a list of feature to remove, default remove all feature
*/
ol.interaction.SnapGuides.prototype.clearGuides = function(features)
{ if (!features) this.overlaySource_.clear();
else
{ for (var i=0, f; f=features[i]; i++)
{ this.overlaySource_.removeFeature(f);
}
}
}
/** Get guidelines
* @return {ol.Collection} guidelines features
*/
ol.interaction.SnapGuides.prototype.getGuides = function(features)
{ return this.overlaySource_.getFeaturesCollection();
}
/** Add a new guide to snap to
* @param {Array<ol.coordinate>} v the direction vector
* @return {ol.Feature} feature guide
*/
ol.interaction.SnapGuides.prototype.addGuide = function(v, ortho)
{ if (v)
{ var map = this.getMap();
// Limit extent
var extent = map.getView().calculateExtent(map.getSize());
extent = ol.extent.buffer(extent, Math.max (1e5+1, (extent[2]-extent[0])*100));
extent = ol.extent.getIntersection(extent, this.projExtent_);
var dx = v[0][0] - v[1][0];
var dy = v[0][1] - v[1][1];
var d = 1 / Math.sqrt(dx*dx+dy*dy);
var p, g = [];
var p0, p1;
for (var i= 0; i<1e8; i+=1e5)
{ if (ortho) p = [ v[0][0] + dy*d*i, v[0][1] - dx*d*i];
else p = [ v[0][0] + dx*d*i, v[0][1] + dy*d*i];
if (ol.extent.containsCoordinate(extent, p)) g.push(p);
else break;
}
var f0 = new ol.Feature(new ol.geom.LineString(g));
var g=[];
for (var i= 0; i>-1e8; i-=1e5)
{ if (ortho) p = [ v[0][0] + dy*d*i, v[0][1] - dx*d*i];
else p = [ v[0][0] + dx*d*i, v[0][1] + dy*d*i];
if (ol.extent.containsCoordinate(extent, p)) g.push(p);
else break;
}
var f1 = new ol.Feature(new ol.geom.LineString(g));
this.overlaySource_.addFeature(f0);
this.overlaySource_.addFeature(f1);
return [f0, f1];
}
};
/** Add a new orthogonal guide to snap to
* @param {Array<ol.coordinate>} v the direction vector
* @return {ol.Feature} feature guide
*/
ol.interaction.SnapGuides.prototype.addOrthoGuide = function(v)
{ return this.addGuide(v, true);
};
/** Listen to draw event to add orthogonal guidelines on the first and last point.
* @param {_ol_interaction_Draw_} drawi a draw interaction to listen to
* @api
*/
ol.interaction.SnapGuides.prototype.setDrawInteraction = function(drawi)
{ var self = this;
// Number of points currently drawing
var nb = 0;
// Current guidelines
var features = [];
function setGuides(e)
{ var coord = [];
var s = 2;
switch (e.target.getType())
{ case 'LineString':
coord = e.target.getCoordinates();
s = 2;
break;
case 'Polygon':
coord = e.target.getCoordinates()[0];
s = 3;
break;
default: break;
}
var l = coord.length;
if (l != nb && l > s)
{ self.clearGuides(features);
features = self.addOrthoGuide([coord[l-s],coord[l-s-1]]);
features = features.concat(self.addGuide([coord[0],coord[1]]));
features = features.concat(self.addOrthoGuide([coord[0],coord[1]]));
nb = l;
}
};
// New drawing
drawi.on ("drawstart", function(e)
{ // When geom is changing add a new orthogonal direction
e.feature.getGeometry().on("change", setGuides);
});
// end drawing, clear directions
drawi.on ("drawend", function(e)
{ self.clearGuides(features);
e.feature.getGeometry().un("change", setGuides);
nb = 0;
features = [];
});
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction split interaction for splitting feature geometry
* @constructor
* @extends {ol.interaction.Interaction}
* @fires beforesplit, aftersplit
* @param {olx.interaction.SplitOptions}
* - source {ol.source.Vector|Array{ol.source.Vector}} a list of source to split (configured with useSpatialIndex set to true)
* - features {ol.Collection.<ol.Feature>} collection of feature to split
* - snapDistance {integer} distance (in px) to snap to an object, default 25px
* - cursor {string|undefined} cursor name to display when hovering an objet
* - filter {function|undefined} a filter that takes a feature and return true if it can be clipped, default always split.
* - featureStyle {ol.style.Style | Array<ol.style.Style> | false | undefined} Style for the selected features, choose false if you don't want feature selection. By default the default edit style is used.
* - sketchStyle {ol.style.Style | Array<ol.style.Style> | undefined} Style for the sektch features.
* - tolerance {function|undefined} Distance between the calculated intersection and a vertex on the source geometry below which the existing vertex will be used for the split. Default is 1e-10.
*/
ol.interaction.Split = function(options)
{ if (!options) options = {};
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ switch (e.type)
{ case "singleclick":
return this.handleDownEvent(e);
case "pointermove":
return this.handleMoveEvent(e);
default:
return true;
}
return true;
}
});
// Snap distance (in px)
this.snapDistance_ = options.snapDistance || 25;
// Split tolerance between the calculated intersection and the geometry
this.tolerance_ = options.tolerance || 1e-10;
// Cursor
this.cursor_ = options.cursor;
// List of source to split
this.sources_ = options.sources ? (options.sources instanceof Array) ? options.sources:[options.sources] : [];
if (options.features)
{ this.sources_.push (new ol.source.Vector({ features: features }));
}
// Get all features candidate
this.filterSplit_ = options.filter || function(){ return true; };
// Default style
var white = [255, 255, 255, 1];
var blue = [0, 153, 255, 1];
var width = 3;
var fill = new ol.style.Fill({ color: 'rgba(255,255,255,0.4)' });
var stroke = new ol.style.Stroke({
color: '#3399CC',
width: 1.25
});
var sketchStyle =
[ new ol.style.Style({
image: new ol.style.Circle({
fill: fill,
stroke: stroke,
radius: 5
}),
fill: fill,
stroke: stroke
})
];
var featureStyle =
[ new ol.style.Style({
stroke: new ol.style.Stroke({
color: white,
width: width + 2
})
}),
new ol.style.Style({
image: new ol.style.Circle({
radius: 2*width,
fill: new ol.style.Fill({
color: blue
}),
stroke: new ol.style.Stroke({
color: white,
width: width/2
})
}),
stroke: new ol.style.Stroke({
color: blue,
width: width
})
}),
];
// Custom style
if (options.sketchStyle) sketchStyle = options.sketchStyle instanceof Array ? options.sketchStyle : [options.sketchStyle];
if (options.featureStyle) featureStyle = options.featureStyle instanceof Array ? options.featureStyle : [options.featureStyle];
// Create a new overlay for the sketch
this.overlayLayer_ = new ol.layer.Vector(
{ source: new ol.source.Vector({
useSpatialIndex: false
}),
name:'Split overlay',
displayInLayerSwitcher: false,
style: function(f)
{ if (f._sketch_) return sketchStyle;
else return featureStyle;
}
});
};
ol.inherits(ol.interaction.Split, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.Split.prototype.setMap = function(map)
{ if (this.getMap()) this.getMap().removeLayer(this.overlayLayer_);
ol.interaction.Interaction.prototype.setMap.call (this, map);
this.overlayLayer_.setMap(map);
};
/** Get closest feature at pixel
* @param {ol.Pixel}
* @return {ol.feature}
* @private
*/
ol.interaction.Split.prototype.getClosestFeature = function(e)
{ var f, c, g, d = this.snapDistance_+1;
for (var i=0; i<this.sources_.length; i++)
{ var source = this.sources_[i];
f = source.getClosestFeatureToCoordinate(e.coordinate);
if (f.getGeometry().splitAt)
{ c = f.getGeometry().getClosestPoint(e.coordinate);
g = new ol.geom.LineString([e.coordinate,c]);
d = g.getLength() / e.frameState.viewState.resolution;
break;
}
}
if (d > this.snapDistance_) return false;
else
{ // Snap to node
var coord = this.getNearestCoord (c, f.getGeometry().getCoordinates());
var p = this.getMap().getPixelFromCoordinate(coord);
if (ol.coordinate.dist2d(e.pixel, p) < this.snapDistance_)
{ c = coord;
}
//
return { source:source, feature:f, coord: c, link: g };
}
}
/** Get nearest coordinate in a list
* @param {ol.coordinate} pt the point to find nearest
* @param {Array<ol.coordinate>} coords list of coordinates
* @return {ol.coordinate} the nearest coordinate in the list
*/
ol.interaction.Split.prototype.getNearestCoord = function(pt, coords)
{ var d, dm=Number.MAX_VALUE, p0;
for (var i=0; i < coords.length; i++)
{ d = ol.coordinate.dist2d (pt, coords[i]);
if (d < dm)
{ dm = d;
p0 = coords[i];
}
}
return p0;
};
/**
* @param {ol.MapBrowserEvent} evt Map browser event.
* @return {boolean} `true` to start the drag sequence.
*/
ol.interaction.Split.prototype.handleDownEvent = function(evt)
{ // Something to split ?
var current = this.getClosestFeature(evt);
if (current)
{ var self = this;
self.overlayLayer_.getSource().clear();
var split = current.feature.getGeometry().splitAt(current.coord, this.tolerance_);
if (split.length > 1)
{ var tosplit = [];
for (var i=0; i<split.length; i++)
{ var f = current.feature.clone();
f.setGeometry(split[i]);
tosplit.push(f);
}
self.dispatchEvent({ type:'beforesplit', original: current.feature, features: tosplit });
current.source.dispatchEvent({ type:'beforesplit', original: current.feature, features: tosplit });
current.source.removeFeature(current.feature);
for (var i=0; i<tosplit.length; i++)
{ current.source.addFeature(tosplit[i]);
}
self.dispatchEvent({ type:'aftersplit', original: current.feature, features: tosplit });
current.source.dispatchEvent({ type:'aftersplit', original: current.feature, features: tosplit });
}
}
return false;
};
/**
* @param {ol.MapBrowserEvent} evt Event.
*/
ol.interaction.Split.prototype.handleMoveEvent = function(e)
{ var map = e.map;
this.overlayLayer_.getSource().clear();
var current = this.getClosestFeature(e);
if (current && this.filterSplit_(current.feature))
{ var coord, p, l;
// Draw sketch
this.overlayLayer_.getSource().addFeature(current.feature);
p = new ol.Feature(new ol.geom.Point(current.coord));
p._sketch_ = true;
this.overlayLayer_.getSource().addFeature(p);
//
l = new ol.Feature(new ol.geom.LineString([e.coordinate,current.coord]));
l._sketch_ = true;
this.overlayLayer_.getSource().addFeature(l);
}
var element = map.getTargetElement();
if (this.cursor_)
{ if (current)
{ if (element.style.cursor != this.cursor_)
{ this.previousCursor_ = element.style.cursor;
element.style.cursor = this.cursor_;
}
}
else if (this.previousCursor_ !== undefined)
{ element.style.cursor = this.previousCursor_;
this.previousCursor_ = undefined;
}
}
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction splitter: acts as a split feature agent while editing vector features (LineString).
* @constructor
* @extends {ol.interaction.Interaction}
* @fires beforesplit, aftersplit
* @param {olx.interaction.SplitOptions}
* - source {ol.source.Vector|Array{ol.source.Vector}} The target source (or array of source) with features to be split (configured with useSpatialIndex set to true)
* - triggerSource {ol.source.Vector} Any newly created or modified features from this source will be used to split features on the target source. If none is provided the target source is used instead.
* - features {ol.Collection.<ol.Feature>} A collection of feature to be split (replace source target).
* - triggerFeatures {ol.Collection.<ol.Feature>} Any newly created or modified features from this collection will be used to split features on the target source (replace triggerSource).
* - filter {function|undefined} a filter that takes a feature and return true if the feature is eligible for splitting, default always split.
* - tolerance {function|undefined} Distance between the calculated intersection and a vertex on the source geometry below which the existing vertex will be used for the split. Default is 1e-10.
* @todo verify auto intersection on features that split.
*/
ol.interaction.Splitter = function(options)
{ if (!options) options = {};
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ // Hack to get only one changeFeature when draging with ol.interaction.Modify on.
if (e.type != "pointermove" && e.type != "pointerdrag")
{ if (this.lastEvent_)
{ this.splitSource(this.lastEvent_.feature);
this.lastEvent_ = null;
}
this.moving_ = false;
}
else this.moving_ = true;
return true;
},
});
// Features added / remove
this.added_ = [];
this.removed_ = [];
// Source to split
if (options.features)
{ this.source_ = new ol.source.Vector({ features: options.features });
}
else
{ this.source_ = options.source ? options.source : new ol.source.Vector({ features: new ol.Collection() });
}
var trigger = this.triggerSource;
if (options.triggerFeatures)
{ trigger = new ol.source.Vector({ features: options.triggerFeatures });
}
if (trigger)
{ trigger.on("addfeature", this.onAddFeature.bind(this));
trigger.on("changefeature", this.onChangeFeature.bind(this));
trigger.on("removefeature", this.onRemoveFeature.bind(this));
}
else
{ this.source_.on("addfeature", this.onAddFeature.bind(this));
this.source_.on("changefeature", this.onChangeFeature.bind(this));
this.source_.on("removefeature", this.onRemoveFeature.bind(this));
}
// Split tolerance between the calculated intersection and the geometry
this.tolerance_ = options.tolerance || 1e-10;
// Get all features candidate
this.filterSplit_ = options.filter || function(){ return true; };
};
ol.inherits(ol.interaction.Splitter, ol.interaction.Interaction);
/** Calculate intersection on 2 segs
* @param {Array<_ol_coordinate_>} s1 first seg to intersect (2 points)
* @param {Array<_ol_coordinate_>} s2 second seg to intersect (2 points)
* @return { boolean | _ol_coordinate_ } intersection point or false no intersection
*/
ol.interaction.Splitter.prototype.intersectSegs = function(s1,s2)
{ var tol = this.tolerance_;
// Solve
var x12 = s1[0][0] - s1[1][0];
var x34 = s2[0][0] - s2[1][0];
var y12 = s1[0][1] - s1[1][1];
var y34 = s2[0][1] - s2[1][1];
var det = x12 * y34 - y12 * x34;
// No intersection
if (Math.abs(det) < tol)
{ return false;
}
else
{ // Outside segement
var r1 = ((s1[0][0] - s2[1][0])*y34 - (s1[0][1] - s2[1][1])*x34) / det;
if (Math.abs(r1)<tol) return s1[0];
if (Math.abs(1-r1)<tol) return s1[1];
if (r1<0 || r1>1) return false;
var r2 = ((s1[0][1] - s2[1][1])*x12 - (s1[0][0] - s2[1][0])*y12) / det;
if (Math.abs(r2)<tol) return s2[1];
if (Math.abs(1-r2)<tol) return s2[0];
if (r2<0 || r2>1) return false;
// Intersection
var a = s1[0][0] * s1[1][1] - s1[0][1] * s1[1][0];
var b = s2[0][0] * s2[1][1] - s2[0][1] * s2[1][0];
var p = [(a * x34 - b * x12) / det, (a * y34 - b * y12) / det];
// Test start / end
/*
console.log("r1: "+r1)
console.log("r2: "+r2)
console.log ("s10: "+(_ol_coordinate_.dist2d(p,s1[0])<tol)) ;
console.log ("s11: "+(_ol_coordinate_.dist2d(p,s1[1])<tol)) ;
console.log ("s20: "+(_ol_coordinate_.dist2d(p,s2[0])<tol)) ;
console.log ("s21: "+(_ol_coordinate_.dist2d(p,s2[1])<tol)) ;
*/
return p;
}
};
/** Split the source using a feature
* @param {ol.Feature} feature The feature to use to split.
*/
ol.interaction.Splitter.prototype.splitSource = function(feature)
{ // Allready perform a split
if (this.splitting) return;
var self = this;
var i, k, f2;
// Start splitting
this.source_.dispatchEvent({ type:'beforesplit', feaure: feature, source: this.source_ });
this.splitting = true;
this.added_ = [];
this.removed_ = [];
var c = feature.getGeometry().getCoordinates();
var seg, split = [];
function intersect (f)
{ if (f !== feature)
{ var c2 = f.getGeometry().getCoordinates();
for (var j=0; j<c2.length-1; j++)
{ var p = this.intersectSegs (seg, [c2[j],c2[j+1]]);
if (p)
{ split.push(p);
g = f.getGeometry().splitAt(p, this.tolerance_);
if (g && g.length>1)
{ found = f;
return true;
}
}
}
}
return false;
}
// Split existing features
for (i=0; i<c.length-1; i++)
{ seg = [c[i],c[i+1]];
var extent = ol.extent.buffer(ol.extent.boundingExtent(seg), this.tolerance_ /*0.01*/ );
var g;
while (true)
{ var found = false;
this.source_.forEachFeatureIntersectingExtent(extent, intersect.bind(this));
// Split feature
if (found)
{ var f = found;
this.source_.removeFeature(f);
for (k=0; k<g.length; k++)
{ f2 = f.clone();
f2.setGeometry(g[k]);
this.source_.addFeature(f2);
}
}
else break;
}
}
// Auto intersect
for (i=0; i<c.length-2; i++)
{ for (var j=i+1; j<c.length-1; j++)
{ var p = this.intersectSegs ([c[i],c[i+1]], [c[j],c[j+1]]);
if (p && p!=c[i+1])
{ split.push(p);
}
}
}
// Split original
var splitOriginal = false;
if (split.length)
{ var result = feature.getGeometry().splitAt(split, this.tolerance_);
if (result.length>1)
{ for (k=0; k<result.length; k++)
{ f2 = feature.clone();
f2.setGeometry(result[k]);
this.source_.addFeature(f2);
}
splitOriginal = true;
}
}
// If the interaction is inserted after modify interaction, the objet is not consistant
// > wait end of other interactions
setTimeout (function()
{ if (splitOriginal) self.source_.removeFeature(feature);
self.source_.dispatchEvent({ type:'aftersplit', featureAdded: self.added_, featureRemoved: self.removed_, source: this.source_ });
// Finish
self.splitting = false;
},0);
};
/** New feature source is added
*/
ol.interaction.Splitter.prototype.onAddFeature = function(e)
{ this.splitSource(e.feature);
if (this.splitting)
{ this.added_.push(e.feature);
}
/*
if (this.splitting) return;
var self = this;
setTimeout (function() { self.splitSource(e.feature); }, 0);
*/
};
/** Feature source is removed > count features added/removed
*/
ol.interaction.Splitter.prototype.onRemoveFeature = function(e)
{ if (this.splitting)
{ var n = this.added_.indexOf(e.feature);
if (n==-1)
{ this.removed_.push(e.feature);
}
else
{ this.added_.splice(n,1);
}
}
};
/** Feature source is changing
*/
ol.interaction.Splitter.prototype.onChangeFeature = function(e)
{ if (this.moving_)
{ this.lastEvent_ = e;
}
else this.splitSource(e.feature);
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction synchronize
* @constructor
* @extends {ol.interaction.Interaction}
* @param {olx.interaction.SynchronizeOptions}
* - maps {Array<ol.Map>} An array of maps to synchronize with the map of the interaction
*/
ol.interaction.Synchronize = function(options)
{ if (!options) options={};
var self = this;
ol.interaction.Interaction.call(this,
{ handleEvent: function(e)
{ if (e.type=="pointermove") { self.handleMove_(e); }
return true;
}
});
this.maps = options.maps;
};
ol.inherits(ol.interaction.Synchronize, ol.interaction.Interaction);
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.Synchronize.prototype.setMap = function(map)
{
if (this._listener) {
ol.Observable.unByKey(this._listener.center);
ol.Observable.unByKey(this._listener.rotation);
ol.Observable.unByKey(this._listener.resolution);
$(this.getMap().getTargetElement()).off('mouseout', this._listener.mouseout);
}
this._listener = null;
ol.interaction.Interaction.prototype.setMap.call (this, map);
if (map) {
this._listener = {};
this._listener.center = this.getMap().getView().on('change:center', this.syncMaps.bind(this));
this._listener.rotation = this.getMap().getView().on('change:rotation', this.syncMaps.bind(this));
this._listener.resolution = this.getMap().getView().on('change:resolution', this.syncMaps.bind(this));
this._listener.mouseout = this.handleMouseOut_.bind(this);
$(this.getMap().getTargetElement()).on('mouseout', this._listener.mouseout);
this.syncMaps();
}
};
/** Synchronize the maps
*/
ol.interaction.Synchronize.prototype.syncMaps = function(e)
{ var map = this.getMap();
if (!e) e = { type:'all' };
if (map)
{ for (var i=0; i<this.maps.length; i++)
{ switch (e.type)
{ case 'change:rotation':
if (this.maps[i].getView().getRotation() != map.getView().getRotation())
this.maps[i].getView().setRotation(map.getView().getRotation());
break;
case 'change:center':
if (this.maps[i].getView().getCenter() != map.getView().getCenter())
this.maps[i].getView().setCenter(map.getView().getCenter());
break;
case 'change:resolution':
if (this.maps[i].getView().getResolution() != map.getView().getResolution())
{ /* old version prior to 1.19.1
this.maps[i].beforeRender ( ol.animation.zoom(
{ duration: 250,
resolution: this.maps[i].getView().getResolution()
}));
*/
this.maps[i].getView().setResolution(map.getView().getResolution());
}
break;
default:
this.maps[i].getView().setRotation(map.getView().getRotation());
this.maps[i].getView().setCenter(map.getView().getCenter());
this.maps[i].getView().setResolution(map.getView().getResolution());
break;
}
}
}
};
/** Cursor move > tells other maps to show the cursor
* @param {ol.event} e "move" event
*/
ol.interaction.Synchronize.prototype.handleMove_ = function(e)
{ for (var i=0; i<this.maps.length; i++)
{ this.maps[i].showTarget(e.coordinate);
}
this.getMap().showTarget();
};
/** Cursor out of map > tells other maps to hide the cursor
* @param {event} e "mouseOut" event
*/
ol.interaction.Synchronize.prototype.handleMouseOut_ = function(e) {
for (var i=0; i<this.maps.length; i++) {
this.maps[i].targetOverlay_.setPosition(undefined);
}
};
/** Show a target overlay at coord
* @param {ol.coordinate} coord
*/
ol.Map.prototype.showTarget = function(coord)
{ if (!this.targetOverlay_)
{ var elt = $("<div>").addClass("ol-target");
this.targetOverlay_ = new ol.Overlay({ element: elt.get(0) });
this.targetOverlay_.setPositioning('center-center');
this.addOverlay(this.targetOverlay_);
elt.parent().addClass("ol-target-overlay");
// hack to render targetOverlay before positioning it
this.targetOverlay_.setPosition([0,0]);
}
this.targetOverlay_.setPosition(coord);
};
/** Hide the target overlay
*/
ol.Map.prototype.hideTarget = function()
{
this.removeOverlay(this.targetOverlay_);
this.targetOverlay_ = undefined;
};
/*
Tinker Bell effect on maps.
Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
@link https://github.com/Viglino
*/
/**
* @constructor
* @extends {ol.interaction.Pointer}
* @param {ol.interaction.TinkerBell.options} options flashlight param
* - color {ol.color} color of the sparkles
*/
ol.interaction.TinkerBell = function(options)
{ options = options || {};
ol.interaction.Pointer.call(this,
{ handleDownEvent: this.onMove,
handleMoveEvent: this.onMove
});
this.set('color', options.color ? ol.color.asString(options.color) : "#fff");
this.sparkle = [0,0];
this.sparkles = [];
this.lastSparkle = this.time = new Date();
var self = this;
this.out_ = function() { self.isout_=true; };
this.isout_ = true;
};
ol.inherits(ol.interaction.TinkerBell, ol.interaction.Pointer);
/** Set the map > start postcompose
*/
ol.interaction.TinkerBell.prototype.setMap = function(map) {
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
if (this.getMap()) {
map.getViewport().removeEventListener('mouseout', this.out_, false);
this.getMap().render();
}
ol.interaction.Pointer.prototype.setMap.call(this, map);
if (map) {
this._listener = map.on('postcompose', this.postcompose_.bind(this));
map.getViewport().addEventListener('mouseout', this.out_, false);
}
};
ol.interaction.TinkerBell.prototype.onMove = function(e)
{ this.sparkle = e.pixel;
this.isout_ = false;
this.getMap().render();
};
/** Postcompose function
*/
ol.interaction.TinkerBell.prototype.postcompose_ = function(e)
{ var delta = 15;
var ctx = e.context;
var canvas = ctx.canvas;
var dt = e.frameState.time - this.time;
this.time = e.frameState.time;
if (e.frameState.time-this.lastSparkle > 30 && !this.isout_)
{ this.lastSparkle = e.frameState.time;
this.sparkles.push({ p:[this.sparkle[0]+Math.random()*delta-delta/2, this.sparkle[1]+Math.random()*delta], o:1 });
}
ctx.save();
ctx.scale(e.frameState.pixelRatio,e.frameState.pixelRatio);
ctx.fillStyle = this.get("color");
for (var i=this.sparkles.length-1, p; p=this.sparkles[i]; i--)
{ if (p.o < 0.2)
{ this.sparkles.splice(0,i+1);
break;
}
ctx.globalAlpha = p.o;
ctx.beginPath();
ctx.arc (p.p[0], p.p[1], 2.2, 0, 2 * Math.PI, false);
ctx.fill();
p.o *= 0.98;
p.p[0] += (Math.random()-0.5);
p.p[1] += dt*(1+Math.random())/30;
};
ctx.restore();
// tell OL3 to continue postcompose animation
if (this.sparkles.length) this.getMap().render();
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Interaction splitter: acts as a split feature agent while editing vector features (LineString).
* @constructor
* @extends {ol.interaction.Pointer}
* @param {olx.interaction.TouchCompass}
* - onDrag {function|undefined} Function handling "drag" events. It provides a dpixel and a traction (in projection) vector form the center of the compas
* - size {Number} size of the compass in px, default 80
* - alpha {Number} opacity of the compass, default 0.5
*/
ol.interaction.TouchCompass = function(options)
{ var options = options||{};
var self = this;
var opt = {};
// Click on the compass
opt.handleDownEvent = function(e)
{ var s = this.getCenter_();
var dx = e.pixel[0]-s[0];
var dy = e.pixel[1]-s[1];
this.start = e;
return (Math.sqrt(dx*dx+dy*dy) < this.size/2);
};
// Pn drag
opt.handleDragEvent = function(e)
{ if (!this.pos)
{ this.pos = this.start;
this.getMap().renderSync();
}
this.pos = e;
};
// Stop drag
opt.handleUpEvent = function(e)
{ this.pos = false;
return true;
};
ol.interaction.Pointer.call(this, opt);
this.ondrag_ = options.onDrag;
this.size = options.size || 80;
this.alpha = options.alpha || 0.5;
if (!ol.interaction.TouchCompass.prototype.compass)
{ var canvas = ol.interaction.TouchCompass.prototype.compass = document.createElement('canvas');
var ctx = canvas.getContext("2d");
var s = canvas.width = canvas.height = this.size;
var w = s/10;
var r = s/2;
var r2 = 0.22*r;
ctx.translate(r,r);
ctx.fillStyle = "#999";
ctx.strokeStyle = "#ccc";
ctx.lineWidth = w;
ctx.beginPath();
ctx.arc (0,0, s*0.42, 0, 2*Math.PI);
ctx.fill();
ctx.stroke();
ctx.fillStyle = "#99f";
ctx.beginPath();
ctx.moveTo (0,0);
ctx.lineTo (r,0); ctx.lineTo (r2,r2); ctx.moveTo (0,0);
ctx.lineTo (-r,0); ctx.lineTo (-r2,-r2); ctx.moveTo (0,0);
ctx.lineTo (0,r); ctx.lineTo (-r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,-r); ctx.lineTo (r2,-r2); ctx.moveTo (0,0);
ctx.fill();
ctx.fillStyle = "#eee";
ctx.beginPath();
ctx.moveTo (0,0);
ctx.lineTo (r,0); ctx.lineTo (r2,-r2); ctx.moveTo (0,0);
ctx.lineTo (-r,0); ctx.lineTo (-r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,r); ctx.lineTo (r2,r2); ctx.moveTo (0,0);
ctx.lineTo (0,-r); ctx.lineTo (-r2,-r2); ctx.moveTo (0,0);
ctx.fill();
}
};
ol.inherits(ol.interaction.TouchCompass, ol.interaction.Pointer);
/** Compass Image as a JS Image object
* @api
*/
ol.interaction.TouchCompass.prototype.compass = null;
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {_ol_Map_} map Map.
* @api stable
*/
ol.interaction.TouchCompass.prototype.setMap = function(map) {
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.interaction.Pointer.prototype.setMap.call (this, map);
if (map) {
this._listener = map.on('postcompose', this.drawCompass_.bind(this));
}
};
/**
* Activate or deactivate the interaction.
* @param {boolean} active Active.
* @observable
* @api
*/
ol.interaction.TouchCompass.prototype.setActive = function(b)
{ ol.interaction.Pointer.prototype.setActive.call (this, b);
if (this.getMap()) this.getMap().renderSync();
}
/**
* Get the center of the compass
* @param {_ol_coordinate_}
* @private
*/
ol.interaction.TouchCompass.prototype.getCenter_ = function()
{ var margin = 10;
var s = this.size;
var c = this.getMap().getSize();
return [c[0]/2, c[1]-margin-s/2];
}
/**
* Draw the compass on post compose
* @private
*/
ol.interaction.TouchCompass.prototype.drawCompass_ = function(e)
{ if (!this.getActive()) return;
var ctx = e.context;
var ratio = e.frameState.pixelRatio;
ctx.save();
ctx.scale(ratio,ratio);
ctx.globalAlpha = this.alpha;
ctx.strokeStyle = "#fff";
ctx.lineWidth = 5;
var s = this.size;
var c = this.getCenter_();
ctx.drawImage(this.compass, 0,0,this.compass.width,this.compass.height, c[0]-s/2, c[1]-s/2, s,s);
if (this.pos)
{ var dx = this.pos.pixel[0]-this.start.pixel[0];
var dy = this.pos.pixel[1]-this.start.pixel[1];
for (var i=1; i<=4; i++)
{ ctx.beginPath();
ctx.arc (c[0] +dx/4*i, c[1] +dy/4*i, s/2*(0.6+0.4*i/4), 0, 2*Math.PI);
ctx.stroke();
}
}
ctx.restore();
if (this.pos)
{ // Get delta
if (this.ondrag_)
{ var r = this.getMap().getView().getResolution();
var delta =
{ dpixel: [ this.pos.pixel[0] - this.start.pixel[0], this.pos.pixel[1] - this.start.pixel[1] ]
}
delta.traction = [ delta.dpixel[0]*r, -delta.dpixel[1]*r];
this.ondrag_(delta, this.pos);
}
// Continue animation
e.frameState.animate = true;
}
};
/** Interaction rotate
* @constructor
* @extends {ol.interaction.Pointer}
* @fires select | rotatestart | rotating | rotateend | translatestart | translating | translateend | scalestart | scaling | scaleend
* @param {any} options
* @param {Array<ol.Layer>} options.layers array of layers to transform,
* @param {ol.Collection<ol.Feature>} options.features collection of feature to transform,
* @param {ol.EventsConditionType|undefined} options.addCondition A function that takes an ol.MapBrowserEvent and returns a boolean to indicate whether that event should be handled. default: ol.events.condition.never.
* @param {number | undefined} options.hitTolerance Tolerance to select feature in pixel, default 0
* @param {bool} options.translateFeature Translate when click on feature
* @param {bool} options.translate Can translate the feature
* @param {bool} options.stretch can stretch the feature
* @param {bool} options.scale can scale the feature
* @param {bool} options.rotate can rotate the feature
* @param {ol.events.ConditionType | undefined} options.keepAspectRatio A function that takes an ol.MapBrowserEvent and returns a boolean to keep aspect ratio, default ol.events.condition.shiftKeyOnly.
* @param {ol.events.ConditionType | undefined} options.modifyCenter A function that takes an ol.MapBrowserEvent and returns a boolean to apply scale & strech from the center, default ol.events.condition.metaKey or ol.events.condition.ctrlKey.
* @param {} options.style list of ol.style for handles
*
*/
ol.interaction.Transform = function(options) {
if (!options) options = {};
var self = this;
// Create a new overlay layer for the sketch
this.handles_ = new ol.Collection();
this.overlayLayer_ = new ol.layer.Vector({
source: new ol.source.Vector({
features: this.handles_,
useSpatialIndex: false
}),
name:'Transform overlay',
displayInLayerSwitcher: false,
// Return the style according to the handle type
style: function (feature) {
return (self.style[(feature.get('handle')||'default')+(feature.get('constraint')||'')+(feature.get('option')||'')]);
}
});
// Extend pointer
ol.interaction.Pointer.call(this, {
handleDownEvent: this.handleDownEvent_,
handleDragEvent: this.handleDragEvent_,
handleMoveEvent: this.handleMoveEvent_,
handleUpEvent: this.handleUpEvent_
});
/** Collection of feature to transform */
this.features_ = options.features;
/** List of layers to transform */
this.layers_ = options.layers ? (options.layers instanceof Array) ? options.layers:[options.layers] : null;
this.addFn_ = options.addCondition || function() { return false; };
/* Translate when click on feature */
this.set('translateFeature', (options.translateFeature!==false));
/* Can translate the feature */
this.set('translate', (options.translate!==false));
/* Can stretch the feature */
this.set('stretch', (options.stretch!==false));
/* Can scale the feature */
this.set('scale', (options.scale!==false));
/* Can rotate the feature */
this.set('rotate', (options.rotate!==false));
/* Keep aspect ratio */
this.set('keepAspectRatio', (options.keepAspectRatio || function(e){ return e.originalEvent.shiftKey }));
/* Modify center */
this.set('modifyCenter', (options.modifyCenter || function(e){ return e.originalEvent.metaKey || e.originalEvent.ctrlKey }));
/* */
this.set('hitTolerance', (options.hitTolerance || 0));
this.selection_ = [];
// Force redraw when changed
this.on ('propertychange', function() {
this.drawSketch_();
});
// setstyle
this.setDefaultStyle();
};
ol.inherits(ol.interaction.Transform, ol.interaction.Pointer);
/** Cursors for transform
*/
ol.interaction.Transform.prototype.Cursors = {
'default': 'auto',
'select': 'pointer',
'translate': 'move',
'rotate': 'move',
'rotate0': 'move',
'scale': 'nesw-resize',
'scale1': 'nwse-resize',
'scale2': 'nesw-resize',
'scale3': 'nwse-resize',
'scalev': 'ew-resize',
'scaleh1': 'ns-resize',
'scalev2': 'ew-resize',
'scaleh3': 'ns-resize'
};
/**
* Remove the interaction from its current map, if any, and attach it to a new
* map, if any. Pass `null` to just remove the interaction from the current map.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.Transform.prototype.setMap = function(map) {
if (this.getMap()) this.getMap().removeLayer(this.overlayLayer_);
ol.interaction.Pointer.prototype.setMap.call (this, map);
this.overlayLayer_.setMap(map);
if (map !== null) {
this.isTouch = /touch/.test(map.getViewport().className);
this.setDefaultStyle();
}
};
/**
* Activate/deactivate interaction
* @param {bool}
* @api stable
*/
ol.interaction.Transform.prototype.setActive = function(b) {
this.select(null);
this.overlayLayer_.setVisible(b);
ol.interaction.Pointer.prototype.setActive.call (this, b);
};
/** Set efault sketch style
*/
ol.interaction.Transform.prototype.setDefaultStyle = function() {
// Style
var stroke = new ol.style.Stroke({ color: [255,0,0,1], width: 1 });
var strokedash = new ol.style.Stroke({ color: [255,0,0,1], width: 1, lineDash:[4,4] });
var fill0 = new ol.style.Fill({ color:[255,0,0,0.01] });
var fill = new ol.style.Fill({ color:[255,255,255,0.8] });
var circle = new ol.style.RegularShape({
fill: fill,
stroke: stroke,
radius: this.isTouch ? 12 : 6,
points: 15
});
circle.getAnchor()[0] = this.isTouch ? -10 : -5;
var bigpt = new ol.style.RegularShape({
fill: fill,
stroke: stroke,
radius: this.isTouch ? 16 : 8,
points: 4,
angle: Math.PI/4
});
var smallpt = new ol.style.RegularShape({
fill: fill,
stroke: stroke,
radius: this.isTouch ? 12 : 6,
points: 4,
angle: Math.PI/4
});
function createStyle (img, stroke, fill) {
return [ new ol.style.Style({image:img, stroke:stroke, fill:fill}) ];
}
/** Style for handles */
this.style = {
'default': createStyle (bigpt, strokedash, fill0),
'translate': createStyle (bigpt, stroke, fill),
'rotate': createStyle (circle, stroke, fill),
'rotate0': createStyle (bigpt, stroke, fill),
'scale': createStyle (bigpt, stroke, fill),
'scale1': createStyle (bigpt, stroke, fill),
'scale2': createStyle (bigpt, stroke, fill),
'scale3': createStyle (bigpt, stroke, fill),
'scalev': createStyle (smallpt, stroke, fill),
'scaleh1': createStyle (smallpt, stroke, fill),
'scalev2': createStyle (smallpt, stroke, fill),
'scaleh3': createStyle (smallpt, stroke, fill),
};
this.drawSketch_();
}
/**
* Set sketch style.
* @param {ol.Map} map Map.
* @api stable
*/
ol.interaction.Transform.prototype.setStyle = function(style, olstyle) {
if (!olstyle) return;
if (olstyle instanceof Array) this.style[style] = olstyle;
else this.style[style] = [ olstyle ];
for (var i=0; i<this.style[style].length; i++) {
var im = this.style[style][i].getImage();
if (im) {
if (style == 'rotate') im.getAnchor()[0] = -5;
if (this.isTouch) im.setScale(1.8);
}
var tx = this.style[style][i].getText();
if (tx) {
if (style == 'rotate') tx.setOffsetX(this.isTouch ? 14 : 7);
if (this.isTouch) tx.setScale(1.8);
}
}
this.drawSketch_();
};
/** Get Feature at pixel
* @param {ol.Pixel}
* @return {ol.feature}
* @private
*/
ol.interaction.Transform.prototype.getFeatureAtPixel_ = function(pixel) {
var self = this;
return this.getMap().forEachFeatureAtPixel(pixel,
function(feature, layer) {
var found = false;
// Overlay ?
if (!layer) {
if (feature===self.bbox_) return false;
self.handles_.forEach (function(f) { if (f===feature) found=true; });
if (found) return { feature: feature, handle:feature.get('handle'), constraint:feature.get('constraint'), option:feature.get('option') };
}
// feature belong to a layer
if (self.layers_) {
for (var i=0; i<self.layers_.length; i++) {
if (self.layers_[i]===layer) return { feature: feature };
}
return null;
}
// feature in the collection
else if (self.features_) {
self.features_.forEach (function(f) { if (f===feature) found=true; });
if (found) return { feature: feature };
else return null;
}
// Others
else return { feature: feature };
},
{ hitTolerance: this.get('hitTolerance') }
) || {};
}
/** Draw transform sketch
* @param {boolean} draw only the center
*/
ol.interaction.Transform.prototype.drawSketch_ = function(center) {
this.overlayLayer_.getSource().clear();
if (!this.selection_.length) return;
var ext = this.selection_[0].getGeometry().getExtent();
// Clone and extend
ext = ol.extent.buffer(ext, 0);
for (var i=1, f; f = this.selection_[i]; i++) {
ol.extent.extend(ext, f.getGeometry().getExtent());
}
if (center===true) {
if (!this.ispt_) {
this.overlayLayer_.getSource().addFeature(new ol.Feature( { geometry: new ol.geom.Point(this.center_), handle:'rotate0' }) );
var geom = ol.geom.Polygon.fromExtent(ext);
var f = this.bbox_ = new ol.Feature(geom);
this.overlayLayer_.getSource().addFeature (f);
}
}
else {
if (this.ispt_) {
var p = this.getMap().getPixelFromCoordinate([ext[0], ext[1]]);
ext = ol.extent.boundingExtent([
this.getMap().getCoordinateFromPixel([p[0]-10, p[1]-10]),
this.getMap().getCoordinateFromPixel([p[0]+10, p[1]+10])
]);
}
var geom = ol.geom.Polygon.fromExtent(ext);
var f = this.bbox_ = new ol.Feature(geom);
var features = [];
var g = geom.getCoordinates()[0];
if (!this.ispt_) {
features.push(f);
// Middle
if (this.get('stretch') && this.get('scale')) for (var i=0; i<g.length-1; i++) {
f = new ol.Feature( { geometry: new ol.geom.Point([(g[i][0]+g[i+1][0])/2,(g[i][1]+g[i+1][1])/2]), handle:'scale', constraint:i%2?"h":"v", option:i });
features.push(f);
}
// Handles
if (this.get('scale')) for (var i=0; i<g.length-1; i++) {
f = new ol.Feature( { geometry: new ol.geom.Point(g[i]), handle:'scale', option:i });
features.push(f);
}
// Center
if (this.get('translate') && !this.get('translateFeature')) {
f = new ol.Feature( { geometry: new ol.geom.Point([(g[0][0]+g[2][0])/2, (g[0][1]+g[2][1])/2]), handle:'translate' });
features.push(f);
}
}
// Rotate
if (this.get('rotate')) {
f = new ol.Feature( { geometry: new ol.geom.Point(g[3]), handle:'rotate' });
features.push(f);
}
// Add sketch
this.overlayLayer_.getSource().addFeatures(features);
}
};
/** Select a feature to transform
* @param {ol.Feature} feature the feature to transform
* @param {boolean} add true to add the feature to the selection, default false
*/
ol.interaction.Transform.prototype.select = function(feature, add) {
if (!feature) {
this.selection_ = [];
return;
}
if (!feature.getGeometry || !feature.getGeometry()) return;
// Add to selection
if (add) this.selection_.push(feature);
else this.selection_ = [feature];
this.ispt_ = (this.selection_.length===1 ? (this.selection_[0].getGeometry().getType() == "Point") : false);
this.drawSketch_();
this.dispatchEvent({ type:'select', feature: feature, features: this.selection_ });
}
/**
* @param {ol.MapBrowserEvent} evt Map browser event.
* @return {boolean} `true` to start the drag sequence.
*/
ol.interaction.Transform.prototype.handleDownEvent_ = function(evt) {
var sel = this.getFeatureAtPixel_(evt.pixel);
var feature = sel.feature;
if (this.selection_.length
&& this.selection_.indexOf(feature) >=0
&& ((this.ispt_ && this.get('translate')) || this.get('translateFeature'))
){
sel.handle = 'translate';
}
if (sel.handle) {
this.mode_ = sel.handle;
this.opt_ = sel.option;
this.constraint_ = sel.constraint;
// Save info
this.coordinate_ = evt.coordinate;
this.pixel_ = evt.pixel;
this.geoms_ = [];
var extent = ol.extent.createEmpty();
for (var i=0, f; f=this.selection_[i]; i++) {
this.geoms_.push(f.getGeometry().clone());
extent = ol.extent.extend(extent, f.getGeometry().getExtent());
}
this.extent_ = (ol.geom.Polygon.fromExtent(extent)).getCoordinates()[0];
if (this.mode_==='rotate') {
this.center_ = this.getCenter() || ol.extent.getCenter(extent);
// we are now rotating (cursor down on rotate mode), so apply the grabbing cursor
var element = evt.map.getTargetElement();
element.style.cursor = this.Cursors.rotate0;
this.previousCursor_ = element.style.cursor;
} else {
this.center_ = ol.extent.getCenter(extent);
}
this.angle_ = Math.atan2(this.center_[1]-evt.coordinate[1], this.center_[0]-evt.coordinate[0]);
this.dispatchEvent({
type: this.mode_+'start',
feature: this.selection_[0], // backward compatibility
features: this.selection_,
pixel: evt.pixel,
coordinate: evt.coordinate
});
return true;
}
else {
if (feature){
if (!this.addFn_(evt)) this.selection_ = [];
var index = this.selection_.indexOf(feature);
if (index < 0) this.selection_.push(feature);
else this.selection_.splice(index,1);
} else {
this.selection_ = [];
}
this.ispt_ = this.selection_.length===1 ? (this.selection_[0].getGeometry().getType() == "Point") : false;
this.drawSketch_();
this.dispatchEvent({ type:'select', feature: feature, features: this.selection_, pixel: evt.pixel, coordinate: evt.coordinate });
return false;
}
};
/**
* Get features to transform
* @return {Array<ol.Feature>}
*/
ol.interaction.Transform.prototype.getFeatures = function() {
return this.selection_;
};
/**
* Get the rotation center
* @return {ol.coordinates|undefined}
*/
ol.interaction.Transform.prototype.getCenter = function() {
return this.get('center');
};
/**
* Set the rotation center
* @param {ol.coordinates|undefined} c the center point, default center on the objet
*/
ol.interaction.Transform.prototype.setCenter = function(c) {
return this.set('center', c);
}
/**
* @param {ol.MapBrowserEvent} evt Map browser event.
*/
ol.interaction.Transform.prototype.handleDragEvent_ = function(evt) {
switch (this.mode_) {
case 'rotate': {
var a = Math.atan2(this.center_[1]-evt.coordinate[1], this.center_[0]-evt.coordinate[0]);
if (!this.ispt) {
// var geometry = this.geom_.clone();
// geometry.rotate(a-this.angle_, this.center_);
// this.feature_.setGeometry(geometry);
for (var i=0, f; f=this.selection_[i]; i++) {
var geometry = this.geoms_[i].clone();
geometry.rotate(a - this.angle_, this.center_);
f.setGeometry(geometry);
}
}
this.drawSketch_(true);
this.dispatchEvent({
type:'rotating',
feature: this.selection_[0],
features: this.selection_,
angle: a-this.angle_,
pixel: evt.pixel,
coordinate: evt.coordinate
});
break;
}
case 'translate': {
var deltaX = evt.coordinate[0] - this.coordinate_[0];
var deltaY = evt.coordinate[1] - this.coordinate_[1];
//this.feature_.getGeometry().translate(deltaX, deltaY);
for (var i=0, f; f=this.selection_[i]; i++) {
f.getGeometry().translate(deltaX, deltaY);
}
this.handles_.forEach(function(f) {
f.getGeometry().translate(deltaX, deltaY);
});
this.coordinate_ = evt.coordinate;
this.dispatchEvent({
type:'translating',
feature: this.selection_[0],
features: this.selection_,
delta:[deltaX,deltaY],
pixel: evt.pixel,
coordinate: evt.coordinate
});
break;
}
case 'scale': {
var center = this.center_;
if (this.get('modifyCenter')(evt)) {
center = this.extent_[(Number(this.opt_)+2)%4];
}
var scx = (evt.coordinate[0] - center[0]) / (this.coordinate_[0] - center[0]);
var scy = (evt.coordinate[1] - center[1]) / (this.coordinate_[1] - center[1]);
if (this.constraint_) {
if (this.constraint_=="h") scx=1;
else scy=1;
} else {
if (this.get('keepAspectRatio')(evt)) {
scx = scy = Math.min(scx,scy);
}
}
for (var i=0, f; f=this.selection_[i]; i++) {
var geometry = this.geoms_[i].clone();
geometry.applyTransform(function(g1, g2, dim) {
if (dim<2) return g2;
for (var i=0; i<g1.length; i+=dim) {
if (scx!=1) g2[i] = center[0] + (g1[i]-center[0])*scx;
if (scy!=1) g2[i+1] = center[1] + (g1[i+1]-center[1])*scy;
}
return g2;
});
f.setGeometry(geometry);
}
this.drawSketch_();
this.dispatchEvent({
type:'scaling',
feature: this.selection_[0],
features: this.selection_,
scale:[scx,scy],
pixel: evt.pixel,
coordinate: evt.coordinate
});
}
default: break;
}
};
/**
* @param {ol.MapBrowserEvent} evt Event.
*/
ol.interaction.Transform.prototype.handleMoveEvent_ = function(evt) {
// console.log("handleMoveEvent");
if (!this.mode_)
{ var map = evt.map;
var sel = this.getFeatureAtPixel_(evt.pixel);
var element = evt.map.getTargetElement();
if (sel.feature)
{ var c = sel.handle ? this.Cursors[(sel.handle||'default')+(sel.constraint||'')+(sel.option||'')] : this.Cursors.select;
if (this.previousCursor_===undefined)
{ this.previousCursor_ = element.style.cursor;
}
element.style.cursor = c;
}
else
{ if (this.previousCursor_!==undefined) element.style.cursor = this.previousCursor_;
this.previousCursor_ = undefined;
}
}
};
/**
* @param {ol.MapBrowserEvent} evt Map browser event.
* @return {boolean} `false` to stop the drag sequence.
*/
ol.interaction.Transform.prototype.handleUpEvent_ = function(evt) {
// remove rotate0 cursor on Up event, otherwise it's stuck on grab/grabbing
if (this.mode_ === 'rotate') {
var element = evt.map.getTargetElement();
element.style.cursor = this.Cursors.default;
this.previousCursor_ = undefined;
}
//dispatchEvent
this.dispatchEvent({
type:this.mode_+'end',
feature: this.selection_[0],
features: this.selection_,
oldgeom: this.geoms_[0],
oldgeoms: this.geoms_
});
this.drawSketch_();
this.mode_ = null;
return false;
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
@classdesc
ol.source.DBPedia is a DBPedia layer source that load DBPedia located content in a vector layer.
olx.source.DBPedia: olx.source.Vector
{ url: {string} Url for DBPedia SPARQL
}
@require jQuery
Inherits from:
<ol.source.Vector>
*/
/**
* @constructor ol.source.DBPedia
* @extends {ol.source.Vector}
* @param {olx.source.DBPedia=} opt_options
*/
ol.source.DBPedia = function(opt_options)
{ var options = opt_options || {};
var self = this;
options.loader = this._loaderFn;
/** Url for DBPedia SPARQL */
this._url = options.url || "http://fr.dbpedia.org/sparql";
/** Max resolution to load features */
this._maxResolution = options.maxResolution || 100;
/** Result language */
this._lang = options.lang || "fr";
/** Query limit */
this._limit = options.limit || 1000;
/** Default attribution */
if (!options.attributions) options.attributions = [ new ol.Attribution({ html:"&copy; <a href='http://dbpedia.org/'>DBpedia</a> CC-by-SA" }) ];
// Bbox strategy : reload at each move
if (!options.strategy) options.strategy = ol.loadingstrategy.bbox;
ol.source.Vector.call (this, options);
};
ol.inherits (ol.source.DBPedia, ol.source.Vector);
/** Decode RDF attributes and choose to add feature to the layer
* @param {feature} the feature
* @param {attributes} RDF attributes
* @param {lastfeature} last feature added (null if none)
* @return {boolean} true: add the feature to the layer
* @API stable
*/
ol.source.DBPedia.prototype.readFeature = function (feature, attributes, lastfeature)
{ // Copy RDF attributes values
for (var i in attributes) feature.set (i, attributes[i].value);
// Prevent same feature with different type duplication
if (lastfeature && lastfeature.get("subject") == attributes.subject.value)
{ // Kepp dbpedia.org type ?
// if (bindings[i].type.match ("dbpedia.org") lastfeature.get("type") = bindings[i].type.value;
// Concat types
lastfeature.set("type", lastfeature.get("type") +"\n"+ attributes.type.value);
return false;
}
else
{ return true;
}
};
/** Set RDF query subject, default: select label, thumbnail, abstract and type
* @API stable
*/
ol.source.DBPedia.prototype.querySubject = function ()
{ return "?subject rdfs:label ?label. "
+ "OPTIONAL {?subject dbpedia-owl:thumbnail ?thumbnail}."
+ "OPTIONAL {?subject dbpedia-owl:abstract ?abstract} . "
+ "OPTIONAL {?subject rdf:type ?type}";
}
/** Set RDF query filter, default: select language
* @API stable
*/
ol.source.DBPedia.prototype.queryFilter = function ()
{ return "lang(?label) = '"+this._lang+"' "
+ "&& lang(?abstract) = '"+this._lang+"'"
// Filter on type
//+ "&& regex (?type, 'Monument|Sculpture|Museum', 'i')"
}
/** Loader function used to load features.
* @private
*/
ol.source.DBPedia.prototype._loaderFn = function(extent, resolution, projection)
{ if (resolution > this._maxResolution) return;
var self = this;
var bbox = ol.proj.transformExtent(extent, projection, "EPSG:4326");
// SPARQL request: for more info @see http://fr.dbpedia.org/
query = "PREFIX geo: <http://www.w3.org/2003/01/geo/wgs84_pos#> "
+ "SELECT DISTINCT * WHERE { "
+ "?subject geo:lat ?lat . "
+ "?subject geo:long ?long . "
+ this.querySubject()+" . "
+ "FILTER("+this.queryFilter()+") . "
// Filter bbox
+ "FILTER(xsd:float(?lat) <= " + bbox[3] + " && " + bbox[1] + " <= xsd:float(?lat) "
+ "&& xsd:float(?long) <= " + bbox[2] + " && " + bbox[0] + " <= xsd:float(?long) "
+ ") . "
+ "} LIMIT "+this._limit;
// Ajax request to get the tile
$.ajax(
{ url: this._url,
dataType: 'jsonp',
data: { query: query, format:"json" },
success: function(data)
{ var bindings = data.results.bindings;
var features = [];
var att, pt, feature, lastfeature = null;
for ( var i in bindings )
{ att = bindings[i];
pt = [Number(bindings[i].long.value), Number(bindings[i].lat.value)];
feature = new ol.Feature(new ol.geom.Point(ol.proj.transform (pt,"EPSG:4326",projection)));
if (self.readFeature(feature, att, lastfeature))
{ features.push(feature);
lastfeature = feature;
}
}
self.addFeatures(features);
}});
};
(function(){
// Style cache
var styleCache = {};
/** Reset the cache (when fonts are loaded)
*/
ol.style.clearDBPediaStyleCache = function()
{ styleCache = {};
}
/** Get a default style function for dbpedia
* @param {} options
* @param {string|function|undefined} options.glyph a glyph name or a function that takes a feature and return a glyph
* @param {number} options.radius radius of the symbol, default 8
* @param {ol.style.Fill} options.fill style for fill, default navy
* @param {ol.style.stroke} options.stroke style for stroke, default 2px white
* @param {string} options.prefix a prefix if many style used for the same type
*
* @require ol.style.FontSymbol and FontAwesome defs are required for dbPediaStyleFunction()
*/
ol.style.dbPediaStyleFunction = function(options)
{ if (!options) options={};
// Get font function using dbPedia type
var getFont;
switch (typeof(options.glyph))
{ case "function": getFont = options.glyph; break;
case "string": getFont = function(){ return options.glyph; }; break;
default:
{ getFont = function (f)
{ var type = f.get("type");
if (type)
{ if (type.match("/Museum")) return "fa-camera";
else if (type.match("/Monument")) return "fa-building";
else if (type.match("/Sculpture")) return "fa-android";
else if (type.match("/Religious")) return "fa-institution";
else if (type.match("/Castle")) return "fa-key";
else if (type.match("Water")) return "fa-tint";
else if (type.match("Island")) return "fa-leaf";
else if (type.match("/Event")) return "fa-heart";
else if (type.match("/Artwork")) return "fa-asterisk";
else if (type.match("/Stadium")) return "fa-futbol-o";
else if (type.match("/Place")) return "fa-street-view";
}
return "fa-star";
}
break;
}
}
// Default values
var radius = options.radius || 8;
var fill = options.fill || new ol.style.Fill({ color:"navy"});
var stroke = options.stroke || new ol.style.Stroke({ color: "#fff", width: 2 });
var prefix = options.prefix ? options.prefix+"_" : "";
// Vector style function
return function (feature, resolution)
{ var glyph = getFont(feature);
var k = prefix + glyph;
var style = styleCache[k];
if (!style)
{ styleCache[k] = style = new ol.style.Style
({ image: new ol.style.FontSymbol(
{ glyph: glyph,
radius: radius,
fill: fill,
stroke: stroke
})
});
}
return [style];
}
};
})();
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
ol.source.GeoImage is a layer source with georeferencement to place it on a map.
olx.source.GeoImageOptions:
{ url: {string} url of the static image
image: {image} the static image, if not provided, use url to load an image
imageCenter: {ol.Coordinate} of the center of the image
imageScale: {ol.Size|Number} [scalex, scaley] of the image
imageRotate: {number} angle of the image in radian, default 0
imageCrop: {ol.Extent} of the image to be show (in the image) default: [0,0,imageWidth,imageHeight]
imageMask: {Array.<ol.Coordinate>} - linestring to mask the image on the map
}
*/
/** Layer source with georeferencement to place it on a map
* @constructor
* @extends {ol.source.ImageCanvas}
* @param {olx.source.GeoImageOptions=} options
*/
ol.source.GeoImage = function(opt_options)
{ var options = {
attributions: opt_options.attributions,
logo: opt_options.logo,
projection: opt_options.projection
};
// options.projection = opt_options.projection;
// Coordinate of the image center
this.center = opt_options.imageCenter;
// Scale of the image
this.scale = opt_options.imageScale;
// Rotation of the image
this.rotate = opt_options.imageRotate ? opt_options.imageRotate : 0;
// Crop of the image
this.crop = opt_options.imageCrop;
// Mask of the image
this.mask = opt_options.imageMask;
// Load Image
this._image = (opt_options.image ? opt_options.image : new Image );
this._image.crossOrigin = opt_options.crossOrigin; // 'anonymous';
// Show image on load
var self = this;
this._image.onload = function()
{ self.setCrop (self.crop);
self.changed();
}
if (!opt_options.image) this._image.src = opt_options.url;
// Draw image on canvas
options.canvasFunction = function(extent, resolution, pixelRatio, size, projection)
{ var canvas = document.createElement('canvas');
canvas.width = size[0];
canvas.height = size[1];
var ctx = canvas.getContext('2d');
if (!this._imageSize) return canvas;
// transform coords to pixel
function tr(xy)
{ return [(xy[0]-extent[0])/(extent[2]-extent[0]) * size[0],
(xy[1]-extent[3])/(extent[1]-extent[3]) * size[1]
];
}
// Clipping mask
if (this.mask)
{ ctx.beginPath();
var p = tr(this.mask[0]);
ctx.moveTo(p[0],p[1]);
for (var i=1; i<this.mask.length; i++)
{ p = tr(this.mask[i]);
ctx.lineTo(p[0],p[1]);
}
ctx.clip();
}
// Draw
var pixel = tr(this.center);
var dx = (this._image.naturalWidth/2 - this.crop[0]) *this.scale[0] /resolution *pixelRatio;
var dy = (this._image.naturalHeight/2 - this.crop[1]) *this.scale[1] /resolution *pixelRatio;
var sx = this._imageSize[0]*this.scale[0]/resolution *pixelRatio;
var sy = this._imageSize[1]*this.scale[1]/resolution *pixelRatio;
ctx.translate(pixel[0],pixel[1]);
if (this.rotate) ctx.rotate(this.rotate);
ctx.drawImage(this._image, this.crop[0], this.crop[1], this._imageSize[0], this._imageSize[1], -dx, -dy, sx,sy);
return canvas;
}
ol.source.ImageCanvas.call (this, options);
this.setCrop (this.crop);
};
ol.inherits (ol.source.GeoImage, ol.source.ImageCanvas);
/**
* Get coordinate of the image center.
* @return {ol.Coordinate} coordinate of the image center.
* @api stable
*/
ol.source.GeoImage.prototype.getCenter = function()
{ return this.center;
}
/**
* Set coordinate of the image center.
* @param {ol.Coordinate} coordinate of the image center.
* @api stable
*/
ol.source.GeoImage.prototype.setCenter = function(center)
{ this.center = center;
this.changed();
}
/**
* Get image scale.
* @return {ol.size} image scale (along x and y axis).
* @api stable
*/
ol.source.GeoImage.prototype.getScale = function()
{ return this.scale;
}
/**
* Set image scale.
* @param {ol.size|Number} image scale (along x and y axis or both).
* @api stable
*/
ol.source.GeoImage.prototype.setScale = function(scale)
{ switch (typeof(scale))
{ case 'number':
scale = [scale,scale];
break;
case 'object':
if (scale.length != 2) return;
break;
default: return;
}
this.scale = scale;
this.changed();
};
/**
* Get image rotation.
* @return {Number} rotation in degre.
* @api stable
*/
ol.source.GeoImage.prototype.getRotation = function()
{ return this.rotate;
};
/**
* Set image rotation.
* @param {Number} rotation in radian.
* @api stable
*/
ol.source.GeoImage.prototype.setRotation = function(angle)
{ this.rotate = angle;
this.changed();
};
/**
* Get the image.
* @api stable
*/
ol.source.GeoImage.prototype.getGeoImage = function()
{ return this._image;
};
/**
* Get image crop extent.
* @return {ol.extent} image crop extent.
* @api stable
*/
ol.source.GeoImage.prototype.getCrop = function()
{ return this.crop;
};
/**
* Set image mask.
* @param {ol.geom.LineString} coords of the mask
* @api stable
*/
ol.source.GeoImage.prototype.setMask = function(mask)
{ this.mask = mask;
this.changed();
};
/**
* Get image mask.
* @return {ol.geom.LineString} coords of the mask
* @api stable
*/
ol.source.GeoImage.prototype.getMask = function()
{ return this.mask;
};
/**
* Set image crop extent.
* @param {ol.extent|Number} image crop extent or a number to crop from original size.
* @api stable
*/
ol.source.GeoImage.prototype.setCrop = function(crop)
{ // Image not loaded => get it latter
if (!this._image.naturalWidth)
{ this.crop = crop;
return;
}
if (crop)
{ switch (typeof(crop))
{ case 'number':
crop = [crop,crop,this._image.naturalWidth-crop,this._image.naturalHeight-crop];
break;
case 'object':
if (crop.length != 4) return;
break;
default: return;
}
var crop = ol.extent.boundingExtent([ [crop[0],crop[1]], [crop[2],crop[3]] ]);
this.crop = [ Math.max(0,crop[0]), Math.max(0,crop[1]), Math.min(this._image.naturalWidth,crop[2]), Math.min(this._image.naturalHeight,crop[3]) ];
}
else this.crop = [0,0, this._image.naturalWidth,this._image.naturalHeight];
if (this.crop[2]<=this.crop[0]) this.crop[2] = this.crop[0]+1;
if (this.crop[3]<=this.crop[1]) this.crop[3] = this.crop[1]+1;
this._imageSize = [ this.crop[2]-this.crop[0], this.crop[3]-this.crop[1] ];
this.changed();
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** A source for hexagonal binning
* @constructor
* @extends {ol.source.Vector}
* @param {} options ol.source.VectorOptions + ol.HexGridOptions
* @param {ol.source.Vector} options.source Source
* @param {Number} options.size size of the exagon in map units, default 80000
* @param {ol.coordinate} options.origin orgin of the grid, default [0,0]
* @param {pointy|flat} options.layout grid layout, default pointy
* @param {function|undefined} options.geometryFunction Function that takes an ol.Feature as argument and returns an ol.geom.Point as feature's center.
*/
ol.source.HexBin = function(options) {
options = options || {} ;
// bind function for callback
this._bind = { modify: this._onModifyFeature.bind(this) };
ol.source.Vector.call (this, options);
// The HexGrid
this._hexgrid = new ol.HexGrid(options);
this._bin = {};
// Source and origin
this._origin = options.source;
// Geometry function to get a point
this._geomFn = options.geometryFunction || ol.coordinate.getFeatureCenter || function(f) { return f.getGeometry().getFirstCoordinate(); };
// Existing features
this.reset();
// Future features
this._origin.on("addfeature", this._onAddFeature.bind(this));
this._origin.on("removefeature", this._onRemoveFeature.bind(this));
};
ol.inherits (ol.source.HexBin, ol.source.Vector);
/**
* On add feature
* @param {ol.Event} e
* @private
*/
ol.source.HexBin.prototype._onAddFeature = function(e) {
var f = e.feature || e.target;
var h = this._hexgrid.coord2hex(this._geomFn(f));
var id = h.toString();
if (this._bin[id]) {
this._bin[id].get('features').push(f);
} else {
var ex = new ol.Feature(new ol.geom.Polygon([this._hexgrid.getHexagon(h)]));
ex.set('features',[f]);
ex.set('center', new ol.geom.Point(ol.extent.getCenter(ex.getGeometry().getExtent())));
this._bin[id] = ex;
this.addFeature(ex);
}
f.on("change", this._bind.modify);
};
/**
* Get the hexagon of a feature
* @param {ol.Feature} f
* @return {} the bin id, the index of the feature in the bin and a boolean if the feature has moved to an other bin
*/
ol.source.HexBin.prototype.getBin = function(f) {
// Test if feature exists in the current hex
var id = this._hexgrid.coord2hex(this._geomFn(f)).toString();
if (this._bin[id]) {
var index = this._bin[id].get('features').indexOf(f);
if (index > -1) return { id:id, index:index };
}
// The feature has moved > check all bins
for (id in this._bin) {
var index = this._bin[id].get('features').indexOf(f);
if (index > -1) return { id:id, index:index, moved:true };
}
return false;
};
/**
* On remove feature
* @param {ol.Event} e
* @param {*} bin
* @private
*/
ol.source.HexBin.prototype._onRemoveFeature = function(e, bin) {
var f = e.feature || e.target;
var b = bin || this.getBin(f);
if (b) {
var features = this._bin[b.id].get('features');
features.splice(b.index, 1);
if (!features.length) {
this.removeFeature(this._bin[b.id]);
delete this._bin[b.id];
}
} else {
console.log("[ERROR:HexBin] remove feature feature doesn't exists anymore.");
}
f.un("change", this._bind.modify);
};
/**
* A feature has been modified
* @param {ol.Event} e
* @private
*/
ol.source.HexBin.prototype._onModifyFeature = function(e) {
var bin = this.getBin(e.target);
if (bin && bin.moved) {
// remove from the bin
this._onRemoveFeature(e, bin);
// insert in the new bin
this._onAddFeature(e);
}
this.changed();
};
/** Clear all bins and generate a new one
*/
ol.source.HexBin.prototype.reset = function() {
this._bin = {};
this.clear();
var features = this._origin.getFeatures();
for (var i=0, f; f=features[i]; i++) {
this._onAddFeature({ feature:f });
};
};
/**
* Get the orginal source
* @return {ol.source.Vector}
*/
ol.source.HexBin.prototype.getSource = function() {
return this._origin;
};
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
@classdesc
ol.source.Mapillary is a source that load Mapillary's geotagged photos in a vector layer.
@require jQuery
Inherits from:
<ol.source.Vector>
*/
/**
* @constructor ol.source.Mapillary
* @extends {ol.source.Vector}
* @param {olx.source.Mapillary=} options
*/
ol.source.Mapillary = function(opt_options)
{ var options = opt_options || {};
var self = this;
options.loader = this._loaderFn;
/** Max resolution to load features */
this._maxResolution = options.maxResolution || 100;
/** Query limit */
this._limit = options.limit || 100;
/** Default attribution */
if (!options.attributions) options.attributions = [ new ol.Attribution({ html:"&copy; <a href='https://www.mapillary.com/'>Mapillary</a>" }) ];
// Bbox strategy : reload at each move
if (!options.strategy) options.strategy = ol.loadingstrategy.bbox;
// Init parent
ol.source.Vector.call (this, options);
// Client ID
// this.set("clientId", options.clientId);
};
ol.inherits (ol.source.Mapillary, ol.source.Vector);
/** Decode wiki attributes and choose to add feature to the layer
* @param {feature} the feature
* @param {attributes} wiki attributes
* @return {boolean} true: add the feature to the layer
* @API stable
*/
ol.source.Mapillary.prototype.readFeature = function (feature, attributes)
{ // Allways read feature (no filter)
return true;
};
/** Loader function used to load features.
* @private
*/
ol.source.Mapillary.prototype._loaderFn = function(extent, resolution, projection)
{ if (resolution > this._maxResolution) return;
var self = this;
var bbox = ol.proj.transformExtent(extent, projection, "EPSG:4326");
// Commons API: for more info @see https://www.mapillary.com/developer
var date = Date.now() - 6 * 30 * 24 * 60 * 60 * 1000;
var url = "https://a.mapillary.com/v2/search/im?client_id="
+ this.get('clientId')
+ "&max_lat=" + bbox[3]
+ "&max_lon=" + bbox[2]
+ "&min_lat=" + bbox[1]
+ "&min_lon=" + bbox[0]
+ "&limit="+(this._limit-1)
+ "&start_time=" + date;
// Ajax request to get the tile
$.ajax(
{ url: url,
dataType: 'jsonp',
success: function(data)
{ console.log(data);
/*
var features = [];
var att, pt, feature, lastfeature = null;
if (data.query && data.query.pages) return;
for ( var i in data.query.pages)
{ att = data.query.pages[i];
if (att.coordinates && att.coordinates.length )
{ pt = [att.coordinates[0].lon, att.coordinates[0].lat];
}
else
{ var meta = att.imageinfo[0].metadata;
if (!meta)
{ //console.log(att);
continue;
}
pt = [];
for (var k=0; k<meta.length; k++)
{ if (meta[k].name=="GPSLongitude") pt[0] = meta[k].value;
if (meta[k].name=="GPSLatitude") pt[1] = meta[k].value;
}
if (!pt.length)
{ //console.log(att);
continue;
}
}
feature = new ol.Feature(new ol.geom.Point(ol.proj.transform (pt,"EPSG:4326",projection)));
att.imageinfo[0].title = att.title;
if (self.readFeature(feature, att.imageinfo[0]))
{ features.push(feature);
}
}
self.addFeatures(features);
*/
}});
};
/* Copyright (c) 2018 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* OSM layer using the Ovepass API
* @constructor ol.source.Overpass
* @extends {ol.source.Vector}
* @param {any} options
* @param {string} options.url service url, default: https://overpass-api.de/api/interpreter
* @param {Array<string>} options.filter an array of tag filters, ie. ["key", "key=value", "key~value", ...]
* @param {boolean} options.node get nodes, default: true
* @param {boolean} options.way get ways, default: true
* @param {boolean} options.rel get relations, default: false
* @param {number} options.maxResolution maximum resolution to load features
* @param {string|ol.Attribution|Array<string>} options.attributions source attribution, default OSM attribution
* @param {ol.loadingstrategy} options.strategy loading strategy, default ol.loadingstrategy.bbox
*/
ol.source.Overpass = function(options) {
options = options || {};
var self = this;
options.loader = this._loaderFn;
/** Ovepass API Url */
this._url = options.url || 'https://overpass-api.de/api/interpreter';
/** Max resolution to load features */
this._maxResolution = options.maxResolution || 100;
/** Default attribution */
if (!options.attributions) {
options.attributions = ol.source.OSM.ATTRIBUTION;
}
// Bbox strategy : reload at each move
if (!options.strategy) options.strategy = ol.loadingstrategy.bbox;
ol.source.Vector.call (this, options);
this._types = {
node: options.node!==false,
way: options.way!==false,
rel: options.rel===true
};
this._filter = options.filter;
};
ol.inherits (ol.source.Overpass, ol.source.Vector);
/** Loader function used to load features.
* @private
*/
ol.source.Overpass.prototype._loaderFn = function(extent, resolution, projection) {
if (resolution > this._maxResolution) return;
var self = this;
var bbox = ol.proj.transformExtent(extent, projection, "EPSG:4326");
bbox = bbox[1] + ',' + bbox[0] + ',' + bbox[3] + ',' + bbox[2];
// Overpass QL
var query = '[bbox:'+bbox+'][out:xml][timeout:25];';
query += '(';
// Search attributes
for (var t in this._types) {
if (this._types[t]) {
query += t;
for (var n=0, filter; filter = this._filter[n]; n++) {
query += '['+filter+']';
}
query += ';'
}
}
query +=');out;>;out skel qt;'
var ajax = new XMLHttpRequest();
ajax.open('POST', this._url, true);
ajax.onload = function () {
var features = new ol.format.OSMXML().readFeatures(this.responseText,{featureProjection: projection});
var result = [];
// Remove duplicated features
for (var i=0, f; f=features[i]; i++) {
if (!self.hasFeature(f)) result.push(f);
}
vectorSource.addFeatures(result);
};
ajax.onerror = function () {
console.log(arguments);
};
ajax.send('data='+query);
};
/**
* Search if feature is allready loaded
* @param {ol.Feature} feature
* @return {boolean}
* @private
*/
ol.source.Overpass.prototype.hasFeature = function(feature) {
var p = feature.getGeometry().getFirstCoordinate();
var id = feature.getId();
var existing = this.getFeaturesInExtent([p[0]-0.1, p[1]-0.1, p[0]+0.1, p[1]+0.1]);
for (var i=0, f; f=existing[i]; i++) {
if (id===f.getId()) {
return true;
}
}
return false;
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
@classdesc
ol.source.WikiCommons is a source that load Wikimedia Commons content in a vector layer.
@require jQuery
Inherits from:
<ol.source.Vector>
*/
/**
* @constructor ol.source.WikiCommons
* @extends {ol.source.Vector}
* @param {olx.source.WikiCommons=} options
*/
ol.source.WikiCommons = function(opt_options)
{ var options = opt_options || {};
var self = this;
options.loader = this._loaderFn;
/** Max resolution to load features */
this._maxResolution = options.maxResolution || 100;
/** Result language */
this._lang = options.lang || "fr";
/** Query limit */
this._limit = options.limit || 100;
/** Default attribution */
if (!options.attributions) options.attributions = [ new ol.Attribution({ html:"&copy; <a href='https://commons.wikimedia.org/'>Wikimedia Commons</a>" }) ];
// Bbox strategy : reload at each move
if (!options.strategy) options.strategy = ol.loadingstrategy.bbox;
ol.source.Vector.call (this, options);
};
ol.inherits (ol.source.WikiCommons, ol.source.Vector);
/** Decode wiki attributes and choose to add feature to the layer
* @param {feature} the feature
* @param {attributes} wiki attributes
* @return {boolean} true: add the feature to the layer
* @API stable
*/
ol.source.WikiCommons.prototype.readFeature = function (feature, attributes)
{ feature.set("descriptionurl", attributes.descriptionurl);
feature.set("url", attributes.url);
feature.set("title", attributes.title.replace(/^file:|.jpg$/ig,""));
feature.set("thumbnail", attributes.url.replace(/^(.+wikipedia\/commons)\/([a-zA-Z0-9]\/[a-zA-Z0-9]{2})\/(.+)$/,"$1/thumb/$2/$3/200px-$3"));
feature.set("user", attributes.user);
if (attributes.extmetadata && attributes.extmetadata.LicenseShortName) feature.set("copy", attributes.extmetadata.LicenseShortName.value);
return true;
};
/** Loader function used to load features.
* @private
*/
ol.source.WikiCommons.prototype._loaderFn = function(extent, resolution, projection)
{ if (resolution > this._maxResolution) return;
var self = this;
var bbox = ol.proj.transformExtent(extent, projection, "EPSG:4326");
// Commons API: for more info @see https://commons.wikimedia.org/wiki/Commons:API/MediaWiki
var url = "https://commons.wikimedia.org/w/api.php?action=query&format=json&origin=*&prop=coordinates|imageinfo"
+ "&generator=geosearch&iiprop=timestamp|user|url|extmetadata|metadata|size&iiextmetadatafilter=LicenseShortName"
+ "&ggsbbox=" + bbox[3] + "|" + bbox[0] + "|" + bbox[1] + "|" + bbox[2]
+ "&ggslimit="+this._limit
+ "&iilimit="+(this._limit-1)
+ "&ggsnamespace=6";
// Ajax request to get the tile
$.ajax(
{ url: url,
dataType: 'jsonp',
success: function(data)
{ //console.log(data);
var features = [];
var att, pt, feature, lastfeature = null;
if (!data.query || !data.query.pages) return;
for ( var i in data.query.pages)
{ att = data.query.pages[i];
if (att.coordinates && att.coordinates.length )
{ pt = [att.coordinates[0].lon, att.coordinates[0].lat];
}
else
{ var meta = att.imageinfo[0].metadata;
if (!meta)
{ //console.log(att);
continue;
}
pt = [];
var found=0;
for (var k=0; k<meta.length; k++)
{ if (meta[k].name=="GPSLongitude")
{ pt[0] = meta[k].value;
found++;
}
if (meta[k].name=="GPSLatitude")
{ pt[1] = meta[k].value;
found++;
}
}
if (found!=2)
{ //console.log(att);
continue;
}
}
feature = new ol.Feature(new ol.geom.Point(ol.proj.transform (pt,"EPSG:4326",projection)));
att.imageinfo[0].title = att.title;
if (self.readFeature(feature, att.imageinfo[0]))
{ features.push(feature);
}
}
self.addFeatures(features);
}});
};
/*
Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (http://www.cecill.info/).
ol.layer.AnimatedCluster is a vector layer that animate cluster
*/
/**
* A vector layer for animated cluster
* @constructor
* @extends {ol.layer.Vector}
* @param {olx.layer.AnimatedClusterOptions=} options extend olx.layer.Options
* @param {Number} options.animationDuration animation duration in ms, default is 700ms
* @param {ol.easingFunction} animationMethod easing method to use, default ol.easing.easeOut
*/
ol.layer.AnimatedCluster = function(opt_options)
{ var options = opt_options || {};
ol.layer.Vector.call (this, options);
this.oldcluster = new ol.source.Vector();
this.clusters = [];
this.animation={start:false};
this.set('animationDuration', typeof(options.animationDuration)=='number' ? options.animationDuration : 700);
this.set('animationMethod', options.animationMethod || ol.easing.easeOut);
// Save cluster before change
this.getSource().on('change', this.saveCluster.bind(this));
// Animate the cluster
this.on('precompose', this.animate.bind(this));
this.on('postcompose', this.postanimate.bind(this));
};
ol.inherits (ol.layer.AnimatedCluster, ol.layer.Vector);
/** save cluster features before change
* @private
*/
ol.layer.AnimatedCluster.prototype.saveCluster = function() {
if (this.oldcluster) {
this.oldcluster.clear();
if (!this.get('animationDuration')) return;
var features = this.getSource().getFeatures();
if (features.length && features[0].get('features'))
{ this.oldcluster.addFeatures (this.clusters);
this.clusters = features.slice(0);
this.sourceChanged = true;
}
}
};
/**
* Get the cluster that contains a feature
* @private
*/
ol.layer.AnimatedCluster.prototype.getClusterForFeature = function(f, cluster)
{ for (var j=0, c; c=cluster[j]; j++)
{ var features = cluster[j].get('features');
if (features && features.length)
{ for (var k=0, f2; f2=features[k]; k++)
{ if (f===f2)
{ return cluster[j];
}
}
}
}
return false;
};
/**
* Stop animation
* @private
*/
ol.layer.AnimatedCluster.prototype.stopAnimation = function()
{ this.animation.start = false;
this.animation.cA = [];
this.animation.cB = [];
};
/**
* animate the cluster
* @private
*/
ol.layer.AnimatedCluster.prototype.animate = function(e)
{ var duration = this.get('animationDuration');
if (!duration) return;
var resolution = e.frameState.viewState.resolution;
var a = this.animation;
var time = e.frameState.time;
// Start a new animation, if change resolution and source has changed
if (a.resolution != resolution && this.sourceChanged)
{ var extent = e.frameState.extent;
if (a.resolution < resolution)
{ extent = ol.extent.buffer(extent, 100*resolution);
a.cA = this.oldcluster.getFeaturesInExtent(extent);
a.cB = this.getSource().getFeaturesInExtent(extent);
a.revers = false;
}
else
{ extent = ol.extent.buffer(extent, 100*resolution);
a.cA = this.getSource().getFeaturesInExtent(extent);
a.cB = this.oldcluster.getFeaturesInExtent(extent);
a.revers = true;
}
a.clusters = [];
for (var i=0, c0; c0=a.cA[i]; i++)
{ var f = c0.get('features');
if (f && f.length)
{ var c = this.getClusterForFeature (f[0], a.cB);
if (c) a.clusters.push({ f:c0, pt:c.getGeometry().getCoordinates() });
}
}
// Save state
a.resolution = resolution;
this.sourceChanged = false;
// No cluster or too much to animate
if (!a.clusters.length || a.clusters.length>1000)
{ this.stopAnimation();
return;
}
// Start animation from now
time = a.start = (new Date()).getTime();
}
// Run animation
if (a.start)
{ var vectorContext = e.vectorContext;
var d = (time - a.start) / duration;
// Animation ends
if (d > 1.0)
{ this.stopAnimation();
d = 1;
}
d = this.get('animationMethod')(d);
// Animate
var style = this.getStyle();
var stylefn = (typeof(style) == 'function') ? style : style.length ? function(){ return style; } : function(){ return [style]; } ;
// Layer opacity
e.context.save();
e.context.globalAlpha = this.getOpacity();
// Retina device
var ratio = e.frameState.pixelRatio;
for (var i=0, c; c=a.clusters[i]; i++)
{ var pt = c.f.getGeometry().getCoordinates();
var dx = pt[0]-c.pt[0];
var dy = pt[1]-c.pt[1];
if (a.revers)
{ pt[0] = c.pt[0] + d * dx;
pt[1] = c.pt[1] + d * dy;
}
else
{ pt[0] = pt[0] - d * dx;
pt[1] = pt[1] - d * dy;
}
// Draw feature
var st = stylefn(c.f, resolution, true);
// Preserve pixel ration on retina
var geo = new ol.geom.Point(pt);
for (var k=0, s; s=st[k]; k++)
{ var sc;
// OL < v4.3 : setImageStyle doesn't check retina
var imgs = ol.Map.prototype.getFeaturesAtPixel ? false : s.getImage();
if (imgs)
{ sc = imgs.getScale();
imgs.setScale(sc*ratio);
}
// OL3 > v3.14
if (vectorContext.setStyle)
{ // If one feature: draw the feature
if (c.f.get("features").length===1 && !dx && !dy) {
vectorContext.drawFeature(c.f.get("features")[0], s);
}
// else draw a point
else {
vectorContext.setStyle(s);
vectorContext.drawGeometry(geo);
}
}
// older version
else
{ vectorContext.setImageStyle(imgs);
vectorContext.setTextStyle(s.getText());
vectorContext.drawPointGeometry(geo);
}
if (imgs) imgs.setScale(sc);
}
}
e.context.restore();
// tell OL3 to continue postcompose animation
e.frameState.animate = true;
// Prevent layer drawing (clip with null rect)
e.context.save();
e.context.beginPath();
e.context.rect(0,0,0,0);
e.context.clip();
this.clip_ = true;
}
return;
};
/**
* remove clipping after the layer is drawn
* @private
*/
ol.layer.AnimatedCluster.prototype.postanimate = function(e)
{ if (this.clip_)
{ e.context.restore();
this.clip_ = false;
}
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Return a preview image of the source.
* @param {ol.Coordinate|undefined} lonlat The center of the preview.
* @param {number} resolution of the preview.
* @return {String} the preview url
* @api
*/
ol.source.Source.prototype.getPreview = function(lonlat, resolution)
{ return "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABHNCSVQICAgIfAhkiAAAAAlwSFlzAAAk6QAAJOkBUCTn+AAAABl0RVh0U29mdHdhcmUAd3d3Lmlua3NjYXBlLm9yZ5vuPBoAAANeSURBVHic7ZpPiE1RHMc/780MBhkik79JSUlIUbOxI+wkI2yRhYSUlJLNpJF/xcpiJBmZGBZsNM1CkmhKITGkGbH0/BuPmXnP4rxbb/TOn3fvOffeec6nfqvb/b7f93fveeec37ng8Xg8Ho/nf6Uu4d+fDswFssCvhHOJhaXAMeApMAQUyyIPPAdOAiuTStAVy4EHjDWsix5gdRLJ2mY34ulWYz6IEeA4kIk9awtkgTOEM/5vdAKT4k0/Ou3YMR/ELcbRm9AKFLBbgCJwNE4TYZkJfMG++SIwDCyLz0o4bI17WdyJz0r1TAZ+oDcxCBwAFgIzEIuhvcBbg3sLwOK4DFXLFvQGniCGSSUagS4DjUPOHESkA3XiOWCORqMR6Nfo9DjI3QqPUSd+ylBnv0Zn0GrWFvmIOvGNhjqrNDp/EAutyFgRKUM2tgO+Gur81FxvAKYZaimxXYBvmuuLDHWWaK4X0RfJCNsF6NdcbzXU2a65PohYFKWOc+jn8PUajbWIXaBKp9NB7lZYh34OzwFbFfd/NtDYYSth27urLGIm0M31AL3APWAAmIooymaDnPIl/Vz4NN1yHrd7gcvxWQnHAuA3bsyPop8hUsE13BSgK04TUViBeFo2zedJ8S6wElexW4D2eNOPTjNi6WvD/DtEr8E6tk6GGoAmxFY2iFHE9NZiQf8gogiB9gTEH23izAZuE77vHyU+ANucO1QwD3hD/MbLowAcdm20EmkwXx4n3NodS9rMB2HabYpEWs0HcRqHp0fNwAvJD+eBTZr7p6BvmQVxUaEzEbiruNfJekH15L8jtrEm7JJolEcOmKXRqQOuKDQuY7HZY8s8iNfzkSLxIuI43FTrkkLnOlBfRW4VsWk+oAX5weknxFAxJQNckGgVgZuIRVoomoGXEmGTMa+iQ6K7M4SW7k24QYgiuDQPYinbhugiF4H3RGtzZYCzyIvQXfpNI1ybLyeLpf5+iTbkRbiP2EcocTHm4+YI8iI8RFHwWjAfsA95Q+YZFU6wasl8wB7kReijtNbIILa0vcg/PRlGfPQwHmlCviDqAzaA+OREtzqr1ejOIDorxlNEjTGUBV4nnUWCvAJxGDlA8q9j3DEArAn2zvXAfOwfl6eVAmJrPpJ0Ih6Px+PxeJLjLwPul3vj5d0eAAAAAElFTkSuQmCC";
};
/**
* Return the tile image of the source.
* @param {ol.Coordinate|undefined} lonlat The center of the preview.
* @param {number} resolution of the preview.
* @return {String} the preview url
* @api
*/
ol.source.Tile.prototype.getPreview = function(lonlat, resolution)
{ if (!lonlat) lonlat = [21020, 6355964];
if (!resolution) resolution = 150;
var coord = this.getTileGrid().getTileCoordForCoordAndResolution(lonlat, resolution);
var fn = this.getTileUrlFunction();
return fn.call(this, coord, this.getProjection());
};
/**
* Return the tile image of the source.
* @param {ol.Coordinate|undefined} lonlat The center of the preview.
* @param {number} resolution of the preview.
* @return {String} the preview url
* @api
*/
ol.source.TileWMS.prototype.getPreview = function(lonlat, resolution)
{ if (!lonlat) lonlat = [21020, 6355964];
if (!resolution) resolution = 150;
/* No way to acces tileUrlFunction...
var fn = this.getTileUrlFunction();
return fn.call(this, lonlat, this.getProjection());
*/
// Use getfeature info instead
var url = this.getGetFeatureInfoUrl(lonlat, resolution, this.getProjection() || 'EPSG:3857', {});
url = url.replace(/getfeatureinfo/i,"GetMap");
return url;
};
/**
* Return a preview for the layer.
* @param {ol.Coordinate|undefined} lonlat The center of the preview.
* @param {number} resolution of the preview.
* @return {Array<String>} list of preview url
* @api
*/
ol.layer.Layer.prototype.getPreview = function(lonlat, resolution)
{ if (this.get("preview")) return [ this.get("preview") ];
if (!resolution) resolution = 150;
// Get middle resolution
if (resolution < this.getMinResolution() || resolution > this.getMaxResolution())
{ var rmin = this.getMinResolution(),
rmax = this.getMaxResolution();
if (rmax>100000) rmax = 156543; // min zoom : world
if (rmin<0.15) rmin = 0.15; // max zoom
resolution = rmax;
while (rmax>rmin)
{ rmin *= 2;
rmax /= 2;
resolution = rmin;
}
}
var e = this.getExtent();
if (!lonlat) lonlat = [21020, 6355964]; // Default lonlat
if (e && !ol.extent.containsCoordinate(e,lonlat)) lonlat = [ (e[0]+e[2])/2, (e[1]+e[3])/2 ];
if (this.getSource) return [ this.getSource().getPreview(lonlat, resolution) ];
return [];
};
/**
* Return a preview for the layer.
* @param {_ol_coordinate_|undefined} lonlat The center of the preview.
* @param {number} resolution of the preview.
* @return {Array<String>} list of preview url
* @api
*/
ol.layer.Group.prototype.getPreview = function(lonlat, resolution)
{ if (this.get("preview")) return [ this.get("preview") ];
var t = [];
if (this.getLayers)
{ var l = this.getLayers().getArray();
for (var i=0; i<l.length; i++)
{ t = t.concat(l[i].getPreview(lonlat, resolution));
}
}
return t;
};
//NB: (Not confirmed)To use this module, you just have to :
// import('ol-ext/layer/getpreview')
/** ol.layer.Vector.prototype.setRender3D
* @extends {ol.layer.Vector}
* @param {ol.render3D}
*/
ol.layer.Vector.prototype.setRender3D = function (r)
{ r.setLayer(this);
}
/**
* @classdesc
* ol.render3D 3D vector layer rendering
* @constructor
* @param {olx.render3DOption}
* - masResolution {number} max resolution to render 3D
* - defaultHeight {number} default height if none is return by a propertie
* - height {function|string|Number} a height function (return height giving a feature) or a popertie name for the height or a fixed value
*/
ol.render3D = function (options)
{ var options = options || {};
this.maxResolution_ = options.maxResolution || 100
this.defaultHeight_ = options.defaultHeight || 0;
this.height_ = this.getHfn (options.height);
}
/** Calculate 3D at potcompose
*/
ol.render3D.prototype.onPostcompose_ = function(e)
{ var res = e.frameState.viewState.resolution;
if (res > this.maxResolution_) return;
this.res_ = res*400;
if (this.animate_)
{ var elapsed = e.frameState.time - this.animate_;
if (elapsed < this.animateDuration_)
{ this.elapsedRatio_ = this.easing_(elapsed / this.animateDuration_);
// tell OL3 to continue postcompose animation
e.frameState.animate = true;
}
else
{ this.animate_ = false;
this.height_ = this.toHeight_
}
}
var ratio = e.frameState.pixelRatio;
var ctx = e.context;
var m = this.matrix_ = e.frameState.coordinateToPixelTransform;
// Old version (matrix)
if (!m)
{ m = e.frameState.coordinateToPixelMatrix,
m[2] = m[4];
m[3] = m[5];
m[4] = m[12];
m[5] = m[13];
}
this.center_ = [ctx.canvas.width/2/ratio, ctx.canvas.height/ratio];
var f = this.layer_.getSource().getFeaturesInExtent(e.frameState.extent);
ctx.save();
ctx.scale(ratio,ratio);
ctx.lineWidth = 1;
ctx.strokeStyle = "red";
ctx.fillStyle = "rgba(0,0,255,0.5)";
var builds = [];
for (var i=0; i<f.length; i++)
{ builds.push (this.getFeature3D_ (f[i], this.getFeatureHeight(f[i])));
}
this.drawFeature3D_ (ctx, builds);
ctx.restore();
}
/** Set layer to render 3D
*/
ol.render3D.prototype.setLayer = function(l)
{ if (this.layer_) this.layer_.un ('postcompose', this.onPostcompose_, this);
this.layer_ = l;
l.on ('postcompose', this.onPostcompose_, this);
}
/** Create a function that return height of a feature
* @param {function|string|number} a height function or a popertie name or a fixed value
* @return {function} function(f) return height of the feature f
*/
ol.render3D.prototype.getHfn= function(h)
{ switch (typeof(h))
{ case 'function': return h;
case 'string':
{ var dh = this.defaultHeight_;
return (function(f)
{ return (Number(f.get(h)) || dh);
});
}
case 'number': return (function(f) { return h; });
default: return (function(f) { return 10; });
}
}
/** Animate rendering
* @param {olx.render3D.animateOptions}
* - height {string|function|number} an attribute name or a function returning height of a feature or a fixed value
* - durtion {number} the duration of the animatioin ms, default 1000
* - easing {ol.easing} an ol easing function
* @api
*/
ol.render3D.prototype.animate = function(options)
{ options = options || {};
this.toHeight_ = this.getHfn(options.height);
this.animate_ = new Date().getTime();
this.animateDuration_ = options.duration ||1000;
this.easing_ = options.easing || ol.easing.easeOut;
// Force redraw
this.layer_.changed();
}
/** Check if animation is on
* @return {bool}
*/
ol.render3D.prototype.animating = function()
{ if (this.animate_ && new Date().getTime() - this.animate_ > this.animateDuration_)
{ this.animate_ = false;
}
return !!this.animate_;
}
/**
*/
ol.render3D.prototype.getFeatureHeight = function (f)
{ if (this.animate_)
{ var h1 = this.height_(f);
var h2 = this.toHeight_(f);
return (h1*(1-this.elapsedRatio_)+this.elapsedRatio_*h2);
}
else return this.height_(f);
}
/**
*/
ol.render3D.prototype.hvector_ = function (pt, h)
{ p0 = [ pt[0]*this.matrix_[0] + pt[1]*this.matrix_[1] + this.matrix_[4],
pt[0]*this.matrix_[2] + pt[1]*this.matrix_[3] + this.matrix_[5]
];
p1 = [ p0[0] + h/this.res_*(p0[0]-this.center_[0]),
p0[1] + h/this.res_*(p0[1]-this.center_[1])
];
return {p0:p0, p1:p1};
}
/**
*/
ol.render3D.prototype.getFeature3D_ = function (f, h)
{ var c = f.getGeometry().getCoordinates();
switch (f.getGeometry().getType())
{ case "Polygon":
c = [c];
case "MultiPolygon":
var build = [];
for (var i=0; i<c.length; i++)
{ var p0, p1;
for (var j=0; j<c[i].length; j++)
{ var b = [];
for (var k=0; k<c[i][j].length; k++)
{ b.push( this.hvector_(c[i][j][k], h) );
}
build.push(b);
}
}
return { type:"MultiPolygon", feature:f, geom:build };
case "Point":
return { type:"Point", feature:f, geom:this.hvector_(c,h) };
default: return {};
}
}
/**
*/
ol.render3D.prototype.drawFeature3D_ = function(ctx, build)
{ // Construct
for (var i=0; i<build.length; i++)
{
switch (build[i].type)
{ case "MultiPolygon":
for (var j=0; j<build[i].geom.length; j++)
{ var b = build[i].geom[j];
for (var k=0; k < b.length; k++)
{ ctx.beginPath();
ctx.moveTo(b[k].p0[0], b[k].p0[1]);
ctx.lineTo(b[k].p1[0], b[k].p1[1]);
ctx.stroke();
}
}
break;
case "Point":
{ var g = build[i].geom;
ctx.beginPath();
ctx.moveTo(g.p0[0], g.p0[1]);
ctx.lineTo(g.p1[0], g.p1[1]);
ctx.stroke();
break;
}
default: break;
}
}
// Roof
for (var i=0; i<build.length; i++)
{ switch (build[i].type)
{ case "MultiPolygon":
{ ctx.beginPath();
for (var j=0; j<build[i].geom.length; j++)
{ var b = build[i].geom[j];
if (j==0)
{ ctx.moveTo(b[0].p1[0], b[0].p1[1]);
for (var k=1; k < b.length; k++)
{ ctx.lineTo(b[k].p1[0], b[k].p1[1]);
}
}
else
{ ctx.moveTo(b[0].p1[0], b[0].p1[1]);
for (var k=b.length-2; k>=0; k--)
{ ctx.lineTo(b[k].p1[0], b[k].p1[1]);
}
}
ctx.closePath();
}
ctx.fill("evenodd");
ctx.stroke();
break;
}
case "Point":
{ var b = build[i];
var t = b.feature.get('label');
var p = b.geom.p1;
var f = ctx.fillStyle;
ctx.fillStyle = ctx.strokeStyle;
ctx.textAlign = 'center';
ctx.textBaseline = 'bottom';
ctx.fillText ( t, p[0], p[1] );
var m = ctx.measureText(t);
var h = Number (ctx.font.match(/\d+(\.\d+)?/g).join([]));
ctx.fillStyle = "rgba(255,255,255,0.5)";
ctx.fillRect (p[0]-m.width/2 -5, p[1]-h -5, m.width +10, h +10)
ctx.strokeRect (p[0]-m.width/2 -5, p[1]-h -5, m.width +10, h +10)
ctx.fillStyle = f;
//console.log(build[i].feature.getProperties())
}
default: break;
}
}
}
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc
* The Magnify overlay add a "magnifying glass" effect to an OL3 map that displays
* a portion of the map in a different zoom (and actually display different content).
*
* @constructor
* @extends {ol.Overlay}
* @param {olx.OverlayOptions} options Overlay options
* @api stable
*/
ol.Overlay.Magnify = function (options)
{ var self = this;
var elt = $("<div>").addClass("ol-magnify");
this._elt = elt.get(0);
ol.Overlay.call(this,
{ positioning: options.positioning || "center-center",
element: this._elt,
stopEvent: false
});
// Create magnify map
this.mgmap_ = new ol.Map(
{ controls: new ol.Collection(),
interactions: new ol.Collection(),
target: options.target || this._elt,
view: new ol.View({ projection: options.projection }),
layers: options.layers
});
this.mgview_ = this.mgmap_.getView();
this.external_ = options.target?true:false;
this.set("zoomOffset", options.zoomOffset||1);
this.set("active", true);
this.on("propertychange", this.setView_.bind(this));
};
ol.inherits(ol.Overlay.Magnify, ol.Overlay);
/**
* Set the map instance the overlay is associated with.
* @param {ol.Map} map The map instance.
*/
ol.Overlay.Magnify.prototype.setMap = function(map) {
if (this.getMap()) {
$(this.getMap().getViewport()).off("mousemove", this.onMouseMove_);
}
if (this._listener) ol.Observable.unByKey(this._listener);
this._listener = null;
ol.Overlay.prototype.setMap.call(this, map);
$(map.getViewport()).on("mousemove", {self:this}, this.onMouseMove_);
this._listener = map.getView().on('propertychange', this.setView_.bind(this));
this.setView_();
};
/** Get the magnifier map
* @return {_ol_Map_}
*/
ol.Overlay.Magnify.prototype.getMagMap = function()
{ return this.mgmap_;
};
/** Magnify is active
* @return {boolean}
*/
ol.Overlay.Magnify.prototype.getActive = function()
{ return this.get("active");
};
/** Activate or deactivate
* @param {boolean} active
*/
ol.Overlay.Magnify.prototype.setActive = function(active)
{ return this.set("active", active);
};
/** Mouse move
* @private
*/
ol.Overlay.Magnify.prototype.onMouseMove_ = function(e)
{ var self = e.data.self;
if (!self.get("active"))
{ self.setPosition();
}
else
{ var px = self.getMap().getEventCoordinate(e);
if (!self.external_) self.setPosition(px);
self.mgview_.setCenter(px);
if ($("canvas", self._elt).css("display")=="none") self.mgmap_.updateSize();
}
};
/** View has changed
* @private
*/
ol.Overlay.Magnify.prototype.setView_ = function(e)
{ if (!this.get("active"))
{ this.setPosition();
return;
}
if (!e)
{ // refresh all
this.setView_({key:'rotation'});
this.setView_({key:'resolution'});
return;
}
// Set the view params
switch (e.key)
{ case 'rotation':
this.mgview_.setRotation(this.getMap().getView().getRotation());
break;
case 'zoomOffset':
case 'resolution':
{ var z = Math.max(0,this.getMap().getView().getZoom()+Number(this.get("zoomOffset")));
this.mgview_.setZoom(z);
break;
}
default: break;
}
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc
* A popup element to be displayed over the map and attached to a single map
* location. The popup are customized using CSS.
*
* @example
var popup = new ol.Overlay.Popup();
map.addOverlay(popup);
popup.show(coordinate, "Hello!");
popup.hide();
*
* @constructor
* @extends {ol.Overlay}
* @param {} options Extend Overlay options
* @param {String} options.popupClass the a class of the overlay to style the popup.
* @param {bool} options.closeBox popup has a close box, default false.
* @param {function|undefined} options.onclose: callback function when popup is closed
* @param {function|undefined} options.onshow callback function when popup is shown
* @param {Number|Array<number>} options.offsetBox an offset box
* @param {ol.OverlayPositioning | string | undefined} options.positionning
* the 'auto' positioning var the popup choose its positioning to stay on the map.
* @api stable
*/
ol.Overlay.Popup = function (options)
{ var self = this;
if (typeof(options.offsetBox)==='number') this.offsetBox = [options.offsetBox,options.offsetBox,options.offsetBox,options.offsetBox];
else this.offsetBox = options.offsetBox;
// Popup div
var d = $("<div>").addClass('ol-overlaycontainer-stopevent');
options.element = d.get(0);
// Anchor div
$("<div>").addClass("anchor").appendTo(d);
// Content
this.content = $("<div>").addClass("content").appendTo(d).get(0);
// Closebox
this.closeBox = options.closeBox;
this.onclose = options.onclose;
this.onshow = options.onshow;
$("<button>").addClass("closeBox").addClass(options.closeBox?"hasclosebox":"")
.attr('type', 'button')
.prependTo(d)
.click(function()
{ self.hide();
});
// Stop event
options.stopEvent = true;
d.on("mousedown touchstart", function(e){ e.stopPropagation(); })
ol.Overlay.call(this, options);
this._elt = $(this.element);
// call setPositioning first in constructor so getClassPositioning is called only once
this.setPositioning(options.positioning);
this.setPopupClass(options.popupClass);
};
ol.inherits(ol.Overlay.Popup, ol.Overlay);
/**
* Get CSS class of the popup according to its positioning.
* @private
*/
ol.Overlay.Popup.prototype.getClassPositioning = function ()
{ var c = "";
var pos = this.getPositioning();
if (/bottom/.test(pos)) c += "ol-popup-bottom ";
if (/top/.test(pos)) c += "ol-popup-top ";
if (/left/.test(pos)) c += "ol-popup-left ";
if (/right/.test(pos)) c += "ol-popup-right ";
if (/^center/.test(pos)) c += "ol-popup-middle ";
if (/center$/.test(pos)) c += "ol-popup-center ";
return c;
};
/**
* Set a close box to the popup.
* @param {bool} b
* @api stable
*/
ol.Overlay.Popup.prototype.setClosebox = function (b)
{ this.closeBox = b;
if (b) this._elt.addClass("hasclosebox");
else this._elt.removeClass("hasclosebox");
};
/**
* Set the CSS class of the popup.
* @param {string} c class name.
* @api stable
*/
ol.Overlay.Popup.prototype.setPopupClass = function (c)
{ this._elt.removeClass()
.addClass("ol-popup "+(c||"default")+" "+this.getClassPositioning()+(this.closeBox?" hasclosebox":""));
};
/**
* Add a CSS class to the popup.
* @param {string} c class name.
* @api stable
*/
ol.Overlay.Popup.prototype.addPopupClass = function (c)
{ this._elt.addClass(c);
};
/**
* Remove a CSS class to the popup.
* @param {string} c class name.
* @api stable
*/
ol.Overlay.Popup.prototype.removePopupClass = function (c)
{ this._elt.removeClass(c);
};
/**
* Set positionning of the popup
* @param {ol.OverlayPositioning | string | undefined} pos an ol.OverlayPositioning
* or 'auto' to var the popup choose the best position
* @api stable
*/
ol.Overlay.Popup.prototype.setPositioning = function (pos)
{ if (pos === undefined)
return;
if (/auto/.test(pos))
{ this.autoPositioning = pos.split('-');
if (this.autoPositioning.length==1) this.autoPositioning[1]="auto";
}
else this.autoPositioning = false;
pos = pos.replace(/auto/g,"center");
if (pos=="center") pos = "bottom-center";
this.setPositioning_(pos);
};
/** @private
* @param {ol.OverlayPositioning | string | undefined} pos
*/
ol.Overlay.Popup.prototype.setPositioning_ = function (pos) {
if (this._elt) {
ol.Overlay.prototype.setPositioning.call(this, pos);
this._elt.removeClass("ol-popup-top ol-popup-bottom ol-popup-left ol-popup-right ol-popup-center ol-popup-middle");
this._elt.addClass(this.getClassPositioning());
}
};
/** Check if popup is visible
* @return {boolean}
*/
ol.Overlay.Popup.prototype.getVisible = function ()
{ return this._elt.hasClass("visible");
};
/**
* Set the position and the content of the popup.
* @param {ol.Coordinate|string} coordinate the coordinate of the popup or the HTML content.
* @param {string|undefined} html the HTML content (undefined = previous content).
* @example
var popup = new ol.Overlay.Popup();
// Show popup
popup.show([166000, 5992000], "Hello world!");
// Move popup at coord with the same info
popup.show([167000, 5990000]);
// set new info
popup.show("New informations");
* @api stable
*/
ol.Overlay.Popup.prototype.show = function (coordinate, html)
{ if (!html && typeof(coordinate)=='string')
{ html = coordinate;
coordinate = null;
}
var self = this;
var map = this.getMap();
if (!map) return;
if (html && html !== this.prevHTML)
{ // Prevent flickering effect
this.prevHTML = html;
$(this.content).html("").append(html);
// Refresh when loaded (img)
$("*", this.content).on('load',function()
{ map.renderSync();
})
}
if (coordinate)
{ // Auto positionning
if (this.autoPositioning)
{ var p = map.getPixelFromCoordinate(coordinate);
var s = map.getSize();
var pos=[];
if (this.autoPositioning[0]=='auto')
{ pos[0] = (p[1]<s[1]/3) ? "top" : "bottom";
}
else pos[0] = this.autoPositioning[0];
pos[1] = (p[0]<2*s[0]/3) ? "left" : "right";
this.setPositioning_(pos[0]+"-"+pos[1]);
if (this.offsetBox)
{ this.setOffset([this.offsetBox[pos[1]=="left"?2:0], this.offsetBox[pos[0]=="top"?3:1] ]);
}
} else {
if (this.offsetBox){
this.setOffset(this.offsetBox);
}
}
// Show
this.setPosition(coordinate);
// Set visible class (wait to compute the size/position first)
this._elt.parent().show();
if (typeof (this.onshow) == 'function') this.onshow();
this._tout = setTimeout (function()
{ self._elt.addClass("visible");
}, 0);
}
};
/**
* Hide the popup
* @api stable
*/
ol.Overlay.Popup.prototype.hide = function ()
{ if (this.getPosition() == undefined) return;
if (typeof (this.onclose) == 'function') this.onclose();
this.setPosition(undefined);
if (this._tout) clearTimeout(this._tout);
this._elt.removeClass("visible");
};
/*
Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (http://www.cecill.info/).
ol.coordinate.convexHull compute a convex hull using Andrew's Monotone Chain Algorithm.
@see https://en.wikipedia.org/wiki/Convex_hull_algorithms
*/
/** Tests if a point is left or right of line (a,b).
* @param {ol.coordinate} a point on the line
* @param {ol.coordinate} b point on the line
* @param {ol.coordinate} 0
* @return {bool} true if (a,b,o) turns clockwise
*/
ol.coordinate.clockwise = function (a, b, o) {
return ((a[0] - o[0]) * (b[1] - o[1]) - (a[1] - o[1]) * (b[0] - o[0]) <= 0);
};
/** Compute a convex hull using Andrew's Monotone Chain Algorithm
* @param {Array<ol.geom.Point>} points an array of 2D points
* @return {Array<ol.geom.Point>} the convex hull vertices
*/
ol.coordinate.convexHull = function (points) { // Sort by increasing x and then y coordinate
points.sort(function(a, b) {
return a[0] == b[0] ? a[1] - b[1] : a[0] - b[0];
});
// Compute the lower hull
var lower = [];
for (var i = 0; i < points.length; i++) {
while (lower.length >= 2 && ol.coordinate.clockwise(lower[lower.length - 2], lower[lower.length - 1], points[i])) {
lower.pop();
}
lower.push(points[i]);
}
// Compute the upper hull
var upper = [];
for (var i = points.length - 1; i >= 0; i--) {
while (upper.length >= 2 && ol.coordinate.clockwise(upper[upper.length - 2], upper[upper.length - 1], points[i])) {
upper.pop();
}
upper.push(points[i]);
}
upper.pop();
lower.pop();
return lower.concat(upper);
};
/* Get coordinates of a geometry */
var getCoordinates = function (geom) {
var h = [];
switch (geom.getType()) {
case "Point":h.push(geom.getCoordinates());
break;
case "LineString":
case "LinearRing":
case "MultiPoint":h = geom.getCoordinates();
break;
case "MultiLineString":
var p = geom.getLineStrings();
for (var i = 0; i < p.length; i++) h.concat(getCoordinates(p[i]));
break;
case "Polygon":
h = getCoordinates(geom.getLinearRing(0));
break;
case "MultiPolygon":
var p = geom.getPolygons();
for (var i = 0; i < p.length; i++) h.concat(getCoordinates(p[i]));
break;
case "GeometryCollection":
var p = geom.getGeometries();
for (var i = 0; i < p.length; i++) h.concat(getCoordinates(p[i]));
break;
default:break;
}
return h;
};
/** Compute a convex hull on a geometry using Andrew's Monotone Chain Algorithm
* @return {Array<ol.geom.Point>} the convex hull vertices
*/
ol.geom.Geometry.prototype.convexHull = function() {
return ol.coordinate.convexHull(getCoordinates(this));
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
Usefull function to handle geometric operations
*/
/** Distance beetween 2 points
* Usefull geometric functions
* @param {ol.coordinate} p1 first point
* @param {ol.coordinate} p2 second point
* @return {number} distance
*/
ol.coordinate.dist2d = function(p1, p2)
{ var dx = p1[0]-p2[0];
var dy = p1[1]-p2[1];
return Math.sqrt(dx*dx+dy*dy);
}
/** 2 points are equal
* Usefull geometric functions
* @param {ol.coordinate} p1 first point
* @param {ol.coordinate} p2 second point
* @return {boolean}
*/
ol.coordinate.equal = function(p1, p2)
{ return (p1[0]==p2[0] && p1[1]==p2[1]);
}
/** Get center coordinate of a feature
* @param {ol.Feature} f
* @return {ol.coordinate} the center
*/
ol.coordinate.getFeatureCenter = function(f)
{ return ol.coordinate.getGeomCenter (f.getGeometry());
};
/** Get center coordinate of a geometry
* @param {ol.Feature} geom
* @return {ol.coordinate} the center
*/
ol.coordinate.getGeomCenter = function(geom)
{ switch (geom.getType())
{ case 'Point':
return geom.getCoordinates();
case "MultiPolygon":
geom = geom.getPolygon(0);
case "Polygon":
return geom.getInteriorPoint().getCoordinates();
default:
return geom.getClosestPoint(ol.extent.getCenter(geom.getExtent()));
};
};
/** Split a lineString by a point or a list of points
* NB: points must be on the line, use getClosestPoint() to get one
* @param {ol.Coordinate | Array<ol.Coordinate>} pt points to split the line
* @param {Number} tol distance tolerance for 2 points to be equal
*/
ol.geom.LineString.prototype.splitAt = function(pt, tol)
{ if (!pt) return [this];
if (!tol) tol = 1e-10;
// Test if list of points
if (pt.length && pt[0].length)
{ var result = [this];
for (var i=0; i<pt.length; i++)
{ var r = [];
for (var k=0; k<result.length; k++)
{ var ri = result[k].splitAt(pt[i], tol);
r = r.concat(ri);
}
result = r;
}
return result;
}
// Nothing to do
if (ol.coordinate.equal(pt,this.getFirstCoordinate())
|| ol.coordinate.equal(pt,this.getLastCoordinate()))
{ return [this];
}
// Get
var c0 = this.getCoordinates();
var ci=[c0[0]], p0, p1;
var c = [];
for (var i=0; i<c0.length-1; i++)
{ // Filter equal points
if (ol.coordinate.equal(c0[i],c0[i+1])) continue;
// Extremity found
if (ol.coordinate.equal(pt,c0[i+1]))
{ ci.push(c0[i+1]);
c.push(new ol.geom.LineString(ci));
ci = [];
}
// Test alignement
else if (!ol.coordinate.equal(pt,c0[i]))
{ var d1, d2;
if (c0[i][0] == c0[i+1][0])
{ d1 = d2 = (c0[i][1]-pt[1]) / (c0[i][1]-c0[i+1][1]);
}
else if (c0[i][1] == c0[i+1][1])
{ d1 = d2 = (c0[i][0]-pt[0]) / (c0[i][0]-c0[i+1][0]);
}
else
{ d1 = (c0[i][0]-pt[0]) / (c0[i][0]-c0[i+1][0]);
d2 = (c0[i][1]-pt[1]) / (c0[i][1]-c0[i+1][1]);
}
if (Math.abs(d1-d2)<tol && 0<=d1 && d1<=1)
{ ci.push(pt);
c.push (new ol.geom.LineString(ci));
ci = [pt];
}
}
ci.push(c0[i+1]);
}
if (ci.length>1) c.push (new ol.geom.LineString(ci));
if (c.length) return c;
else return [this];
}
/** Offset a polyline
* @param {Array<ol.coordinate>} coords
* @param {Number} offset
* @return {Array<ol.coordinates>} resulting coord
* @see http://stackoverflow.com/a/11970006/796832
* @see https://drive.google.com/viewerng/viewer?a=v&pid=sites&srcid=ZGVmYXVsdGRvbWFpbnxqa2dhZGdldHN0b3JlfGd4OjQ4MzI5M2Y0MjNmNzI2MjY
*/
ol.coordinate.offsetCoords = function (coords, offset) {
var path = [];
var N = coords.length-1;
var max = N;
var mi, mi1, li, li1, ri, ri1, si, si1, Xi1, Yi1;
var p0, p1, p2;
var isClosed = ol.coordinate.equal(coords[0],coords[N]);
if (!isClosed) {
p0 = coords[0];
p1 = coords[1];
p2 = [
p0[0] + (p1[1] - p0[1]) / ol.coordinate.dist2d(p0,p1) *offset,
p0[1] - (p1[0] - p0[0]) / ol.coordinate.dist2d(p0,p1) *offset
];
path.push(p2);
coords.push(coords[N])
N++;
max--;
}
for (var i = 0; i < max; i++) {
p0 = coords[i];
p1 = coords[(i+1) % N];
p2 = coords[(i+2) % N];
mi = (p1[1] - p0[1])/(p1[0] - p0[0]);
mi1 = (p2[1] - p1[1])/(p2[0] - p1[0]);
// Prevent alignements
if (Math.abs(mi-mi1) > 1e-10) {
li = Math.sqrt((p1[0] - p0[0])*(p1[0] - p0[0])+(p1[1] - p0[1])*(p1[1] - p0[1]));
li1 = Math.sqrt((p2[0] - p1[0])*(p2[0] - p1[0])+(p2[1] - p1[1])*(p2[1] - p1[1]));
ri = p0[0] + offset*(p1[1] - p0[1])/li;
ri1 = p1[0] + offset*(p2[1] - p1[1])/li1;
si = p0[1] - offset*(p1[0] - p0[0])/li;
si1 = p1[1] - offset*(p2[0] - p1[0])/li1;
Xi1 = (mi1*ri1-mi*ri+si-si1) / (mi1-mi);
Yi1 = (mi*mi1*(ri1-ri)+mi1*si-mi*si1) / (mi1-mi);
// Correction for vertical lines
if(p1[0] - p0[0] == 0) {
Xi1 = p1[0] + offset*(p1[1] - p0[1])/Math.abs(p1[1] - p0[1]);
Yi1 = mi1*Xi1 - mi1*ri1 + si1;
}
if (p2[0] - p1[0] == 0 ) {
Xi1 = p2[0] + offset*(p2[1] - p1[1])/Math.abs(p2[1] - p1[1]);
Yi1 = mi*Xi1 - mi*ri + si;
}
path.push([Xi1, Yi1]);
}
}
if (isClosed) {
path.push(path[0]);
} else {
coords.pop();
p0 = coords[coords.length-1];
p1 = coords[coords.length-2];
p2 = [
p0[0] - (p1[1] - p0[1]) / ol.coordinate.dist2d(p0,p1) *offset,
p0[1] + (p1[0] - p0[0]) / ol.coordinate.dist2d(p0,p1) *offset
];
path.push(p2);
}
return path;
}
/** Find the segment a point belongs to
* @param {ol.coordinate} pt
* @param {Array<ol.coordinate>} coords
* @return {} the index (-1 if not found) and the segment
*/
ol.coordinate.findSegment = function (pt, coords) {
for (var i=0; i<coords.length-1; i++) {
var p0 = coords[i];
var p1 = coords[i+1];
if (ol.coordinate.equal(pt, p0) || ol.coordinate.equal(pt, p1)) {
return { index:1, segment: [p0,p1] };
} else {
var d0 = ol.coordinate.dist2d(p0,p1);
var v0 = [ (p1[0] - p0[0]) / d0, (p1[1] - p0[1]) / d0 ];
var d1 = ol.coordinate.dist2d(p0,pt);
var v1 = [ (pt[0] - p0[0]) / d1, (pt[1] - p0[1]) / d1 ];
if (Math.abs(v0[0]*v1[1] - v0[1]*v1[0]) < 1e-10) {
return { index:1, segment: [p0,p1] };
}
}
}
return { index: -1 };
};
/* Use
*/
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
Usefull function to handle geometric operations
*/
/**
* Split a Polygon geom with horizontal lines
* @param {Array<ol.coordinate>} geom
* @param {Number} y the y to split
* @param {Number} n contour index
* @return {Array<Array<ol.coordinate>>}
*/
ol.coordinate.splitH = function (geom, y, n) {
var x, abs;
var list = [];
for (var i=0; i<geom.length-1; i++) {
// Hole separator?
if (!geom[i].length || !geom[i+1].length) continue;
// Intersect
if (geom[i][1]<=y && geom[i+1][1]>y || geom[i][1]>=y && geom[i+1][1]<y) {
abs = (y-geom[i][1]) / (geom[i+1][1]-geom[i][1]);
x = abs * (geom[i+1][0]-geom[i][0]) + geom[i][0];
list.push ({ contour: n, index: i, pt: [x,y], abs: abs });
}
}
// Sort x
list.sort(function(a,b) { return a.pt[0] - b.pt[0] });
// Horizontal segement
var result = [];
for (var j=0; j<list.length-1; j += 2) {
result.push([list[j], list[j+1]])
}
return result;
};
/**
* Calculate a MultiPolyline to fill a Polygon with a scribble effect that appears hand-made
* @param {} options
* @param {Number} options.interval interval beetween lines
* @param {Number} options.angle hatch angle in radian, default PI/2
* @return {ol.geom.MultiLineString|null} the resulting MultiLineString geometry or null if none
*/
ol.geom.MultiPolygon.prototype.scribbleFill = function (options) {
var scribbles = [];
var poly = this.getPolygons();
for (var i=0, p; p=poly[i]; i++) {
var mls = p.scribbleFill(options);
if (mls) scribbles.push(mls);
}
if (!scribbles.length) return null;
// Merge scribbles
var scribble = scribbles[0];
for (var i=0, s; s=scribbles[i]; i++) {
ls = s.getLineStrings();
for (k=0; k<ls.length; k++) {
scribble.appendLineString(ls[k]);
}
}
return scribble;
};
/**
* Calculate a MultiPolyline to fill a Polygon with a scribble effect that appears hand-made
* @param {} options
* @param {Number} options.interval interval beetween lines
* @param {Number} options.angle hatch angle in radian, default PI/2
* @return {ol.geom.MultiLineString|null} the resulting MultiLineString geometry or null if none
*/
ol.geom.Polygon.prototype.scribbleFill = function (options) {
var step = options.interval;
var angle = options.angle || Math.PI/2;
// Geometry + rotate
var geom = this.clone();
geom.rotate(angle, [0,0]);
var coords = geom.getCoordinates();
// Merge holes
var coord = coords[0];
for (var i=1; i<coords.length; i++) {
// Add a separator
coord.push([]);
// Add the hole
coord = coord.concat(coords[i]);
}
// Extent
var ext = geom.getExtent();
// Split polygon with horizontal lines
var lines = [];
for (var y = (Math.floor(ext[1]/step)+1)*step; y<ext[3]; y += step) {
var l = ol.coordinate.splitH(coord, y, i);
lines = lines.concat(l);
}
if (!lines.length) return null;
// Order lines on segment index
var mod = coord.length-1;
var first = lines[0][0].index;
for (var k=0, l; l=lines[k]; k++) {
lines[k][0].index = (lines[k][0].index-first+mod) % mod;
lines[k][1].index = (lines[k][1].index-first+mod) % mod;
}
var scribble = [];
while(true) {
for (var k=0, l; l=lines[k]; k++) {
if (!l[0].done) break;
}
if (!l) break;
var scrib = [];
while (l) {
l[0].done = true;
scrib.push(l[0].pt);
scrib.push(l[1].pt);
var nexty = l[0].pt[1] + step;
var d0 = Infinity;
var l2 = null;
while (lines[k]) {
if (lines[k][0].pt[1] > nexty) break;
if (lines[k][0].pt[1] === nexty) {
var d = Math.min(
(lines[k][0].index - l[0].index + mod) % mod,
(l[0].index - lines[k][0].index + mod) % mod
);
var d2 = Math.min(
(l[1].index - l[0].index + mod) % mod,
(l[0].index - l[1].index + mod) % mod
);
if (d<d0 && d<d2) {
d0 = d;
if (!lines[k][0].done) l2 = lines[k];
else l2 = null;
}
}
k++;
}
l = l2;
}
if (scrib.length) {
scribble.push(scrib);
}
}
// Return the scribble as MultiLineString
if (!scribble.length) return null;
var mline = new ol.geom.MultiLineString(scribble);
mline.rotate(-angle,[0,0]);
return mline.cspline({ pointsPerSeg:8, tension:.9 });
};
// import('ol-ext/geom/Scribble')
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Pulse an extent on postcompose
* @param {ol.coordinates} point to pulse
* @param {ol.pulse.options} options pulse options param
* @param {ol.projectionLike|undefined} options.projection projection of coords, default no transform
* @param {Number} options.duration animation duration in ms, default 2000
* @param {ol.easing} options.easing easing function, default ol.easing.upAndDown
* @param {ol.style.Stroke} options.style stroke style, default 2px red
*/
ol.Map.prototype.animExtent = function(extent, options)
{ var listenerKey;
options = options || {};
// Change to map's projection
if (options.projection)
{ extent = ol.proj.transformExtent (extent, options.projection, this.getView().getProjection());
}
// options
var start = new Date().getTime();
var duration = options.duration || 1000;
var easing = options.easing || ol.easing.upAndDown;
var width = options.style ? options.style.getWidth() || 2 : 2;
var color = options.style ? options.style.getColr() || 'red' : 'red';
// Animate function
function animate(event)
{ var frameState = event.frameState;
var ratio = frameState.pixelRatio;
var elapsed = frameState.time - start;
if (elapsed > duration) ol.Observable.unByKey(listenerKey);
else
{ var elapsedRatio = elapsed / duration;
var p0 = this.getPixelFromCoordinate([extent[0],extent[1]]);
var p1 = this.getPixelFromCoordinate([extent[2],extent[3]]);
var context = event.context;
context.save();
context.scale(ratio,ratio);
context.beginPath();
var e = easing(elapsedRatio)
context.globalAlpha = easing(1 - elapsedRatio);
context.lineWidth = width;
context.strokeStyle = color;
context.rect(p0[0], p0[1], p1[0]-p0[0], p1[1]-p0[1]);
context.stroke();
context.restore();
// tell OL3 to continue postcompose animation
frameState.animate = true;
}
}
// Launch animation
listenerKey = this.on('postcompose', animate.bind(this));
this.renderSync();
}
/** Create a cardinal spline version of this geometry.
* Original https://github.com/epistemex/cardinal-spline-js
* @see https://en.wikipedia.org/wiki/Cubic_Hermite_spline#Cardinal_spline
*
* @param {} options
* @param {Number} options.tension a [0,1] number / can be interpreted as the "length" of the tangent, default 0.5
* @param {Number} options.resolution size of segment to split
* @param {Interger} options.pointsPerSeg number of points per segment to add if no resolution is provided, default add 10 points per segment
*/
/** Cache cspline calculation
*/
ol.geom.Geometry.prototype.cspline = function(options)
{ // Calculate cspline
if (this.calcCSpline_)
{ if (this.csplineGeometryRevision != this.getRevision()
|| this.csplineOption != JSON.stringify(options))
{ this.csplineGeometry_ = this.calcCSpline_(options)
this.csplineGeometryRevision = this.getRevision();
this.csplineOption = JSON.stringify(options);
}
return this.csplineGeometry_;
}
// Default do nothing
else
{ return this;
}
}
ol.geom.GeometryCollection.prototype.calcCSpline_ = function(options)
{ var g=[], g0=this.getGeometries();
for (var i=0; i<g0.length; i++)
{ g.push(g0[i].cspline(options));
}
return new ol.geom.GeometryCollection(g);
}
ol.geom.MultiLineString.prototype.calcCSpline_ = function(options)
{ var g=[], lines = this.getLineStrings();
for (var i=0; i<lines.length; i++)
{ g.push(lines[i].cspline(options).getCoordinates());
}
return new ol.geom.MultiLineString(g);
}
ol.geom.Polygon.prototype.calcCSpline_ = function(options)
{ var g=[], g0=this.getCoordinates();
for (var i=0; i<g0.length; i++)
{ g.push((new ol.geom.LineString(g0[i])).cspline(options).getCoordinates());
}
return new ol.geom.Polygon(g);
}
ol.geom.MultiPolygon.prototype.calcCSpline_ = function(options)
{ var g=[], g0=this.getPolygons();
for (var i=0; i<g0.length; i++)
{ g.push(g0[i].cspline(options).getCoordinates());
}
return new ol.geom.MultiPolygon(g);
}
/**
*/
ol.geom.LineString.prototype.calcCSpline_ = function(options)
{ if (!options) options={};
var line = this.getCoordinates();
var tension = typeof options.tension === "number" ? options.tension : 0.5;
var resolution = options.resolution || (this.getLength() / line.length / (options.pointsPerSeg || 10));
var pts, res = [], // clone array
x, y, // our x,y coords
t1x, t2x, t1y, t2y, // tension vectors
c1, c2, c3, c4, // cardinal points
st, t, i; // steps based on num. of segments
// clone array so we don't change the original
//
pts = line.slice(0);
// The algorithm require a previous and next point to the actual point array.
// Check if we will draw closed or open curve.
// If closed, copy end points to beginning and first points to end
// If open, duplicate first points to befinning, end points to end
if (line.length>2 && line[0][0]==line[line.length-1][0] && line[0][1]==line[line.length-1][1])
{ pts.unshift(line[line.length-2]);
pts.push(line[1]);
}
else
{ pts.unshift(line[0]);
pts.push(line[line.length-1]);
}
// ok, lets start..
function dist2d(x1, y1, x2, y2)
{ var dx = x2-x1;
var dy = y2-y1;
return Math.sqrt(dx*dx+dy*dy);
}
// 1. loop goes through point array
// 2. loop goes through each segment between the 2 pts + 1e point before and after
for (i=1; i < (pts.length - 2); i++)
{ var d1 = dist2d (pts[i][0], pts[i][1], pts[i+1][0], pts[i+1][1]);
var numOfSegments = Math.round(d1/resolution);
var d=1;
if (options.normalize)
{ var d1 = dist2d (pts[i+1][0], pts[i+1][1], pts[i-1][0], pts[i-1][1]);
var d2 = dist2d (pts[i+2][0], pts[i+2][1], pts[i][0], pts[i][1]);
if (d1<d2) d = d1/d2;
else d = d2/d1;
}
// calc tension vectors
t1x = (pts[i+1][0] - pts[i-1][0]) * tension *d;
t2x = (pts[i+2][0] - pts[i][0]) * tension *d;
t1y = (pts[i+1][1] - pts[i-1][1]) * tension *d;
t2y = (pts[i+2][1] - pts[i][1]) * tension *d;
for (t=0; t <= numOfSegments; t++)
{ // calc step
st = t / numOfSegments;
// calc cardinals
c1 = 2 * Math.pow(st, 3) - 3 * Math.pow(st, 2) + 1;
c2 = -(2 * Math.pow(st, 3)) + 3 * Math.pow(st, 2);
c3 = Math.pow(st, 3) - 2 * Math.pow(st, 2) + st;
c4 = Math.pow(st, 3) - Math.pow(st, 2);
// calc x and y cords with common control vectors
x = c1 * pts[i][0] + c2 * pts[i+1][0] + c3 * t1x + c4 * t2x;
y = c1 * pts[i][1] + c2 * pts[i+1][1] + c3 * t1y + c4 * t2y;
//store points in array
if (x && y) res.push([x,y]);
}
}
return new ol.geom.LineString(res);
}
//NB: (Not confirmed)To use this module, you just have to :
// import('ol-ext/utils/cspline')
/* Copyright (c) 2017 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* Hexagonal grids
* @classdesc ol.HexGrid is a class to compute hexagonal grids
* @see http://www.redblobgames.com/grids/hexagons
*
* @constructor ol.HexGrid
* @extends {ol.Object}
* @param {olx.HexGrid=} options
* @param {Number} options.size size of the exagon in map units, default 80000
* @param {_ol_coordinate_} options.origin orgin of the grid, default [0,0]
* @param {pointy|flat} options.layout grid layout, default pointy
*/
ol.HexGrid = function (options)
{ options = options || {};
ol.Object.call (this, options);
// Options
this.size_ = options.size||80000;
this.origin_ = options.origin || [0,0];
this.layout_ = this.layout[options.layout] || this.layout.pointy;
};
ol.inherits (ol.HexGrid, ol.Object);
/** Layout
*/
ol.HexGrid.prototype.layout =
{ pointy:
[ Math.sqrt(3), Math.sqrt(3)/2, 0, 3/2,
Math.sqrt(3)/3, -1/3, 0, 2/3,
// corners
Math.cos(Math.PI / 180 * (60 * 0 + 30)), Math.sin(Math.PI / 180 * (60 * 0 + 30)),
Math.cos(Math.PI / 180 * (60 * 1 + 30)), Math.sin(Math.PI / 180 * (60 * 1 + 30)),
Math.cos(Math.PI / 180 * (60 * 2 + 30)), Math.sin(Math.PI / 180 * (60 * 2 + 30)),
Math.cos(Math.PI / 180 * (60 * 3 + 30)), Math.sin(Math.PI / 180 * (60 * 3 + 30)),
Math.cos(Math.PI / 180 * (60 * 4 + 30)), Math.sin(Math.PI / 180 * (60 * 4 + 30)),
Math.cos(Math.PI / 180 * (60 * 5 + 30)), Math.sin(Math.PI / 180 * (60 * 5 + 30))
],
flat:
[ 3/2, 0, Math.sqrt(3)/2, Math.sqrt(3), 2/3,
0, -1/3, Math.sqrt(3) / 3,
// corners
Math.cos(Math.PI / 180 * (60 * 0)), Math.sin(Math.PI / 180 * (60 * 0)),
Math.cos(Math.PI / 180 * (60 * 1)), Math.sin(Math.PI / 180 * (60 * 1)),
Math.cos(Math.PI / 180 * (60 * 2)), Math.sin(Math.PI / 180 * (60 * 2)),
Math.cos(Math.PI / 180 * (60 * 3)), Math.sin(Math.PI / 180 * (60 * 3)),
Math.cos(Math.PI / 180 * (60 * 4)), Math.sin(Math.PI / 180 * (60 * 4)),
Math.cos(Math.PI / 180 * (60 * 5)), Math.sin(Math.PI / 180 * (60 * 5))
]
};
/** Set layout
* @param {pointy | flat | undefined} layout name, default pointy
*/
ol.HexGrid.prototype.setLayout = function (layout)
{ this.layout_ = this.layout[layout] || this.layout.pointy;
this.changed();
}
/** Get layout
* @return {pointy | flat} layout name
*/
ol.HexGrid.prototype.getLayout = function ()
{ return (this.layout_[9]!=0 ? 'pointy' : 'flat');
}
/** Set hexagon origin
* @param {ol.coordinate} coord origin
*/
ol.HexGrid.prototype.setOrigin = function (coord)
{ this.origin_ = coord;
this.changed();
}
/** Get hexagon origin
* @return {ol.coordinate} coord origin
*/
ol.HexGrid.prototype.getOrigin = function (coord)
{ return this.origin_;
}
/** Set hexagon size
* @param {Number} hexagon size
*/
ol.HexGrid.prototype.setSize = function (s)
{ this.size_ = s || 80000;
this.changed();
}
/** Get hexagon size
* @return {Number} hexagon size
*/
ol.HexGrid.prototype.getSize = function (s)
{ return this.size_;
}
/** Convert cube to axial coords
* @param {ol.coordinate} c cube coordinate
* @return {ol.coordinate} axial coordinate
*/
ol.HexGrid.prototype.cube2hex = function (c)
{ return [c[0], c[2]];
};
/** Convert axial to cube coords
* @param {ol.coordinate} h axial coordinate
* @return {ol.coordinate} cube coordinate
*/
ol.HexGrid.prototype.hex2cube = function(h)
{ return [h[0], -h[0]-h[1], h[1]];
};
/** Convert offset to axial coords
* @param {ol.coordinate} h axial coordinate
* @return {ol.coordinate} offset coordinate
*/
ol.HexGrid.prototype.hex2offset = function (h)
{ if (this.layout_[9]) return [ h[0] + (h[1] - (h[1]&1)) / 2, h[1] ];
else return [ h[0], h[1] + (h[0] + (h[0]&1)) / 2 ];
}
/** Convert axial to offset coords
* @param {ol.coordinate} o offset coordinate
* @return {ol.coordinate} axial coordinate
*/
ol.HexGrid.prototype.offset2hex = function(o)
{ if (this.layout_[9]) return [ q = o[0] - (o[1] - (o[1]&1)) / 2, r = o[1] ];
else return [ o[0], o[1] - (o[0] + (o[0]&1)) / 2 ];
}
/** Convert offset to cube coords
* @param {ol.coordinate} c cube coordinate
* @return {ol.coordinate} offset coordinate
* /
ol.HexGrid.prototype.cube2offset = function(c)
{ return hex2offset(cube2hex(c));
};
/** Convert cube to offset coords
* @param {ol.coordinate} o offset coordinate
* @return {ol.coordinate} cube coordinate
* /
ol.HexGrid.prototype.offset2cube = function (o)
{ return hex2cube(offset2Hex(o));
};
/** Round cube coords
* @param {ol.coordinate} h cube coordinate
* @return {ol.coordinate} rounded cube coordinate
*/
ol.HexGrid.prototype.cube_round = function(h)
{ var rx = Math.round(h[0])
var ry = Math.round(h[1])
var rz = Math.round(h[2])
var x_diff = Math.abs(rx - h[0])
var y_diff = Math.abs(ry - h[1])
var z_diff = Math.abs(rz - h[2])
if (x_diff > y_diff && x_diff > z_diff) rx = -ry-rz
else if (y_diff > z_diff) ry = -rx-rz
else rz = -rx-ry
return [rx, ry, rz];
};
/** Round axial coords
* @param {ol.coordinate} h axial coordinate
* @return {ol.coordinate} rounded axial coordinate
*/
ol.HexGrid.prototype.hex_round = function(h)
{ return this.cube2hex( this.cube_round( this.hex2cube(h )) );
};
/** Get hexagon corners
*/
ol.HexGrid.prototype.hex_corner = function(center, size, i)
{ return [ center[0] + size * this.layout_[8+(2*(i%6))], center[1] + size * this.layout_[9+(2*(i%6))]];
};
/** Get hexagon coordinates at a coordinate
* @param {ol.coord} coord
* @return {Arrary<ol.coord>}
*/
ol.HexGrid.prototype.getHexagonAtCoord = function (coord)
{ returhn (this.getHexagon(this.coord2hex(coord)));
};
/** Get hexagon coordinates at hex
* @param {ol.coord} hex
* @return {Arrary<ol.coord>}
*/
ol.HexGrid.prototype.getHexagon = function (hex)
{ var p = [];
var c = this.hex2coord(hex);
for (var i=0; i<=7; i++)
{ p.push(this.hex_corner(c, this.size_, i, this.layout_[8]));
}
return p;
};
/** Convert hex to coord
* @param {ol.hex} hex
* @return {ol.coord}
*/
ol.HexGrid.prototype.hex2coord = function (hex)
{ return [
this.origin_[0] + this.size_ * (this.layout_[0] * hex[0] + this.layout_[1] * hex[1]),
this.origin_[1] + this.size_ * (this.layout_[2] * hex[0] + this.layout_[3] * hex[1])
];
};
/** Convert coord to hex
* @param {ol.coord} coord
* @return {ol.hex}
*/
ol.HexGrid.prototype.coord2hex = function (coord)
{ var c = [ (coord[0]-this.origin_[0]) / this.size_, (coord[1]-this.origin_[1]) / this.size_ ];
var q = this.layout_[4] * c[0] + this.layout_[5] * c[1];
var r = this.layout_[6] * c[0] + this.layout_[7] * c[1];
return this.hex_round([q, r]);
};
/** Calculate distance between to hexagon (number of cube)
* @param {ol.coordinate} a first cube coord
* @param {ol.coordinate} a second cube coord
* @return {Number} distance
*/
ol.HexGrid.prototype.cube_distance = function (a, b)
{ //return ( (Math.abs(a[0] - b[0]) + Math.abs(a[1] - b[1]) + Math.abs(a[2] - b[2])) / 2 );
return ( Math.max (Math.abs(a[0] - b[0]), Math.abs(a[1] - b[1]), Math.abs(a[2] - b[2])) );
};
(function(){
/** Line interpolation
*/
function lerp(a, b, t)
{ // for floats
return a + (b - a) * t;
};
function cube_lerp(a, b, t)
{ // for hexes
return [
lerp (a[0]+1e-6, b[0], t),
lerp (a[1]+1e-6, b[1], t),
lerp (a[2]+1e-6, b[2], t)
];
};
/** Calculate line between to hexagon
* @param {ol.coordinate} a first cube coord
* @param {ol.coordinate} b second cube coord
* @return {Array<ol.coordinate>} array of cube coordinates
*/
ol.HexGrid.prototype.cube_line = function (a, b)
{ var d = this.cube_distance(a, b);
if (!d) return [a];
var results = []
for (var i=0; i<=d; i++)
{ results.push ( this.cube_round ( cube_lerp(a, b, i/d) ) );
}
return results;
};
})();
ol.HexGrid.prototype.neighbors =
{ 'cube': [ [+1, -1, 0], [+1, 0, -1], [0, +1, -1], [-1, +1, 0], [-1, 0, +1], [0, -1, +1] ],
'hex': [ [+1, 0], [+1, -1], [0, -1], [-1, 0], [-1, +1], [0, +1] ]
};
/** Get the neighbors for an hexagon
* @param {ol.coordinate} h axial coord
* @param {Number} direction
* @return { ol.coordinate | Array<ol.coordinates> } neighbor || array of neighbors
*/
ol.HexGrid.prototype.hex_neighbors = function (h, d)
{ if (d!==undefined)
{ return [ h[0] + this.neighbors.hex[d%6][0], h[1] + this.neighbors.hex[d%6][1] ];
}
else
{ var n = [];
for (d=0; d<6; d++)
{ n.push ([ h[0] + this.neighbors.hex[d][0], h[1] + this.neighbors.hex[d][1] ]);
}
return n;
}
};
/** Get the neighbors for an hexagon
* @param {ol.coordinate} c cube coord
* @param {Number} direction
* @return { ol.coordinate | Array<ol.coordinates> } neighbor || array of neighbors
*/
ol.HexGrid.prototype.cube_neighbors = function (c, d)
{ if (d!==undefined)
{ return [ c[0] + this.neighbors.cube[d%6][0], c[1] + this.neighbors.cube[d%6][1], c[2] + this.neighbors.cube[d%6][2] ];
}
else
{ var n = [];
for (d=0; d<6; d++)
{ n.push ([ c[0] + this.neighbors.cube[d][0], c[1] + this.neighbors.cube[d][1], c[2] + this.neighbors.cube[d][2] ]);
}
for (d=0; d<6; d++) n[d] = this.cube2hex(n[d])
return n;
}
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Show a markup a point on postcompose
* @deprecated use map.animateFeature instead
* @param {ol.coordinates} point to pulse
* @param {ol.markup.options} pulse options param
* - projection {ol.projection|String|undefined} projection of coords, default none
* - delay {Number} delay before mark fadeout
* - maxZoom {Number} zoom when mark fadeout
* - style {ol.style.Image|ol.style.Style|Array<ol.style.Style>} Image to draw as markup, default red circle
* @return Unique key for the listener with a stop function to stop animation
*/
ol.Map.prototype.markup = function(coords, options)
{ var listenerKey;
var self = this;
options = options || {};
// Change to map's projection
if (options.projection)
{ coords = ol.proj.transform(coords, options.projection, this.getView().getProjection());
}
// options
var start = new Date().getTime();
var delay = options.delay || 3000;
var duration = 1000;
var maxZoom = options.maxZoom || 100;
var easing = ol.easing.easeOut;
var style = options.style;
if (!style) style = new ol.style.Circle({ radius:10, stroke:new ol.style.Stroke({color:'red', width:2 }) });
if (style instanceof ol.style.Image) style = new ol.style.Style({ image: style });
if (!(style instanceof Array)) style = [style];
// Animate function
function animate(event)
{ var frameState = event.frameState;
var elapsed = frameState.time - start;
if (elapsed > delay+duration)
{ ol.Observable.unByKey(listenerKey);
listenerKey = null;
}
else
{ if (delay>elapsed && this.getView().getZoom()>maxZoom) delay = elapsed;
var ratio = frameState.pixelRatio;
var elapsedRatio = 0;
if (elapsed > delay) elapsedRatio = (elapsed-delay) / duration;
var context = event.context;
context.save();
context.beginPath();
context.globalAlpha = easing(1 - elapsedRatio);
for (var i=0; i<style.length; i++)
{ var imgs = style[i].getImage();
var sc = imgs.getScale();
imgs.setScale(sc*ratio);
event.vectorContext.setStyle(style[i]);
event.vectorContext.drawGeometry(new ol.geom.Point(coords));
imgs.setScale(sc);
}
context.restore();
// tell OL3 to continue postcompose animation
if (elapsed >= delay) frameState.animate = true;
}
}
setTimeout (function()
{ if (listenerKey) self.renderSync();
}, delay);
// Launch animation
listenerKey = this.on('postcompose', animate.bind(this));
this.renderSync();
listenerKey.stop = function()
{ delay = duration = 0;
this.target.renderSync();
};
return listenerKey;
}
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Ordering function for ol.layer.Vector renderOrder parameter
* ol.ordering.fn (options)
* It will return an ordering function (f0,f1)
* @namespace
*/
ol.ordering = {};
/** y-Ordering
* @return ordering function (f0,f1)
*/
ol.ordering.yOrdering = function(options)
{ return function(f0,f1)
{ return f1.getGeometry().getExtent()[1] - f0.getGeometry().getExtent()[1] ;
};
};
/** Order with a feature attribute
* @param options
* attribute: ordering attribute, default zIndex
* equalFn: ordering function for equal values
* @return ordering function (f0,f1)
*/
ol.ordering.zIndex = function(options)
{ if (!options) options = {};
var attr = options.attribute || 'zIndex';
if (option.equalFn)
{ return function(f0,f1)
{ if (f0.get(attr) == f1.get(attr)) return option.equalFn(f0,f1);
else return f0.get(attr) < f1.get(attr) ? 1:-1;
};
}
else
{ return function(f0,f1)
{ if (f0.get(attr) == f1.get(attr)) return 0;
else return f0.get(attr) < f1.get(attr) ? 1:-1;
};
}
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/** Pulse a point on postcompose
* @deprecated use map.animateFeature instead
* @param {ol.coordinates} point to pulse
* @param {ol.pulse.options} pulse options param
* - projection {ol.projection||String} projection of coords
* - duration {Number} animation duration in ms, default 3000
* - amplitude {Number} movement amplitude 0: none - 0.5: start at 0.5*radius of the image - 1: max, default 1
* - easing {ol.easing} easing function, default ol.easing.easeOut
* - style {ol.style.Image|ol.style.Style|Array<ol.style.Style>} Image to draw as markup, default red circle
*/
ol.Map.prototype.pulse = function(coords, options)
{ var listenerKey;
options = options || {};
// Change to map's projection
if (options.projection)
{ coords = ol.proj.transform(coords, options.projection, this.getView().getProjection());
}
// options
var start = new Date().getTime();
var duration = options.duration || 3000;
var easing = options.easing || ol.easing.easeOut;
var style = options.style;
if (!style) style = new ol.style.Circle({ radius:30, stroke:new ol.style.Stroke({color:'red', width:2 }) });
if (style instanceof ol.style.Image) style = new ol.style.Style({ image: style });
if (!(style instanceof Array)) style = [style];
var amplitude = options.amplitude || 1;
if (amplitude<0) amplitude=0;
var maxRadius = options.radius || 15;
if (maxRadius<0) maxRadius = 5;
var minRadius = maxRadius - (options.amplitude || maxRadius); //options.minRadius || 0;
var width = options.lineWidth || 2;
var color = options.color || 'red';
console.log("pulse")
// Animate function
function animate(event)
{ var frameState = event.frameState;
var ratio = frameState.pixelRatio;
var elapsed = frameState.time - start;
if (elapsed > duration) ol.Observable.unByKey(listenerKey);
else
{ var elapsedRatio = elapsed / duration;
var context = event.context;
context.save();
context.beginPath();
var e = easing(elapsedRatio)
context.globalAlpha = easing(1 - elapsedRatio);
console.log("anim")
for (var i=0; i<style.length; i++)
{ var imgs = style[i].getImage();
var sc = imgs.getScale();
imgs.setScale(ratio*sc*(1+amplitude*(e-1)));
event.vectorContext.setStyle(style[i]);
event.vectorContext.drawGeometry(new ol.geom.Point(coords));
imgs.setScale(sc);
}
context.restore();
// tell OL3 to continue postcompose animation
frameState.animate = true;
}
}
// Launch animation
listenerKey = this.on('postcompose', animate.bind(this));
this.renderSync();
}
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*
* Add a chart style to display charts (pies or bars) on a map
*/
/**
* @requires ol.style.Circle
* @requires ol.structs.IHasChecksum
*/
/**
* @classdesc
* Set chart style for vector features.
*
* @constructor
* @param {} options
* @param {String} options.type Chart type: pie,pie3D, donut or bar
* @param {number} options.radius Chart radius/size, default 20
* @param {number} options.rotation Rotation in radians (positive rotation clockwise). Default is 0.
* @param {bool} options.snapToPixel use integral numbers of pixels, default true
* @param {_ol_style_Stroke_} options.stroke stroke style
* @param {String|Array<ol.color>} options.colors predefined color set "classic","dark","pale","pastel","neon" / array of color string, default classic
* @param {number} options.offsetX X offset in px
* @param {number} options.offsetY Y offset in px
* @param {number} options.animation step in an animation sequence [0,1]
* @see [Statistic charts example](../../examples/map.style.chart.html)
* @extends {ol.style.RegularShape}
* @implements {ol.structs.IHasChecksum}
* @api
*/
ol.style.Chart = function(opt_options)
{ options = opt_options || {};
var strokeWidth = 0;
if (opt_options.stroke) strokeWidth = opt_options.stroke.getWidth();
ol.style.RegularShape.call (this,
{ radius: options.radius + strokeWidth,
fill: new ol.style.Fill({color: [0,0,0]}),
rotation: options.rotation,
snapToPixel: options.snapToPixel
});
if (options.scale) this.setScale(options.scale);
this.stroke_ = options.stroke;
this.radius_ = options.radius || 20;
this.donutratio_ = options.donutRatio || 0.5;
this.type_ = options.type;
this.offset_ = [options.offsetX ? options.offsetX : 0, options.offsetY ? options.offsetY : 0];
this.animation_ = (typeof(options.animation) == 'number') ? { animate:true, step:options.animation } : this.animation_ = { animate:false, step:1 };
this.data_ = options.data;
if (options.colors instanceof Array)
{ this.colors_ = options.colors;
}
else
{ this.colors_ = ol.style.Chart.colors[options.colors];
if(!this.colors_) this.colors_ = ol.style.Chart.colors.classic;
}
this.renderChart_();
};
ol.inherits(ol.style.Chart, ol.style.RegularShape);
/** Default color set: classic, dark, pale, pastel, neon
*/
ol.style.Chart.colors =
{ "classic": ["#ffa500","blue","red","green","cyan","magenta","yellow","#0f0"],
"dark": ["#960","#003","#900","#060","#099","#909","#990","#090"],
"pale": ["#fd0","#369","#f64","#3b7","#880","#b5d","#666"],
"pastel": ["#fb4","#79c","#f66","#7d7","#acc","#fdd","#ff9","#b9b"],
"neon": ["#ff0","#0ff","#0f0","#f0f","#f00","#00f"]
}
/**
* Clones the style.
* @return {ol.style.Chart}
*/
ol.style.Chart.prototype.clone = function()
{ var s = new ol.style.Chart(
{ type: this.type_,
radius: this.radius_,
rotation: this.getRotation(),
scale: this.getScale(),
data: this.getData(),
snapToPixel: this.getSnapToPixel(),
stroke: this.stroke_,
colors: this.colors_,
offsetX: this.offset_[0],
offsetY: this.offset_[1],
animation: this.animation_
});
s.setScale(this.getScale());
s.setOpacity(this.getOpacity());
return s;
};
/** Get data associatied with the chart
*/
ol.style.Chart.prototype.getData = function()
{ return this.data_;
}
/** Set data associatied with the chart
* @param {Array<number>}
*/
ol.style.Chart.prototype.setData = function(data)
{ this.data_ = data;
this.renderChart_();
}
/** Get symbol radius
*/
ol.style.Chart.prototype.getRadius = function()
{ return this.radius_;
}
/** Set symbol radius
* @param {number} symbol radius
* @param {number} donut ratio
*/
ol.style.Chart.prototype.setRadius = function(radius, ratio)
{ this.radius_ = radius;
this.donuratio_ = ratio || this.donuratio_;
this.renderChart_();
}
/** Set animation step
* @param {false|number} false to stop animation or the step of the animation [0,1]
*/
ol.style.Chart.prototype.setAnimation = function(step)
{ if (step===false)
{ if (this.animation_.animate == false) return;
this.animation_.animate = false;
}
else
{ if (this.animation_.step == step) return;
this.animation_.animate = true;
this.animation_.step = step;
}
this.renderChart_();
}
/** @private
*/
ol.style.Chart.prototype.renderChart_ = function(atlasManager)
{ var strokeStyle;
var strokeWidth = 0;
if (this.stroke_)
{ strokeStyle = ol.color.asString(this.stroke_.getColor());
strokeWidth = this.stroke_.getWidth();
}
// no atlas manager is used, create a new canvas
var canvas = this.getImage();
// draw the circle on the canvas
var context = (canvas.getContext('2d'));
context.clearRect(0, 0, canvas.width, canvas.height);
context.lineJoin = 'round';
var sum=0;
for (var i=0; i<this.data_.length; i++)
sum += this.data_[i];
// reset transform
context.setTransform(1, 0, 0, 1, 0, 0);
// then move to (x, y)
context.translate(0,0);
var step = this.animation_.animate ? this.animation_.step : 1;
//console.log(this.animation_.step)
// Draw pie
switch (this.type_)
{ case "donut":
case "pie3D":
case "pie":
{ var a, a0 = Math.PI * (step-1.5);
var c = canvas.width/2;
context.strokeStyle = strokeStyle;
context.lineWidth = strokeWidth;
context.save();
if (this.type_=="pie3D")
{ context.translate(0, c*0.3);
context.scale(1, 0.7);
context.beginPath();
context.fillStyle = "#369";
context.arc ( c, c*1.4, this.radius_ *step, 0, 2*Math.PI);
context.fill();
context.stroke();
}
if (this.type_=="donut")
{ context.save();
context.beginPath();
context.rect ( 0,0,2*c,2*c );
context.arc ( c, c, this.radius_ *step *this.donutratio_, 0, 2*Math.PI);
context.clip("evenodd");
}
for (var i=0; i<this.data_.length; i++)
{ context.beginPath();
context.moveTo(c,c);
context.fillStyle = this.colors_[i%this.colors_.length];
a = a0 + 2*Math.PI*this.data_[i]/sum *step;
context.arc ( c, c, this.radius_ *step, a0, a);
context.closePath();
context.fill();
context.stroke();
a0 = a;
}
if (this.type_=="donut")
{ context.restore();
context.beginPath();
context.strokeStyle = strokeStyle;
context.lineWidth = strokeWidth;
context.arc ( c, c, this.radius_ *step *this.donutratio_, Math.PI * (step-1.5), a0);
context.stroke();
}
context.restore();
break;
}
case "bar":
default:
{ var max=0;
for (var i=0; i<this.data_.length; i++)
{ if (max < this.data_[i]) max = this.data_[i];
}
var s = Math.min(5,2*this.radius_/this.data_.length);
var c = canvas.width/2;
var b = canvas.width - strokeWidth;
var x, x0 = c - this.data_.length*s/2
context.strokeStyle = strokeStyle;
context.lineWidth = strokeWidth;
for (var i=0; i<this.data_.length; i++)
{ context.beginPath();
context.fillStyle = this.colors_[i%this.colors_.length];
x = x0 + s;
var h = this.data_[i]/max*2*this.radius_ *step;
context.rect ( x0, b-h, s, h);
//console.log ( x0+", "+(b-this.data_[i]/max*2*this.radius_)+", "+x+", "+b);
context.closePath();
context.fill();
context.stroke();
x0 = x;
}
}
}
// Set Anchor
var a = this.getAnchor();
a[0] = c - this.offset_[0];
a[1] = c - this.offset_[1];
};
/**
* @inheritDoc
*/
ol.style.Chart.prototype.getChecksum = function()
{
var strokeChecksum = (this.stroke_!==null) ?
this.stroke_.getChecksum() : '-';
var recalculate = (this.checksums_===null) ||
(strokeChecksum != this.checksums_[1] ||
fillChecksum != this.checksums_[2] ||
this.radius_ != this.checksums_[3] ||
this.data_.join('|') != this.checksums_[4]);
if (recalculate) {
var checksum = 'c' + strokeChecksum + fillChecksum
+ ((this.radius_ !== void 0) ? this.radius_.toString() : '-')
+ this.data_.join('|');
this.checksums_ = [checksum, strokeChecksum, fillChecksum, this.radius_, this.data_.join('|')];
}
return this.checksums_[0];
};
/* Copyright (c) 2016 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc
* Fill style with named pattern
*
* @constructor
* @param {olx.style.FillPatternOption=} options
* @param {ol.style.Image|undefined} options.image an image pattern, image must be preloaded to draw on first call
* @param {number|undefined} options.opacity opacity with image pattern, default:1
* @param {olx.style.fillPattern} options.pattern pattern name (override by image option)
* @param {ol.color} options.color pattern color
* @param {ol.style.Fill} options.fill fill color (background)
* @param {number} options.offset pattern offset for hash/dot/circle/cross pattern
* @param {number} options.size line size for hash/dot/circle/cross pattern
* @param {number} options.spacing spacing for hash/dot/circle/cross pattern
* @param {number|bool} options.angle angle for hash pattern / true for 45deg dot/circle/cross
* @param {number} options.scale pattern scale
* @extends {ol.style.Fill}
* @implements {ol.structs.IHasChecksum}
* @api
*/
ol.style.FillPattern = function(options)
{ if (!options) options = {};
var pattern;
var canvas = this.canvas_ = document.createElement('canvas');
var scale = Number(options.scale)>0 ? Number(options.scale) : 1;
var ratio = scale*ol.has.DEVICE_PIXEL_RATIO || ol.has.DEVICE_PIXEL_RATIO;
var ctx = canvas.getContext('2d');
if (options.image)
{ options.image.load();
var img = options.image.getImage();
if (img.width)
{ canvas.width = Math.round(img.width *ratio);
canvas.height = Math.round(img.height *ratio);
ctx.globalAlpha = typeof(options.opacity) == 'number' ? options.opacity:1;
ctx.drawImage(img, 0,0, img.width, img.height, 0, 0, canvas.width, canvas.height);
pattern = ctx.createPattern(canvas, 'repeat');
}
else
{ var self = this;
pattern = [0,0,0,0];
img.onload = function ()
{ canvas.width = Math.round(img.width *ratio);
canvas.height = Math.round(img.height *ratio);
ctx.globalAlpha = typeof(options.opacity) == 'number' ? options.opacity:1;
ctx.drawImage(img, 0,0, img.width, img.height, 0, 0, canvas.width, canvas.height);
pattern = ctx.createPattern(canvas, 'repeat');
self.setColor(pattern);
}
}
}
else
{ var pat = this.getPattern_(options);
canvas.width = Math.round(pat.width *ratio);
canvas.height = Math.round(pat.height *ratio);
ctx.beginPath();
if (options.fill)
{ ctx.fillStyle = ol.color.asString(options.fill.getColor());
ctx.fillRect(0,0, canvas.width, canvas.height);
}
ctx.scale(ratio,ratio);
ctx.lineCap = "round";
ctx.lineWidth = pat.stroke || 1;
ctx.fillStyle = ol.color.asString(options.color||"#000");
ctx.strokeStyle = ol.color.asString(options.color||"#000");
if (pat.circles) for (var i=0; i<pat.circles.length; i++)
{ var ci = pat.circles[i];
ctx.beginPath();
ctx.arc(ci[0], ci[1], ci[2], 0,2*Math.PI);
if (pat.fill) ctx.fill();
if (pat.stroke) ctx.stroke();
}
if (!pat.repeat) pat.repeat=[[0,0]];
if (pat.char)
{ ctx.font = pat.font || (pat.width)+"px Arial";
ctx.textAlign = 'center';
ctx.textBaseline = 'middle';
if (pat.angle)
{ ctx.fillText(pat.char, pat.width/4, pat.height/4);
ctx.fillText(pat.char, 5*pat.width/4, 5*pat.height/4);
ctx.fillText(pat.char, pat.width/4, 5*pat.height/4);
ctx.fillText(pat.char, 5*pat.width/4, pat.height/4);
ctx.fillText(pat.char, 3*pat.width/4, 3*pat.height/4);
ctx.fillText(pat.char, -pat.width/4, -pat.height/4);
ctx.fillText(pat.char, 3*pat.width/4, -pat.height/4);
ctx.fillText(pat.char, -pat.width/4, 3*pat.height/4);
}
else ctx.fillText(pat.char, pat.width/2, pat.height/2);
}
if (pat.lines) for (var i=0; i<pat.lines.length; i++) for (var r=0; r<pat.repeat.length; r++)
{ var li = pat.lines[i];
ctx.beginPath();
ctx.moveTo(li[0]+pat.repeat[r][0],li[1]+pat.repeat[r][1]);
for (var k=2; k<li.length; k+=2)
{ ctx.lineTo(li[k]+pat.repeat[r][0],li[k+1]+pat.repeat[r][1]);
}
if (pat.fill) ctx.fill();
if (pat.stroke) ctx.stroke();
ctx.save()
ctx.strokeStyle = 'red';
ctx.strokeWidth = 0.1;
//ctx.strokeRect(0,0,canvas.width,canvas.height);
ctx.restore()
}
pattern = ctx.createPattern(canvas, 'repeat');
if (options.offset)
{ var offset = options.offset;
if (typeof(offset) == "number") offset = [offset,offset];
if (offset instanceof Array)
{ var dx = Math.round((offset[0]*ratio));
var dy = Math.round((offset[1]*ratio));
// New pattern
ctx.scale(1/ratio,1/ratio)
ctx.clearRect(0,0,canvas.width,canvas.height);
ctx.translate(dx,dy);
ctx.fillStyle = pattern;
ctx.fillRect(-dx, -dy, canvas.width,canvas.height);
pattern = ctx.createPattern(canvas, 'repeat');
}
}
}
ol.style.Fill.call (this, { color: pattern });
};
ol.inherits(ol.style.FillPattern, ol.style.Fill);
/**
* Clones the style.
* @return {ol.style.FillPattern}
*/
ol.style.FillPattern.prototype.clone = function()
{ var s = ol.style.Fill.prototype.clone.call(this);
s.canvas_ = this.canvas_;
return s;
};
/** Get canvas used as pattern
* @return {canvas}
*/
ol.style.FillPattern.prototype.getImage = function()
{ return this.canvas_;
}
/** Get pattern
* @param {olx.style.FillPatternOption}
*/
ol.style.FillPattern.prototype.getPattern_ = function(options)
{ var pat = ol.style.FillPattern.prototype.patterns[options.pattern]
|| ol.style.FillPattern.prototype.patterns.dot;
var d = Math.round(options.spacing)||10;
var d2 = Math.round(d/2)+0.5;
switch (options.pattern)
{ case 'dot':
case 'circle':
{ var size = options.size===0 ? 0 : options.size/2 || 2;
if (!options.angle)
{ pat.width = pat.height = d;
pat.circles = [[ d/2, d/2, size ]]
if (options.pattern=='circle')
{ pat.circles = pat.circles.concat([
[ d/2+d, d/2, size ],
[ d/2-d, d/2, size ],
[ d/2, d/2+d, size ],
[ d/2, d/2-d, size ],
[ d/2+d, d/2+d, size ],
[ d/2+d, d/2-d, size ],
[ d/2-d, d/2+d, size ],
[ d/2-d, d/2-d, size ] ])
};
}
else
{ d = pat.width = pat.height = Math.round(d*1.4);
pat.circles = [[ d/4, d/4, size ], [ 3*d/4, 3*d/4, size ]];
if (options.pattern=='circle')
{ pat.circles = pat.circles.concat([
[ d/4+d, d/4, size ],
[ d/4, d/4+d, size ],
[ 3*d/4-d, 3*d/4, size ],
[ 3*d/4, 3*d/4-d, size ],
[ d/4+d, d/4+d, size ],
[ 3*d/4-d, 3*d/4-d, size ] ]);
}
}
break;
}
case 'tile':
case 'square':
{ var size = options.size===0 ? 0 : options.size/2 || 2;
if (!options.angle)
{ pat.width = pat.height = d;
pat.lines = [[ d/2-size, d/2-size, d/2+size, d/2-size, d/2+size, d/2+size, d/2-size,d/2+size, d/2-size, d/2-size ]]
}
else
{ pat.width = pat.height = d;
//size *= Math.sqrt(2);
pat.lines = [[ d/2-size,d/2, d/2,d/2-size, d/2+size,d/2, d/2,d/2+size, d/2-size,d/2 ]]
}
if (options.pattern=='square') pat.repeat = [[0,0], [0,d], [d,0], [0,-d], [-d,0], [-d,-d], [d,d], [-d,d], [d,-d] ]
break;
}
case 'cross':
{ // Limit angle to 0 | 45
if (options.angle) options.angle = 45;
}
case 'hatch':
{ var a = Math.round(((options.angle||0)-90)%360);
if (a>180) a -= 360;
a *= Math.PI/180;
var cos = Math.cos(a);
var sin = Math.sin(a);
if (Math.abs(sin)<0.0001)
{ pat.width = pat.height = d;
pat.lines = [ [ 0,0.5, d, 0.5 ] ];
pat.repeat = [ [0,0], [0,d] ];
}
else if (Math.abs(cos)<0.0001)
{ pat.width = pat.height = d;
pat.lines = [ [ 0.5,0, 0.5, d] ];
pat.repeat = [ [0,0], [d,0] ];
if (options.pattern=='cross')
{ pat.lines.push ([ 0,0.5, d, 0.5 ]);
pat.repeat.push([0,d]);
}
}
else
{ var w = pat.width = Math.round(Math.abs(d/sin)) || 1;
var h = pat.height = Math.round(Math.abs(d/cos)) || 1;
if (options.pattern=='cross')
{ pat.lines = [ [-w,-h, 2*w,2*h], [2*w,-h, -w,2*h] ];
pat.repeat = [ [0,0] ];
}
else if (cos*sin>0)
{ pat.lines = [ [-w,-h, 2*w,2*h] ];
pat.repeat = [ [0,0], [w,0], [0,h] ];
}
else
{ pat.lines = [ [2*w,-h, -w,2*h] ];
pat.repeat = [ [0,0], [-w,0], [0,h] ];
}
}
pat.stroke = options.size===0 ? 0 : options.size||4;
}
default: break;
}
return pat
}
/** Static fuction to add char patterns
* @param {title}
* @param {olx.fillpattern.Option}
* - size {integer} default 10
* - width {integer} default 10
* - height {integer} default 10
* - circles {Array<circles>}
* - lines: {Array<pointlist>}
* - stroke {integer}
* - fill {bool}
* - char {char}
* - font {string} default "10px Arial"
*/
ol.style.FillPattern.addPattern = function (title, options)
{ if (!options) options={};
ol.style.FillPattern.prototype.patterns[title || options.char] =
{ width: options.width || options.size || 10,
height: options.height || options.size || 10,
font: options.font,
char: options.char,
circles: options.circles,
lines: options.lines,
repeat: options.repeat,
stroke: options.stroke,
angle: options.angle,
fill: options.fill
}
}
/** Patterns definitions
Examples : http://seig.ensg.ign.fr/fichchap.php?NOFICHE=FP31&NOCHEM=CHEMS009&NOLISTE=1&N=8
*/
ol.style.FillPattern.prototype.patterns =
{
"hatch":
{ width:5,
height:5,
lines:[[0,2.5,5,2.5]],
stroke:1
},
"cross":
{ width:7,
height:7,
lines:[[0,3,10,3],[3,0,3,10]],
stroke:1
},
"dot":
{ width:8,
height:8,
circles:[[5,5,2]],
stroke:false,
fill:true,
},
"circle":
{ width:10,
height:10,
circles:[[5,5,2]],
stroke:1,
fill:false,
},
"square":
{ width:10,
height:10,
lines:[[3,3, 3,8, 8,8, 8,3, 3,3]],
stroke:1,
fill:false,
},
"tile":
{ width:10,
height:10,
lines:[[3,3, 3,8, 8,8, 8,3, 3,3]],
fill:true,
},
"woven":
{ width: 12,
height: 12,
lines: [[ 3,3, 9,9 ],[0,12, 3,9], [9,3, 12,0], [-1,1,1,-1], [13,11,11,13]],
stroke: 1
},
"crosses":
{ width: 8,
height: 8,
lines: [[ 2,2, 6,6 ],[2,6,6,2]],
stroke: 1
},
"caps":
{ width: 8,
height: 8,
lines: [[ 2,6, 4,2, 6,6 ]],
stroke: 1
},
"nylon":
{ width: 20,
height: 20,
// lines: [[ 0,5, 0,0, 5,0 ],[ 5,10, 10,10, 10,5 ], [ 10,15, 10,20, 15,20 ],[ 15,10, 20,10, 20,15 ]],
// repeat: [[0,0], [20,0], [0,20], [-20,0], [0,-20], [-20,-20]],
lines: [[ 1,6, 1,1, 6,1 ],[ 6,11, 11,11, 11,6 ], [ 11,16, 11,21, 16,21 ],[ 16,11, 21,11, 21,16 ]],
repeat: [[0,0], [-20,0], [0,-20] ],
stroke: 1
},
"hexagon":
{ width: 20,
height: 12,
lines: [[ 0,10, 4,4, 10,4, 14,10, 10,16, 4,16, 0,10 ]],
stroke:1,
repeat:[[0,0],[10,6],[10,-6],[-10,-6]]
},
"cemetry":
{ width:15,
height:19,
lines:[[0,3.5,7,3.5],[3.5,0,3.5,10],
//[7,12.5,14,12.5],[10.5,9,10.5,19]
],
stroke:1,
repeat:[[0,0],[7,9]]
},
"sand":
{ width:20,
height:20,
circles:[[1,2,1],[9,3,1],[2,16,1],
[7,8,1],[6,14,1],[4,19,1],
[14,2,1],[12,10,1],[14,18,1],
[18,8,1],[18,14,1]],
fill:1
},
"conglomerate":
{ width:30,
height:20,
circles:[[2,4,1],[17,3,1],[26,18,1],[12,17,1],[5,17,2],[28,11,2]],
lines:[[7,5, 6,7, 9,9, 11,8, 11,6, 9,5, 7,5],
[16,10, 15,13, 16,14, 19,15, 21,13, 22,9, 20,8, 19,8, 16,10],
[24,6, 26,7, 27,5, 26,4, 24,4, 24,6]],
stroke:1
},
"gravel":
{ width:15,
height:10,
circles:[[4,2,1],[5,9,1],[1,7,1]],//[9,9,1],,[15,2,1]],
lines:[[7,5, 6,6, 7,7, 8,7, 9,7, 10,5, 9,4, 7,5], [11,2, 14,4, 14,1, 12,1, 11,2]],
stroke:1
},
"brick":
{ width:18,
height:16,
lines:[ [0,1,18,1],[0,10,18,10], [6,1,6,10],[12,10,12,18],[12,0,12,1]],
stroke:1
},
"dolomite":
{ width:20,
height:16,
lines:[[0,1,20,1],[0,9,20,9],[1,9,6,1],[11,9,14,16],[14,0,14.4,1]],
stroke:1
},
"coal":
{ width:20,
height:16,
lines:[[1,5, 7,1, 7,7], [11,10, 12,5, 18,9], [5,10, 2,15, 9,15,], [15,16, 15,13, 20,16], [15,0, 15,2, 20,0]],
fill:1
},
"breccia":
{ width:20,
height:16,
lines:[[1,5, 7,1, 7,7, 1,5], [11,10, 12,5, 18,9, 11,10], [5,10, 2,15, 9,15, 5,10], [15,16, 15,13, 22,18], [15,0, 15,2, 20,0] ],
stroke:1,
},
"clay":
{ width:20,
height:20,
lines:[[0,0, 3,11, 0,20], [11,0, 10,3, 13,13, 11,20], [0,0, 10,3, 20,0], [0,12, 3,11, 13,13, 20,12]],
stroke:1
},
"flooded":
{ width:15,
height:10,
lines:[ [0,1,10,1],[0,6,5,6], [10,6,15,6]],
stroke:1
},
"chaos":
{ width:40,
height:40,
lines:[[40,2, 40,0, 38,0, 40,2],
[4,0, 3,2, 2,5, 0,0, 0,3, 2,7, 5,6, 7,7, 8,10, 9,12, 9,13, 9,14, 8,14, 6,15, 2,15, 0,20, 0,22, 2,20, 5,19,
8,15, 10,14, 11,12.25, 10,12, 10,10, 12,9, 13,7, 12,6, 13,4, 16,7, 17,4, 20,0, 18,0, 15,3, 14,2, 14,0,
12,1, 11,0, 10,1, 11,4, 10,7, 9,8, 8,5, 6,4, 5,3, 5,1, 5,0, 4,0],
[7,1, 7,3, 8,3, 8,2, 7,1], [4,3, 5,5, 4,5, 4,3], [34,5, 33,7, 38,10, 38,8, 36,5, 34,5],
[ 27,0, 23,2, 21,8, 30,0, 27,0],
[25,8, 26,12, 26,16, 22.71875,15.375, 20,13, 18,15, 17,18, 13,22, 17,21, 19,22, 21,20, 19,18, 22,17, 30,25,
26,26, 24,28, 21.75,33.34375, 20,36, 18,40, 20,40, 24,37, 25,32, 27,31, 26,38, 27,37, 30,32, 32,35, 36,37,
38,40, 38,39, 40,40, 37,36, 34,32, 37,31, 36,29, 33,27, 34,24, 39,21, 40,21, 40,16, 37,20, 31,22, 32,25,
27,20, 29,15, 30,20, 32,20, 34,18, 33,12, 31,11, 29,14, 26,9, 25,8], [39,24, 37,26, 40,28, 39,24],
[13,15, 9,19, 14,18, 13,15], [18,23, 14,27, 16,27, 17,25, 20,26, 18,23],
[6,24, 2,26, 1,28, 2,30, 5,28, 12,30, 16,32, 18,30, 15,30, 12,28, 9,25, 7,27, 6,24],
[29,27, 32,28, 33,31, 30,29, 27,28, 29,27],
[5,35, 1,33, 3,36, 13,38, 15,35, 10,36, 5,35]],
fill:1,
},
"grass":
{ width:27,
height:22,
lines: [[0,10.5,13,10.5], [2.5,10,1.5,7], [4.5,10, 4.5,5, 3.5,4 ], [7,10, 7.5,6, 8.5,3], [10,10,11,6]],
repeat: [[0,0],[14,10]],
stroke:1
},
"swamp":
{ width:24,
height:23,
lines:[ [0,10.5,9.5,10.5], [2.5,10,2.5,7], [4.5,10,4.5,4], [6.5,10,6.5,6], [3,12.5,7,12.5] ],
repeat: [[0,0],[14,10]],
stroke:1
},
"wave":
{ width:10,
height:8,
lines:[ [0,0, 5,4, 10,0] ],
stroke:1
},
"vine":
{ width:13,
height:13,
lines:[[3,0,3,6],[9,7,9,13]],
stroke:1.0
},
"forest":
{ width:55,
height:30,
circles:[[7,7,3.5],[20,20,1.5],[42,22,3.5],[35,5,1.5]],
stroke:1
},
"scrub":
{ width:26,
height:20,
lines:[ [1,4, 4,8, 6,4] ],
circles:[[20,13,1.5]],
stroke:1,
},
"tree":
{ width:30,
height:30,
lines:[[7.78,10.61,4.95,10.61,4.95,7.78,3.54,7.78,2.12,6.36,0.71,6.36,0,4.24,0.71,2.12,4.24,0,7.78,0.71,9.19,3.54,7.78,4.95,7.07,7.07,4.95,7.78]],
repeat: [[3,1],[18,16]],
stroke:1
},
"pine":
{ width:30,
height:30,
lines:[[5.66,11.31,2.83,11.31,2.83,8.49,0,8.49,2.83,0,5.66,8.49,2.83,8.49]],
repeat:[[3,1],[18,16]],
stroke:1
},
"pines":
{ width:22,
height:20,
lines:[[1,4,3.5,1,6,4],[1,8,3.5,5,6,8],[3.5,1,3.5,11],[12,14.5,14.5,14,17,14.5],[12,18,17,18],[14.5,12,14.5,18]],
repeat: [[2,1]],
stroke:1
},
"rock":
{ width:20,
height:20,
lines:[ [1,0,1,9],[4,0,4,9],[7,0,7,9],
[10,1,19,1],[10,4,19,4],[10,7,19,7],
[0,11,9,11],[0,14,9,14],[0,17,9,17],
[12,10,12,19],[15,10,15,19],[18,10,18,19] ],
repeat:[[0.5,0.5]],
stroke:1
},
"rocks":
{ width:20,
height:20,
lines:[ [5,0, 3,0, 5,4, 4,6, 0,3, 0,5, 3,6, 5,9, 3.75,10, 2.5,10, 0,9, 0,10, 4,11, 5,14, 4,15, 0,13,
0,13, 0,13, 0,14, 0,14, 5,16, 5,18, 3,19, 0,19, -0.25,19.9375, 5,20, 10,19, 10,20, 11,20, 12,19,
14,20, 15,20, 17,19, 20,20, 20,19, 19,16, 20,15, 20,11, 20,10, 19,8, 20,5, 20,0, 19,0, 20,2, 19,4,
17,4, 16,3, 15,0, 14,0, 15,4, 11,5, 10,4, 11,0, 10,0, 9,4, 6,5, 5,0,],
[18,5, 19,6, 18,10, 16,10, 14,9, 16,5, 18,5],
[5,6, 9,5, 10,6, 10,9, 6,10, 5,6],
[14,5, 14,8, 13,9, 12,9, 11,7, 12,5, 14,5],
[ 5,11, 8,10, 9,11, 10,14, 6,15, 6,15, 5,11],
[13,10, 14,11, 15,14, 15,14, 15,14, 11,15, 10,11, 11,10, 13,10],
[15,12, 16,11, 19,11, 19,15, 16,14, 16,14, 15,12],
[6,16, 9,15, 10,18, 5,19, 6,16],
[10,16, 14,16, 14,18, 13,19, 11,18, 10,16],
[15,15, 18,16, 18,18, 16,19, 15,18, 15,15]],
stroke:1
}
}
/**
* /
ol.style.FillPattern.prototype.getChecksum = function()
{
var strokeChecksum = (this.stroke_!==null) ?
this.stroke_.getChecksum() : '-';
var fillChecksum = (this.fill_!==null) ?
this.fill_.getChecksum() : '-';
var recalculate = (this.checksums_===null) ||
(strokeChecksum != this.checksums_[1] ||
fillChecksum != this.checksums_[2] ||
this.radius_ != this.checksums_[3] ||
this.form_+"-"+this.glyphs_ != this.checksums_[4]);
if (recalculate) {
var checksum = 'c' + strokeChecksum + fillChecksum
+ ((this.radius_ !== void 0) ? this.radius_.toString() : '-')
+ this.form_+"-"+this.glyphs_;
this.checksums_ = [checksum, strokeChecksum, fillChecksum, this.radius_, this.form_+"-"+this.glyphs_];
}
return this.checksums_[0];
};
/**/
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @requires ol.style.Circle
* @requires ol.structs.IHasChecksum
*/
/**
* @classdesc
* A marker style to use with font symbols.
*
* @constructor
* @param {} options Options.
* @param {number} options.glyph the glyph name or a char to display as symbol.
* The name must be added using the {@link ol.style.FontSymbol.addDefs} function.
* @param {string} options.form
* none|circle|poi|bubble|marker|coma|shield|blazon|bookmark|hexagon|diamond|triangle|sign|ban|lozenge|square
* a form that will enclose the glyph, default none
* @param {number} options.radius
* @param {number} options.rotation
* @param {number} options.rotateWithView
* @param {number} options.opacity
* @param {number} options.fontSize, default 1
* @param {boolean} options.gradient true to display a gradient on the symbol
* @param {_ol_style_Fill_} options.fill
* @param {_ol_style_Stroke_} options.stroke
* @extends {ol.style.RegularShape}
* @implements {ol.structs.IHasChecksum}
* @api
*/
ol.style.FontSymbol = function(options)
{ options = options || {};
var strokeWidth = 0;
if (options.stroke) strokeWidth = options.stroke.getWidth();
ol.style.RegularShape.call (this,{ radius: options.radius, fill:options.fill,
rotation:options.rotation, rotateWithView: options.rotateWithView });
if (typeof(options.opacity)=="number") this.setOpacity(options.opacity);
this.color_ = options.color;
this.fontSize_ = options.fontSize || 1;
this.stroke_ = options.stroke;
this.fill_ = options.fill;
this.radius_ = options.radius -strokeWidth;
this.form_ = options.form || "none";
this.gradient_ = options.gradient;
this.offset_ = [options.offsetX ? options.offsetX :0, options.offsetY ? options.offsetY :0];
this.glyph_ = this.getGlyph(options.glyph) || "";
this.renderMarker_();
};
ol.inherits(ol.style.FontSymbol, ol.style.RegularShape);
/** Cool stuff to get the image symbol for a style
*/
ol.style.Image.prototype.getImagePNG = function()
{ var canvas = this.getImage();
if (canvas)
{ try { return canvas.toDataURL("image/png"); }
catch(e) { return false; }
}
else return false;
}
/**
* Font defs
*/
ol.style.FontSymbol.prototype.defs = { 'fonts':{}, 'glyphs':{} };
/** Static function : add new font defs
* @param {String|Object} font the font desciption
* @param {} glyphs a key / value list of glyph definitions.
* Each key is the name of the glyph,
* the value is an object that code the font, the caracter code,
* the name and a search string for the glyph.
*/
ol.style.FontSymbol.addDefs = function(font, glyphs)
{ var thefont = font;
if (typeof(font) == "string") thefont = {"font":font, "name":font, "copyright":"" };
if (!thefont.font || typeof(thefont.font) != "string")
{ console.log("bad font def");
return;
}
var fontname = thefont.font;
ol.style.FontSymbol.prototype.defs.fonts[fontname] = thefont;
for (var i in glyphs)
{ var g = glyphs[i];
if (typeof(g) == "string" && g.length==1) g = { char: g };
ol.style.FontSymbol.prototype.defs.glyphs[i] =
{ font: thefont.font,
char: g.char || ""+String.fromCharCode(g.code) || "",
theme: g.theme || thefont.name,
name: g.name || i,
search: g.search || ""
};
}
};
/**
* Clones the style.
* @return {ol.style.FontSymbol}
*/
ol.style.FontSymbol.prototype.clone = function()
{ var g = new ol.style.FontSymbol(
{ glyph: "",
color: this.color_,
fontSize: this.fontSize_,
stroke: this.stroke_,
fill: this.fill_,
radius: this.radius_ + (this.stroke_ ? this.stroke_.getWidth():0),
form: this.form_,
gradient: this.gradient_,
offsetX: this.offset_[0],
offsetY: this.offset_[1],
opacity: this.getOpacity(),
rotation: this.getRotation(),
rotateWithView: this.getRotateWithView()
});
g.setScale(this.getScale());
g.glyph_ = this.glyph_;
g.renderMarker_();
return g;
};
/**
* Get the fill style for the symbol.
* @return {ol.style.Fill} Fill style.
* @api
*/
ol.style.FontSymbol.prototype.getFill = function() {
return this.fill_;
};
/**
* Get the stroke style for the symbol.
* @return {_ol_style_Stroke_} Stroke style.
* @api
*/
ol.style.FontSymbol.prototype.getStroke = function() {
return this.stroke_;
};
/**
* Get the glyph definition for the symbol.
* @param {string|undefined} name a glyph name to get the definition, default return the glyph definition for the style.
* @return {_ol_style_Stroke_} Stroke style.
* @api
*/
ol.style.FontSymbol.prototype.getGlyph = function(name)
{ if (name) return ol.style.FontSymbol.prototype.defs.glyphs[name] || { "font":"none","char":name.charAt(0),"theme":"none","name":"none", "search":""};
else return this.glyph_;
};
/**
* Get the glyph name.
* @return {string} the name
* @api
*/
ol.style.FontSymbol.prototype.getGlyphName = function()
{ for (var i in ol.style.FontSymbol.prototype.defs.glyphs)
{ if (ol.style.FontSymbol.prototype.defs.glyphs[i] === this.glyph_) return i;
}
return "";
};
/**
* Get the stroke style for the symbol.
* @return {_ol_style_Stroke_} Stroke style.
* @api
*/
ol.style.FontSymbol.prototype.getFontInfo = function(glyph)
{ return ol.style.FontSymbol.prototype.defs.fonts[glyph.font];
}
/** @private
*/
ol.style.FontSymbol.prototype.renderMarker_ = function(atlasManager)
{
var strokeStyle;
var strokeWidth = 0;
if (this.stroke_)
{ strokeStyle = ol.color.asString(this.stroke_.getColor());
strokeWidth = this.stroke_.getWidth();
}
// no atlas manager is used, create a new canvas
var canvas = this.getImage();
//console.log(this.getImage().width+" / "+(2 * (this.radius_ + strokeWidth) + 1));
/** @type {ol.style.FontSymbol.RenderOptions} */
var renderOptions = {
strokeStyle: strokeStyle,
strokeWidth: strokeWidth,
size: canvas.width,
};
// draw the circle on the canvas
var context = (canvas.getContext('2d'));
context.clearRect(0, 0, canvas.width, canvas.height);
this.drawMarker_(renderOptions, context, 0, 0);
// Set Anchor
var a = this.getAnchor();
a[0] = canvas.width / 2 - this.offset_[0];
a[1] = canvas.width / 2 - this.offset_[1];
//this.createMarkerHitDetectionCanvas_(renderOptions);
};
/**
* @private
* @param {ol.style.FontSymbol.RenderOptions} renderOptions
* @param {CanvasRenderingContext2D} context
*/
ol.style.FontSymbol.prototype.drawPath_ = function(renderOptions, context)
{
var s = 2*this.radius_+renderOptions.strokeWidth+1;
var w = renderOptions.strokeWidth/2;
var c = renderOptions.size / 2;
// Transfo to place the glyph at the right place
var transfo = { fac:1, posX:renderOptions.size / 2, posY:renderOptions.size / 2 };
context.lineJoin = 'round';
context.beginPath();
// Draw the path with the form
switch (this.form_)
{ case "none": transfo.fac=1; break;
case "circle":
case "ban":
context.arc ( c, c, s/2, 0, 2 * Math.PI, true);
break;
case "poi":
context.arc ( c, c -0.4*this.radius_, 0.6*this.radius_, 0.15*Math.PI, 0.85*Math.PI, true);
context.lineTo ( c-0.89*0.05*s, (0.95+0.45*0.05)*s+w);
context.arc ( c, 0.95*s+w, 0.05*s, 0.85*Math.PI, 0.15*Math.PI, true);
transfo = { fac:0.45, posX:c, posY:c -0.35*this.radius_ };
break;
case "bubble":
context.arc ( c, c -0.2*this.radius_, 0.8*this.radius_, 0.4*Math.PI, 0.6*Math.PI, true);
context.lineTo ( 0.5*s+w, s+w);
transfo = { fac:0.7, posX:c, posY:c -0.2*this.radius_ };
break;
case "marker":
context.arc ( c, c -0.2*this.radius_, 0.8*this.radius_, 0.25*Math.PI, 0.75*Math.PI, true);
context.lineTo ( 0.5*s+w, s+w);
transfo = { fac:0.7, posX: c, posY: c -0.2*this.radius_ };
break;
case "coma":
/*
context.arc( renderOptions.size / 2, renderOptions.size / 2 +0.2*this.radius_, 0.8*this.radius_, 0.5*Math.PI, 0, true);
context.arc( renderOptions.size / 2, renderOptions.size / 2 -0.2*this.radius_, 0.8*this.radius_, 0, 0.5*Math.PI, true);
*/
context.moveTo ( c + 0.8*this.radius_, c -0.2*this.radius_);
context.quadraticCurveTo ( 0.95*s+w, 0.75*s+w, 0.5*s+w, s+w);
context.arc ( c, c -0.2*this.radius_, 0.8*this.radius_, 0.45*Math.PI, 0, false);
transfo = { fac:0.7, posX: c, posY: c -0.2*this.radius_ };
break;
default:
{ var pts;
switch (this.form_)
{ case "shield":
pts = [ 0.05,0, 0.95,0, 0.95,0.8, 0.5,1, 0.05,0.8, 0.05,0 ];
transfo.posY = 0.45*s+w ;
break;
case "blazon":
pts = [ 0.1,0, 0.9,0, 0.9,0.8, 0.6,0.8, 0.5,1, 0.4,0.8, 0.1,0.8, 0.1,0 ];
transfo.fac = 0.8;
transfo.posY = 0.4*s+w ;
break;
case "bookmark":
pts = [ 0.05,0, 0.95,0, 0.95,1, 0.5,0.8, 0.05,1, 0.05,0 ];
transfo.fac = 0.9;
transfo.posY = 0.4*s+w ;
break;
case "hexagon":
pts = [ 0.05,0.2, 0.5,0, 0.95,0.2, 0.95,0.8, 0.5,1, 0.05,0.8, 0.05,0.2 ];
transfo.fac = 0.9;
transfo.posY = 0.5*s+w ;
break;
case "diamond":
pts = [ 0.25,0, 0.75,0, 1,0.2, 1,0.4, 0.5,1, 0,0.4, 0,0.2, 0.25,0 ];
transfo.fac = 0.75 ;
transfo.posY = 0.35*s+w ;
break;
case "triangle":
pts = [ 0,0, 1,0, 0.5,1, 0,0 ];
transfo.fac = 0.6 ;
transfo.posY = 0.3*s+w ;
break;
case "sign":
pts = [ 0.5,0.05, 1,0.95, 0,0.95, 0.5,0.05 ];
transfo.fac = 0.7 ;
transfo.posY = 0.65*s+w ;
break;
case "lozenge":
pts = [ 0.5,0, 1,0.5, 0.5,1, 0,0.5, 0.5,0 ];
transfo.fac = 0.7;
break;
case "square":
default:
pts = [ 0,0, 1,0, 1,1, 0,1, 0,0 ]; break;
}
for (var i=0; i<pts.length; i+=2) context.lineTo ( pts[i]*s+w, pts[i+1]*s+w);
}
}
context.closePath();
return transfo;
}
/**
* @private
* @param {ol.style.FontSymbol.RenderOptions} renderOptions
* @param {CanvasRenderingContext2D} context
* @param {number} x The origin for the symbol (x).
* @param {number} y The origin for the symbol (y).
*/
ol.style.FontSymbol.prototype.drawMarker_ = function(renderOptions, context, x, y)
{ var fcolor = this.fill_ ? this.fill_.getColor() : "#000";
var scolor = this.stroke_ ? this.stroke_.getColor() : "#000";
if (this.form_ == "none" && this.stroke_ && this.fill_)
{ scolor = this.fill_.getColor();
fcolor = this.stroke_.getColor();
}
// reset transform
context.setTransform(1, 0, 0, 1, 0, 0);
// then move to (x, y)
context.translate(x, y);
var tr = this.drawPath_(renderOptions, context);
if (this.fill_)
{ if (this.gradient_ && this.form_!="none")
{ var grd = context.createLinearGradient(0,0,renderOptions.size/2,renderOptions.size);
grd.addColorStop (1, ol.color.asString(fcolor));
grd.addColorStop (0, ol.color.asString(scolor));
context.fillStyle = grd;
}
else context.fillStyle = ol.color.asString(fcolor);
context.fill();
}
if (this.stroke_ && renderOptions.strokeWidth) {
context.strokeStyle = renderOptions.strokeStyle;
context.lineWidth = renderOptions.strokeWidth;
context.stroke();
}
// Draw the symbol
if (this.glyph_.char)
{ context.font = (2*tr.fac*(this.radius_)*this.fontSize_)+"px "+this.glyph_.font;
context.strokeStyle = context.fillStyle;
context.lineWidth = renderOptions.strokeWidth * (this.form_ == "none" ? 2:1);
context.fillStyle = ol.color.asString(this.color_ || scolor);
context.textAlign = "center";
context.textBaseline = "middle";
var t = this.glyph_.char;
if (renderOptions.strokeWidth && scolor!="transparent") context.strokeText(t, tr.posX, tr.posY);
context.fillText(t, tr.posX, tr.posY);
}
if (this.form_=="ban" && this.stroke_ && renderOptions.strokeWidth)
{ context.strokeStyle = renderOptions.strokeStyle;
context.lineWidth = renderOptions.strokeWidth;
var r = this.radius_ + renderOptions.strokeWidth;
var d = this.radius_ * Math.cos(Math.PI/4);
context.moveTo(r + d, r - d);
context.lineTo(r - d, r + d);
context.stroke();
}
};
/**
* @inheritDoc
*/
ol.style.FontSymbol.prototype.getChecksum = function()
{
var strokeChecksum = (this.stroke_!==null) ?
this.stroke_.getChecksum() : '-';
var fillChecksum = (this.fill_!==null) ?
this.fill_.getChecksum() : '-';
var recalculate = (this.checksums_===null) ||
(strokeChecksum != this.checksums_[1] ||
fillChecksum != this.checksums_[2] ||
this.radius_ != this.checksums_[3] ||
this.form_+"-"+this.glyphs_ != this.checksums_[4]);
if (recalculate) {
var checksum = 'c' + strokeChecksum + fillChecksum
+ ((this.radius_ !== void 0) ? this.radius_.toString() : '-')
+ this.form_+"-"+this.glyphs_;
this.checksums_ = [checksum, strokeChecksum, fillChecksum, this.radius_, this.form_+"-"+this.glyphs_];
}
return this.checksums_[0];
};
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*
* Photo style for vector features
*/
/**
* @requires ol.style.RegularShape
* @requires ol.structs.IHasChecksum
*/
/**
* @classdesc
* Set Photo style for vector features.
*
* @constructor
* @param {} options
* @param { default | square | round | anchored | folio } options.kind
* @param {boolean} options.crop crop within square, default is false
* @param {Number} options.radius symbol size
* @param {boolean} options.shadow drop a shadow
* @param {ol.style.Stroke} options.stroke
* @param {String} options.src image src
* @param {String} options.crossOrigin The crossOrigin attribute for loaded images. Note that you must provide a crossOrigin value if you want to access pixel data with the Canvas renderer.
* @param {Number} options.offsetX Horizontal offset in pixels. Default is 0.
* @param {Number} options.offsetY Vertical offset in pixels. Default is 0.
* @param {function} options.onload callback when image is loaded (to redraw the layer)
* @extends {ol.style.RegularShape}
* @implements {ol.structs.IHasChecksum}
* @api
*/
ol.style.Photo = function(options)
{ options = options || {};
this.sanchor_ = options.kind=="anchored" ? 8:0;
this.shadow_ = Number(options.shadow) || 0;
if (!options.stroke)
{ options.stroke = new ol.style.Stroke({ width: 0, color: "#000"})
}
var strokeWidth = options.stroke.getWidth();
if (strokeWidth<0) strokeWidth = 0;
if (options.kind=='folio') strokeWidth += 6;
options.stroke.setWidth(strokeWidth);
ol.style.RegularShape.call (this,
{ radius: options.radius + strokeWidth + this.sanchor_/2 + this.shadow_/2,
points:0
// fill:new ol.style.Fill({color:"red"}) // No fill to create a hit detection Image
});
// Hack to get the hit detection Image (no API exported)
if (!this.hitDetectionCanvas_)
{ var img = this.getImage();
for (var i in this)
{ if (this[i] && this[i].getContext && this[i]!==img)
{ this.hitDetectionCanvas_ = this[i];
break;
}
}
}
this.stroke_ = options.stroke;
this.fill_ = options.fill;
this.crop_ = options.crop;
this.crossOrigin_ = options.crossOrigin;
this.kind_ = options.kind || "default";
this.radius_ = options.radius;
this.src_ = options.src;
this.offset_ = [options.offsetX ? options.offsetX :0, options.offsetY ? options.offsetY :0];
this.onload_ = options.onload;
if (typeof(options.opacity)=='number') this.setOpacity(options.opacity);
if (typeof(options.rotation)=='number') this.setRotation(options.rotation);
this.renderPhoto_();
};
ol.inherits(ol.style.Photo, ol.style.RegularShape);
/**
* Clones the style.
* @return {ol.style.Photo}
*/
ol.style.Photo.prototype.clone = function()
{ return new ol.style.Photo(
{ stroke: this.stroke_,
fill: this.fill_,
shadow: this.shadow_,
crop: this.crop_,
crossOrigin: this.crossOrigin_,
kind: this.kind_,
radius: this.radius_,
src: this.src_,
offsetX: this.offset_[0],
offsetY: this.offset_[1],
opacity: this.getOpacity(),
rotation: this.getRotation()
});
};
/**
* Draws a rounded rectangle using the current state of the canvas.
* Draw a rectangle if the radius is null.
* @param {Number} x The top left x coordinate
* @param {Number} y The top left y coordinate
* @param {Number} width The width of the rectangle
* @param {Number} height The height of the rectangle
* @param {Number} radius The corner radius.
*/
CanvasRenderingContext2D.prototype.roundRect = function (x, y, w, h, r)
{ if (!r) this.rect(x,y,w,h);
else
{ if (w < 2 * r) r = w / 2;
if (h < 2 * r) r = h / 2;
this.beginPath();
this.moveTo(x+r, y);
this.arcTo(x+w, y, x+w, y+h, r);
this.arcTo(x+w, y+h, x, y+h, r);
this.arcTo(x, y+h, x, y, r);
this.arcTo(x, y, x+w, y, r);
this.closePath();
}
return this;
}
/**
* Draw the form without the image
* @private
*/
ol.style.Photo.prototype.drawBack_ = function(context, color, strokeWidth)
{ var canvas = context.canvas;
context.beginPath();
context.fillStyle = color;
context.clearRect(0, 0, canvas.width, canvas.height);
switch (this.kind_)
{ case 'square':
context.rect(0,0,canvas.width-this.shadow_, canvas.height-this.shadow_);
break;
case 'circle':
context.arc(this.radius_+strokeWidth, this.radius_+strokeWidth, this.radius_+strokeWidth, 0, 2 * Math.PI, false);
break;
case 'folio':
offset = 6;
strokeWidth -= offset;
context.strokeStyle = 'rgba(0,0,0,0.5)';
var w = canvas.width-this.shadow_-2*offset;
var a = Math.atan(6/w);
context.save();
context.rotate(-a);
context.translate(-6,2);
context.beginPath();
context.rect(offset,offset,w,w);
context.stroke();
context.fill();
context.restore();
context.save();
context.translate(6,-1);
context.rotate(a);
context.beginPath();
context.rect(offset,offset,w,w);
context.stroke();
context.fill();
context.restore();
context.beginPath();
context.rect(offset,offset,w,w);
context.stroke();
break;
case 'anchored':
context.roundRect(this.sanchor_/2,0,canvas.width-this.sanchor_-this.shadow_, canvas.height-this.sanchor_-this.shadow_, strokeWidth);
context.moveTo(canvas.width/2-this.sanchor_-this.shadow_/2,canvas.height-this.sanchor_-this.shadow_);
context.lineTo(canvas.width/2+this.sanchor_-this.shadow_/2,canvas.height-this.sanchor_-this.shadow_);
context.lineTo(canvas.width/2-this.shadow_/2,canvas.height-this.shadow_);break;
default: /* roundrect */
context.roundRect(0,0,canvas.width-this.shadow_, canvas.height-this.shadow_, strokeWidth);
break;
}
context.closePath();
}
/**
* @private
*/
ol.style.Photo.prototype.renderPhoto_ = function()
{
var strokeStyle;
var strokeWidth = 0;
if (this.stroke_)
{ strokeStyle = ol.color.asString(this.stroke_.getColor());
strokeWidth = this.stroke_.getWidth();
}
var canvas = this.getImage();
// Draw hitdetection image
var context = this.hitDetectionCanvas_.getContext('2d');
this.drawBack_(context,"#000",strokeWidth);
context.fill();
// Draw the image
var context = (canvas.getContext('2d'));
this.drawBack_(context,strokeStyle,strokeWidth);
// Draw a shadow
if (this.shadow_)
{ context.shadowColor = 'rgba(0,0,0,0.5)';
context.shadowBlur = this.shadow_/2;
context.shadowOffsetX = this.shadow_/2;
context.shadowOffsetY = this.shadow_/2;
}
context.fill();
context.shadowColor = 'transparent';
var self = this;
var img = this.img_ = new Image();
if (this.crossOrigin_) img.crossOrigin = this.crossOrigin_;
img.src = this.src_;
// Draw image
if (img.width) self.drawImage_(img);
else img.onload = function()
{ self.drawImage_(img);
// Force change (?!)
// self.setScale(1);
if (self.onload_) self.onload_();
};
// Set anchor
var a = this.getAnchor();
a[0] = (canvas.width - this.shadow_)/2;
a[1] = (canvas.height - this.shadow_)/2;
if (this.sanchor_)
{ a[1] = canvas.height - this.shadow_;
}
}
/**
* Draw an timage when loaded
* @private
*/
ol.style.Photo.prototype.drawImage_ = function(img)
{ var canvas = this.getImage();
// Remove the circle on the canvas
var context = (canvas.getContext('2d'));
var strokeWidth = 0;
if (this.stroke_) strokeWidth = this.stroke_.getWidth();
var size = 2*this.radius_;
context.save();
if (this.kind_=='circle')
{ context.beginPath();
context.arc(this.radius_+strokeWidth, this.radius_+strokeWidth, this.radius_, 0, 2 * Math.PI, false);
context.clip();
}
var s, x, y, w, h, sx, sy, sw, sh;
// Crop the image to a square vignette
if (this.crop_)
{ s = Math.min (img.width/size, img.height/size);
sw = sh = s*size;
sx = (img.width-sw)/2;
sy = (img.height-sh)/2;
x = y = 0;
w = h = size+1;
}
// Fit the image to the size
else
{ s = Math.min (size/img.width, size/img.height);
sx = sy = 0;
sw = img.width;
sh = img.height;
w = s*sw;
h = s*sh;
x = (size-w)/2;
y = (size-h)/2;
}
x += strokeWidth + this.sanchor_/2;
y += strokeWidth;
context.drawImage(img, sx, sy, sw, sh, x, y, w, h);
context.restore();
// Draw a circle to avoid aliasing on clip
if (this.kind_=='circle' && strokeWidth)
{ context.beginPath();
context.strokeStyle = ol.color.asString(this.stroke_.getColor());
context.lineWidth = strokeWidth/4;
context.arc(this.radius_+strokeWidth, this.radius_+strokeWidth, this.radius_, 0, 2 * Math.PI, false);
context.stroke();
}
}
/**
* @inheritDoc
*/
ol.style.Photo.prototype.getChecksum = function()
{
var strokeChecksum = (this.stroke_!==null) ?
this.stroke_.getChecksum() : '-';
var fillChecksum = (this.fill_!==null) ?
this.fill_.getChecksum() : '-';
var recalculate = (this.checksums_===null) ||
(strokeChecksum != this.checksums_[1] ||
fillChecksum != this.checksums_[2] ||
this.radius_ != this.checksums_[3]);
if (recalculate) {
var checksum = 'c' + strokeChecksum + fillChecksum
+ ((this.radius_ !== void 0) ? this.radius_.toString() : '-');
this.checksums_ = [checksum, strokeChecksum, fillChecksum, this.radius_];
}
return this.checksums_[0];
};
/** Add a setTextPath style to draw text along linestrings
@toto letterpadding/spacing, wordpadding/spacing
*/
(function()
{
/** Internal drawing function called on postcompose
* @param {ol.eventPoscompose} e postcompose event
*/
function drawTextPath (e)
{ // Prent drawing at large resolution
if (e.frameState.viewState.resolution > this.textPathMaxResolution_) return;
var extent = e.frameState.extent;
var c2p = e.frameState.coordinateToPixelTransform;
// Get pixel path with coordinates
function getPath(c, readable)
{ var path1 = [];
for (var k=0; k<c.length; k++)
{ path1.push(c2p[0]*c[k][0]+c2p[1]*c[k][1]+c2p[4]);
path1.push(c2p[2]*c[k][0]+c2p[3]*c[k][1]+c2p[5]);
}
// Revert line ?
if (readable && path1[0]>path1[path1.length-2])
{ var path2 = [];
for (var k=path1.length-2; k>=0; k-=2)
{ path2.push(path1[k]);
path2.push(path1[k+1]);
}
return path2;
}
else return path1;
}
var ctx = e.context;
ctx.save();
ctx.scale(e.frameState.pixelRatio,e.frameState.pixelRatio);
var features = this.getSource().getFeaturesInExtent(extent);
for (var i=0, f; f=features[i]; i++)
{ { var style = this.textPathStyle_(f,e.frameState.viewState.resolution);
for (var s,j=0; s=style[j]; j++)
{
var g = s.getGeometry() || f.getGeometry();
var c;
switch (g.getType())
{ case "LineString": c = g.getCoordinates(); break;
case "MultiLineString": c = g.getLineString(0).getCoordinates(); break;
default: continue;
}
var st = s.getText();
var path = getPath(c, st.getRotateWithView() );
ctx.font = st.getFont();
ctx.textBaseline = st.getTextBaseline();
ctx.textAlign = st.getTextAlign();
ctx.lineWidth = st.getStroke() ? (st.getStroke().getWidth()||0) : 0;
ctx.strokeStyle = st.getStroke() ? (st.getStroke().getColor()||"#fff") : "#fff";
ctx.fillStyle = st.getFill() ? st.getFill().getColor()||"#000" : "#000";
// New params
ctx.textJustify = st.getTextAlign()=="justify";
ctx.textOverflow = st.getTextOverflow ? st.getTextOverflow():"";
ctx.minWidth = st.getMinWidth ? st.getMinWidth():0;
// Draw textpath
ctx.textPath(st.getText()||f.get("name"), path);
}
}
}
ctx.restore();
}
/** Set the style for features.
* This can be a single style object, an array of styles, or a function that takes a feature and resolution and
* returns an array of styles. If it is undefined the default style is used.
* If it is null the layer has no style (a null style).
* See ol.style for information on the default style.
* @param {ol.style.Style|Array.<ol.style.Style>|ol.StyleFunction} style
* @param {Number} maxResolution to display text, default: 0
*/
ol.layer.Vector.prototype.setTextPathStyle = function(style, maxResolution)
{
// Remove existing style
if (style===null)
{ if (this.textPath_) this.unByKey(this.textPath_);
this.textPath_ = null;
this.changed();
return;
}
// New postcompose
if (!this.textPath_)
{ this.textPath_ = this.on('postcompose', drawTextPath.bind(this));
}
// Set textPathStyle
if (style===undefined)
{ style = [ new ol.style.Style({ text: new ol.style.Text()}) ];
}
if (typeof(style) == "function") this.textPathStyle_ = style;
else this.textPathStyle_ = function() { return style; };
this.textPathMaxResolution_ = Number(maxResolution) || Number.MAX_VALUE;
// Force redraw
this.changed();
}
/** Add new properties to ol.style.Text
* to use with ol.layer.Vector.prototype.setTextPathStyle
* @constructor
* @param {} options
* @param {visible|ellipsis|string} textOverflow
* @param {number} minWidth minimum width (px) to draw text, default 0
*/
ol.style.TextPath = function(options)
{ if (!options) options={};
ol.style.Text.call (this, options);
this.textOverflow_ = typeof(options.textOverflow)!="undefined" ? options.textOverflow : "visible";
this.minWidth_ = options.minWidth || 0;
}
ol.inherits(ol.style.TextPath, ol.style.Text);
ol.style.TextPath.prototype.getTextOverflow = function()
{ return this.textOverflow_;
};
ol.style.TextPath.prototype.getMinWidth = function()
{ return this.minWidth_;
};
/**/
})();
/** CanvasRenderingContext2D: draw text along path
* @param {string} text
* @param {Array<Number>} path
*/
CanvasRenderingContext2D.prototype.textPath = function (text, path)
{
var ctx = this;
function dist2D(x1,y1,x2,y2)
{ var dx = x2-x1;
var dy = y2-y1;
return Math.sqrt(dx*dx+dy*dy);
}
var di, dpos=0;
var pos=2;
function getPoint(path, dl)
{ if (!di || dpos+di<dl)
{ for (; pos<path.length; )
{ di = dist2D(path[pos-2],path[pos-1],path[pos],path[pos+1]);
if (dpos+di>dl) break;
pos += 2;
if (pos>=path.length) break;
dpos += di;
}
}
var x, y, a, dt = dl-dpos;
if (pos>=path.length)
{ pos = path.length-2;
}
if (!dt)
{ x = path[pos-2];
y = path[pos-1];
a = Math.atan2(path[pos+1]-path[pos-1], path[pos]-path[pos-2]);
}
else
{ x = path[pos-2]+ (path[pos]-path[pos-2])*dt/di;
y = path[pos-1]+(path[pos+1]-path[pos-1])*dt/di;
a = Math.atan2(path[pos+1]-path[pos-1], path[pos]-path[pos-2]);
}
return [x,y,a];
}
var letterPadding = ctx.measureText(" ").width *0.25;
var start = 0;
var d = 0;
for (var i=2; i<path.length; i+=2)
{ d += dist2D(path[i-2],path[i-1],path[i],path[i+1])
}
if (d < ctx.minWidth) return;
var nbspace = text.split(" ").length -1;
// Remove char for overflow
if (ctx.textOverflow != "visible")
{ if (d < ctx.measureText(text).width + (text.length-1 + nbspace) * letterPadding)
{ var overflow = (ctx.textOverflow=="ellipsis") ? '\u2026' : ctx.textOverflow;
do
{ nbspace = text.split(" ").length -1;
text = text.slice(0,text.length-1);
} while (text && d < ctx.measureText(text+overflow).width + (text.length + overflow.length-1 + nbspace) * letterPadding)
text += overflow;
}
}
switch (ctx.textJustify || ctx.textAlign)
{ case true: // justify
case "center":
case "end":
case "right":
{ // Text align
if (ctx.textJustify)
{ start = 0;
letterPadding = (d - ctx.measureText(text).width) / (text.length-1 + nbspace);
}
else
{ start = d - ctx.measureText(text).width - (text.length + nbspace) * letterPadding;
if (ctx.textAlign == "center") start /= 2;
}
break;
}
default: break;
}
for (var t=0; t<text.length; t++)
{ var letter = text[t];
var wl = ctx.measureText(letter).width;
var p = getPoint(path, start+wl/2);
ctx.save();
ctx.textAlign = "center";
ctx.translate(p[0], p[1]);
ctx.rotate(p[2]);
if (ctx.lineWidth) ctx.strokeText(letter,0,0);
ctx.fillText(letter,0,0);
ctx.restore();
start += wl+letterPadding*(letter==" "?2:1);
}
};
//NB: (Not confirmed)To use this module, you just have to :
// import('ol-ext/layer/getpreview')
/* Copyright (c) 2015 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*
* Shadow image style for point vector features
*/
/**
* @requires ol.style.Circle
* @requires ol.structs.IHasChecksum
*/
/**
* @classdesc
* Set Shadow style for point vector features.
*
* @constructor
* @param {} options Options.
* @param {ol.style.Fill | undefined} options.fill fill style, default rgba(0,0,0,0.5)
* @param {number} options.radius point radius
* @param {number} options.blur lur radius, default radius/3
* @param {number} options.offsetX x offset, default 0
* @param {number} options.offsetY y offset, default 0
* @extends {ol.style.RegularShape}
* @implements {ol.structs.IHasChecksum}
* @api
*/
ol.style.Shadow = function(options)
{ options = options || {};
if (!options.fill) options.fill = new ol.style.Fill({ color: "rgba(0,0,0,0.5)" });
ol.style.RegularShape.call (this,{ radius: options.radius, fill: options.fill });
this.fill_ = options.fill;
this.radius_ = options.radius;
this.blur_ = options.blur===0 ? 0 : options.blur || options.radius/3;
this.offset_ = [options.offsetX ? options.offsetX : 0, options.offsetY ? options.offsetY : 0];
this.renderShadow_();
};
ol.inherits(ol.style.Shadow, ol.style.RegularShape);
/**
* Clones the style.
* @return {ol.style.Shadow}
*/
ol.style.Shadow.prototype.clone = function()
{ var s = new ol.style.Shadow(
{ fill: this.fill_,
radius: this.radius_,
blur: this.blur_,
offsetX: this.offset_[0],
offsetY: this.offset_[1]
});
s.setScale(this.getScale());
s.setOpacity(this.getOpacity());
return s;
};
/**
* @private
*/
ol.style.Shadow.prototype.renderShadow_ = function()
{
var radius = this.radius_;
var canvas = this.getImage();
var s = [canvas.width, canvas.height];
s[1] = radius;
// Remove the circle on the canvas
var context = (canvas.getContext('2d'));
context.beginPath();
context.clearRect(0, 0, canvas.width, canvas.height);
context.scale(1,0.5);
context.arc(radius, -radius, radius-this.blur_, 0, 2 * Math.PI, false);
context.fillStyle = '#000';
context.shadowColor = this.fill_.getColor();
context.shadowBlur = 0.7*this.blur_;
context.shadowOffsetX = 0;
context.shadowOffsetY = radius;
context.closePath();
context.fill();
context.shadowColor = 'transparent';
// Set anchor
var a = this.getAnchor();
a[0] = canvas.width /2 -this.offset_[0];
a[1] = canvas.height/5 -this.offset_[1];
}
/**
* @inheritDoc
*/
ol.style.Shadow.prototype.getChecksum = function()
{
var strokeChecksum = (this.stroke_!==null) ?
this.stroke_.getChecksum() : '-';
var fillChecksum = (this.fill_!==null) ?
this.fill_.getChecksum() : '-';
var recalculate = (this.checksums_===null) ||
(strokeChecksum != this.checksums_[1] ||
fillChecksum != this.checksums_[2] ||
this.radius_ != this.checksums_[3] ||
this.form_+"-"+this.glyphs_ != this.checksums_[4]);
if (recalculate) {
var checksum = 'c' + strokeChecksum + fillChecksum
+ ((this.radius_ !== void 0) ? this.radius_.toString() : '-')
+ this.form_+"-"+this.glyphs_;
this.checksums_ = [checksum, strokeChecksum, fillChecksum, this.radius_, this.form_+"-"+this.glyphs_];
}
return this.checksums_[0];
};
/* Copyright (c) 2018 Jean-Marc VIGLINO,
released under the CeCILL-B license (French BSD license)
(http://www.cecill.info/licences/Licence_CeCILL-B_V1-en.txt).
*/
/**
* @classdesc
* Stroke style with named pattern
*
* @constructor
* @param {any} options
* @param {ol.style.Image|undefined} options.image an image pattern, image must be preloaded to draw on first call
* @param {number|undefined} options.opacity opacity with image pattern, default:1
* @param {olx.style.fillPattern} options.pattern pattern name (override by image option)
* @param {ol.colorLike} options.color pattern color
* @param {ol.style.Fill} options.fill fill color (background)
* @param {number} options.offset pattern offset for hash/dot/circle/cross pattern
* @param {number} options.size line size for hash/dot/circle/cross pattern
* @param {number} options.spacing spacing for hash/dot/circle/cross pattern
* @param {number|bool} options.angle angle for hash pattern / true for 45deg dot/circle/cross
* @param {number} options.scale pattern scale
* @extends {ol.style.Fill}
* @implements {ol.structs.IHasChecksum}
* @api
*/
ol.style.StrokePattern = function(options)
{ if (!options) options = {};
var pattern;
var canvas = this.canvas_ = document.createElement('canvas');
var scale = Number(options.scale)>0 ? Number(options.scale) : 1;
var ratio = scale*ol.has.DEVICE_PIXEL_RATIO || ol.has.DEVICE_PIXEL_RATIO;
var ctx = canvas.getContext('2d');
if (options.image)
{ options.image.load();
var img = options.image.getImage();
if (img.width)
{ canvas.width = Math.round(img.width *ratio);
canvas.height = Math.round(img.height *ratio);
ctx.globalAlpha = typeof(options.opacity) == 'number' ? options.opacity:1;
ctx.drawImage(img, 0,0, img.width, img.height, 0, 0, canvas.width, canvas.height);
pattern = ctx.createPattern(canvas, 'repeat');
}
else
{ var self = this;
pattern = [0,0,0,0];
img.onload = function ()
{ canvas.width = Math.round(img.width *ratio);
canvas.height = Math.round(img.height *ratio);
ctx.globalAlpha = typeof(options.opacity) == 'number' ? options.opacity:1;
ctx.drawImage(img, 0,0, img.width, img.height, 0, 0, canvas.width, canvas.height);
pattern = ctx.createPattern(canvas, 'repeat');
self.setColor(pattern);
}
}
}
else
{ var pat = this.getPattern_(options);
canvas.width = Math.round(pat.width *ratio);
canvas.height = Math.round(pat.height *ratio);
ctx.beginPath();
if (options.fill)
{ ctx.fillStyle = ol.color.asString(options.fill.getColor());
ctx.fillRect(0,0, canvas.width, canvas.height);
}
ctx.scale(ratio,ratio);
ctx.lineCap = "round";
ctx.lineWidth = pat.stroke || 1;
ctx.fillStyle = ol.color.asString(options.color||"#000");
ctx.strokeStyle = ol.color.asString(options.color||"#000");
if (pat.circles) for (var i=0; i<pat.circles.length; i++)
{ var ci = pat.circles[i];
ctx.beginPath();
ctx.arc(ci[0], ci[1], ci[2], 0,2*Math.PI);
if (pat.fill) ctx.fill();
if (pat.stroke) ctx.stroke();
}
if (!pat.repeat) pat.repeat=[[0,0]];
if (pat.char)
{ ctx.font = pat.font || (pat.width)+"px Arial";
ctx.textAlign = 'center';
ctx.textBaseline = 'middle';
if (pat.angle)
{ ctx.fillText(pat.char, pat.width/4, pat.height/4);
ctx.fillText(pat.char, 5*pat.width/4, 5*pat.height/4);
ctx.fillText(pat.char, pat.width/4, 5*pat.height/4);
ctx.fillText(pat.char, 5*pat.width/4, pat.height/4);
ctx.fillText(pat.char, 3*pat.width/4, 3*pat.height/4);
ctx.fillText(pat.char, -pat.width/4, -pat.height/4);
ctx.fillText(pat.char, 3*pat.width/4, -pat.height/4);
ctx.fillText(pat.char, -pat.width/4, 3*pat.height/4);
}
else ctx.fillText(pat.char, pat.width/2, pat.height/2);
}
if (pat.lines) for (var i=0; i<pat.lines.length; i++) for (var r=0; r<pat.repeat.length; r++)
{ var li = pat.lines[i];
ctx.beginPath();
ctx.moveTo(li[0]+pat.repeat[r][0],li[1]+pat.repeat[r][1]);
for (var k=2; k<li.length; k+=2)
{ ctx.lineTo(li[k]+pat.repeat[r][0],li[k+1]+pat.repeat[r][1]);
}
if (pat.fill) ctx.fill();
if (pat.stroke) ctx.stroke();
ctx.save()
ctx.strokeStyle = 'red';
ctx.strokeWidth = 0.1;
//ctx.strokeRect(0,0,canvas.width,canvas.height);
ctx.restore()
}
pattern = ctx.createPattern(canvas, 'repeat');
if (options.offset)
{ var offset = options.offset;
if (typeof(offset) == "number") offset = [offset,offset];
if (offset instanceof Array)
{ var dx = Math.round((offset[0]*ratio));
var dy = Math.round((offset[1]*ratio));
// New pattern
ctx.scale(1/ratio,1/ratio)
ctx.clearRect(0,0,canvas.width,canvas.height);
ctx.translate(dx,dy);
ctx.fillStyle = pattern;
ctx.fillRect(-dx, -dy, canvas.width,canvas.height);
pattern = ctx.createPattern(canvas, 'repeat');
}
}
}
options.color = pattern;
ol.style.Stroke.call (this, options);
};
ol.inherits(ol.style.StrokePattern, ol.style.Stroke);
/**
* Clones the style.
* @return {ol.style.StrokePattern}
*/
ol.style.StrokePattern.prototype.clone = function()
{ var s = ol.style.Fill.prototype.clone.call(this);
s.canvas_ = this.canvas_;
return s;
};
/** Get canvas used as pattern
* @return {canvas}
*/
ol.style.StrokePattern.prototype.getImage = function()
{ return this.canvas_;
}
/** Get pattern
* @param {olx.style.FillPatternOption}
*/
ol.style.StrokePattern.prototype.getPattern_ = function(options)
{ var pat = ol.style.FillPattern.prototype.patterns[options.pattern]
|| ol.style.FillPattern.prototype.patterns.dot;
var d = Math.round(options.spacing)||10;
var d2 = Math.round(d/2)+0.5;
switch (options.pattern)
{ case 'dot':
case 'circle':
{ var size = options.size===0 ? 0 : options.size/2 || 2;
if (!options.angle)
{ pat.width = pat.height = d;
pat.circles = [[ d/2, d/2, size ]]
if (options.pattern=='circle')
{ pat.circles = pat.circles.concat([
[ d/2+d, d/2, size ],
[ d/2-d, d/2, size ],
[ d/2, d/2+d, size ],
[ d/2, d/2-d, size ],
[ d/2+d, d/2+d, size ],
[ d/2+d, d/2-d, size ],
[ d/2-d, d/2+d, size ],
[ d/2-d, d/2-d, size ] ])
};
}
else
{ d = pat.width = pat.height = Math.round(d*1.4);
pat.circles = [[ d/4, d/4, size ], [ 3*d/4, 3*d/4, size ]];
if (options.pattern=='circle')
{ pat.circles = pat.circles.concat([
[ d/4+d, d/4, size ],
[ d/4, d/4+d, size ],
[ 3*d/4-d, 3*d/4, size ],
[ 3*d/4, 3*d/4-d, size ],
[ d/4+d, d/4+d, size ],
[ 3*d/4-d, 3*d/4-d, size ] ]);
}
}
break;
}
case 'tile':
case 'square':
{ var size = options.size===0 ? 0 : options.size/2 || 2;
if (!options.angle)
{ pat.width = pat.height = d;
pat.lines = [[ d/2-size, d/2-size, d/2+size, d/2-size, d/2+size, d/2+size, d/2-size,d/2+size, d/2-size, d/2-size ]]
}
else
{ pat.width = pat.height = d;
//size *= Math.sqrt(2);
pat.lines = [[ d/2-size,d/2, d/2,d/2-size, d/2+size,d/2, d/2,d/2+size, d/2-size,d/2 ]]
}
if (options.pattern=='square') pat.repeat = [[0,0], [0,d], [d,0], [0,-d], [-d,0], [-d,-d], [d,d], [-d,d], [d,-d] ]
break;
}
case 'cross':
{ // Limit angle to 0 | 45
if (options.angle) options.angle = 45;
}
case 'hatch':
{ var a = Math.round(((options.angle||0)-90)%360);
if (a>180) a -= 360;
a *= Math.PI/180;
var cos = Math.cos(a);
var sin = Math.sin(a);
if (Math.abs(sin)<0.0001)
{ pat.width = pat.height = d;
pat.lines = [ [ 0,0.5, d, 0.5 ] ];
pat.repeat = [ [0,0], [0,d] ];
}
else if (Math.abs(cos)<0.0001)
{ pat.width = pat.height = d;
pat.lines = [ [ 0.5,0, 0.5, d] ];
pat.repeat = [ [0,0], [d,0] ];
if (options.pattern=='cross')
{ pat.lines.push ([ 0,0.5, d, 0.5 ]);
pat.repeat.push([0,d]);
}
}
else
{ var w = pat.width = Math.round(Math.abs(d/sin)) || 1;
var h = pat.height = Math.round(Math.abs(d/cos)) || 1;
if (options.pattern=='cross')
{ pat.lines = [ [-w,-h, 2*w,2*h], [2*w,-h, -w,2*h] ];
pat.repeat = [ [0,0] ];
}
else if (cos*sin>0)
{ pat.lines = [ [-w,-h, 2*w,2*h] ];
pat.repeat = [ [0,0], [w,0], [0,h] ];
}
else
{ pat.lines = [ [2*w,-h, -w,2*h] ];
pat.repeat = [ [0,0], [-w,0], [0,h] ];
}
}
pat.stroke = options.size===0 ? 0 : options.size||4;
}
default: break;
}
return pat
}